Merge pull request #416 from gwasser/update_jquery

Update Static Copies of JS/CSS
This commit is contained in:
Ross Poulton 2016-08-08 11:30:17 +10:00 committed by GitHub
commit 574009e375
109 changed files with 18277 additions and 1528 deletions

View File

@ -34,6 +34,9 @@ HELPDESK_KB_ENABLED = getattr(settings, 'HELPDESK_KB_ENABLED', True)
# show extended navigation by default, to all users, irrespective of staff status? # show extended navigation by default, to all users, irrespective of staff status?
HELPDESK_NAVIGATION_ENABLED = getattr(settings, 'HELPDESK_NAVIGATION_ENABLED', False) HELPDESK_NAVIGATION_ENABLED = getattr(settings, 'HELPDESK_NAVIGATION_ENABLED', False)
# use public CDNs to serve jquery and other javascript by default? otherwise, use built-in static copy
HELPDESK_USE_CDN = getattr(settings, 'HELPDESK_USE_CDN', False)
# show dropdown list of languages that ticket comments can be translated into? # show dropdown list of languages that ticket comments can be translated into?
HELPDESK_TRANSLATE_TICKET_COMMENTS = getattr(settings, 'HELPDESK_TRANSLATE_TICKET_COMMENTS', False) HELPDESK_TRANSLATE_TICKET_COMMENTS = getattr(settings, 'HELPDESK_TRANSLATE_TICKET_COMMENTS', False)

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,288 @@
<?xml version="1.0" standalone="no"?>
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
<svg xmlns="http://www.w3.org/2000/svg">
<metadata></metadata>
<defs>
<font id="glyphicons_halflingsregular" horiz-adv-x="1200" >
<font-face units-per-em="1200" ascent="960" descent="-240" />
<missing-glyph horiz-adv-x="500" />
<glyph horiz-adv-x="0" />
<glyph horiz-adv-x="400" />
<glyph unicode=" " />
<glyph unicode="*" d="M600 1100q15 0 34 -1.5t30 -3.5l11 -1q10 -2 17.5 -10.5t7.5 -18.5v-224l158 158q7 7 18 8t19 -6l106 -106q7 -8 6 -19t-8 -18l-158 -158h224q10 0 18.5 -7.5t10.5 -17.5q6 -41 6 -75q0 -15 -1.5 -34t-3.5 -30l-1 -11q-2 -10 -10.5 -17.5t-18.5 -7.5h-224l158 -158 q7 -7 8 -18t-6 -19l-106 -106q-8 -7 -19 -6t-18 8l-158 158v-224q0 -10 -7.5 -18.5t-17.5 -10.5q-41 -6 -75 -6q-15 0 -34 1.5t-30 3.5l-11 1q-10 2 -17.5 10.5t-7.5 18.5v224l-158 -158q-7 -7 -18 -8t-19 6l-106 106q-7 8 -6 19t8 18l158 158h-224q-10 0 -18.5 7.5 t-10.5 17.5q-6 41 -6 75q0 15 1.5 34t3.5 30l1 11q2 10 10.5 17.5t18.5 7.5h224l-158 158q-7 7 -8 18t6 19l106 106q8 7 19 6t18 -8l158 -158v224q0 10 7.5 18.5t17.5 10.5q41 6 75 6z" />
<glyph unicode="+" d="M450 1100h200q21 0 35.5 -14.5t14.5 -35.5v-350h350q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-350v-350q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v350h-350q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5 h350v350q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xa0;" />
<glyph unicode="&#xa5;" d="M825 1100h250q10 0 12.5 -5t-5.5 -13l-364 -364q-6 -6 -11 -18h268q10 0 13 -6t-3 -14l-120 -160q-6 -8 -18 -14t-22 -6h-125v-100h275q10 0 13 -6t-3 -14l-120 -160q-6 -8 -18 -14t-22 -6h-125v-174q0 -11 -7.5 -18.5t-18.5 -7.5h-148q-11 0 -18.5 7.5t-7.5 18.5v174 h-275q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h125v100h-275q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h118q-5 12 -11 18l-364 364q-8 8 -5.5 13t12.5 5h250q25 0 43 -18l164 -164q8 -8 18 -8t18 8l164 164q18 18 43 18z" />
<glyph unicode="&#x2000;" horiz-adv-x="650" />
<glyph unicode="&#x2001;" horiz-adv-x="1300" />
<glyph unicode="&#x2002;" horiz-adv-x="650" />
<glyph unicode="&#x2003;" horiz-adv-x="1300" />
<glyph unicode="&#x2004;" horiz-adv-x="433" />
<glyph unicode="&#x2005;" horiz-adv-x="325" />
<glyph unicode="&#x2006;" horiz-adv-x="216" />
<glyph unicode="&#x2007;" horiz-adv-x="216" />
<glyph unicode="&#x2008;" horiz-adv-x="162" />
<glyph unicode="&#x2009;" horiz-adv-x="260" />
<glyph unicode="&#x200a;" horiz-adv-x="72" />
<glyph unicode="&#x202f;" horiz-adv-x="260" />
<glyph unicode="&#x205f;" horiz-adv-x="325" />
<glyph unicode="&#x20ac;" d="M744 1198q242 0 354 -189q60 -104 66 -209h-181q0 45 -17.5 82.5t-43.5 61.5t-58 40.5t-60.5 24t-51.5 7.5q-19 0 -40.5 -5.5t-49.5 -20.5t-53 -38t-49 -62.5t-39 -89.5h379l-100 -100h-300q-6 -50 -6 -100h406l-100 -100h-300q9 -74 33 -132t52.5 -91t61.5 -54.5t59 -29 t47 -7.5q22 0 50.5 7.5t60.5 24.5t58 41t43.5 61t17.5 80h174q-30 -171 -128 -278q-107 -117 -274 -117q-206 0 -324 158q-36 48 -69 133t-45 204h-217l100 100h112q1 47 6 100h-218l100 100h134q20 87 51 153.5t62 103.5q117 141 297 141z" />
<glyph unicode="&#x20bd;" d="M428 1200h350q67 0 120 -13t86 -31t57 -49.5t35 -56.5t17 -64.5t6.5 -60.5t0.5 -57v-16.5v-16.5q0 -36 -0.5 -57t-6.5 -61t-17 -65t-35 -57t-57 -50.5t-86 -31.5t-120 -13h-178l-2 -100h288q10 0 13 -6t-3 -14l-120 -160q-6 -8 -18 -14t-22 -6h-138v-175q0 -11 -5.5 -18 t-15.5 -7h-149q-10 0 -17.5 7.5t-7.5 17.5v175h-267q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h117v100h-267q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h117v475q0 10 7.5 17.5t17.5 7.5zM600 1000v-300h203q64 0 86.5 33t22.5 119q0 84 -22.5 116t-86.5 32h-203z" />
<glyph unicode="&#x2212;" d="M250 700h800q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#x231b;" d="M1000 1200v-150q0 -21 -14.5 -35.5t-35.5 -14.5h-50v-100q0 -91 -49.5 -165.5t-130.5 -109.5q81 -35 130.5 -109.5t49.5 -165.5v-150h50q21 0 35.5 -14.5t14.5 -35.5v-150h-800v150q0 21 14.5 35.5t35.5 14.5h50v150q0 91 49.5 165.5t130.5 109.5q-81 35 -130.5 109.5 t-49.5 165.5v100h-50q-21 0 -35.5 14.5t-14.5 35.5v150h800zM400 1000v-100q0 -60 32.5 -109.5t87.5 -73.5q28 -12 44 -37t16 -55t-16 -55t-44 -37q-55 -24 -87.5 -73.5t-32.5 -109.5v-150h400v150q0 60 -32.5 109.5t-87.5 73.5q-28 12 -44 37t-16 55t16 55t44 37 q55 24 87.5 73.5t32.5 109.5v100h-400z" />
<glyph unicode="&#x25fc;" horiz-adv-x="500" d="M0 0z" />
<glyph unicode="&#x2601;" d="M503 1089q110 0 200.5 -59.5t134.5 -156.5q44 14 90 14q120 0 205 -86.5t85 -206.5q0 -121 -85 -207.5t-205 -86.5h-750q-79 0 -135.5 57t-56.5 137q0 69 42.5 122.5t108.5 67.5q-2 12 -2 37q0 153 108 260.5t260 107.5z" />
<glyph unicode="&#x26fa;" d="M774 1193.5q16 -9.5 20.5 -27t-5.5 -33.5l-136 -187l467 -746h30q20 0 35 -18.5t15 -39.5v-42h-1200v42q0 21 15 39.5t35 18.5h30l468 746l-135 183q-10 16 -5.5 34t20.5 28t34 5.5t28 -20.5l111 -148l112 150q9 16 27 20.5t34 -5zM600 200h377l-182 112l-195 534v-646z " />
<glyph unicode="&#x2709;" d="M25 1100h1150q10 0 12.5 -5t-5.5 -13l-564 -567q-8 -8 -18 -8t-18 8l-564 567q-8 8 -5.5 13t12.5 5zM18 882l264 -264q8 -8 8 -18t-8 -18l-264 -264q-8 -8 -13 -5.5t-5 12.5v550q0 10 5 12.5t13 -5.5zM918 618l264 264q8 8 13 5.5t5 -12.5v-550q0 -10 -5 -12.5t-13 5.5 l-264 264q-8 8 -8 18t8 18zM818 482l364 -364q8 -8 5.5 -13t-12.5 -5h-1150q-10 0 -12.5 5t5.5 13l364 364q8 8 18 8t18 -8l164 -164q8 -8 18 -8t18 8l164 164q8 8 18 8t18 -8z" />
<glyph unicode="&#x270f;" d="M1011 1210q19 0 33 -13l153 -153q13 -14 13 -33t-13 -33l-99 -92l-214 214l95 96q13 14 32 14zM1013 800l-615 -614l-214 214l614 614zM317 96l-333 -112l110 335z" />
<glyph unicode="&#xe001;" d="M700 650v-550h250q21 0 35.5 -14.5t14.5 -35.5v-50h-800v50q0 21 14.5 35.5t35.5 14.5h250v550l-500 550h1200z" />
<glyph unicode="&#xe002;" d="M368 1017l645 163q39 15 63 0t24 -49v-831q0 -55 -41.5 -95.5t-111.5 -63.5q-79 -25 -147 -4.5t-86 75t25.5 111.5t122.5 82q72 24 138 8v521l-600 -155v-606q0 -42 -44 -90t-109 -69q-79 -26 -147 -5.5t-86 75.5t25.5 111.5t122.5 82.5q72 24 138 7v639q0 38 14.5 59 t53.5 34z" />
<glyph unicode="&#xe003;" d="M500 1191q100 0 191 -39t156.5 -104.5t104.5 -156.5t39 -191l-1 -2l1 -5q0 -141 -78 -262l275 -274q23 -26 22.5 -44.5t-22.5 -42.5l-59 -58q-26 -20 -46.5 -20t-39.5 20l-275 274q-119 -77 -261 -77l-5 1l-2 -1q-100 0 -191 39t-156.5 104.5t-104.5 156.5t-39 191 t39 191t104.5 156.5t156.5 104.5t191 39zM500 1022q-88 0 -162 -43t-117 -117t-43 -162t43 -162t117 -117t162 -43t162 43t117 117t43 162t-43 162t-117 117t-162 43z" />
<glyph unicode="&#xe005;" d="M649 949q48 68 109.5 104t121.5 38.5t118.5 -20t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-150 152.5t-126.5 127.5t-93.5 124.5t-33.5 117.5q0 64 28 123t73 100.5t104 64t119 20 t120.5 -38.5t104.5 -104z" />
<glyph unicode="&#xe006;" d="M407 800l131 353q7 19 17.5 19t17.5 -19l129 -353h421q21 0 24 -8.5t-14 -20.5l-342 -249l130 -401q7 -20 -0.5 -25.5t-24.5 6.5l-343 246l-342 -247q-17 -12 -24.5 -6.5t-0.5 25.5l130 400l-347 251q-17 12 -14 20.5t23 8.5h429z" />
<glyph unicode="&#xe007;" d="M407 800l131 353q7 19 17.5 19t17.5 -19l129 -353h421q21 0 24 -8.5t-14 -20.5l-342 -249l130 -401q7 -20 -0.5 -25.5t-24.5 6.5l-343 246l-342 -247q-17 -12 -24.5 -6.5t-0.5 25.5l130 400l-347 251q-17 12 -14 20.5t23 8.5h429zM477 700h-240l197 -142l-74 -226 l193 139l195 -140l-74 229l192 140h-234l-78 211z" />
<glyph unicode="&#xe008;" d="M600 1200q124 0 212 -88t88 -212v-250q0 -46 -31 -98t-69 -52v-75q0 -10 6 -21.5t15 -17.5l358 -230q9 -5 15 -16.5t6 -21.5v-93q0 -10 -7.5 -17.5t-17.5 -7.5h-1150q-10 0 -17.5 7.5t-7.5 17.5v93q0 10 6 21.5t15 16.5l358 230q9 6 15 17.5t6 21.5v75q-38 0 -69 52 t-31 98v250q0 124 88 212t212 88z" />
<glyph unicode="&#xe009;" d="M25 1100h1150q10 0 17.5 -7.5t7.5 -17.5v-1050q0 -10 -7.5 -17.5t-17.5 -7.5h-1150q-10 0 -17.5 7.5t-7.5 17.5v1050q0 10 7.5 17.5t17.5 7.5zM100 1000v-100h100v100h-100zM875 1000h-550q-10 0 -17.5 -7.5t-7.5 -17.5v-350q0 -10 7.5 -17.5t17.5 -7.5h550 q10 0 17.5 7.5t7.5 17.5v350q0 10 -7.5 17.5t-17.5 7.5zM1000 1000v-100h100v100h-100zM100 800v-100h100v100h-100zM1000 800v-100h100v100h-100zM100 600v-100h100v100h-100zM1000 600v-100h100v100h-100zM875 500h-550q-10 0 -17.5 -7.5t-7.5 -17.5v-350q0 -10 7.5 -17.5 t17.5 -7.5h550q10 0 17.5 7.5t7.5 17.5v350q0 10 -7.5 17.5t-17.5 7.5zM100 400v-100h100v100h-100zM1000 400v-100h100v100h-100zM100 200v-100h100v100h-100zM1000 200v-100h100v100h-100z" />
<glyph unicode="&#xe010;" d="M50 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM650 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400 q0 21 14.5 35.5t35.5 14.5zM50 500h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM650 500h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe011;" d="M50 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200 q0 21 14.5 35.5t35.5 14.5zM850 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM50 700h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200 q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 700h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM850 700h200q21 0 35.5 -14.5t14.5 -35.5v-200 q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM50 300h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 300h200 q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM850 300h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5 t35.5 14.5z" />
<glyph unicode="&#xe012;" d="M50 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 1100h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v200 q0 21 14.5 35.5t35.5 14.5zM50 700h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 700h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700 q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM50 300h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 300h700q21 0 35.5 -14.5t14.5 -35.5v-200 q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe013;" d="M465 477l571 571q8 8 18 8t17 -8l177 -177q8 -7 8 -17t-8 -18l-783 -784q-7 -8 -17.5 -8t-17.5 8l-384 384q-8 8 -8 18t8 17l177 177q7 8 17 8t18 -8l171 -171q7 -7 18 -7t18 7z" />
<glyph unicode="&#xe014;" d="M904 1083l178 -179q8 -8 8 -18.5t-8 -17.5l-267 -268l267 -268q8 -7 8 -17.5t-8 -18.5l-178 -178q-8 -8 -18.5 -8t-17.5 8l-268 267l-268 -267q-7 -8 -17.5 -8t-18.5 8l-178 178q-8 8 -8 18.5t8 17.5l267 268l-267 268q-8 7 -8 17.5t8 18.5l178 178q8 8 18.5 8t17.5 -8 l268 -267l268 268q7 7 17.5 7t18.5 -7z" />
<glyph unicode="&#xe015;" d="M507 1177q98 0 187.5 -38.5t154.5 -103.5t103.5 -154.5t38.5 -187.5q0 -141 -78 -262l300 -299q8 -8 8 -18.5t-8 -18.5l-109 -108q-7 -8 -17.5 -8t-18.5 8l-300 299q-119 -77 -261 -77q-98 0 -188 38.5t-154.5 103t-103 154.5t-38.5 188t38.5 187.5t103 154.5 t154.5 103.5t188 38.5zM506.5 1023q-89.5 0 -165.5 -44t-120 -120.5t-44 -166t44 -165.5t120 -120t165.5 -44t166 44t120.5 120t44 165.5t-44 166t-120.5 120.5t-166 44zM425 900h150q10 0 17.5 -7.5t7.5 -17.5v-75h75q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5 t-17.5 -7.5h-75v-75q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v75h-75q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h75v75q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe016;" d="M507 1177q98 0 187.5 -38.5t154.5 -103.5t103.5 -154.5t38.5 -187.5q0 -141 -78 -262l300 -299q8 -8 8 -18.5t-8 -18.5l-109 -108q-7 -8 -17.5 -8t-18.5 8l-300 299q-119 -77 -261 -77q-98 0 -188 38.5t-154.5 103t-103 154.5t-38.5 188t38.5 187.5t103 154.5 t154.5 103.5t188 38.5zM506.5 1023q-89.5 0 -165.5 -44t-120 -120.5t-44 -166t44 -165.5t120 -120t165.5 -44t166 44t120.5 120t44 165.5t-44 166t-120.5 120.5t-166 44zM325 800h350q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-350q-10 0 -17.5 7.5 t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe017;" d="M550 1200h100q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM800 975v166q167 -62 272 -209.5t105 -331.5q0 -117 -45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5 t-184.5 123t-123 184.5t-45.5 224q0 184 105 331.5t272 209.5v-166q-103 -55 -165 -155t-62 -220q0 -116 57 -214.5t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5q0 120 -62 220t-165 155z" />
<glyph unicode="&#xe018;" d="M1025 1200h150q10 0 17.5 -7.5t7.5 -17.5v-1150q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v1150q0 10 7.5 17.5t17.5 7.5zM725 800h150q10 0 17.5 -7.5t7.5 -17.5v-750q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v750 q0 10 7.5 17.5t17.5 7.5zM425 500h150q10 0 17.5 -7.5t7.5 -17.5v-450q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v450q0 10 7.5 17.5t17.5 7.5zM125 300h150q10 0 17.5 -7.5t7.5 -17.5v-250q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5 v250q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe019;" d="M600 1174q33 0 74 -5l38 -152l5 -1q49 -14 94 -39l5 -2l134 80q61 -48 104 -105l-80 -134l3 -5q25 -44 39 -93l1 -6l152 -38q5 -43 5 -73q0 -34 -5 -74l-152 -38l-1 -6q-15 -49 -39 -93l-3 -5l80 -134q-48 -61 -104 -105l-134 81l-5 -3q-44 -25 -94 -39l-5 -2l-38 -151 q-43 -5 -74 -5q-33 0 -74 5l-38 151l-5 2q-49 14 -94 39l-5 3l-134 -81q-60 48 -104 105l80 134l-3 5q-25 45 -38 93l-2 6l-151 38q-6 42 -6 74q0 33 6 73l151 38l2 6q13 48 38 93l3 5l-80 134q47 61 105 105l133 -80l5 2q45 25 94 39l5 1l38 152q43 5 74 5zM600 815 q-89 0 -152 -63t-63 -151.5t63 -151.5t152 -63t152 63t63 151.5t-63 151.5t-152 63z" />
<glyph unicode="&#xe020;" d="M500 1300h300q41 0 70.5 -29.5t29.5 -70.5v-100h275q10 0 17.5 -7.5t7.5 -17.5v-75h-1100v75q0 10 7.5 17.5t17.5 7.5h275v100q0 41 29.5 70.5t70.5 29.5zM500 1200v-100h300v100h-300zM1100 900v-800q0 -41 -29.5 -70.5t-70.5 -29.5h-700q-41 0 -70.5 29.5t-29.5 70.5 v800h900zM300 800v-700h100v700h-100zM500 800v-700h100v700h-100zM700 800v-700h100v700h-100zM900 800v-700h100v700h-100z" />
<glyph unicode="&#xe021;" d="M18 618l620 608q8 7 18.5 7t17.5 -7l608 -608q8 -8 5.5 -13t-12.5 -5h-175v-575q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v375h-300v-375q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v575h-175q-10 0 -12.5 5t5.5 13z" />
<glyph unicode="&#xe022;" d="M600 1200v-400q0 -41 29.5 -70.5t70.5 -29.5h300v-650q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v1100q0 21 14.5 35.5t35.5 14.5h450zM1000 800h-250q-21 0 -35.5 14.5t-14.5 35.5v250z" />
<glyph unicode="&#xe023;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM525 900h50q10 0 17.5 -7.5t7.5 -17.5v-275h175q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe024;" d="M1300 0h-538l-41 400h-242l-41 -400h-538l431 1200h209l-21 -300h162l-20 300h208zM515 800l-27 -300h224l-27 300h-170z" />
<glyph unicode="&#xe025;" d="M550 1200h200q21 0 35.5 -14.5t14.5 -35.5v-450h191q20 0 25.5 -11.5t-7.5 -27.5l-327 -400q-13 -16 -32 -16t-32 16l-327 400q-13 16 -7.5 27.5t25.5 11.5h191v450q0 21 14.5 35.5t35.5 14.5zM1125 400h50q10 0 17.5 -7.5t7.5 -17.5v-350q0 -10 -7.5 -17.5t-17.5 -7.5 h-1050q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h50q10 0 17.5 -7.5t7.5 -17.5v-175h900v175q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe026;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM525 900h150q10 0 17.5 -7.5t7.5 -17.5v-275h137q21 0 26 -11.5t-8 -27.5l-223 -275q-13 -16 -32 -16t-32 16l-223 275q-13 16 -8 27.5t26 11.5h137v275q0 10 7.5 17.5t17.5 7.5z " />
<glyph unicode="&#xe027;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM632 914l223 -275q13 -16 8 -27.5t-26 -11.5h-137v-275q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v275h-137q-21 0 -26 11.5t8 27.5l223 275q13 16 32 16 t32 -16z" />
<glyph unicode="&#xe028;" d="M225 1200h750q10 0 19.5 -7t12.5 -17l186 -652q7 -24 7 -49v-425q0 -12 -4 -27t-9 -17q-12 -6 -37 -6h-1100q-12 0 -27 4t-17 8q-6 13 -6 38l1 425q0 25 7 49l185 652q3 10 12.5 17t19.5 7zM878 1000h-556q-10 0 -19 -7t-11 -18l-87 -450q-2 -11 4 -18t16 -7h150 q10 0 19.5 -7t11.5 -17l38 -152q2 -10 11.5 -17t19.5 -7h250q10 0 19.5 7t11.5 17l38 152q2 10 11.5 17t19.5 7h150q10 0 16 7t4 18l-87 450q-2 11 -11 18t-19 7z" />
<glyph unicode="&#xe029;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM540 820l253 -190q17 -12 17 -30t-17 -30l-253 -190q-16 -12 -28 -6.5t-12 26.5v400q0 21 12 26.5t28 -6.5z" />
<glyph unicode="&#xe030;" d="M947 1060l135 135q7 7 12.5 5t5.5 -13v-362q0 -10 -7.5 -17.5t-17.5 -7.5h-362q-11 0 -13 5.5t5 12.5l133 133q-109 76 -238 76q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5h150q0 -117 -45.5 -224 t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5q192 0 347 -117z" />
<glyph unicode="&#xe031;" d="M947 1060l135 135q7 7 12.5 5t5.5 -13v-361q0 -11 -7.5 -18.5t-18.5 -7.5h-361q-11 0 -13 5.5t5 12.5l134 134q-110 75 -239 75q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5h-150q0 117 45.5 224t123 184.5t184.5 123t224 45.5q192 0 347 -117zM1027 600h150 q0 -117 -45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5q-192 0 -348 118l-134 -134q-7 -8 -12.5 -5.5t-5.5 12.5v360q0 11 7.5 18.5t18.5 7.5h360q10 0 12.5 -5.5t-5.5 -12.5l-133 -133q110 -76 240 -76q116 0 214.5 57t155.5 155.5t57 214.5z" />
<glyph unicode="&#xe032;" d="M125 1200h1050q10 0 17.5 -7.5t7.5 -17.5v-1150q0 -10 -7.5 -17.5t-17.5 -7.5h-1050q-10 0 -17.5 7.5t-7.5 17.5v1150q0 10 7.5 17.5t17.5 7.5zM1075 1000h-850q-10 0 -17.5 -7.5t-7.5 -17.5v-850q0 -10 7.5 -17.5t17.5 -7.5h850q10 0 17.5 7.5t7.5 17.5v850 q0 10 -7.5 17.5t-17.5 7.5zM325 900h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 900h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5zM325 700h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 700h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5zM325 500h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 500h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5zM325 300h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 300h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe033;" d="M900 800v200q0 83 -58.5 141.5t-141.5 58.5h-300q-82 0 -141 -59t-59 -141v-200h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-600q0 -41 29.5 -70.5t70.5 -29.5h900q41 0 70.5 29.5t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5h-100zM400 800v150q0 21 15 35.5t35 14.5h200 q20 0 35 -14.5t15 -35.5v-150h-300z" />
<glyph unicode="&#xe034;" d="M125 1100h50q10 0 17.5 -7.5t7.5 -17.5v-1075h-100v1075q0 10 7.5 17.5t17.5 7.5zM1075 1052q4 0 9 -2q16 -6 16 -23v-421q0 -6 -3 -12q-33 -59 -66.5 -99t-65.5 -58t-56.5 -24.5t-52.5 -6.5q-26 0 -57.5 6.5t-52.5 13.5t-60 21q-41 15 -63 22.5t-57.5 15t-65.5 7.5 q-85 0 -160 -57q-7 -5 -15 -5q-6 0 -11 3q-14 7 -14 22v438q22 55 82 98.5t119 46.5q23 2 43 0.5t43 -7t32.5 -8.5t38 -13t32.5 -11q41 -14 63.5 -21t57 -14t63.5 -7q103 0 183 87q7 8 18 8z" />
<glyph unicode="&#xe035;" d="M600 1175q116 0 227 -49.5t192.5 -131t131 -192.5t49.5 -227v-300q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v300q0 127 -70.5 231.5t-184.5 161.5t-245 57t-245 -57t-184.5 -161.5t-70.5 -231.5v-300q0 -10 -7.5 -17.5t-17.5 -7.5h-50 q-10 0 -17.5 7.5t-7.5 17.5v300q0 116 49.5 227t131 192.5t192.5 131t227 49.5zM220 500h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14v460q0 8 6 14t14 6zM820 500h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14v460 q0 8 6 14t14 6z" />
<glyph unicode="&#xe036;" d="M321 814l258 172q9 6 15 2.5t6 -13.5v-750q0 -10 -6 -13.5t-15 2.5l-258 172q-21 14 -46 14h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h250q25 0 46 14zM900 668l120 120q7 7 17 7t17 -7l34 -34q7 -7 7 -17t-7 -17l-120 -120l120 -120q7 -7 7 -17 t-7 -17l-34 -34q-7 -7 -17 -7t-17 7l-120 119l-120 -119q-7 -7 -17 -7t-17 7l-34 34q-7 7 -7 17t7 17l119 120l-119 120q-7 7 -7 17t7 17l34 34q7 8 17 8t17 -8z" />
<glyph unicode="&#xe037;" d="M321 814l258 172q9 6 15 2.5t6 -13.5v-750q0 -10 -6 -13.5t-15 2.5l-258 172q-21 14 -46 14h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h250q25 0 46 14zM766 900h4q10 -1 16 -10q96 -129 96 -290q0 -154 -90 -281q-6 -9 -17 -10l-3 -1q-9 0 -16 6 l-29 23q-7 7 -8.5 16.5t4.5 17.5q72 103 72 229q0 132 -78 238q-6 8 -4.5 18t9.5 17l29 22q7 5 15 5z" />
<glyph unicode="&#xe038;" d="M967 1004h3q11 -1 17 -10q135 -179 135 -396q0 -105 -34 -206.5t-98 -185.5q-7 -9 -17 -10h-3q-9 0 -16 6l-42 34q-8 6 -9 16t5 18q111 150 111 328q0 90 -29.5 176t-84.5 157q-6 9 -5 19t10 16l42 33q7 5 15 5zM321 814l258 172q9 6 15 2.5t6 -13.5v-750q0 -10 -6 -13.5 t-15 2.5l-258 172q-21 14 -46 14h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h250q25 0 46 14zM766 900h4q10 -1 16 -10q96 -129 96 -290q0 -154 -90 -281q-6 -9 -17 -10l-3 -1q-9 0 -16 6l-29 23q-7 7 -8.5 16.5t4.5 17.5q72 103 72 229q0 132 -78 238 q-6 8 -4.5 18.5t9.5 16.5l29 22q7 5 15 5z" />
<glyph unicode="&#xe039;" d="M500 900h100v-100h-100v-100h-400v-100h-100v600h500v-300zM1200 700h-200v-100h200v-200h-300v300h-200v300h-100v200h600v-500zM100 1100v-300h300v300h-300zM800 1100v-300h300v300h-300zM300 900h-100v100h100v-100zM1000 900h-100v100h100v-100zM300 500h200v-500 h-500v500h200v100h100v-100zM800 300h200v-100h-100v-100h-200v100h-100v100h100v200h-200v100h300v-300zM100 400v-300h300v300h-300zM300 200h-100v100h100v-100zM1200 200h-100v100h100v-100zM700 0h-100v100h100v-100zM1200 0h-300v100h300v-100z" />
<glyph unicode="&#xe040;" d="M100 200h-100v1000h100v-1000zM300 200h-100v1000h100v-1000zM700 200h-200v1000h200v-1000zM900 200h-100v1000h100v-1000zM1200 200h-200v1000h200v-1000zM400 0h-300v100h300v-100zM600 0h-100v91h100v-91zM800 0h-100v91h100v-91zM1100 0h-200v91h200v-91z" />
<glyph unicode="&#xe041;" d="M500 1200l682 -682q8 -8 8 -18t-8 -18l-464 -464q-8 -8 -18 -8t-18 8l-682 682l1 475q0 10 7.5 17.5t17.5 7.5h474zM319.5 1024.5q-29.5 29.5 -71 29.5t-71 -29.5t-29.5 -71.5t29.5 -71.5t71 -29.5t71 29.5t29.5 71.5t-29.5 71.5z" />
<glyph unicode="&#xe042;" d="M500 1200l682 -682q8 -8 8 -18t-8 -18l-464 -464q-8 -8 -18 -8t-18 8l-682 682l1 475q0 10 7.5 17.5t17.5 7.5h474zM800 1200l682 -682q8 -8 8 -18t-8 -18l-464 -464q-8 -8 -18 -8t-18 8l-56 56l424 426l-700 700h150zM319.5 1024.5q-29.5 29.5 -71 29.5t-71 -29.5 t-29.5 -71.5t29.5 -71.5t71 -29.5t71 29.5t29.5 71.5t-29.5 71.5z" />
<glyph unicode="&#xe043;" d="M300 1200h825q75 0 75 -75v-900q0 -25 -18 -43l-64 -64q-8 -8 -13 -5.5t-5 12.5v950q0 10 -7.5 17.5t-17.5 7.5h-700q-25 0 -43 -18l-64 -64q-8 -8 -5.5 -13t12.5 -5h700q10 0 17.5 -7.5t7.5 -17.5v-950q0 -10 -7.5 -17.5t-17.5 -7.5h-850q-10 0 -17.5 7.5t-7.5 17.5v975 q0 25 18 43l139 139q18 18 43 18z" />
<glyph unicode="&#xe044;" d="M250 1200h800q21 0 35.5 -14.5t14.5 -35.5v-1150l-450 444l-450 -445v1151q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe045;" d="M822 1200h-444q-11 0 -19 -7.5t-9 -17.5l-78 -301q-7 -24 7 -45l57 -108q6 -9 17.5 -15t21.5 -6h450q10 0 21.5 6t17.5 15l62 108q14 21 7 45l-83 301q-1 10 -9 17.5t-19 7.5zM1175 800h-150q-10 0 -21 -6.5t-15 -15.5l-78 -156q-4 -9 -15 -15.5t-21 -6.5h-550 q-10 0 -21 6.5t-15 15.5l-78 156q-4 9 -15 15.5t-21 6.5h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-650q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h750q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5 t7.5 17.5v650q0 10 -7.5 17.5t-17.5 7.5zM850 200h-500q-10 0 -19.5 -7t-11.5 -17l-38 -152q-2 -10 3.5 -17t15.5 -7h600q10 0 15.5 7t3.5 17l-38 152q-2 10 -11.5 17t-19.5 7z" />
<glyph unicode="&#xe046;" d="M500 1100h200q56 0 102.5 -20.5t72.5 -50t44 -59t25 -50.5l6 -20h150q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5v600q0 41 29.5 70.5t70.5 29.5h150q2 8 6.5 21.5t24 48t45 61t72 48t102.5 21.5zM900 800v-100 h100v100h-100zM600 730q-95 0 -162.5 -67.5t-67.5 -162.5t67.5 -162.5t162.5 -67.5t162.5 67.5t67.5 162.5t-67.5 162.5t-162.5 67.5zM600 603q43 0 73 -30t30 -73t-30 -73t-73 -30t-73 30t-30 73t30 73t73 30z" />
<glyph unicode="&#xe047;" d="M681 1199l385 -998q20 -50 60 -92q18 -19 36.5 -29.5t27.5 -11.5l10 -2v-66h-417v66q53 0 75 43.5t5 88.5l-82 222h-391q-58 -145 -92 -234q-11 -34 -6.5 -57t25.5 -37t46 -20t55 -6v-66h-365v66q56 24 84 52q12 12 25 30.5t20 31.5l7 13l399 1006h93zM416 521h340 l-162 457z" />
<glyph unicode="&#xe048;" d="M753 641q5 -1 14.5 -4.5t36 -15.5t50.5 -26.5t53.5 -40t50.5 -54.5t35.5 -70t14.5 -87q0 -67 -27.5 -125.5t-71.5 -97.5t-98.5 -66.5t-108.5 -40.5t-102 -13h-500v89q41 7 70.5 32.5t29.5 65.5v827q0 24 -0.5 34t-3.5 24t-8.5 19.5t-17 13.5t-28 12.5t-42.5 11.5v71 l471 -1q57 0 115.5 -20.5t108 -57t80.5 -94t31 -124.5q0 -51 -15.5 -96.5t-38 -74.5t-45 -50.5t-38.5 -30.5zM400 700h139q78 0 130.5 48.5t52.5 122.5q0 41 -8.5 70.5t-29.5 55.5t-62.5 39.5t-103.5 13.5h-118v-350zM400 200h216q80 0 121 50.5t41 130.5q0 90 -62.5 154.5 t-156.5 64.5h-159v-400z" />
<glyph unicode="&#xe049;" d="M877 1200l2 -57q-83 -19 -116 -45.5t-40 -66.5l-132 -839q-9 -49 13 -69t96 -26v-97h-500v97q186 16 200 98l173 832q3 17 3 30t-1.5 22.5t-9 17.5t-13.5 12.5t-21.5 10t-26 8.5t-33.5 10q-13 3 -19 5v57h425z" />
<glyph unicode="&#xe050;" d="M1300 900h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-200v-850q0 -22 25 -34.5t50 -13.5l25 -2v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v850h-200q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h1000v-300zM175 1000h-75v-800h75l-125 -167l-125 167h75v800h-75l125 167z" />
<glyph unicode="&#xe051;" d="M1100 900h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-200v-650q0 -22 25 -34.5t50 -13.5l25 -2v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v650h-200q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h1000v-300zM1167 50l-167 -125v75h-800v-75l-167 125l167 125v-75h800v75z" />
<glyph unicode="&#xe052;" d="M50 1100h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 800h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM50 500h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe053;" d="M250 1100h700q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 800h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM250 500h700q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe054;" d="M500 950v100q0 21 14.5 35.5t35.5 14.5h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5zM100 650v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000 q-21 0 -35.5 14.5t-14.5 35.5zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5zM0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100 q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5z" />
<glyph unicode="&#xe055;" d="M50 1100h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 800h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM50 500h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe056;" d="M50 1100h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 1100h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM50 800h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 800h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 500h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 500h800q21 0 35.5 -14.5t14.5 -35.5v-100 q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 200h800 q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe057;" d="M400 0h-100v1100h100v-1100zM550 1100h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM550 800h500q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-500 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM267 550l-167 -125v75h-200v100h200v75zM550 500h300q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM550 200h600 q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe058;" d="M50 1100h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM900 0h-100v1100h100v-1100zM50 800h500q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-500 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM1100 600h200v-100h-200v-75l-167 125l167 125v-75zM50 500h300q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h600 q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe059;" d="M75 1000h750q31 0 53 -22t22 -53v-650q0 -31 -22 -53t-53 -22h-750q-31 0 -53 22t-22 53v650q0 31 22 53t53 22zM1200 300l-300 300l300 300v-600z" />
<glyph unicode="&#xe060;" d="M44 1100h1112q18 0 31 -13t13 -31v-1012q0 -18 -13 -31t-31 -13h-1112q-18 0 -31 13t-13 31v1012q0 18 13 31t31 13zM100 1000v-737l247 182l298 -131l-74 156l293 318l236 -288v500h-1000zM342 884q56 0 95 -39t39 -94.5t-39 -95t-95 -39.5t-95 39.5t-39 95t39 94.5 t95 39z" />
<glyph unicode="&#xe062;" d="M648 1169q117 0 216 -60t156.5 -161t57.5 -218q0 -115 -70 -258q-69 -109 -158 -225.5t-143 -179.5l-54 -62q-9 8 -25.5 24.5t-63.5 67.5t-91 103t-98.5 128t-95.5 148q-60 132 -60 249q0 88 34 169.5t91.5 142t137 96.5t166.5 36zM652.5 974q-91.5 0 -156.5 -65 t-65 -157t65 -156.5t156.5 -64.5t156.5 64.5t65 156.5t-65 157t-156.5 65z" />
<glyph unicode="&#xe063;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 173v854q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57z" />
<glyph unicode="&#xe064;" d="M554 1295q21 -72 57.5 -143.5t76 -130t83 -118t82.5 -117t70 -116t49.5 -126t18.5 -136.5q0 -71 -25.5 -135t-68.5 -111t-99 -82t-118.5 -54t-125.5 -23q-84 5 -161.5 34t-139.5 78.5t-99 125t-37 164.5q0 69 18 136.5t49.5 126.5t69.5 116.5t81.5 117.5t83.5 119 t76.5 131t58.5 143zM344 710q-23 -33 -43.5 -70.5t-40.5 -102.5t-17 -123q1 -37 14.5 -69.5t30 -52t41 -37t38.5 -24.5t33 -15q21 -7 32 -1t13 22l6 34q2 10 -2.5 22t-13.5 19q-5 4 -14 12t-29.5 40.5t-32.5 73.5q-26 89 6 271q2 11 -6 11q-8 1 -15 -10z" />
<glyph unicode="&#xe065;" d="M1000 1013l108 115q2 1 5 2t13 2t20.5 -1t25 -9.5t28.5 -21.5q22 -22 27 -43t0 -32l-6 -10l-108 -115zM350 1100h400q50 0 105 -13l-187 -187h-368q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v182l200 200v-332 q0 -165 -93.5 -257.5t-256.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5zM1009 803l-362 -362l-161 -50l55 170l355 355z" />
<glyph unicode="&#xe066;" d="M350 1100h361q-164 -146 -216 -200h-195q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5l200 153v-103q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5z M824 1073l339 -301q8 -7 8 -17.5t-8 -17.5l-340 -306q-7 -6 -12.5 -4t-6.5 11v203q-26 1 -54.5 0t-78.5 -7.5t-92 -17.5t-86 -35t-70 -57q10 59 33 108t51.5 81.5t65 58.5t68.5 40.5t67 24.5t56 13.5t40 4.5v210q1 10 6.5 12.5t13.5 -4.5z" />
<glyph unicode="&#xe067;" d="M350 1100h350q60 0 127 -23l-178 -177h-349q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v69l200 200v-219q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5z M643 639l395 395q7 7 17.5 7t17.5 -7l101 -101q7 -7 7 -17.5t-7 -17.5l-531 -532q-7 -7 -17.5 -7t-17.5 7l-248 248q-7 7 -7 17.5t7 17.5l101 101q7 7 17.5 7t17.5 -7l111 -111q8 -7 18 -7t18 7z" />
<glyph unicode="&#xe068;" d="M318 918l264 264q8 8 18 8t18 -8l260 -264q7 -8 4.5 -13t-12.5 -5h-170v-200h200v173q0 10 5 12t13 -5l264 -260q8 -7 8 -17.5t-8 -17.5l-264 -265q-8 -7 -13 -5t-5 12v173h-200v-200h170q10 0 12.5 -5t-4.5 -13l-260 -264q-8 -8 -18 -8t-18 8l-264 264q-8 8 -5.5 13 t12.5 5h175v200h-200v-173q0 -10 -5 -12t-13 5l-264 265q-8 7 -8 17.5t8 17.5l264 260q8 7 13 5t5 -12v-173h200v200h-175q-10 0 -12.5 5t5.5 13z" />
<glyph unicode="&#xe069;" d="M250 1100h100q21 0 35.5 -14.5t14.5 -35.5v-438l464 453q15 14 25.5 10t10.5 -25v-1000q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v1000q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe070;" d="M50 1100h100q21 0 35.5 -14.5t14.5 -35.5v-438l464 453q15 14 25.5 10t10.5 -25v-438l464 453q15 14 25.5 10t10.5 -25v-1000q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5 t-14.5 35.5v1000q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe071;" d="M1200 1050v-1000q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -10.5 -25t-25.5 10l-492 480q-15 14 -15 35t15 35l492 480q15 14 25.5 10t10.5 -25v-438l464 453q15 14 25.5 10t10.5 -25z" />
<glyph unicode="&#xe072;" d="M243 1074l814 -498q18 -11 18 -26t-18 -26l-814 -498q-18 -11 -30.5 -4t-12.5 28v1000q0 21 12.5 28t30.5 -4z" />
<glyph unicode="&#xe073;" d="M250 1000h200q21 0 35.5 -14.5t14.5 -35.5v-800q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v800q0 21 14.5 35.5t35.5 14.5zM650 1000h200q21 0 35.5 -14.5t14.5 -35.5v-800q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v800 q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe074;" d="M1100 950v-800q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v800q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5z" />
<glyph unicode="&#xe075;" d="M500 612v438q0 21 10.5 25t25.5 -10l492 -480q15 -14 15 -35t-15 -35l-492 -480q-15 -14 -25.5 -10t-10.5 25v438l-464 -453q-15 -14 -25.5 -10t-10.5 25v1000q0 21 10.5 25t25.5 -10z" />
<glyph unicode="&#xe076;" d="M1048 1102l100 1q20 0 35 -14.5t15 -35.5l5 -1000q0 -21 -14.5 -35.5t-35.5 -14.5l-100 -1q-21 0 -35.5 14.5t-14.5 35.5l-2 437l-463 -454q-14 -15 -24.5 -10.5t-10.5 25.5l-2 437l-462 -455q-15 -14 -25.5 -9.5t-10.5 24.5l-5 1000q0 21 10.5 25.5t25.5 -10.5l466 -450 l-2 438q0 20 10.5 24.5t25.5 -9.5l466 -451l-2 438q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe077;" d="M850 1100h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438l-464 -453q-15 -14 -25.5 -10t-10.5 25v1000q0 21 10.5 25t25.5 -10l464 -453v438q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe078;" d="M686 1081l501 -540q15 -15 10.5 -26t-26.5 -11h-1042q-22 0 -26.5 11t10.5 26l501 540q15 15 36 15t36 -15zM150 400h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe079;" d="M885 900l-352 -353l352 -353l-197 -198l-552 552l552 550z" />
<glyph unicode="&#xe080;" d="M1064 547l-551 -551l-198 198l353 353l-353 353l198 198z" />
<glyph unicode="&#xe081;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM650 900h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-150h-150 q-21 0 -35.5 -14.5t-14.5 -35.5v-100q0 -21 14.5 -35.5t35.5 -14.5h150v-150q0 -21 14.5 -35.5t35.5 -14.5h100q21 0 35.5 14.5t14.5 35.5v150h150q21 0 35.5 14.5t14.5 35.5v100q0 21 -14.5 35.5t-35.5 14.5h-150v150q0 21 -14.5 35.5t-35.5 14.5z" />
<glyph unicode="&#xe082;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM850 700h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100q0 -21 14.5 -35.5 t35.5 -14.5h500q21 0 35.5 14.5t14.5 35.5v100q0 21 -14.5 35.5t-35.5 14.5z" />
<glyph unicode="&#xe083;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM741.5 913q-12.5 0 -21.5 -9l-120 -120l-120 120q-9 9 -21.5 9 t-21.5 -9l-141 -141q-9 -9 -9 -21.5t9 -21.5l120 -120l-120 -120q-9 -9 -9 -21.5t9 -21.5l141 -141q9 -9 21.5 -9t21.5 9l120 120l120 -120q9 -9 21.5 -9t21.5 9l141 141q9 9 9 21.5t-9 21.5l-120 120l120 120q9 9 9 21.5t-9 21.5l-141 141q-9 9 -21.5 9z" />
<glyph unicode="&#xe084;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM546 623l-84 85q-7 7 -17.5 7t-18.5 -7l-139 -139q-7 -8 -7 -18t7 -18 l242 -241q7 -8 17.5 -8t17.5 8l375 375q7 7 7 17.5t-7 18.5l-139 139q-7 7 -17.5 7t-17.5 -7z" />
<glyph unicode="&#xe085;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM588 941q-29 0 -59 -5.5t-63 -20.5t-58 -38.5t-41.5 -63t-16.5 -89.5 q0 -25 20 -25h131q30 -5 35 11q6 20 20.5 28t45.5 8q20 0 31.5 -10.5t11.5 -28.5q0 -23 -7 -34t-26 -18q-1 0 -13.5 -4t-19.5 -7.5t-20 -10.5t-22 -17t-18.5 -24t-15.5 -35t-8 -46q-1 -8 5.5 -16.5t20.5 -8.5h173q7 0 22 8t35 28t37.5 48t29.5 74t12 100q0 47 -17 83 t-42.5 57t-59.5 34.5t-64 18t-59 4.5zM675 400h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5z" />
<glyph unicode="&#xe086;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM675 1000h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5 t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5zM675 700h-250q-10 0 -17.5 -7.5t-7.5 -17.5v-50q0 -10 7.5 -17.5t17.5 -7.5h75v-200h-75q-10 0 -17.5 -7.5t-7.5 -17.5v-50q0 -10 7.5 -17.5t17.5 -7.5h350q10 0 17.5 7.5t7.5 17.5v50q0 10 -7.5 17.5 t-17.5 7.5h-75v275q0 10 -7.5 17.5t-17.5 7.5z" />
<glyph unicode="&#xe087;" d="M525 1200h150q10 0 17.5 -7.5t7.5 -17.5v-194q103 -27 178.5 -102.5t102.5 -178.5h194q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-194q-27 -103 -102.5 -178.5t-178.5 -102.5v-194q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v194 q-103 27 -178.5 102.5t-102.5 178.5h-194q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h194q27 103 102.5 178.5t178.5 102.5v194q0 10 7.5 17.5t17.5 7.5zM700 893v-168q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v168q-68 -23 -119 -74 t-74 -119h168q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-168q23 -68 74 -119t119 -74v168q0 10 7.5 17.5t17.5 7.5h150q10 0 17.5 -7.5t7.5 -17.5v-168q68 23 119 74t74 119h-168q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h168 q-23 68 -74 119t-119 74z" />
<glyph unicode="&#xe088;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM759 823l64 -64q7 -7 7 -17.5t-7 -17.5l-124 -124l124 -124q7 -7 7 -17.5t-7 -17.5l-64 -64q-7 -7 -17.5 -7t-17.5 7l-124 124l-124 -124q-7 -7 -17.5 -7t-17.5 7l-64 64 q-7 7 -7 17.5t7 17.5l124 124l-124 124q-7 7 -7 17.5t7 17.5l64 64q7 7 17.5 7t17.5 -7l124 -124l124 124q7 7 17.5 7t17.5 -7z" />
<glyph unicode="&#xe089;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM782 788l106 -106q7 -7 7 -17.5t-7 -17.5l-320 -321q-8 -7 -18 -7t-18 7l-202 203q-8 7 -8 17.5t8 17.5l106 106q7 8 17.5 8t17.5 -8l79 -79l197 197q7 7 17.5 7t17.5 -7z" />
<glyph unicode="&#xe090;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5q0 -120 65 -225 l587 587q-105 65 -225 65zM965 819l-584 -584q104 -62 219 -62q116 0 214.5 57t155.5 155.5t57 214.5q0 115 -62 219z" />
<glyph unicode="&#xe091;" d="M39 582l522 427q16 13 27.5 8t11.5 -26v-291h550q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-550v-291q0 -21 -11.5 -26t-27.5 8l-522 427q-16 13 -16 32t16 32z" />
<glyph unicode="&#xe092;" d="M639 1009l522 -427q16 -13 16 -32t-16 -32l-522 -427q-16 -13 -27.5 -8t-11.5 26v291h-550q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5h550v291q0 21 11.5 26t27.5 -8z" />
<glyph unicode="&#xe093;" d="M682 1161l427 -522q13 -16 8 -27.5t-26 -11.5h-291v-550q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v550h-291q-21 0 -26 11.5t8 27.5l427 522q13 16 32 16t32 -16z" />
<glyph unicode="&#xe094;" d="M550 1200h200q21 0 35.5 -14.5t14.5 -35.5v-550h291q21 0 26 -11.5t-8 -27.5l-427 -522q-13 -16 -32 -16t-32 16l-427 522q-13 16 -8 27.5t26 11.5h291v550q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe095;" d="M639 1109l522 -427q16 -13 16 -32t-16 -32l-522 -427q-16 -13 -27.5 -8t-11.5 26v291q-94 -2 -182 -20t-170.5 -52t-147 -92.5t-100.5 -135.5q5 105 27 193.5t67.5 167t113 135t167 91.5t225.5 42v262q0 21 11.5 26t27.5 -8z" />
<glyph unicode="&#xe096;" d="M850 1200h300q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -10.5 -25t-24.5 10l-94 94l-249 -249q-8 -7 -18 -7t-18 7l-106 106q-7 8 -7 18t7 18l249 249l-94 94q-14 14 -10 24.5t25 10.5zM350 0h-300q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 10.5 25t24.5 -10l94 -94l249 249 q8 7 18 7t18 -7l106 -106q7 -8 7 -18t-7 -18l-249 -249l94 -94q14 -14 10 -24.5t-25 -10.5z" />
<glyph unicode="&#xe097;" d="M1014 1120l106 -106q7 -8 7 -18t-7 -18l-249 -249l94 -94q14 -14 10 -24.5t-25 -10.5h-300q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 10.5 25t24.5 -10l94 -94l249 249q8 7 18 7t18 -7zM250 600h300q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -10.5 -25t-24.5 10l-94 94 l-249 -249q-8 -7 -18 -7t-18 7l-106 106q-7 8 -7 18t7 18l249 249l-94 94q-14 14 -10 24.5t25 10.5z" />
<glyph unicode="&#xe101;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM704 900h-208q-20 0 -32 -14.5t-8 -34.5l58 -302q4 -20 21.5 -34.5 t37.5 -14.5h54q20 0 37.5 14.5t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5zM675 400h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5z" />
<glyph unicode="&#xe102;" d="M260 1200q9 0 19 -2t15 -4l5 -2q22 -10 44 -23l196 -118q21 -13 36 -24q29 -21 37 -12q11 13 49 35l196 118q22 13 45 23q17 7 38 7q23 0 47 -16.5t37 -33.5l13 -16q14 -21 18 -45l25 -123l8 -44q1 -9 8.5 -14.5t17.5 -5.5h61q10 0 17.5 -7.5t7.5 -17.5v-50 q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 -7.5t-7.5 -17.5v-175h-400v300h-200v-300h-400v175q0 10 -7.5 17.5t-17.5 7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5h61q11 0 18 3t7 8q0 4 9 52l25 128q5 25 19 45q2 3 5 7t13.5 15t21.5 19.5t26.5 15.5 t29.5 7zM915 1079l-166 -162q-7 -7 -5 -12t12 -5h219q10 0 15 7t2 17l-51 149q-3 10 -11 12t-15 -6zM463 917l-177 157q-8 7 -16 5t-11 -12l-51 -143q-3 -10 2 -17t15 -7h231q11 0 12.5 5t-5.5 12zM500 0h-375q-10 0 -17.5 7.5t-7.5 17.5v375h400v-400zM1100 400v-375 q0 -10 -7.5 -17.5t-17.5 -7.5h-375v400h400z" />
<glyph unicode="&#xe103;" d="M1165 1190q8 3 21 -6.5t13 -17.5q-2 -178 -24.5 -323.5t-55.5 -245.5t-87 -174.5t-102.5 -118.5t-118 -68.5t-118.5 -33t-120 -4.5t-105 9.5t-90 16.5q-61 12 -78 11q-4 1 -12.5 0t-34 -14.5t-52.5 -40.5l-153 -153q-26 -24 -37 -14.5t-11 43.5q0 64 42 102q8 8 50.5 45 t66.5 58q19 17 35 47t13 61q-9 55 -10 102.5t7 111t37 130t78 129.5q39 51 80 88t89.5 63.5t94.5 45t113.5 36t129 31t157.5 37t182 47.5zM1116 1098q-8 9 -22.5 -3t-45.5 -50q-38 -47 -119 -103.5t-142 -89.5l-62 -33q-56 -30 -102 -57t-104 -68t-102.5 -80.5t-85.5 -91 t-64 -104.5q-24 -56 -31 -86t2 -32t31.5 17.5t55.5 59.5q25 30 94 75.5t125.5 77.5t147.5 81q70 37 118.5 69t102 79.5t99 111t86.5 148.5q22 50 24 60t-6 19z" />
<glyph unicode="&#xe104;" d="M653 1231q-39 -67 -54.5 -131t-10.5 -114.5t24.5 -96.5t47.5 -80t63.5 -62.5t68.5 -46.5t65 -30q-4 7 -17.5 35t-18.5 39.5t-17 39.5t-17 43t-13 42t-9.5 44.5t-2 42t4 43t13.5 39t23 38.5q96 -42 165 -107.5t105 -138t52 -156t13 -159t-19 -149.5q-13 -55 -44 -106.5 t-68 -87t-78.5 -64.5t-72.5 -45t-53 -22q-72 -22 -127 -11q-31 6 -13 19q6 3 17 7q13 5 32.5 21t41 44t38.5 63.5t21.5 81.5t-6.5 94.5t-50 107t-104 115.5q10 -104 -0.5 -189t-37 -140.5t-65 -93t-84 -52t-93.5 -11t-95 24.5q-80 36 -131.5 114t-53.5 171q-2 23 0 49.5 t4.5 52.5t13.5 56t27.5 60t46 64.5t69.5 68.5q-8 -53 -5 -102.5t17.5 -90t34 -68.5t44.5 -39t49 -2q31 13 38.5 36t-4.5 55t-29 64.5t-36 75t-26 75.5q-15 85 2 161.5t53.5 128.5t85.5 92.5t93.5 61t81.5 25.5z" />
<glyph unicode="&#xe105;" d="M600 1094q82 0 160.5 -22.5t140 -59t116.5 -82.5t94.5 -95t68 -95t42.5 -82.5t14 -57.5t-14 -57.5t-43 -82.5t-68.5 -95t-94.5 -95t-116.5 -82.5t-140 -59t-159.5 -22.5t-159.5 22.5t-140 59t-116.5 82.5t-94.5 95t-68.5 95t-43 82.5t-14 57.5t14 57.5t42.5 82.5t68 95 t94.5 95t116.5 82.5t140 59t160.5 22.5zM888 829q-15 15 -18 12t5 -22q25 -57 25 -119q0 -124 -88 -212t-212 -88t-212 88t-88 212q0 59 23 114q8 19 4.5 22t-17.5 -12q-70 -69 -160 -184q-13 -16 -15 -40.5t9 -42.5q22 -36 47 -71t70 -82t92.5 -81t113 -58.5t133.5 -24.5 t133.5 24t113 58.5t92.5 81.5t70 81.5t47 70.5q11 18 9 42.5t-14 41.5q-90 117 -163 189zM448 727l-35 -36q-15 -15 -19.5 -38.5t4.5 -41.5q37 -68 93 -116q16 -13 38.5 -11t36.5 17l35 34q14 15 12.5 33.5t-16.5 33.5q-44 44 -89 117q-11 18 -28 20t-32 -12z" />
<glyph unicode="&#xe106;" d="M592 0h-148l31 120q-91 20 -175.5 68.5t-143.5 106.5t-103.5 119t-66.5 110t-22 76q0 21 14 57.5t42.5 82.5t68 95t94.5 95t116.5 82.5t140 59t160.5 22.5q61 0 126 -15l32 121h148zM944 770l47 181q108 -85 176.5 -192t68.5 -159q0 -26 -19.5 -71t-59.5 -102t-93 -112 t-129 -104.5t-158 -75.5l46 173q77 49 136 117t97 131q11 18 9 42.5t-14 41.5q-54 70 -107 130zM310 824q-70 -69 -160 -184q-13 -16 -15 -40.5t9 -42.5q18 -30 39 -60t57 -70.5t74 -73t90 -61t105 -41.5l41 154q-107 18 -178.5 101.5t-71.5 193.5q0 59 23 114q8 19 4.5 22 t-17.5 -12zM448 727l-35 -36q-15 -15 -19.5 -38.5t4.5 -41.5q37 -68 93 -116q16 -13 38.5 -11t36.5 17l12 11l22 86l-3 4q-44 44 -89 117q-11 18 -28 20t-32 -12z" />
<glyph unicode="&#xe107;" d="M-90 100l642 1066q20 31 48 28.5t48 -35.5l642 -1056q21 -32 7.5 -67.5t-50.5 -35.5h-1294q-37 0 -50.5 34t7.5 66zM155 200h345v75q0 10 7.5 17.5t17.5 7.5h150q10 0 17.5 -7.5t7.5 -17.5v-75h345l-445 723zM496 700h208q20 0 32 -14.5t8 -34.5l-58 -252 q-4 -20 -21.5 -34.5t-37.5 -14.5h-54q-20 0 -37.5 14.5t-21.5 34.5l-58 252q-4 20 8 34.5t32 14.5z" />
<glyph unicode="&#xe108;" d="M650 1200q62 0 106 -44t44 -106v-339l363 -325q15 -14 26 -38.5t11 -44.5v-41q0 -20 -12 -26.5t-29 5.5l-359 249v-263q100 -93 100 -113v-64q0 -21 -13 -29t-32 1l-205 128l-205 -128q-19 -9 -32 -1t-13 29v64q0 20 100 113v263l-359 -249q-17 -12 -29 -5.5t-12 26.5v41 q0 20 11 44.5t26 38.5l363 325v339q0 62 44 106t106 44z" />
<glyph unicode="&#xe109;" d="M850 1200h100q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-150h-1100v150q0 21 14.5 35.5t35.5 14.5h50v50q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-50h500v50q0 21 14.5 35.5t35.5 14.5zM1100 800v-750q0 -21 -14.5 -35.5 t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v750h1100zM100 600v-100h100v100h-100zM300 600v-100h100v100h-100zM500 600v-100h100v100h-100zM700 600v-100h100v100h-100zM900 600v-100h100v100h-100zM100 400v-100h100v100h-100zM300 400v-100h100v100h-100zM500 400 v-100h100v100h-100zM700 400v-100h100v100h-100zM900 400v-100h100v100h-100zM100 200v-100h100v100h-100zM300 200v-100h100v100h-100zM500 200v-100h100v100h-100zM700 200v-100h100v100h-100zM900 200v-100h100v100h-100z" />
<glyph unicode="&#xe110;" d="M1135 1165l249 -230q15 -14 15 -35t-15 -35l-249 -230q-14 -14 -24.5 -10t-10.5 25v150h-159l-600 -600h-291q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h209l600 600h241v150q0 21 10.5 25t24.5 -10zM522 819l-141 -141l-122 122h-209q-21 0 -35.5 14.5 t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h291zM1135 565l249 -230q15 -14 15 -35t-15 -35l-249 -230q-14 -14 -24.5 -10t-10.5 25v150h-241l-181 181l141 141l122 -122h159v150q0 21 10.5 25t24.5 -10z" />
<glyph unicode="&#xe111;" d="M100 1100h1000q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-596l-304 -300v300h-100q-41 0 -70.5 29.5t-29.5 70.5v600q0 41 29.5 70.5t70.5 29.5z" />
<glyph unicode="&#xe112;" d="M150 1200h200q21 0 35.5 -14.5t14.5 -35.5v-250h-300v250q0 21 14.5 35.5t35.5 14.5zM850 1200h200q21 0 35.5 -14.5t14.5 -35.5v-250h-300v250q0 21 14.5 35.5t35.5 14.5zM1100 800v-300q0 -41 -3 -77.5t-15 -89.5t-32 -96t-58 -89t-89 -77t-129 -51t-174 -20t-174 20 t-129 51t-89 77t-58 89t-32 96t-15 89.5t-3 77.5v300h300v-250v-27v-42.5t1.5 -41t5 -38t10 -35t16.5 -30t25.5 -24.5t35 -19t46.5 -12t60 -4t60 4.5t46.5 12.5t35 19.5t25 25.5t17 30.5t10 35t5 38t2 40.5t-0.5 42v25v250h300z" />
<glyph unicode="&#xe113;" d="M1100 411l-198 -199l-353 353l-353 -353l-197 199l551 551z" />
<glyph unicode="&#xe114;" d="M1101 789l-550 -551l-551 551l198 199l353 -353l353 353z" />
<glyph unicode="&#xe115;" d="M404 1000h746q21 0 35.5 -14.5t14.5 -35.5v-551h150q21 0 25 -10.5t-10 -24.5l-230 -249q-14 -15 -35 -15t-35 15l-230 249q-14 14 -10 24.5t25 10.5h150v401h-381zM135 984l230 -249q14 -14 10 -24.5t-25 -10.5h-150v-400h385l215 -200h-750q-21 0 -35.5 14.5 t-14.5 35.5v550h-150q-21 0 -25 10.5t10 24.5l230 249q14 15 35 15t35 -15z" />
<glyph unicode="&#xe116;" d="M56 1200h94q17 0 31 -11t18 -27l38 -162h896q24 0 39 -18.5t10 -42.5l-100 -475q-5 -21 -27 -42.5t-55 -21.5h-633l48 -200h535q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-50q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v50h-300v-50 q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v50h-31q-18 0 -32.5 10t-20.5 19l-5 10l-201 961h-54q-20 0 -35 14.5t-15 35.5t15 35.5t35 14.5z" />
<glyph unicode="&#xe117;" d="M1200 1000v-100h-1200v100h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500zM0 800h1200v-800h-1200v800z" />
<glyph unicode="&#xe118;" d="M200 800l-200 -400v600h200q0 41 29.5 70.5t70.5 29.5h300q42 0 71 -29.5t29 -70.5h500v-200h-1000zM1500 700l-300 -700h-1200l300 700h1200z" />
<glyph unicode="&#xe119;" d="M635 1184l230 -249q14 -14 10 -24.5t-25 -10.5h-150v-601h150q21 0 25 -10.5t-10 -24.5l-230 -249q-14 -15 -35 -15t-35 15l-230 249q-14 14 -10 24.5t25 10.5h150v601h-150q-21 0 -25 10.5t10 24.5l230 249q14 15 35 15t35 -15z" />
<glyph unicode="&#xe120;" d="M936 864l249 -229q14 -15 14 -35.5t-14 -35.5l-249 -229q-15 -15 -25.5 -10.5t-10.5 24.5v151h-600v-151q0 -20 -10.5 -24.5t-25.5 10.5l-249 229q-14 15 -14 35.5t14 35.5l249 229q15 15 25.5 10.5t10.5 -25.5v-149h600v149q0 21 10.5 25.5t25.5 -10.5z" />
<glyph unicode="&#xe121;" d="M1169 400l-172 732q-5 23 -23 45.5t-38 22.5h-672q-20 0 -38 -20t-23 -41l-172 -739h1138zM1100 300h-1000q-41 0 -70.5 -29.5t-29.5 -70.5v-100q0 -41 29.5 -70.5t70.5 -29.5h1000q41 0 70.5 29.5t29.5 70.5v100q0 41 -29.5 70.5t-70.5 29.5zM800 100v100h100v-100h-100 zM1000 100v100h100v-100h-100z" />
<glyph unicode="&#xe122;" d="M1150 1100q21 0 35.5 -14.5t14.5 -35.5v-850q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v850q0 21 14.5 35.5t35.5 14.5zM1000 200l-675 200h-38l47 -276q3 -16 -5.5 -20t-29.5 -4h-7h-84q-20 0 -34.5 14t-18.5 35q-55 337 -55 351v250v6q0 16 1 23.5t6.5 14 t17.5 6.5h200l675 250v-850zM0 750v-250q-4 0 -11 0.5t-24 6t-30 15t-24 30t-11 48.5v50q0 26 10.5 46t25 30t29 16t25.5 7z" />
<glyph unicode="&#xe123;" d="M553 1200h94q20 0 29 -10.5t3 -29.5l-18 -37q83 -19 144 -82.5t76 -140.5l63 -327l118 -173h17q19 0 33 -14.5t14 -35t-13 -40.5t-31 -27q-8 -4 -23 -9.5t-65 -19.5t-103 -25t-132.5 -20t-158.5 -9q-57 0 -115 5t-104 12t-88.5 15.5t-73.5 17.5t-54.5 16t-35.5 12l-11 4 q-18 8 -31 28t-13 40.5t14 35t33 14.5h17l118 173l63 327q15 77 76 140t144 83l-18 32q-6 19 3.5 32t28.5 13zM498 110q50 -6 102 -6q53 0 102 6q-12 -49 -39.5 -79.5t-62.5 -30.5t-63 30.5t-39 79.5z" />
<glyph unicode="&#xe124;" d="M800 946l224 78l-78 -224l234 -45l-180 -155l180 -155l-234 -45l78 -224l-224 78l-45 -234l-155 180l-155 -180l-45 234l-224 -78l78 224l-234 45l180 155l-180 155l234 45l-78 224l224 -78l45 234l155 -180l155 180z" />
<glyph unicode="&#xe125;" d="M650 1200h50q40 0 70 -40.5t30 -84.5v-150l-28 -125h328q40 0 70 -40.5t30 -84.5v-100q0 -45 -29 -74l-238 -344q-16 -24 -38 -40.5t-45 -16.5h-250q-7 0 -42 25t-66 50l-31 25h-61q-45 0 -72.5 18t-27.5 57v400q0 36 20 63l145 196l96 198q13 28 37.5 48t51.5 20z M650 1100l-100 -212l-150 -213v-375h100l136 -100h214l250 375v125h-450l50 225v175h-50zM50 800h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v500q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe126;" d="M600 1100h250q23 0 45 -16.5t38 -40.5l238 -344q29 -29 29 -74v-100q0 -44 -30 -84.5t-70 -40.5h-328q28 -118 28 -125v-150q0 -44 -30 -84.5t-70 -40.5h-50q-27 0 -51.5 20t-37.5 48l-96 198l-145 196q-20 27 -20 63v400q0 39 27.5 57t72.5 18h61q124 100 139 100z M50 1000h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v500q0 21 14.5 35.5t35.5 14.5zM636 1000l-136 -100h-100v-375l150 -213l100 -212h50v175l-50 225h450v125l-250 375h-214z" />
<glyph unicode="&#xe127;" d="M356 873l363 230q31 16 53 -6l110 -112q13 -13 13.5 -32t-11.5 -34l-84 -121h302q84 0 138 -38t54 -110t-55 -111t-139 -39h-106l-131 -339q-6 -21 -19.5 -41t-28.5 -20h-342q-7 0 -90 81t-83 94v525q0 17 14 35.5t28 28.5zM400 792v-503l100 -89h293l131 339 q6 21 19.5 41t28.5 20h203q21 0 30.5 25t0.5 50t-31 25h-456h-7h-6h-5.5t-6 0.5t-5 1.5t-5 2t-4 2.5t-4 4t-2.5 4.5q-12 25 5 47l146 183l-86 83zM50 800h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v500 q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe128;" d="M475 1103l366 -230q2 -1 6 -3.5t14 -10.5t18 -16.5t14.5 -20t6.5 -22.5v-525q0 -13 -86 -94t-93 -81h-342q-15 0 -28.5 20t-19.5 41l-131 339h-106q-85 0 -139.5 39t-54.5 111t54 110t138 38h302l-85 121q-11 15 -10.5 34t13.5 32l110 112q22 22 53 6zM370 945l146 -183 q17 -22 5 -47q-2 -2 -3.5 -4.5t-4 -4t-4 -2.5t-5 -2t-5 -1.5t-6 -0.5h-6h-6.5h-6h-475v-100h221q15 0 29 -20t20 -41l130 -339h294l106 89v503l-342 236zM1050 800h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5 v500q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe129;" d="M550 1294q72 0 111 -55t39 -139v-106l339 -131q21 -6 41 -19.5t20 -28.5v-342q0 -7 -81 -90t-94 -83h-525q-17 0 -35.5 14t-28.5 28l-9 14l-230 363q-16 31 6 53l112 110q13 13 32 13.5t34 -11.5l121 -84v302q0 84 38 138t110 54zM600 972v203q0 21 -25 30.5t-50 0.5 t-25 -31v-456v-7v-6v-5.5t-0.5 -6t-1.5 -5t-2 -5t-2.5 -4t-4 -4t-4.5 -2.5q-25 -12 -47 5l-183 146l-83 -86l236 -339h503l89 100v293l-339 131q-21 6 -41 19.5t-20 28.5zM450 200h500q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-500 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe130;" d="M350 1100h500q21 0 35.5 14.5t14.5 35.5v100q0 21 -14.5 35.5t-35.5 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100q0 -21 14.5 -35.5t35.5 -14.5zM600 306v-106q0 -84 -39 -139t-111 -55t-110 54t-38 138v302l-121 -84q-15 -12 -34 -11.5t-32 13.5l-112 110 q-22 22 -6 53l230 363q1 2 3.5 6t10.5 13.5t16.5 17t20 13.5t22.5 6h525q13 0 94 -83t81 -90v-342q0 -15 -20 -28.5t-41 -19.5zM308 900l-236 -339l83 -86l183 146q22 17 47 5q2 -1 4.5 -2.5t4 -4t2.5 -4t2 -5t1.5 -5t0.5 -6v-5.5v-6v-7v-456q0 -22 25 -31t50 0.5t25 30.5 v203q0 15 20 28.5t41 19.5l339 131v293l-89 100h-503z" />
<glyph unicode="&#xe131;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM914 632l-275 223q-16 13 -27.5 8t-11.5 -26v-137h-275 q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h275v-137q0 -21 11.5 -26t27.5 8l275 223q16 13 16 32t-16 32z" />
<glyph unicode="&#xe132;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM561 855l-275 -223q-16 -13 -16 -32t16 -32l275 -223q16 -13 27.5 -8 t11.5 26v137h275q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5h-275v137q0 21 -11.5 26t-27.5 -8z" />
<glyph unicode="&#xe133;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM855 639l-223 275q-13 16 -32 16t-32 -16l-223 -275q-13 -16 -8 -27.5 t26 -11.5h137v-275q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v275h137q21 0 26 11.5t-8 27.5z" />
<glyph unicode="&#xe134;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM675 900h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-275h-137q-21 0 -26 -11.5 t8 -27.5l223 -275q13 -16 32 -16t32 16l223 275q13 16 8 27.5t-26 11.5h-137v275q0 10 -7.5 17.5t-17.5 7.5z" />
<glyph unicode="&#xe135;" d="M600 1176q116 0 222.5 -46t184 -123.5t123.5 -184t46 -222.5t-46 -222.5t-123.5 -184t-184 -123.5t-222.5 -46t-222.5 46t-184 123.5t-123.5 184t-46 222.5t46 222.5t123.5 184t184 123.5t222.5 46zM627 1101q-15 -12 -36.5 -20.5t-35.5 -12t-43 -8t-39 -6.5 q-15 -3 -45.5 0t-45.5 -2q-20 -7 -51.5 -26.5t-34.5 -34.5q-3 -11 6.5 -22.5t8.5 -18.5q-3 -34 -27.5 -91t-29.5 -79q-9 -34 5 -93t8 -87q0 -9 17 -44.5t16 -59.5q12 0 23 -5t23.5 -15t19.5 -14q16 -8 33 -15t40.5 -15t34.5 -12q21 -9 52.5 -32t60 -38t57.5 -11 q7 -15 -3 -34t-22.5 -40t-9.5 -38q13 -21 23 -34.5t27.5 -27.5t36.5 -18q0 -7 -3.5 -16t-3.5 -14t5 -17q104 -2 221 112q30 29 46.5 47t34.5 49t21 63q-13 8 -37 8.5t-36 7.5q-15 7 -49.5 15t-51.5 19q-18 0 -41 -0.5t-43 -1.5t-42 -6.5t-38 -16.5q-51 -35 -66 -12 q-4 1 -3.5 25.5t0.5 25.5q-6 13 -26.5 17.5t-24.5 6.5q1 15 -0.5 30.5t-7 28t-18.5 11.5t-31 -21q-23 -25 -42 4q-19 28 -8 58q6 16 22 22q6 -1 26 -1.5t33.5 -4t19.5 -13.5q7 -12 18 -24t21.5 -20.5t20 -15t15.5 -10.5l5 -3q2 12 7.5 30.5t8 34.5t-0.5 32q-3 18 3.5 29 t18 22.5t15.5 24.5q6 14 10.5 35t8 31t15.5 22.5t34 22.5q-6 18 10 36q8 0 24 -1.5t24.5 -1.5t20 4.5t20.5 15.5q-10 23 -31 42.5t-37.5 29.5t-49 27t-43.5 23q0 1 2 8t3 11.5t1.5 10.5t-1 9.5t-4.5 4.5q31 -13 58.5 -14.5t38.5 2.5l12 5q5 28 -9.5 46t-36.5 24t-50 15 t-41 20q-18 -4 -37 0zM613 994q0 -17 8 -42t17 -45t9 -23q-8 1 -39.5 5.5t-52.5 10t-37 16.5q3 11 16 29.5t16 25.5q10 -10 19 -10t14 6t13.5 14.5t16.5 12.5z" />
<glyph unicode="&#xe136;" d="M756 1157q164 92 306 -9l-259 -138l145 -232l251 126q6 -89 -34 -156.5t-117 -110.5q-60 -34 -127 -39.5t-126 16.5l-596 -596q-15 -16 -36.5 -16t-36.5 16l-111 110q-15 15 -15 36.5t15 37.5l600 599q-34 101 5.5 201.5t135.5 154.5z" />
<glyph unicode="&#xe137;" horiz-adv-x="1220" d="M100 1196h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5v100q0 41 29.5 70.5t70.5 29.5zM1100 1096h-200v-100h200v100zM100 796h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5v100q0 41 29.5 70.5t70.5 29.5zM1100 696h-500v-100h500v100zM100 396h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5v100q0 41 29.5 70.5t70.5 29.5zM1100 296h-300v-100h300v100z " />
<glyph unicode="&#xe138;" d="M150 1200h900q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM700 500v-300l-200 -200v500l-350 500h900z" />
<glyph unicode="&#xe139;" d="M500 1200h200q41 0 70.5 -29.5t29.5 -70.5v-100h300q41 0 70.5 -29.5t29.5 -70.5v-400h-500v100h-200v-100h-500v400q0 41 29.5 70.5t70.5 29.5h300v100q0 41 29.5 70.5t70.5 29.5zM500 1100v-100h200v100h-200zM1200 400v-200q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5v200h1200z" />
<glyph unicode="&#xe140;" d="M50 1200h300q21 0 25 -10.5t-10 -24.5l-94 -94l199 -199q7 -8 7 -18t-7 -18l-106 -106q-8 -7 -18 -7t-18 7l-199 199l-94 -94q-14 -14 -24.5 -10t-10.5 25v300q0 21 14.5 35.5t35.5 14.5zM850 1200h300q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -10.5 -25t-24.5 10l-94 94 l-199 -199q-8 -7 -18 -7t-18 7l-106 106q-7 8 -7 18t7 18l199 199l-94 94q-14 14 -10 24.5t25 10.5zM364 470l106 -106q7 -8 7 -18t-7 -18l-199 -199l94 -94q14 -14 10 -24.5t-25 -10.5h-300q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 10.5 25t24.5 -10l94 -94l199 199 q8 7 18 7t18 -7zM1071 271l94 94q14 14 24.5 10t10.5 -25v-300q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -25 10.5t10 24.5l94 94l-199 199q-7 8 -7 18t7 18l106 106q8 7 18 7t18 -7z" />
<glyph unicode="&#xe141;" d="M596 1192q121 0 231.5 -47.5t190 -127t127 -190t47.5 -231.5t-47.5 -231.5t-127 -190.5t-190 -127t-231.5 -47t-231.5 47t-190.5 127t-127 190.5t-47 231.5t47 231.5t127 190t190.5 127t231.5 47.5zM596 1010q-112 0 -207.5 -55.5t-151 -151t-55.5 -207.5t55.5 -207.5 t151 -151t207.5 -55.5t207.5 55.5t151 151t55.5 207.5t-55.5 207.5t-151 151t-207.5 55.5zM454.5 905q22.5 0 38.5 -16t16 -38.5t-16 -39t-38.5 -16.5t-38.5 16.5t-16 39t16 38.5t38.5 16zM754.5 905q22.5 0 38.5 -16t16 -38.5t-16 -39t-38 -16.5q-14 0 -29 10l-55 -145 q17 -23 17 -51q0 -36 -25.5 -61.5t-61.5 -25.5t-61.5 25.5t-25.5 61.5q0 32 20.5 56.5t51.5 29.5l122 126l1 1q-9 14 -9 28q0 23 16 39t38.5 16zM345.5 709q22.5 0 38.5 -16t16 -38.5t-16 -38.5t-38.5 -16t-38.5 16t-16 38.5t16 38.5t38.5 16zM854.5 709q22.5 0 38.5 -16 t16 -38.5t-16 -38.5t-38.5 -16t-38.5 16t-16 38.5t16 38.5t38.5 16z" />
<glyph unicode="&#xe142;" d="M546 173l469 470q91 91 99 192q7 98 -52 175.5t-154 94.5q-22 4 -47 4q-34 0 -66.5 -10t-56.5 -23t-55.5 -38t-48 -41.5t-48.5 -47.5q-376 -375 -391 -390q-30 -27 -45 -41.5t-37.5 -41t-32 -46.5t-16 -47.5t-1.5 -56.5q9 -62 53.5 -95t99.5 -33q74 0 125 51l548 548 q36 36 20 75q-7 16 -21.5 26t-32.5 10q-26 0 -50 -23q-13 -12 -39 -38l-341 -338q-15 -15 -35.5 -15.5t-34.5 13.5t-14 34.5t14 34.5q327 333 361 367q35 35 67.5 51.5t78.5 16.5q14 0 29 -1q44 -8 74.5 -35.5t43.5 -68.5q14 -47 2 -96.5t-47 -84.5q-12 -11 -32 -32 t-79.5 -81t-114.5 -115t-124.5 -123.5t-123 -119.5t-96.5 -89t-57 -45q-56 -27 -120 -27q-70 0 -129 32t-93 89q-48 78 -35 173t81 163l511 511q71 72 111 96q91 55 198 55q80 0 152 -33q78 -36 129.5 -103t66.5 -154q17 -93 -11 -183.5t-94 -156.5l-482 -476 q-15 -15 -36 -16t-37 14t-17.5 34t14.5 35z" />
<glyph unicode="&#xe143;" d="M649 949q48 68 109.5 104t121.5 38.5t118.5 -20t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-150 152.5t-126.5 127.5t-93.5 124.5t-33.5 117.5q0 64 28 123t73 100.5t104 64t119 20 t120.5 -38.5t104.5 -104zM896 972q-33 0 -64.5 -19t-56.5 -46t-47.5 -53.5t-43.5 -45.5t-37.5 -19t-36 19t-40 45.5t-43 53.5t-54 46t-65.5 19q-67 0 -122.5 -55.5t-55.5 -132.5q0 -23 13.5 -51t46 -65t57.5 -63t76 -75l22 -22q15 -14 44 -44t50.5 -51t46 -44t41 -35t23 -12 t23.5 12t42.5 36t46 44t52.5 52t44 43q4 4 12 13q43 41 63.5 62t52 55t46 55t26 46t11.5 44q0 79 -53 133.5t-120 54.5z" />
<glyph unicode="&#xe144;" d="M776.5 1214q93.5 0 159.5 -66l141 -141q66 -66 66 -160q0 -42 -28 -95.5t-62 -87.5l-29 -29q-31 53 -77 99l-18 18l95 95l-247 248l-389 -389l212 -212l-105 -106l-19 18l-141 141q-66 66 -66 159t66 159l283 283q65 66 158.5 66zM600 706l105 105q10 -8 19 -17l141 -141 q66 -66 66 -159t-66 -159l-283 -283q-66 -66 -159 -66t-159 66l-141 141q-66 66 -66 159.5t66 159.5l55 55q29 -55 75 -102l18 -17l-95 -95l247 -248l389 389z" />
<glyph unicode="&#xe145;" d="M603 1200q85 0 162 -15t127 -38t79 -48t29 -46v-953q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-41 0 -70.5 29.5t-29.5 70.5v953q0 21 30 46.5t81 48t129 37.5t163 15zM300 1000v-700h600v700h-600zM600 254q-43 0 -73.5 -30.5t-30.5 -73.5t30.5 -73.5t73.5 -30.5t73.5 30.5 t30.5 73.5t-30.5 73.5t-73.5 30.5z" />
<glyph unicode="&#xe146;" d="M902 1185l283 -282q15 -15 15 -36t-14.5 -35.5t-35.5 -14.5t-35 15l-36 35l-279 -267v-300l-212 210l-308 -307l-280 -203l203 280l307 308l-210 212h300l267 279l-35 36q-15 14 -15 35t14.5 35.5t35.5 14.5t35 -15z" />
<glyph unicode="&#xe148;" d="M700 1248v-78q38 -5 72.5 -14.5t75.5 -31.5t71 -53.5t52 -84t24 -118.5h-159q-4 36 -10.5 59t-21 45t-40 35.5t-64.5 20.5v-307l64 -13q34 -7 64 -16.5t70 -32t67.5 -52.5t47.5 -80t20 -112q0 -139 -89 -224t-244 -97v-77h-100v79q-150 16 -237 103q-40 40 -52.5 93.5 t-15.5 139.5h139q5 -77 48.5 -126t117.5 -65v335l-27 8q-46 14 -79 26.5t-72 36t-63 52t-40 72.5t-16 98q0 70 25 126t67.5 92t94.5 57t110 27v77h100zM600 754v274q-29 -4 -50 -11t-42 -21.5t-31.5 -41.5t-10.5 -65q0 -29 7 -50.5t16.5 -34t28.5 -22.5t31.5 -14t37.5 -10 q9 -3 13 -4zM700 547v-310q22 2 42.5 6.5t45 15.5t41.5 27t29 42t12 59.5t-12.5 59.5t-38 44.5t-53 31t-66.5 24.5z" />
<glyph unicode="&#xe149;" d="M561 1197q84 0 160.5 -40t123.5 -109.5t47 -147.5h-153q0 40 -19.5 71.5t-49.5 48.5t-59.5 26t-55.5 9q-37 0 -79 -14.5t-62 -35.5q-41 -44 -41 -101q0 -26 13.5 -63t26.5 -61t37 -66q6 -9 9 -14h241v-100h-197q8 -50 -2.5 -115t-31.5 -95q-45 -62 -99 -112 q34 10 83 17.5t71 7.5q32 1 102 -16t104 -17q83 0 136 30l50 -147q-31 -19 -58 -30.5t-55 -15.5t-42 -4.5t-46 -0.5q-23 0 -76 17t-111 32.5t-96 11.5q-39 -3 -82 -16t-67 -25l-23 -11l-55 145q4 3 16 11t15.5 10.5t13 9t15.5 12t14.5 14t17.5 18.5q48 55 54 126.5 t-30 142.5h-221v100h166q-23 47 -44 104q-7 20 -12 41.5t-6 55.5t6 66.5t29.5 70.5t58.5 71q97 88 263 88z" />
<glyph unicode="&#xe150;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM935 1184l230 -249q14 -14 10 -24.5t-25 -10.5h-150v-900h-200v900h-150q-21 0 -25 10.5t10 24.5l230 249q14 15 35 15t35 -15z" />
<glyph unicode="&#xe151;" d="M1000 700h-100v100h-100v-100h-100v500h300v-500zM400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM801 1100v-200h100v200h-100zM1000 350l-200 -250h200v-100h-300v150l200 250h-200v100h300v-150z " />
<glyph unicode="&#xe152;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1000 1050l-200 -250h200v-100h-300v150l200 250h-200v100h300v-150zM1000 0h-100v100h-100v-100h-100v500h300v-500zM801 400v-200h100v200h-100z " />
<glyph unicode="&#xe153;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1000 700h-100v400h-100v100h200v-500zM1100 0h-100v100h-200v400h300v-500zM901 400v-200h100v200h-100z" />
<glyph unicode="&#xe154;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1100 700h-100v100h-200v400h300v-500zM901 1100v-200h100v200h-100zM1000 0h-100v400h-100v100h200v-500z" />
<glyph unicode="&#xe155;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM900 1000h-200v200h200v-200zM1000 700h-300v200h300v-200zM1100 400h-400v200h400v-200zM1200 100h-500v200h500v-200z" />
<glyph unicode="&#xe156;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1200 1000h-500v200h500v-200zM1100 700h-400v200h400v-200zM1000 400h-300v200h300v-200zM900 100h-200v200h200v-200z" />
<glyph unicode="&#xe157;" d="M350 1100h400q162 0 256 -93.5t94 -256.5v-400q0 -165 -93.5 -257.5t-256.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5z" />
<glyph unicode="&#xe158;" d="M350 1100h400q165 0 257.5 -92.5t92.5 -257.5v-400q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-163 0 -256.5 92.5t-93.5 257.5v400q0 163 94 256.5t256 93.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5zM440 770l253 -190q17 -12 17 -30t-17 -30l-253 -190q-16 -12 -28 -6.5t-12 26.5v400q0 21 12 26.5t28 -6.5z" />
<glyph unicode="&#xe159;" d="M350 1100h400q163 0 256.5 -94t93.5 -256v-400q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 163 92.5 256.5t257.5 93.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5zM350 700h400q21 0 26.5 -12t-6.5 -28l-190 -253q-12 -17 -30 -17t-30 17l-190 253q-12 16 -6.5 28t26.5 12z" />
<glyph unicode="&#xe160;" d="M350 1100h400q165 0 257.5 -92.5t92.5 -257.5v-400q0 -163 -92.5 -256.5t-257.5 -93.5h-400q-163 0 -256.5 94t-93.5 256v400q0 165 92.5 257.5t257.5 92.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5zM580 693l190 -253q12 -16 6.5 -28t-26.5 -12h-400q-21 0 -26.5 12t6.5 28l190 253q12 17 30 17t30 -17z" />
<glyph unicode="&#xe161;" d="M550 1100h400q165 0 257.5 -92.5t92.5 -257.5v-400q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h450q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-450q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM338 867l324 -284q16 -14 16 -33t-16 -33l-324 -284q-16 -14 -27 -9t-11 26v150h-250q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5h250v150q0 21 11 26t27 -9z" />
<glyph unicode="&#xe162;" d="M793 1182l9 -9q8 -10 5 -27q-3 -11 -79 -225.5t-78 -221.5l300 1q24 0 32.5 -17.5t-5.5 -35.5q-1 0 -133.5 -155t-267 -312.5t-138.5 -162.5q-12 -15 -26 -15h-9l-9 8q-9 11 -4 32q2 9 42 123.5t79 224.5l39 110h-302q-23 0 -31 19q-10 21 6 41q75 86 209.5 237.5 t228 257t98.5 111.5q9 16 25 16h9z" />
<glyph unicode="&#xe163;" d="M350 1100h400q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-450q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h450q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400 q0 165 92.5 257.5t257.5 92.5zM938 867l324 -284q16 -14 16 -33t-16 -33l-324 -284q-16 -14 -27 -9t-11 26v150h-250q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5h250v150q0 21 11 26t27 -9z" />
<glyph unicode="&#xe164;" d="M750 1200h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -10.5 -25t-24.5 10l-109 109l-312 -312q-15 -15 -35.5 -15t-35.5 15l-141 141q-15 15 -15 35.5t15 35.5l312 312l-109 109q-14 14 -10 24.5t25 10.5zM456 900h-156q-41 0 -70.5 -29.5t-29.5 -70.5v-500 q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v148l200 200v-298q0 -165 -93.5 -257.5t-256.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5h300z" />
<glyph unicode="&#xe165;" d="M600 1186q119 0 227.5 -46.5t187 -125t125 -187t46.5 -227.5t-46.5 -227.5t-125 -187t-187 -125t-227.5 -46.5t-227.5 46.5t-187 125t-125 187t-46.5 227.5t46.5 227.5t125 187t187 125t227.5 46.5zM600 1022q-115 0 -212 -56.5t-153.5 -153.5t-56.5 -212t56.5 -212 t153.5 -153.5t212 -56.5t212 56.5t153.5 153.5t56.5 212t-56.5 212t-153.5 153.5t-212 56.5zM600 794q80 0 137 -57t57 -137t-57 -137t-137 -57t-137 57t-57 137t57 137t137 57z" />
<glyph unicode="&#xe166;" d="M450 1200h200q21 0 35.5 -14.5t14.5 -35.5v-350h245q20 0 25 -11t-9 -26l-383 -426q-14 -15 -33.5 -15t-32.5 15l-379 426q-13 15 -8.5 26t25.5 11h250v350q0 21 14.5 35.5t35.5 14.5zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5z M900 200v-50h100v50h-100z" />
<glyph unicode="&#xe167;" d="M583 1182l378 -435q14 -15 9 -31t-26 -16h-244v-250q0 -20 -17 -35t-39 -15h-200q-20 0 -32 14.5t-12 35.5v250h-250q-20 0 -25.5 16.5t8.5 31.5l383 431q14 16 33.5 17t33.5 -14zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5z M900 200v-50h100v50h-100z" />
<glyph unicode="&#xe168;" d="M396 723l369 369q7 7 17.5 7t17.5 -7l139 -139q7 -8 7 -18.5t-7 -17.5l-525 -525q-7 -8 -17.5 -8t-17.5 8l-292 291q-7 8 -7 18t7 18l139 139q8 7 18.5 7t17.5 -7zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5zM900 200v-50h100v50 h-100z" />
<glyph unicode="&#xe169;" d="M135 1023l142 142q14 14 35 14t35 -14l77 -77l-212 -212l-77 76q-14 15 -14 36t14 35zM655 855l210 210q14 14 24.5 10t10.5 -25l-2 -599q-1 -20 -15.5 -35t-35.5 -15l-597 -1q-21 0 -25 10.5t10 24.5l208 208l-154 155l212 212zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5 v-250h-1100v250q0 21 14.5 35.5t35.5 14.5zM900 200v-50h100v50h-100z" />
<glyph unicode="&#xe170;" d="M350 1200l599 -2q20 -1 35 -15.5t15 -35.5l1 -597q0 -21 -10.5 -25t-24.5 10l-208 208l-155 -154l-212 212l155 154l-210 210q-14 14 -10 24.5t25 10.5zM524 512l-76 -77q-15 -14 -36 -14t-35 14l-142 142q-14 14 -14 35t14 35l77 77zM50 300h1000q21 0 35.5 -14.5 t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5zM900 200v-50h100v50h-100z" />
<glyph unicode="&#xe171;" d="M1200 103l-483 276l-314 -399v423h-399l1196 796v-1096zM483 424v-230l683 953z" />
<glyph unicode="&#xe172;" d="M1100 1000v-850q0 -21 -14.5 -35.5t-35.5 -14.5h-150v400h-700v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200z" />
<glyph unicode="&#xe173;" d="M1100 1000l-2 -149l-299 -299l-95 95q-9 9 -21.5 9t-21.5 -9l-149 -147h-312v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM1132 638l106 -106q7 -7 7 -17.5t-7 -17.5l-420 -421q-8 -7 -18 -7 t-18 7l-202 203q-8 7 -8 17.5t8 17.5l106 106q7 8 17.5 8t17.5 -8l79 -79l297 297q7 7 17.5 7t17.5 -7z" />
<glyph unicode="&#xe174;" d="M1100 1000v-269l-103 -103l-134 134q-15 15 -33.5 16.5t-34.5 -12.5l-266 -266h-329v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM1202 572l70 -70q15 -15 15 -35.5t-15 -35.5l-131 -131 l131 -131q15 -15 15 -35.5t-15 -35.5l-70 -70q-15 -15 -35.5 -15t-35.5 15l-131 131l-131 -131q-15 -15 -35.5 -15t-35.5 15l-70 70q-15 15 -15 35.5t15 35.5l131 131l-131 131q-15 15 -15 35.5t15 35.5l70 70q15 15 35.5 15t35.5 -15l131 -131l131 131q15 15 35.5 15 t35.5 -15z" />
<glyph unicode="&#xe175;" d="M1100 1000v-300h-350q-21 0 -35.5 -14.5t-14.5 -35.5v-150h-500v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM850 600h100q21 0 35.5 -14.5t14.5 -35.5v-250h150q21 0 25 -10.5t-10 -24.5 l-230 -230q-14 -14 -35 -14t-35 14l-230 230q-14 14 -10 24.5t25 10.5h150v250q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe176;" d="M1100 1000v-400l-165 165q-14 15 -35 15t-35 -15l-263 -265h-402v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM935 565l230 -229q14 -15 10 -25.5t-25 -10.5h-150v-250q0 -20 -14.5 -35 t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35v250h-150q-21 0 -25 10.5t10 25.5l230 229q14 15 35 15t35 -15z" />
<glyph unicode="&#xe177;" d="M50 1100h1100q21 0 35.5 -14.5t14.5 -35.5v-150h-1200v150q0 21 14.5 35.5t35.5 14.5zM1200 800v-550q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v550h1200zM100 500v-200h400v200h-400z" />
<glyph unicode="&#xe178;" d="M935 1165l248 -230q14 -14 14 -35t-14 -35l-248 -230q-14 -14 -24.5 -10t-10.5 25v150h-400v200h400v150q0 21 10.5 25t24.5 -10zM200 800h-50q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h50v-200zM400 800h-100v200h100v-200zM18 435l247 230 q14 14 24.5 10t10.5 -25v-150h400v-200h-400v-150q0 -21 -10.5 -25t-24.5 10l-247 230q-15 14 -15 35t15 35zM900 300h-100v200h100v-200zM1000 500h51q20 0 34.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-34.5 -14.5h-51v200z" />
<glyph unicode="&#xe179;" d="M862 1073l276 116q25 18 43.5 8t18.5 -41v-1106q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v397q-4 1 -11 5t-24 17.5t-30 29t-24 42t-11 56.5v359q0 31 18.5 65t43.5 52zM550 1200q22 0 34.5 -12.5t14.5 -24.5l1 -13v-450q0 -28 -10.5 -59.5 t-25 -56t-29 -45t-25.5 -31.5l-10 -11v-447q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v447q-4 4 -11 11.5t-24 30.5t-30 46t-24 55t-11 60v450q0 2 0.5 5.5t4 12t8.5 15t14.5 12t22.5 5.5q20 0 32.5 -12.5t14.5 -24.5l3 -13v-350h100v350v5.5t2.5 12 t7 15t15 12t25.5 5.5q23 0 35.5 -12.5t13.5 -24.5l1 -13v-350h100v350q0 2 0.5 5.5t3 12t7 15t15 12t24.5 5.5z" />
<glyph unicode="&#xe180;" d="M1200 1100v-56q-4 0 -11 -0.5t-24 -3t-30 -7.5t-24 -15t-11 -24v-888q0 -22 25 -34.5t50 -13.5l25 -2v-56h-400v56q75 0 87.5 6.5t12.5 43.5v394h-500v-394q0 -37 12.5 -43.5t87.5 -6.5v-56h-400v56q4 0 11 0.5t24 3t30 7.5t24 15t11 24v888q0 22 -25 34.5t-50 13.5 l-25 2v56h400v-56q-75 0 -87.5 -6.5t-12.5 -43.5v-394h500v394q0 37 -12.5 43.5t-87.5 6.5v56h400z" />
<glyph unicode="&#xe181;" d="M675 1000h375q21 0 35.5 -14.5t14.5 -35.5v-150h-105l-295 -98v98l-200 200h-400l100 100h375zM100 900h300q41 0 70.5 -29.5t29.5 -70.5v-500q0 -41 -29.5 -70.5t-70.5 -29.5h-300q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5zM100 800v-200h300v200 h-300zM1100 535l-400 -133v163l400 133v-163zM100 500v-200h300v200h-300zM1100 398v-248q0 -21 -14.5 -35.5t-35.5 -14.5h-375l-100 -100h-375l-100 100h400l200 200h105z" />
<glyph unicode="&#xe182;" d="M17 1007l162 162q17 17 40 14t37 -22l139 -194q14 -20 11 -44.5t-20 -41.5l-119 -118q102 -142 228 -268t267 -227l119 118q17 17 42.5 19t44.5 -12l192 -136q19 -14 22.5 -37.5t-13.5 -40.5l-163 -162q-3 -1 -9.5 -1t-29.5 2t-47.5 6t-62.5 14.5t-77.5 26.5t-90 42.5 t-101.5 60t-111 83t-119 108.5q-74 74 -133.5 150.5t-94.5 138.5t-60 119.5t-34.5 100t-15 74.5t-4.5 48z" />
<glyph unicode="&#xe183;" d="M600 1100q92 0 175 -10.5t141.5 -27t108.5 -36.5t81.5 -40t53.5 -37t31 -27l9 -10v-200q0 -21 -14.5 -33t-34.5 -9l-202 34q-20 3 -34.5 20t-14.5 38v146q-141 24 -300 24t-300 -24v-146q0 -21 -14.5 -38t-34.5 -20l-202 -34q-20 -3 -34.5 9t-14.5 33v200q3 4 9.5 10.5 t31 26t54 37.5t80.5 39.5t109 37.5t141 26.5t175 10.5zM600 795q56 0 97 -9.5t60 -23.5t30 -28t12 -24l1 -10v-50l365 -303q14 -15 24.5 -40t10.5 -45v-212q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v212q0 20 10.5 45t24.5 40l365 303v50 q0 4 1 10.5t12 23t30 29t60 22.5t97 10z" />
<glyph unicode="&#xe184;" d="M1100 700l-200 -200h-600l-200 200v500h200v-200h200v200h200v-200h200v200h200v-500zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-12l137 -100h-950l137 100h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5 t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe185;" d="M700 1100h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-1000h300v1000q0 41 -29.5 70.5t-70.5 29.5zM1100 800h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-700h300v700q0 41 -29.5 70.5t-70.5 29.5zM400 0h-300v400q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-400z " />
<glyph unicode="&#xe186;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 700h-200v-100h200v-300h-300v100h200v100h-200v300h300v-100zM900 700v-300l-100 -100h-200v500h200z M700 700v-300h100v300h-100z" />
<glyph unicode="&#xe187;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 300h-100v200h-100v-200h-100v500h100v-200h100v200h100v-500zM900 700v-300l-100 -100h-200v500h200z M700 700v-300h100v300h-100z" />
<glyph unicode="&#xe188;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 700h-200v-300h200v-100h-300v500h300v-100zM900 700h-200v-300h200v-100h-300v500h300v-100z" />
<glyph unicode="&#xe189;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 400l-300 150l300 150v-300zM900 550l-300 -150v300z" />
<glyph unicode="&#xe190;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM900 300h-700v500h700v-500zM800 700h-130q-38 0 -66.5 -43t-28.5 -108t27 -107t68 -42h130v300zM300 700v-300 h130q41 0 68 42t27 107t-28.5 108t-66.5 43h-130z" />
<glyph unicode="&#xe191;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 700h-200v-100h200v-300h-300v100h200v100h-200v300h300v-100zM900 300h-100v400h-100v100h200v-500z M700 300h-100v100h100v-100z" />
<glyph unicode="&#xe192;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM300 700h200v-400h-300v500h100v-100zM900 300h-100v400h-100v100h200v-500zM300 600v-200h100v200h-100z M700 300h-100v100h100v-100z" />
<glyph unicode="&#xe193;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 500l-199 -200h-100v50l199 200v150h-200v100h300v-300zM900 300h-100v400h-100v100h200v-500zM701 300h-100 v100h100v-100z" />
<glyph unicode="&#xe194;" d="M600 1191q120 0 229.5 -47t188.5 -126t126 -188.5t47 -229.5t-47 -229.5t-126 -188.5t-188.5 -126t-229.5 -47t-229.5 47t-188.5 126t-126 188.5t-47 229.5t47 229.5t126 188.5t188.5 126t229.5 47zM600 1021q-114 0 -211 -56.5t-153.5 -153.5t-56.5 -211t56.5 -211 t153.5 -153.5t211 -56.5t211 56.5t153.5 153.5t56.5 211t-56.5 211t-153.5 153.5t-211 56.5zM800 700h-300v-200h300v-100h-300l-100 100v200l100 100h300v-100z" />
<glyph unicode="&#xe195;" d="M600 1191q120 0 229.5 -47t188.5 -126t126 -188.5t47 -229.5t-47 -229.5t-126 -188.5t-188.5 -126t-229.5 -47t-229.5 47t-188.5 126t-126 188.5t-47 229.5t47 229.5t126 188.5t188.5 126t229.5 47zM600 1021q-114 0 -211 -56.5t-153.5 -153.5t-56.5 -211t56.5 -211 t153.5 -153.5t211 -56.5t211 56.5t153.5 153.5t56.5 211t-56.5 211t-153.5 153.5t-211 56.5zM800 700v-100l-50 -50l100 -100v-50h-100l-100 100h-150v-100h-100v400h300zM500 700v-100h200v100h-200z" />
<glyph unicode="&#xe197;" d="M503 1089q110 0 200.5 -59.5t134.5 -156.5q44 14 90 14q120 0 205 -86.5t85 -207t-85 -207t-205 -86.5h-128v250q0 21 -14.5 35.5t-35.5 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-250h-222q-80 0 -136 57.5t-56 136.5q0 69 43 122.5t108 67.5q-2 19 -2 37q0 100 49 185 t134 134t185 49zM525 500h150q10 0 17.5 -7.5t7.5 -17.5v-275h137q21 0 26 -11.5t-8 -27.5l-223 -244q-13 -16 -32 -16t-32 16l-223 244q-13 16 -8 27.5t26 11.5h137v275q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe198;" d="M502 1089q110 0 201 -59.5t135 -156.5q43 15 89 15q121 0 206 -86.5t86 -206.5q0 -99 -60 -181t-150 -110l-378 360q-13 16 -31.5 16t-31.5 -16l-381 -365h-9q-79 0 -135.5 57.5t-56.5 136.5q0 69 43 122.5t108 67.5q-2 19 -2 38q0 100 49 184.5t133.5 134t184.5 49.5z M632 467l223 -228q13 -16 8 -27.5t-26 -11.5h-137v-275q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v275h-137q-21 0 -26 11.5t8 27.5q199 204 223 228q19 19 31.5 19t32.5 -19z" />
<glyph unicode="&#xe199;" d="M700 100v100h400l-270 300h170l-270 300h170l-300 333l-300 -333h170l-270 -300h170l-270 -300h400v-100h-50q-21 0 -35.5 -14.5t-14.5 -35.5v-50h400v50q0 21 -14.5 35.5t-35.5 14.5h-50z" />
<glyph unicode="&#xe200;" d="M600 1179q94 0 167.5 -56.5t99.5 -145.5q89 -6 150.5 -71.5t61.5 -155.5q0 -61 -29.5 -112.5t-79.5 -82.5q9 -29 9 -55q0 -74 -52.5 -126.5t-126.5 -52.5q-55 0 -100 30v-251q21 0 35.5 -14.5t14.5 -35.5v-50h-300v50q0 21 14.5 35.5t35.5 14.5v251q-45 -30 -100 -30 q-74 0 -126.5 52.5t-52.5 126.5q0 18 4 38q-47 21 -75.5 65t-28.5 97q0 74 52.5 126.5t126.5 52.5q5 0 23 -2q0 2 -1 10t-1 13q0 116 81.5 197.5t197.5 81.5z" />
<glyph unicode="&#xe201;" d="M1010 1010q111 -111 150.5 -260.5t0 -299t-150.5 -260.5q-83 -83 -191.5 -126.5t-218.5 -43.5t-218.5 43.5t-191.5 126.5q-111 111 -150.5 260.5t0 299t150.5 260.5q83 83 191.5 126.5t218.5 43.5t218.5 -43.5t191.5 -126.5zM476 1065q-4 0 -8 -1q-121 -34 -209.5 -122.5 t-122.5 -209.5q-4 -12 2.5 -23t18.5 -14l36 -9q3 -1 7 -1q23 0 29 22q27 96 98 166q70 71 166 98q11 3 17.5 13.5t3.5 22.5l-9 35q-3 13 -14 19q-7 4 -15 4zM512 920q-4 0 -9 -2q-80 -24 -138.5 -82.5t-82.5 -138.5q-4 -13 2 -24t19 -14l34 -9q4 -1 8 -1q22 0 28 21 q18 58 58.5 98.5t97.5 58.5q12 3 18 13.5t3 21.5l-9 35q-3 12 -14 19q-7 4 -15 4zM719.5 719.5q-49.5 49.5 -119.5 49.5t-119.5 -49.5t-49.5 -119.5t49.5 -119.5t119.5 -49.5t119.5 49.5t49.5 119.5t-49.5 119.5zM855 551q-22 0 -28 -21q-18 -58 -58.5 -98.5t-98.5 -57.5 q-11 -4 -17 -14.5t-3 -21.5l9 -35q3 -12 14 -19q7 -4 15 -4q4 0 9 2q80 24 138.5 82.5t82.5 138.5q4 13 -2.5 24t-18.5 14l-34 9q-4 1 -8 1zM1000 515q-23 0 -29 -22q-27 -96 -98 -166q-70 -71 -166 -98q-11 -3 -17.5 -13.5t-3.5 -22.5l9 -35q3 -13 14 -19q7 -4 15 -4 q4 0 8 1q121 34 209.5 122.5t122.5 209.5q4 12 -2.5 23t-18.5 14l-36 9q-3 1 -7 1z" />
<glyph unicode="&#xe202;" d="M700 800h300v-380h-180v200h-340v-200h-380v755q0 10 7.5 17.5t17.5 7.5h575v-400zM1000 900h-200v200zM700 300h162l-212 -212l-212 212h162v200h100v-200zM520 0h-395q-10 0 -17.5 7.5t-7.5 17.5v395zM1000 220v-195q0 -10 -7.5 -17.5t-17.5 -7.5h-195z" />
<glyph unicode="&#xe203;" d="M700 800h300v-520l-350 350l-550 -550v1095q0 10 7.5 17.5t17.5 7.5h575v-400zM1000 900h-200v200zM862 200h-162v-200h-100v200h-162l212 212zM480 0h-355q-10 0 -17.5 7.5t-7.5 17.5v55h380v-80zM1000 80v-55q0 -10 -7.5 -17.5t-17.5 -7.5h-155v80h180z" />
<glyph unicode="&#xe204;" d="M1162 800h-162v-200h100l100 -100h-300v300h-162l212 212zM200 800h200q27 0 40 -2t29.5 -10.5t23.5 -30t7 -57.5h300v-100h-600l-200 -350v450h100q0 36 7 57.5t23.5 30t29.5 10.5t40 2zM800 400h240l-240 -400h-800l300 500h500v-100z" />
<glyph unicode="&#xe205;" d="M650 1100h100q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h50v50q0 21 14.5 35.5t35.5 14.5zM1000 850v150q41 0 70.5 -29.5t29.5 -70.5v-800 q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-1 0 -20 4l246 246l-326 326v324q0 41 29.5 70.5t70.5 29.5v-150q0 -62 44 -106t106 -44h300q62 0 106 44t44 106zM412 250l-212 -212v162h-200v100h200v162z" />
<glyph unicode="&#xe206;" d="M450 1100h100q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h50v50q0 21 14.5 35.5t35.5 14.5zM800 850v150q41 0 70.5 -29.5t29.5 -70.5v-500 h-200v-300h200q0 -36 -7 -57.5t-23.5 -30t-29.5 -10.5t-40 -2h-600q-41 0 -70.5 29.5t-29.5 70.5v800q0 41 29.5 70.5t70.5 29.5v-150q0 -62 44 -106t106 -44h300q62 0 106 44t44 106zM1212 250l-212 -212v162h-200v100h200v162z" />
<glyph unicode="&#xe209;" d="M658 1197l637 -1104q23 -38 7 -65.5t-60 -27.5h-1276q-44 0 -60 27.5t7 65.5l637 1104q22 39 54 39t54 -39zM704 800h-208q-20 0 -32 -14.5t-8 -34.5l58 -302q4 -20 21.5 -34.5t37.5 -14.5h54q20 0 37.5 14.5t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5zM500 300v-100h200 v100h-200z" />
<glyph unicode="&#xe210;" d="M425 1100h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM425 800h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5 t17.5 7.5zM825 800h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM25 500h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150 q0 10 7.5 17.5t17.5 7.5zM425 500h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM825 500h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5 v150q0 10 7.5 17.5t17.5 7.5zM25 200h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM425 200h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5 t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM825 200h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe211;" d="M700 1200h100v-200h-100v-100h350q62 0 86.5 -39.5t-3.5 -94.5l-66 -132q-41 -83 -81 -134h-772q-40 51 -81 134l-66 132q-28 55 -3.5 94.5t86.5 39.5h350v100h-100v200h100v100h200v-100zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-12l137 -100 h-950l138 100h-13q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe212;" d="M600 1300q40 0 68.5 -29.5t28.5 -70.5h-194q0 41 28.5 70.5t68.5 29.5zM443 1100h314q18 -37 18 -75q0 -8 -3 -25h328q41 0 44.5 -16.5t-30.5 -38.5l-175 -145h-678l-178 145q-34 22 -29 38.5t46 16.5h328q-3 17 -3 25q0 38 18 75zM250 700h700q21 0 35.5 -14.5 t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-150v-200l275 -200h-950l275 200v200h-150q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe213;" d="M600 1181q75 0 128 -53t53 -128t-53 -128t-128 -53t-128 53t-53 128t53 128t128 53zM602 798h46q34 0 55.5 -28.5t21.5 -86.5q0 -76 39 -183h-324q39 107 39 183q0 58 21.5 86.5t56.5 28.5h45zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-13 l138 -100h-950l137 100h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe214;" d="M600 1300q47 0 92.5 -53.5t71 -123t25.5 -123.5q0 -78 -55.5 -133.5t-133.5 -55.5t-133.5 55.5t-55.5 133.5q0 62 34 143l144 -143l111 111l-163 163q34 26 63 26zM602 798h46q34 0 55.5 -28.5t21.5 -86.5q0 -76 39 -183h-324q39 107 39 183q0 58 21.5 86.5t56.5 28.5h45 zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-13l138 -100h-950l137 100h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe215;" d="M600 1200l300 -161v-139h-300q0 -57 18.5 -108t50 -91.5t63 -72t70 -67.5t57.5 -61h-530q-60 83 -90.5 177.5t-30.5 178.5t33 164.5t87.5 139.5t126 96.5t145.5 41.5v-98zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-13l138 -100h-950l137 100 h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe216;" d="M600 1300q41 0 70.5 -29.5t29.5 -70.5v-78q46 -26 73 -72t27 -100v-50h-400v50q0 54 27 100t73 72v78q0 41 29.5 70.5t70.5 29.5zM400 800h400q54 0 100 -27t72 -73h-172v-100h200v-100h-200v-100h200v-100h-200v-100h200q0 -83 -58.5 -141.5t-141.5 -58.5h-400 q-83 0 -141.5 58.5t-58.5 141.5v400q0 83 58.5 141.5t141.5 58.5z" />
<glyph unicode="&#xe218;" d="M150 1100h900q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v500q0 21 14.5 35.5t35.5 14.5zM125 400h950q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-283l224 -224q13 -13 13 -31.5t-13 -32 t-31.5 -13.5t-31.5 13l-88 88h-524l-87 -88q-13 -13 -32 -13t-32 13.5t-13 32t13 31.5l224 224h-289q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM541 300l-100 -100h324l-100 100h-124z" />
<glyph unicode="&#xe219;" d="M200 1100h800q83 0 141.5 -58.5t58.5 -141.5v-200h-100q0 41 -29.5 70.5t-70.5 29.5h-250q-41 0 -70.5 -29.5t-29.5 -70.5h-100q0 41 -29.5 70.5t-70.5 29.5h-250q-41 0 -70.5 -29.5t-29.5 -70.5h-100v200q0 83 58.5 141.5t141.5 58.5zM100 600h1000q41 0 70.5 -29.5 t29.5 -70.5v-300h-1200v300q0 41 29.5 70.5t70.5 29.5zM300 100v-50q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v50h200zM1100 100v-50q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v50h200z" />
<glyph unicode="&#xe221;" d="M480 1165l682 -683q31 -31 31 -75.5t-31 -75.5l-131 -131h-481l-517 518q-32 31 -32 75.5t32 75.5l295 296q31 31 75.5 31t76.5 -31zM108 794l342 -342l303 304l-341 341zM250 100h800q21 0 35.5 -14.5t14.5 -35.5v-50h-900v50q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe223;" d="M1057 647l-189 506q-8 19 -27.5 33t-40.5 14h-400q-21 0 -40.5 -14t-27.5 -33l-189 -506q-8 -19 1.5 -33t30.5 -14h625v-150q0 -21 14.5 -35.5t35.5 -14.5t35.5 14.5t14.5 35.5v150h125q21 0 30.5 14t1.5 33zM897 0h-595v50q0 21 14.5 35.5t35.5 14.5h50v50 q0 21 14.5 35.5t35.5 14.5h48v300h200v-300h47q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-50z" />
<glyph unicode="&#xe224;" d="M900 800h300v-575q0 -10 -7.5 -17.5t-17.5 -7.5h-375v591l-300 300v84q0 10 7.5 17.5t17.5 7.5h375v-400zM1200 900h-200v200zM400 600h300v-575q0 -10 -7.5 -17.5t-17.5 -7.5h-650q-10 0 -17.5 7.5t-7.5 17.5v950q0 10 7.5 17.5t17.5 7.5h375v-400zM700 700h-200v200z " />
<glyph unicode="&#xe225;" d="M484 1095h195q75 0 146 -32.5t124 -86t89.5 -122.5t48.5 -142q18 -14 35 -20q31 -10 64.5 6.5t43.5 48.5q10 34 -15 71q-19 27 -9 43q5 8 12.5 11t19 -1t23.5 -16q41 -44 39 -105q-3 -63 -46 -106.5t-104 -43.5h-62q-7 -55 -35 -117t-56 -100l-39 -234q-3 -20 -20 -34.5 t-38 -14.5h-100q-21 0 -33 14.5t-9 34.5l12 70q-49 -14 -91 -14h-195q-24 0 -65 8l-11 -64q-3 -20 -20 -34.5t-38 -14.5h-100q-21 0 -33 14.5t-9 34.5l26 157q-84 74 -128 175l-159 53q-19 7 -33 26t-14 40v50q0 21 14.5 35.5t35.5 14.5h124q11 87 56 166l-111 95 q-16 14 -12.5 23.5t24.5 9.5h203q116 101 250 101zM675 1000h-250q-10 0 -17.5 -7.5t-7.5 -17.5v-50q0 -10 7.5 -17.5t17.5 -7.5h250q10 0 17.5 7.5t7.5 17.5v50q0 10 -7.5 17.5t-17.5 7.5z" />
<glyph unicode="&#xe226;" d="M641 900l423 247q19 8 42 2.5t37 -21.5l32 -38q14 -15 12.5 -36t-17.5 -34l-139 -120h-390zM50 1100h106q67 0 103 -17t66 -71l102 -212h823q21 0 35.5 -14.5t14.5 -35.5v-50q0 -21 -14 -40t-33 -26l-737 -132q-23 -4 -40 6t-26 25q-42 67 -100 67h-300q-62 0 -106 44 t-44 106v200q0 62 44 106t106 44zM173 928h-80q-19 0 -28 -14t-9 -35v-56q0 -51 42 -51h134q16 0 21.5 8t5.5 24q0 11 -16 45t-27 51q-18 28 -43 28zM550 727q-32 0 -54.5 -22.5t-22.5 -54.5t22.5 -54.5t54.5 -22.5t54.5 22.5t22.5 54.5t-22.5 54.5t-54.5 22.5zM130 389 l152 130q18 19 34 24t31 -3.5t24.5 -17.5t25.5 -28q28 -35 50.5 -51t48.5 -13l63 5l48 -179q13 -61 -3.5 -97.5t-67.5 -79.5l-80 -69q-47 -40 -109 -35.5t-103 51.5l-130 151q-40 47 -35.5 109.5t51.5 102.5zM380 377l-102 -88q-31 -27 2 -65l37 -43q13 -15 27.5 -19.5 t31.5 6.5l61 53q19 16 14 49q-2 20 -12 56t-17 45q-11 12 -19 14t-23 -8z" />
<glyph unicode="&#xe227;" d="M625 1200h150q10 0 17.5 -7.5t7.5 -17.5v-109q79 -33 131 -87.5t53 -128.5q1 -46 -15 -84.5t-39 -61t-46 -38t-39 -21.5l-17 -6q6 0 15 -1.5t35 -9t50 -17.5t53 -30t50 -45t35.5 -64t14.5 -84q0 -59 -11.5 -105.5t-28.5 -76.5t-44 -51t-49.5 -31.5t-54.5 -16t-49.5 -6.5 t-43.5 -1v-75q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v75h-100v-75q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v75h-175q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h75v600h-75q-10 0 -17.5 7.5t-7.5 17.5v150 q0 10 7.5 17.5t17.5 7.5h175v75q0 10 7.5 17.5t17.5 7.5h150q10 0 17.5 -7.5t7.5 -17.5v-75h100v75q0 10 7.5 17.5t17.5 7.5zM400 900v-200h263q28 0 48.5 10.5t30 25t15 29t5.5 25.5l1 10q0 4 -0.5 11t-6 24t-15 30t-30 24t-48.5 11h-263zM400 500v-200h363q28 0 48.5 10.5 t30 25t15 29t5.5 25.5l1 10q0 4 -0.5 11t-6 24t-15 30t-30 24t-48.5 11h-363z" />
<glyph unicode="&#xe230;" d="M212 1198h780q86 0 147 -61t61 -147v-416q0 -51 -18 -142.5t-36 -157.5l-18 -66q-29 -87 -93.5 -146.5t-146.5 -59.5h-572q-82 0 -147 59t-93 147q-8 28 -20 73t-32 143.5t-20 149.5v416q0 86 61 147t147 61zM600 1045q-70 0 -132.5 -11.5t-105.5 -30.5t-78.5 -41.5 t-57 -45t-36 -41t-20.5 -30.5l-6 -12l156 -243h560l156 243q-2 5 -6 12.5t-20 29.5t-36.5 42t-57 44.5t-79 42t-105 29.5t-132.5 12zM762 703h-157l195 261z" />
<glyph unicode="&#xe231;" d="M475 1300h150q103 0 189 -86t86 -189v-500q0 -41 -42 -83t-83 -42h-450q-41 0 -83 42t-42 83v500q0 103 86 189t189 86zM700 300v-225q0 -21 -27 -48t-48 -27h-150q-21 0 -48 27t-27 48v225h300z" />
<glyph unicode="&#xe232;" d="M475 1300h96q0 -150 89.5 -239.5t239.5 -89.5v-446q0 -41 -42 -83t-83 -42h-450q-41 0 -83 42t-42 83v500q0 103 86 189t189 86zM700 300v-225q0 -21 -27 -48t-48 -27h-150q-21 0 -48 27t-27 48v225h300z" />
<glyph unicode="&#xe233;" d="M1294 767l-638 -283l-378 170l-78 -60v-224l100 -150v-199l-150 148l-150 -149v200l100 150v250q0 4 -0.5 10.5t0 9.5t1 8t3 8t6.5 6l47 40l-147 65l642 283zM1000 380l-350 -166l-350 166v147l350 -165l350 165v-147z" />
<glyph unicode="&#xe234;" d="M250 800q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM650 800q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM1050 800q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44z" />
<glyph unicode="&#xe235;" d="M550 1100q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM550 700q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM550 300q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44z" />
<glyph unicode="&#xe236;" d="M125 1100h950q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-950q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM125 700h950q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-950q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5 t17.5 7.5zM125 300h950q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-950q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5z" />
<glyph unicode="&#xe237;" d="M350 1200h500q162 0 256 -93.5t94 -256.5v-500q0 -165 -93.5 -257.5t-256.5 -92.5h-500q-165 0 -257.5 92.5t-92.5 257.5v500q0 165 92.5 257.5t257.5 92.5zM900 1000h-600q-41 0 -70.5 -29.5t-29.5 -70.5v-600q0 -41 29.5 -70.5t70.5 -29.5h600q41 0 70.5 29.5 t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5zM350 900h500q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -14.5 -35.5t-35.5 -14.5h-500q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 14.5 35.5t35.5 14.5zM400 800v-200h400v200h-400z" />
<glyph unicode="&#xe238;" d="M150 1100h1000q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-200h50q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-200h50q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-200h50q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5 t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5h50v200h-50q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5h50v200h-50q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5h50v200h-50q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe239;" d="M650 1187q87 -67 118.5 -156t0 -178t-118.5 -155q-87 66 -118.5 155t0 178t118.5 156zM300 800q124 0 212 -88t88 -212q-124 0 -212 88t-88 212zM1000 800q0 -124 -88 -212t-212 -88q0 124 88 212t212 88zM300 500q124 0 212 -88t88 -212q-124 0 -212 88t-88 212z M1000 500q0 -124 -88 -212t-212 -88q0 124 88 212t212 88zM700 199v-144q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v142q40 -4 43 -4q17 0 57 6z" />
<glyph unicode="&#xe240;" d="M745 878l69 19q25 6 45 -12l298 -295q11 -11 15 -26.5t-2 -30.5q-5 -14 -18 -23.5t-28 -9.5h-8q1 0 1 -13q0 -29 -2 -56t-8.5 -62t-20 -63t-33 -53t-51 -39t-72.5 -14h-146q-184 0 -184 288q0 24 10 47q-20 4 -62 4t-63 -4q11 -24 11 -47q0 -288 -184 -288h-142 q-48 0 -84.5 21t-56 51t-32 71.5t-16 75t-3.5 68.5q0 13 2 13h-7q-15 0 -27.5 9.5t-18.5 23.5q-6 15 -2 30.5t15 25.5l298 296q20 18 46 11l76 -19q20 -5 30.5 -22.5t5.5 -37.5t-22.5 -31t-37.5 -5l-51 12l-182 -193h891l-182 193l-44 -12q-20 -5 -37.5 6t-22.5 31t6 37.5 t31 22.5z" />
<glyph unicode="&#xe241;" d="M1200 900h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-200v-850q0 -22 25 -34.5t50 -13.5l25 -2v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v850h-200q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h1000v-300zM500 450h-25q0 15 -4 24.5t-9 14.5t-17 7.5t-20 3t-25 0.5h-100v-425q0 -11 12.5 -17.5t25.5 -7.5h12v-50h-200v50q50 0 50 25v425h-100q-17 0 -25 -0.5t-20 -3t-17 -7.5t-9 -14.5t-4 -24.5h-25v150h500v-150z" />
<glyph unicode="&#xe242;" d="M1000 300v50q-25 0 -55 32q-14 14 -25 31t-16 27l-4 11l-289 747h-69l-300 -754q-18 -35 -39 -56q-9 -9 -24.5 -18.5t-26.5 -14.5l-11 -5v-50h273v50q-49 0 -78.5 21.5t-11.5 67.5l69 176h293l61 -166q13 -34 -3.5 -66.5t-55.5 -32.5v-50h312zM412 691l134 342l121 -342 h-255zM1100 150v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5z" />
<glyph unicode="&#xe243;" d="M50 1200h1100q21 0 35.5 -14.5t14.5 -35.5v-1100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v1100q0 21 14.5 35.5t35.5 14.5zM611 1118h-70q-13 0 -18 -12l-299 -753q-17 -32 -35 -51q-18 -18 -56 -34q-12 -5 -12 -18v-50q0 -8 5.5 -14t14.5 -6 h273q8 0 14 6t6 14v50q0 8 -6 14t-14 6q-55 0 -71 23q-10 14 0 39l63 163h266l57 -153q11 -31 -6 -55q-12 -17 -36 -17q-8 0 -14 -6t-6 -14v-50q0 -8 6 -14t14 -6h313q8 0 14 6t6 14v50q0 7 -5.5 13t-13.5 7q-17 0 -42 25q-25 27 -40 63h-1l-288 748q-5 12 -19 12zM639 611 h-197l103 264z" />
<glyph unicode="&#xe244;" d="M1200 1100h-1200v100h1200v-100zM50 1000h400q21 0 35.5 -14.5t14.5 -35.5v-900q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v900q0 21 14.5 35.5t35.5 14.5zM650 1000h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM700 900v-300h300v300h-300z" />
<glyph unicode="&#xe245;" d="M50 1200h400q21 0 35.5 -14.5t14.5 -35.5v-900q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v900q0 21 14.5 35.5t35.5 14.5zM650 700h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400 q0 21 14.5 35.5t35.5 14.5zM700 600v-300h300v300h-300zM1200 0h-1200v100h1200v-100z" />
<glyph unicode="&#xe246;" d="M50 1000h400q21 0 35.5 -14.5t14.5 -35.5v-350h100v150q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-150h100v-100h-100v-150q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v150h-100v-350q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5v800q0 21 14.5 35.5t35.5 14.5zM700 700v-300h300v300h-300z" />
<glyph unicode="&#xe247;" d="M100 0h-100v1200h100v-1200zM250 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM300 1000v-300h300v300h-300zM250 500h900q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe248;" d="M600 1100h150q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-150v-100h450q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5h350v100h-150q-21 0 -35.5 14.5 t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5h150v100h100v-100zM400 1000v-300h300v300h-300z" />
<glyph unicode="&#xe249;" d="M1200 0h-100v1200h100v-1200zM550 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM600 1000v-300h300v300h-300zM50 500h900q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5z" />
<glyph unicode="&#xe250;" d="M865 565l-494 -494q-23 -23 -41 -23q-14 0 -22 13.5t-8 38.5v1000q0 25 8 38.5t22 13.5q18 0 41 -23l494 -494q14 -14 14 -35t-14 -35z" />
<glyph unicode="&#xe251;" d="M335 635l494 494q29 29 50 20.5t21 -49.5v-1000q0 -41 -21 -49.5t-50 20.5l-494 494q-14 14 -14 35t14 35z" />
<glyph unicode="&#xe252;" d="M100 900h1000q41 0 49.5 -21t-20.5 -50l-494 -494q-14 -14 -35 -14t-35 14l-494 494q-29 29 -20.5 50t49.5 21z" />
<glyph unicode="&#xe253;" d="M635 865l494 -494q29 -29 20.5 -50t-49.5 -21h-1000q-41 0 -49.5 21t20.5 50l494 494q14 14 35 14t35 -14z" />
<glyph unicode="&#xe254;" d="M700 741v-182l-692 -323v221l413 193l-413 193v221zM1200 0h-800v200h800v-200z" />
<glyph unicode="&#xe255;" d="M1200 900h-200v-100h200v-100h-300v300h200v100h-200v100h300v-300zM0 700h50q0 21 4 37t9.5 26.5t18 17.5t22 11t28.5 5.5t31 2t37 0.5h100v-550q0 -22 -25 -34.5t-50 -13.5l-25 -2v-100h400v100q-4 0 -11 0.5t-24 3t-30 7t-24 15t-11 24.5v550h100q25 0 37 -0.5t31 -2 t28.5 -5.5t22 -11t18 -17.5t9.5 -26.5t4 -37h50v300h-800v-300z" />
<glyph unicode="&#xe256;" d="M800 700h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-100v-550q0 -22 25 -34.5t50 -14.5l25 -1v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v550h-100q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h800v-300zM1100 200h-200v-100h200v-100h-300v300h200v100h-200v100h300v-300z" />
<glyph unicode="&#xe257;" d="M701 1098h160q16 0 21 -11t-7 -23l-464 -464l464 -464q12 -12 7 -23t-21 -11h-160q-13 0 -23 9l-471 471q-7 8 -7 18t7 18l471 471q10 9 23 9z" />
<glyph unicode="&#xe258;" d="M339 1098h160q13 0 23 -9l471 -471q7 -8 7 -18t-7 -18l-471 -471q-10 -9 -23 -9h-160q-16 0 -21 11t7 23l464 464l-464 464q-12 12 -7 23t21 11z" />
<glyph unicode="&#xe259;" d="M1087 882q11 -5 11 -21v-160q0 -13 -9 -23l-471 -471q-8 -7 -18 -7t-18 7l-471 471q-9 10 -9 23v160q0 16 11 21t23 -7l464 -464l464 464q12 12 23 7z" />
<glyph unicode="&#xe260;" d="M618 993l471 -471q9 -10 9 -23v-160q0 -16 -11 -21t-23 7l-464 464l-464 -464q-12 -12 -23 -7t-11 21v160q0 13 9 23l471 471q8 7 18 7t18 -7z" />
<glyph unicode="&#xf8ff;" d="M1000 1200q0 -124 -88 -212t-212 -88q0 124 88 212t212 88zM450 1000h100q21 0 40 -14t26 -33l79 -194q5 1 16 3q34 6 54 9.5t60 7t65.5 1t61 -10t56.5 -23t42.5 -42t29 -64t5 -92t-19.5 -121.5q-1 -7 -3 -19.5t-11 -50t-20.5 -73t-32.5 -81.5t-46.5 -83t-64 -70 t-82.5 -50q-13 -5 -42 -5t-65.5 2.5t-47.5 2.5q-14 0 -49.5 -3.5t-63 -3.5t-43.5 7q-57 25 -104.5 78.5t-75 111.5t-46.5 112t-26 90l-7 35q-15 63 -18 115t4.5 88.5t26 64t39.5 43.5t52 25.5t58.5 13t62.5 2t59.5 -4.5t55.5 -8l-147 192q-12 18 -5.5 30t27.5 12z" />
<glyph unicode="&#x1f511;" d="M250 1200h600q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-150v-500l-255 -178q-19 -9 -32 -1t-13 29v650h-150q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM400 1100v-100h300v100h-300z" />
<glyph unicode="&#x1f6aa;" d="M250 1200h750q39 0 69.5 -40.5t30.5 -84.5v-933l-700 -117v950l600 125h-700v-1000h-100v1025q0 23 15.5 49t34.5 26zM500 525v-100l100 20v100z" />
</font>
</defs></svg>

After

Width:  |  Height:  |  Size: 106 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 6.8 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 6.9 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 4.6 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 6.8 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 4.5 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 6.2 KiB

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View File

@ -1,573 +0,0 @@
/*
* jQuery UI CSS Framework 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Theming/API
*/
/* Layout helpers
----------------------------------*/
.ui-helper-hidden { display: none; }
.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
.ui-helper-clearfix { display: inline-block; }
/* required comment for clearfix to work in Opera \*/
* html .ui-helper-clearfix { height:1%; }
.ui-helper-clearfix { display:block; }
/* end clearfix */
.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
/* Interaction Cues
----------------------------------*/
.ui-state-disabled { cursor: default !important; }
/* Icons
----------------------------------*/
/* states and images */
.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
/* Misc visuals
----------------------------------*/
/* Overlays */
.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
/*
* jQuery UI CSS Framework 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Theming/API
*
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
*/
/* Component containers
----------------------------------*/
.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
.ui-widget .ui-widget { font-size: 1em; }
.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
.ui-widget-content a { color: #222222; }
.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
.ui-widget-header a { color: #222222; }
/* Interaction states
----------------------------------*/
.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
.ui-widget :active { outline: none; }
/* Interaction Cues
----------------------------------*/
.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
/* Icons
----------------------------------*/
/* states and images */
.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
/* positioning */
.ui-icon-carat-1-n { background-position: 0 0; }
.ui-icon-carat-1-ne { background-position: -16px 0; }
.ui-icon-carat-1-e { background-position: -32px 0; }
.ui-icon-carat-1-se { background-position: -48px 0; }
.ui-icon-carat-1-s { background-position: -64px 0; }
.ui-icon-carat-1-sw { background-position: -80px 0; }
.ui-icon-carat-1-w { background-position: -96px 0; }
.ui-icon-carat-1-nw { background-position: -112px 0; }
.ui-icon-carat-2-n-s { background-position: -128px 0; }
.ui-icon-carat-2-e-w { background-position: -144px 0; }
.ui-icon-triangle-1-n { background-position: 0 -16px; }
.ui-icon-triangle-1-ne { background-position: -16px -16px; }
.ui-icon-triangle-1-e { background-position: -32px -16px; }
.ui-icon-triangle-1-se { background-position: -48px -16px; }
.ui-icon-triangle-1-s { background-position: -64px -16px; }
.ui-icon-triangle-1-sw { background-position: -80px -16px; }
.ui-icon-triangle-1-w { background-position: -96px -16px; }
.ui-icon-triangle-1-nw { background-position: -112px -16px; }
.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
.ui-icon-arrow-1-n { background-position: 0 -32px; }
.ui-icon-arrow-1-ne { background-position: -16px -32px; }
.ui-icon-arrow-1-e { background-position: -32px -32px; }
.ui-icon-arrow-1-se { background-position: -48px -32px; }
.ui-icon-arrow-1-s { background-position: -64px -32px; }
.ui-icon-arrow-1-sw { background-position: -80px -32px; }
.ui-icon-arrow-1-w { background-position: -96px -32px; }
.ui-icon-arrow-1-nw { background-position: -112px -32px; }
.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
.ui-icon-arrow-4 { background-position: 0 -80px; }
.ui-icon-arrow-4-diag { background-position: -16px -80px; }
.ui-icon-extlink { background-position: -32px -80px; }
.ui-icon-newwin { background-position: -48px -80px; }
.ui-icon-refresh { background-position: -64px -80px; }
.ui-icon-shuffle { background-position: -80px -80px; }
.ui-icon-transfer-e-w { background-position: -96px -80px; }
.ui-icon-transferthick-e-w { background-position: -112px -80px; }
.ui-icon-folder-collapsed { background-position: 0 -96px; }
.ui-icon-folder-open { background-position: -16px -96px; }
.ui-icon-document { background-position: -32px -96px; }
.ui-icon-document-b { background-position: -48px -96px; }
.ui-icon-note { background-position: -64px -96px; }
.ui-icon-mail-closed { background-position: -80px -96px; }
.ui-icon-mail-open { background-position: -96px -96px; }
.ui-icon-suitcase { background-position: -112px -96px; }
.ui-icon-comment { background-position: -128px -96px; }
.ui-icon-person { background-position: -144px -96px; }
.ui-icon-print { background-position: -160px -96px; }
.ui-icon-trash { background-position: -176px -96px; }
.ui-icon-locked { background-position: -192px -96px; }
.ui-icon-unlocked { background-position: -208px -96px; }
.ui-icon-bookmark { background-position: -224px -96px; }
.ui-icon-tag { background-position: -240px -96px; }
.ui-icon-home { background-position: 0 -112px; }
.ui-icon-flag { background-position: -16px -112px; }
.ui-icon-calendar { background-position: -32px -112px; }
.ui-icon-cart { background-position: -48px -112px; }
.ui-icon-pencil { background-position: -64px -112px; }
.ui-icon-clock { background-position: -80px -112px; }
.ui-icon-disk { background-position: -96px -112px; }
.ui-icon-calculator { background-position: -112px -112px; }
.ui-icon-zoomin { background-position: -128px -112px; }
.ui-icon-zoomout { background-position: -144px -112px; }
.ui-icon-search { background-position: -160px -112px; }
.ui-icon-wrench { background-position: -176px -112px; }
.ui-icon-gear { background-position: -192px -112px; }
.ui-icon-heart { background-position: -208px -112px; }
.ui-icon-star { background-position: -224px -112px; }
.ui-icon-link { background-position: -240px -112px; }
.ui-icon-cancel { background-position: 0 -128px; }
.ui-icon-plus { background-position: -16px -128px; }
.ui-icon-plusthick { background-position: -32px -128px; }
.ui-icon-minus { background-position: -48px -128px; }
.ui-icon-minusthick { background-position: -64px -128px; }
.ui-icon-close { background-position: -80px -128px; }
.ui-icon-closethick { background-position: -96px -128px; }
.ui-icon-key { background-position: -112px -128px; }
.ui-icon-lightbulb { background-position: -128px -128px; }
.ui-icon-scissors { background-position: -144px -128px; }
.ui-icon-clipboard { background-position: -160px -128px; }
.ui-icon-copy { background-position: -176px -128px; }
.ui-icon-contact { background-position: -192px -128px; }
.ui-icon-image { background-position: -208px -128px; }
.ui-icon-video { background-position: -224px -128px; }
.ui-icon-script { background-position: -240px -128px; }
.ui-icon-alert { background-position: 0 -144px; }
.ui-icon-info { background-position: -16px -144px; }
.ui-icon-notice { background-position: -32px -144px; }
.ui-icon-help { background-position: -48px -144px; }
.ui-icon-check { background-position: -64px -144px; }
.ui-icon-bullet { background-position: -80px -144px; }
.ui-icon-radio-off { background-position: -96px -144px; }
.ui-icon-radio-on { background-position: -112px -144px; }
.ui-icon-pin-w { background-position: -128px -144px; }
.ui-icon-pin-s { background-position: -144px -144px; }
.ui-icon-play { background-position: 0 -160px; }
.ui-icon-pause { background-position: -16px -160px; }
.ui-icon-seek-next { background-position: -32px -160px; }
.ui-icon-seek-prev { background-position: -48px -160px; }
.ui-icon-seek-end { background-position: -64px -160px; }
.ui-icon-seek-start { background-position: -80px -160px; }
/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
.ui-icon-seek-first { background-position: -80px -160px; }
.ui-icon-stop { background-position: -96px -160px; }
.ui-icon-eject { background-position: -112px -160px; }
.ui-icon-volume-off { background-position: -128px -160px; }
.ui-icon-volume-on { background-position: -144px -160px; }
.ui-icon-power { background-position: 0 -176px; }
.ui-icon-signal-diag { background-position: -16px -176px; }
.ui-icon-signal { background-position: -32px -176px; }
.ui-icon-battery-0 { background-position: -48px -176px; }
.ui-icon-battery-1 { background-position: -64px -176px; }
.ui-icon-battery-2 { background-position: -80px -176px; }
.ui-icon-battery-3 { background-position: -96px -176px; }
.ui-icon-circle-plus { background-position: 0 -192px; }
.ui-icon-circle-minus { background-position: -16px -192px; }
.ui-icon-circle-close { background-position: -32px -192px; }
.ui-icon-circle-triangle-e { background-position: -48px -192px; }
.ui-icon-circle-triangle-s { background-position: -64px -192px; }
.ui-icon-circle-triangle-w { background-position: -80px -192px; }
.ui-icon-circle-triangle-n { background-position: -96px -192px; }
.ui-icon-circle-arrow-e { background-position: -112px -192px; }
.ui-icon-circle-arrow-s { background-position: -128px -192px; }
.ui-icon-circle-arrow-w { background-position: -144px -192px; }
.ui-icon-circle-arrow-n { background-position: -160px -192px; }
.ui-icon-circle-zoomin { background-position: -176px -192px; }
.ui-icon-circle-zoomout { background-position: -192px -192px; }
.ui-icon-circle-check { background-position: -208px -192px; }
.ui-icon-circlesmall-plus { background-position: 0 -208px; }
.ui-icon-circlesmall-minus { background-position: -16px -208px; }
.ui-icon-circlesmall-close { background-position: -32px -208px; }
.ui-icon-squaresmall-plus { background-position: -48px -208px; }
.ui-icon-squaresmall-minus { background-position: -64px -208px; }
.ui-icon-squaresmall-close { background-position: -80px -208px; }
.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
/* Misc visuals
----------------------------------*/
/* Corner radius */
.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
/* Overlays */
.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
* jQuery UI Resizable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Resizable#theming
*/
.ui-resizable { position: relative;}
.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
* jQuery UI Selectable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Selectable#theming
*/
.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
/*
* jQuery UI Accordion 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Accordion#theming
*/
/* IE/Win - Fix animation bug - #4615 */
.ui-accordion { width: 100%; }
.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
.ui-accordion .ui-accordion-li-fix { display: inline; }
.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
.ui-accordion .ui-accordion-content-active { display: block; }
/*
* jQuery UI Autocomplete 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Autocomplete#theming
*/
.ui-autocomplete { position: absolute; cursor: default; }
/* workarounds */
* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
/*
* jQuery UI Menu 1.8.9
*
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Menu#theming
*/
.ui-menu {
list-style:none;
padding: 2px;
margin: 0;
display:block;
float: left;
}
.ui-menu .ui-menu {
margin-top: -3px;
}
.ui-menu .ui-menu-item {
margin:0;
padding: 0;
zoom: 1;
float: left;
clear: left;
width: 100%;
}
.ui-menu .ui-menu-item a {
text-decoration:none;
display:block;
padding:.2em .4em;
line-height:1.5;
zoom:1;
}
.ui-menu .ui-menu-item a.ui-state-hover,
.ui-menu .ui-menu-item a.ui-state-active {
font-weight: normal;
margin: -1px;
}
/*
* jQuery UI Button 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Button#theming
*/
.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
.ui-button-icons-only { width: 3.4em; }
button.ui-button-icons-only { width: 3.7em; }
/*button text element */
.ui-button .ui-button-text { display: block; line-height: 1.4; }
.ui-button-text-only .ui-button-text { padding: .4em 1em; }
.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
/* no icon support for input elements, provide padding by default */
input.ui-button { padding: .4em 1em; }
/*button icon element(s) */
.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
/*button sets*/
.ui-buttonset { margin-right: 7px; }
.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
/* workarounds */
button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
/*
* jQuery UI Dialog 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Dialog#theming
*/
.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
.ui-draggable .ui-dialog-titlebar { cursor: move; }
/*
* jQuery UI Slider 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Slider#theming
*/
.ui-slider { position: relative; text-align: left; }
.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
.ui-slider-horizontal { height: .8em; }
.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
.ui-slider-horizontal .ui-slider-range-min { left: 0; }
.ui-slider-horizontal .ui-slider-range-max { right: 0; }
.ui-slider-vertical { width: .8em; height: 100px; }
.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
* jQuery UI Tabs 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Tabs#theming
*/
.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
.ui-tabs .ui-tabs-hide { display: none !important; }
/*
* jQuery UI Datepicker 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Datepicker#theming
*/
.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
.ui-datepicker .ui-datepicker-prev { left:2px; }
.ui-datepicker .ui-datepicker-next { right:2px; }
.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
.ui-datepicker .ui-datepicker-next-hover { right:1px; }
.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
.ui-datepicker select.ui-datepicker-month,
.ui-datepicker select.ui-datepicker-year { width: 49%;}
.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
.ui-datepicker td { border: 0; padding: 1px; }
.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
/* with multiple calendars */
.ui-datepicker.ui-datepicker-multi { width:auto; }
.ui-datepicker-multi .ui-datepicker-group { float:left; }
.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
.ui-datepicker-row-break { clear:both; width:100%; }
/* RTL support */
.ui-datepicker-rtl { direction: rtl; }
.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
.ui-datepicker-rtl .ui-datepicker-group { float:right; }
.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
.ui-datepicker-cover {
display: none; /*sorry for IE5*/
display/**/: block; /*sorry for IE5*/
position: absolute; /*must have*/
z-index: -1; /*must have*/
filter: mask(); /*must have*/
top: -4px; /*must have*/
left: -4px; /*must have*/
width: 200px; /*must have*/
height: 200px; /*must have*/
}/*
* jQuery UI Progressbar 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Progressbar#theming
*/
.ui-progressbar { height:2em; text-align: left; }
.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View File

@ -1,781 +0,0 @@
/*!
* jQuery UI 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI
*/
(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.9",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
;/*!
* jQuery UI Widget 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Widget
*/
(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
;/*!
* jQuery UI Mouse 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Mouse
*
* Depends:
* jquery.ui.widget.js
*/
(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(true===c.data(b.target,a.widgetName+".preventClickEvent")){c.removeData(b.target,a.widgetName+".preventClickEvent");b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=
a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);
return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&c.data(a.target,this.widgetName+".preventClickEvent",
true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
;/*
* jQuery UI Position 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Position
*/
(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
;/*
* jQuery UI Draggable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Draggables
*
* Depends:
* jquery.ui.core.js
* jquery.ui.mouse.js
* jquery.ui.widget.js
*/
(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?
0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==
Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;
if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/
b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-
this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=
this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.9"});
d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=
0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=
c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,
true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=
0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=
a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},
stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=
document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-
c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-
(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable",
"snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=
c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",
{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,
left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,
a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,
b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
;/*
* jQuery UI Droppable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Droppables
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
* jquery.ui.mouse.js
* jquery.ui.draggable.js
*/
(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.9"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
;/*
* jQuery UI Resizable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Resizables
*
* Depends:
* jquery.ui.core.js
* jquery.ui.mouse.js
* jquery.ui.widget.js
*/
(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
f={width:c.size.width-(f?0:c.sizeDiff.width),height:c.size.height-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=
a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,
k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),
c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=
this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+
a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,
arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,
{version:"1.8.9"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,
function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=
(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=
false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-
a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",
b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top",
"Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,
f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=
a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+
a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&
e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",
height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=
d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
;/*
* jQuery UI Selectable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Selectables
*
* Depends:
* jquery.ui.core.js
* jquery.ui.mouse.js
* jquery.ui.widget.js
*/
(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.9"})})(jQuery);
;/*
* jQuery UI Sortable 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Sortables
*
* Depends:
* jquery.ui.core.js
* jquery.ui.mouse.js
* jquery.ui.widget.js
*/
(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,
arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-
1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});
this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&
a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?
"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?
c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;
return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=
d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});
return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=
d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=
this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=
e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];
if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);
c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===
1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=
this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):
b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==
""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||
document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,
b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=
document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-
this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<
this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&
this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=
this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();
this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],
this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",
g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||
this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,
originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.9"})})(jQuery);
;/*
* jQuery UI Accordion 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Accordion
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
*/
(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+
a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.9",animations:{slide:function(a,b){a=
c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);f[i]={value:j[1],
unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",paddingTop:"hide",
paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
;/*
* jQuery UI Autocomplete 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Autocomplete
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
* jquery.ui.position.js
*/
(function(d){d.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,f;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){f=false;var e=d.ui.keyCode;
switch(c.keyCode){case e.PAGE_UP:a._move("previousPage",c);break;case e.PAGE_DOWN:a._move("nextPage",c);break;case e.UP:a._move("previous",c);c.preventDefault();break;case e.DOWN:a._move("next",c);c.preventDefault();break;case e.ENTER:case e.NUMPAD_ENTER:if(a.menu.active){f=true;c.preventDefault()}case e.TAB:if(!a.menu.active)return;a.menu.select(c);break;case e.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=
null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(f){f=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||
"body",b)[0]).mousedown(function(c){var e=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(g){g.target!==a.element[0]&&g.target!==e&&!d.ui.contains(e,g.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,e){e=e.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:e})&&/^key/.test(c.originalEvent.type)&&a.element.val(e.value)},selected:function(c,e){var g=e.item.data("item.autocomplete"),
h=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=h;setTimeout(function(){a.previous=h;a.selectedItem=g},1)}false!==a._trigger("select",c,{item:g})&&a.element.val(g.value);a.term=a.element.val();a.close(c);a.selectedItem=g},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,f;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,e){e(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source===
"string"){f=this.options.source;this.source=function(c,e){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:f,data:c,dataType:"json",success:function(g,h,i){i===a.xhr&&e(g);a.xhr=null},error:function(g){g===a.xhr&&e([]);a.xhr=null}})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;
this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==
this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position))},
_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var f=this;d.each(b,function(c,e){f._renderItem(a,e)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);
else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(a,b){var f=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return f.test(c.label||c.value||c)})}})})(jQuery);
(function(d){d.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(d(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
-1).mouseenter(function(b){a.activate(b,d(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var f=b.offset().top-this.element.offset().top,c=this.element.attr("scrollTop"),e=this.element.height();if(f<0)this.element.attr("scrollTop",c+f);else f>=e&&this.element.attr("scrollTop",c+f-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},
deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,f){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);
a.length?this.activate(f,a):this.activate(f,this.element.children(b))}else this.activate(f,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||this.last())this.activate(a,this.element.children(".ui-menu-item:first"));else{var b=this.active.offset().top,f=this.element.height(),c=this.element.children(".ui-menu-item").filter(function(){var e=d(this).offset().top-b-f+d(this).height();return e<10&&e>-10});c.length||(c=this.element.children(".ui-menu-item:last"));this.activate(a,
c)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(".ui-menu-item:last"));else{var b=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-b+f-d(this).height();return c<10&&c>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
this.activate(a,result)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
;/*
* jQuery UI Button 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Button
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
*/
(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,e=a([]);if(c)e=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return e};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",e="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(e)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var f=b.element[0];h(f).not(f).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(f){if(c.disabled)return false;if(f.keyCode==a.ui.keyCode.SPACE||f.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(f){f.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=
this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||
this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary;if(d.primary||d.secondary){b.addClass("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){b.addClass(e?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary");
this.hasTitle||b.attr("title",c)}}else b.addClass("ui-button-text-only")}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
;/*
* jQuery UI Dialog 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Dialog
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
* jquery.ui.button.js
* jquery.ui.draggable.js
* jquery.ui.mouse.js
* jquery.ui.position.js
* jquery.ui.resizable.js
*/
(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&
c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=
b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&
a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index");
isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);
d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}});
c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=
d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,
position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,
h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===
1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in
l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");
break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e=
this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&&
this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.9",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===
0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,
function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
;/*
* jQuery UI Slider 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Slider
*
* Depends:
* jquery.ui.core.js
* jquery.ui.mouse.js
* jquery.ui.widget.js
*/
(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h===
b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b,
g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},
_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],
value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value();
else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);
if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.9"})})(jQuery);
;/*
* jQuery UI Tabs 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Tabs
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
*/
(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.9"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&
a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
;/*
* jQuery UI Datepicker 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Datepicker
*
* Depends:
* jquery.ui.core.js
*/
(function(d,G){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function E(a,b){d.extend(a,b);for(var c in b)if(b[c]==
null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.9"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();
f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});
b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);
this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",
this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,
function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:
f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},
e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);
this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]?
d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||
a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,
e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,
"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==G?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},
_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=
d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,
c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&
d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",
function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=
-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,
"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},
_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-
g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?
b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):
0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=
false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=
d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);
else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=
a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,
g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){var v=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&v?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,v,H){p=o(p)?H:v;for(v=0;v<p.length;v++)if(b.substr(s,p[v].length).toLowerCase()==p[v].toLowerCase()){s+=p[v].length;return v+1}throw"Unknown name at position "+
s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(k)if(a.charAt(z)=="'"&&!o("'"))k=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var w=new Date(m("@"));c=w.getFullYear();j=w.getMonth()+1;l=w.getDate();break;case "!":w=new Date((m("!")-this._ticksTo1970)/1E4);c=w.getFullYear();j=w.getMonth()+
1;l=w.getDate();break;case "'":if(o("'"))r();else k=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",
RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&
a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",
b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+=
"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==G?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=
f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=
(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,
l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+
(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+
(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,
"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=
this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",C=0;C<i[0];C++){for(var M="",D=0;D<i[1];D++){var N=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-
1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,C>0||D>0,z,w)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=
(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<A;O++){x+="<tr>";var P=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=
p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,J=B&&!H||!F[0]||k&&q<k||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==N.getTime()&&g==a.selectedMonth&&a._keyEvent||L.getTime()==q.getTime()&&L.getTime()==N.getTime()?" "+this._dayOverClass:"")+(J?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!v?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":
""))+'"'+((!B||v)&&F[2]?' title="'+F[2]+'"':"")+(J?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!v?"&#xa0;":J?'<span class="ui-state-default">'+q.getDate()+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=
P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',
o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&
l)?"&#xa0;":""));a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+
a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";if(d.browser.mozilla)k+='<select class="ui-datepicker-year"><option value="'+c+'" selected="selected">'+c+"</option></select>";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?"&#xa0;":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=
a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));
return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.9";window["DP_jQuery_"+y]=d})(jQuery);
;/*
* jQuery UI Progressbar 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Progressbar
*
* Depends:
* jquery.ui.core.js
* jquery.ui.widget.js
*/
(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.9"})})(jQuery);
;/*
* jQuery UI Effects 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/
*/
jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0];
h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,
a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.9",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,
a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);
return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments);
else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),
b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,
a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,
a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==
e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=
g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/
h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,
a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
;/*
* jQuery UI Effects Blind 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Blind
*
* Depends:
* jquery.effects.core.js
*/
(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
;/*
* jQuery UI Effects Bounce 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Bounce
*
* Depends:
* jquery.effects.core.js
*/
(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
;/*
* jQuery UI Effects Clip 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Clip
*
* Depends:
* jquery.effects.core.js
*/
(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
;/*
* jQuery UI Effects Drop 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Drop
*
* Depends:
* jquery.effects.core.js
*/
(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
;/*
* jQuery UI Effects Explode 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Explode
*
* Depends:
* jquery.effects.core.js
*/
(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
;/*
* jQuery UI Effects Fade 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Fade
*
* Depends:
* jquery.effects.core.js
*/
(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
;/*
* jQuery UI Effects Fold 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Fold
*
* Depends:
* jquery.effects.core.js
*/
(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
;/*
* jQuery UI Effects Highlight 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Highlight
*
* Depends:
* jquery.effects.core.js
*/
(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
;/*
* jQuery UI Effects Pulsate 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Pulsate
*
* Depends:
* jquery.effects.core.js
*/
(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
;/*
* jQuery UI Effects Scale 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Scale
*
* Depends:
* jquery.effects.core.js
*/
(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
;/*
* jQuery UI Effects Shake 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Shake
*
* Depends:
* jquery.effects.core.js
*/
(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
;/*
* jQuery UI Effects Slide 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Slide
*
* Depends:
* jquery.effects.core.js
*/
(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
;/*
* jQuery UI Effects Transfer 1.8.9
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* http://docs.jquery.com/UI/Effects/Transfer
*
* Depends:
* jquery.effects.core.js
*/
(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
b.dequeue()})})}})(jQuery);
;

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

File diff suppressed because it is too large Load Diff

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1 @@
.jqplot-xaxis,.jqplot-xaxis-label{margin-top:10px}.jqplot-x2axis,.jqplot-x2axis-label{margin-bottom:10px}.jqplot-target{position:relative;color:#666;font-family:"Trebuchet MS",Arial,Helvetica,sans-serif;font-size:1em}.jqplot-axis{font-size:.75em}.jqplot-yaxis{margin-right:10px}.jqplot-y2axis,.jqplot-y3axis,.jqplot-y4axis,.jqplot-y5axis,.jqplot-y6axis,.jqplot-y7axis,.jqplot-y8axis,.jqplot-y9axis,.jqplot-yMidAxis{margin-left:10px;margin-right:10px}.jqplot-axis-tick,.jqplot-x2axis-tick,.jqplot-xaxis-tick,.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick,.jqplot-yMidAxis-tick,.jqplot-yaxis-tick{position:absolute;white-space:pre}.jqplot-xaxis-tick{top:0;left:15px;vertical-align:top}.jqplot-x2axis-tick{bottom:0;left:15px;vertical-align:bottom}.jqplot-yaxis-tick{right:0;top:15px;text-align:right}.jqplot-yaxis-tick.jqplot-breakTick{right:-20px;margin-right:0;padding:1px 5px;z-index:2;font-size:1.5em}.jqplot-x2axis-label,.jqplot-xaxis-label,.jqplot-yMidAxis-label,.jqplot-yaxis-label{font-size:11pt;position:absolute}.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick{left:0;top:15px;text-align:left}.jqplot-yMidAxis-tick{text-align:center;white-space:nowrap}.jqplot-yaxis-label{margin-right:10px}.jqplot-y2axis-label,.jqplot-y3axis-label,.jqplot-y4axis-label,.jqplot-y5axis-label,.jqplot-y6axis-label,.jqplot-y7axis-label,.jqplot-y8axis-label,.jqplot-y9axis-label{font-size:11pt;margin-left:10px;position:absolute}.jqplot-meterGauge-tick{font-size:.75em;color:#999}.jqplot-meterGauge-label{font-size:1em;color:#999}table.jqplot-table-legend{margin:12px}table.jqplot-cursor-legend,table.jqplot-table-legend{background-color:rgba(255,255,255,.6);border:1px solid #ccc;position:absolute;font-size:.75em}td.jqplot-table-legend{vertical-align:middle}td.jqplot-seriesToggle:active,td.jqplot-seriesToggle:hover{cursor:pointer}.jqplot-table-legend .jqplot-series-hidden{text-decoration:line-through}div.jqplot-table-legend-swatch-outline{border:1px solid #ccc;padding:1px}div.jqplot-table-legend-swatch{width:0;height:0;border-width:5px 6px;border-style:solid}.jqplot-title{top:0;left:0;padding-bottom:.5em;font-size:1.2em}table.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em}.jqplot-canvasOverlay-tooltip,.jqplot-cursor-tooltip,.jqplot-highlighter-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,.5);padding:1px}.jqplot-point-label{font-size:.75em;z-index:2}td.jqplot-cursor-legend-swatch{vertical-align:middle;text-align:center}div.jqplot-cursor-legend-swatch{width:1.2em;height:.7em}.jqplot-error{text-align:center}.jqplot-error-message{position:relative;top:46%;display:inline-block}div.jqplot-bubble-label{font-size:.8em;padding-left:2px;padding-right:2px;color:rgb(20%,20%,20%)}div.jqplot-bubble-label.jqplot-bubble-label-highlight{background:rgba(90%,90%,90%,.7)}div.jqplot-noData-container{text-align:center;background-color:rgba(96%,96%,96%,.3)}

File diff suppressed because one or more lines are too long

View File

@ -1 +0,0 @@
.jqplot-target{position:relative;color:#666;font-family:"Trebuchet MS",Arial,Helvetica,sans-serif;font-size:1em}.jqplot-axis{font-size:.75em}.jqplot-xaxis{margin-top:10px}.jqplot-x2axis{margin-bottom:10px}.jqplot-yaxis{margin-right:10px}.jqplot-y2axis,.jqplot-y3axis,.jqplot-y4axis,.jqplot-y5axis,.jqplot-y6axis,.jqplot-y7axis,.jqplot-y8axis,.jqplot-y9axis,.jqplot-yMidAxis{margin-left:10px;margin-right:10px}.jqplot-axis-tick,.jqplot-xaxis-tick,.jqplot-yaxis-tick,.jqplot-x2axis-tick,.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick,.jqplot-yMidAxis-tick{position:absolute;white-space:pre}.jqplot-xaxis-tick{top:0;left:15px;vertical-align:top}.jqplot-x2axis-tick{bottom:0;left:15px;vertical-align:bottom}.jqplot-yaxis-tick{right:0;top:15px;text-align:right}.jqplot-yaxis-tick.jqplot-breakTick{right:-20px;margin-right:0;padding:1px 5px 1px 5px;z-index:2;font-size:1.5em}.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick{left:0;top:15px;text-align:left}.jqplot-yMidAxis-tick{text-align:center;white-space:nowrap}.jqplot-xaxis-label{margin-top:10px;font-size:11pt;position:absolute}.jqplot-x2axis-label{margin-bottom:10px;font-size:11pt;position:absolute}.jqplot-yaxis-label{margin-right:10px;font-size:11pt;position:absolute}.jqplot-yMidAxis-label{font-size:11pt;position:absolute}.jqplot-y2axis-label,.jqplot-y3axis-label,.jqplot-y4axis-label,.jqplot-y5axis-label,.jqplot-y6axis-label,.jqplot-y7axis-label,.jqplot-y8axis-label,.jqplot-y9axis-label{font-size:11pt;margin-left:10px;position:absolute}.jqplot-meterGauge-tick{font-size:.75em;color:#999}.jqplot-meterGauge-label{font-size:1em;color:#999}table.jqplot-table-legend{margin-top:12px;margin-bottom:12px;margin-left:12px;margin-right:12px}table.jqplot-table-legend,table.jqplot-cursor-legend{background-color:rgba(255,255,255,0.6);border:1px solid #ccc;position:absolute;font-size:.75em}td.jqplot-table-legend{vertical-align:middle}td.jqplot-seriesToggle:hover,td.jqplot-seriesToggle:active{cursor:pointer}.jqplot-table-legend .jqplot-series-hidden{text-decoration:line-through}div.jqplot-table-legend-swatch-outline{border:1px solid #ccc;padding:1px}div.jqplot-table-legend-swatch{width:0;height:0;border-top-width:5px;border-bottom-width:5px;border-left-width:6px;border-right-width:6px;border-top-style:solid;border-bottom-style:solid;border-left-style:solid;border-right-style:solid}.jqplot-title{top:0;left:0;padding-bottom:.5em;font-size:1.2em}table.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em}.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,0.5);padding:1px}.jqplot-highlighter-tooltip,.jqplot-canvasOverlay-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,0.5);padding:1px}.jqplot-point-label{font-size:.75em;z-index:2}td.jqplot-cursor-legend-swatch{vertical-align:middle;text-align:center}div.jqplot-cursor-legend-swatch{width:1.2em;height:.7em}.jqplot-error{text-align:center}.jqplot-error-message{position:relative;top:46%;display:inline-block}div.jqplot-bubble-label{font-size:.8em;padding-left:2px;padding-right:2px;color:rgb(20%,20%,20%)}div.jqplot-bubble-label.jqplot-bubble-label-highlight{background:rgba(90%,90%,90%,0.7)}div.jqplot-noData-container{text-align:center;background-color:rgba(96%,96%,96%,0.3)}

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,314 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
// Class: $.jqplot.BezierCurveRenderer.js
// Renderer which draws lines as stacked bezier curves.
// Data for the line will not be specified as an array of
// [x, y] data point values, but as a an array of [start piont, bezier curve]
// So, the line is specified as: [[xstart, ystart], [cp1x, cp1y, cp2x, cp2y, xend, yend]].
$.jqplot.BezierCurveRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.BezierCurveRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.BezierCurveRenderer.prototype.constructor = $.jqplot.BezierCurveRenderer;
// Method: setGridData
// converts the user data values to grid coordinates and stores them
// in the gridData array.
// Called with scope of a series.
$.jqplot.BezierCurveRenderer.prototype.setGridData = function(plot) {
// recalculate the grid data
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
// this._plotData should be same as this.data
var data = this.data;
this.gridData = [];
this._prevGridData = [];
// if seriesIndex = 0, fill to x axis.
// if seriesIndex > 0, fill to previous series data.
var idx = this.index;
if (data.length == 2) {
if (idx == 0) {
this.gridData = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[1][2]), yp.call(this._yaxis, data[1][3]),
xp.call(this._xaxis, data[1][4]), yp.call(this._yaxis, data[1][5])],
[xp.call(this._xaxis, data[1][4]), yp.call(this._yaxis, this._yaxis.min)],
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, this._yaxis.min)]
];
}
else {
var psd = plot.series[idx-1].data;
this.gridData = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[1][2]), yp.call(this._yaxis, data[1][3]),
xp.call(this._xaxis, data[1][4]), yp.call(this._yaxis, data[1][5])],
[xp.call(this._xaxis, psd[1][4]), yp.call(this._yaxis, psd[1][5])],
[xp.call(this._xaxis, psd[1][2]), yp.call(this._yaxis, psd[1][3]),
xp.call(this._xaxis, psd[1][0]), yp.call(this._yaxis, psd[1][1]),
xp.call(this._xaxis, psd[0][0]), yp.call(this._yaxis, psd[0][1])]
];
}
}
else {
if (idx == 0) {
this.gridData = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[2][0]), yp.call(this._yaxis, data[2][1]),
xp.call(this._xaxis, data[3][0]), yp.call(this._yaxis, data[3][1])],
[xp.call(this._xaxis, data[3][1]), yp.call(this._yaxis, this._yaxis.min)],
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, this._yaxis.min)]
];
}
else {
var psd = plot.series[idx-1].data;
this.gridData = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[2][0]), yp.call(this._yaxis, data[2][1]),
xp.call(this._xaxis, data[3][0]), yp.call(this._yaxis, data[3][1])],
[xp.call(this._xaxis, psd[3][0]), yp.call(this._yaxis, psd[3][1])],
[xp.call(this._xaxis, psd[2][0]), yp.call(this._yaxis, psd[2][1]),
xp.call(this._xaxis, psd[1][0]), yp.call(this._yaxis, psd[1][1]),
xp.call(this._xaxis, psd[0][0]), yp.call(this._yaxis, psd[0][1])]
];
}
}
};
// Method: makeGridData
// converts any arbitrary data values to grid coordinates and
// returns them. This method exists so that plugins can use a series'
// linerenderer to generate grid data points without overwriting the
// grid data associated with that series.
// Called with scope of a series.
$.jqplot.BezierCurveRenderer.prototype.makeGridData = function(data, plot) {
// recalculate the grid data
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var gd = [];
var pgd = [];
// if seriesIndex = 0, fill to x axis.
// if seriesIndex > 0, fill to previous series data.
var idx = this.index;
if (data.length == 2) {
if (idx == 0) {
gd = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[1][2]), yp.call(this._yaxis, data[1][3]),
xp.call(this._xaxis, data[1][4]), yp.call(this._yaxis, data[1][5])],
[xp.call(this._xaxis, data[1][4]), yp.call(this._yaxis, this._yaxis.min)],
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, this._yaxis.min)]
];
}
else {
var psd = plot.series[idx-1].data;
gd = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[1][2]), yp.call(this._yaxis, data[1][3]),
xp.call(this._xaxis, data[1][4]), yp.call(this._yaxis, data[1][5])],
[xp.call(this._xaxis, psd[1][4]), yp.call(this._yaxis, psd[1][5])],
[xp.call(this._xaxis, psd[1][2]), yp.call(this._yaxis, psd[1][3]),
xp.call(this._xaxis, psd[1][0]), yp.call(this._yaxis, psd[1][1]),
xp.call(this._xaxis, psd[0][0]), yp.call(this._yaxis, psd[0][1])]
];
}
}
else {
if (idx == 0) {
gd = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[2][0]), yp.call(this._yaxis, data[2][1]),
xp.call(this._xaxis, data[3][0]), yp.call(this._yaxis, data[3][1])],
[xp.call(this._xaxis, data[3][1]), yp.call(this._yaxis, this._yaxis.min)],
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, this._yaxis.min)]
];
}
else {
var psd = plot.series[idx-1].data;
gd = [
[xp.call(this._xaxis, data[0][0]), yp.call(this._yaxis, data[0][1])],
[xp.call(this._xaxis, data[1][0]), yp.call(this._yaxis, data[1][1]),
xp.call(this._xaxis, data[2][0]), yp.call(this._yaxis, data[2][1]),
xp.call(this._xaxis, data[3][0]), yp.call(this._yaxis, data[3][1])],
[xp.call(this._xaxis, psd[3][0]), yp.call(this._yaxis, psd[3][1])],
[xp.call(this._xaxis, psd[2][0]), yp.call(this._yaxis, psd[2][1]),
xp.call(this._xaxis, psd[1][0]), yp.call(this._yaxis, psd[1][1]),
xp.call(this._xaxis, psd[0][0]), yp.call(this._yaxis, psd[0][1])]
];
}
}
return gd;
};
// called within scope of series.
$.jqplot.BezierCurveRenderer.prototype.draw = function(ctx, gd, options) {
var i;
ctx.save();
if (gd.length) {
if (this.showLine) {
ctx.save();
var opts = (options != null) ? options : {};
ctx.fillStyle = opts.fillStyle || this.color;
ctx.beginPath();
ctx.moveTo(gd[0][0], gd[0][1]);
ctx.bezierCurveTo(gd[1][0], gd[1][1], gd[1][2], gd[1][3], gd[1][4], gd[1][5]);
ctx.lineTo(gd[2][0], gd[2][1]);
if (gd[3].length == 2) {
ctx.lineTo(gd[3][0], gd[3][1]);
}
else {
ctx.bezierCurveTo(gd[3][0], gd[3][1], gd[3][2], gd[3][3], gd[3][4], gd[3][5]);
}
ctx.closePath();
ctx.fill();
ctx.restore();
}
}
ctx.restore();
};
$.jqplot.BezierCurveRenderer.prototype.drawShadow = function(ctx, gd, options) {
// This is a no-op, shadows drawn with lines.
};
$.jqplot.BezierAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
};
$.jqplot.BezierAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.BezierAxisRenderer.prototype.constructor = $.jqplot.BezierAxisRenderer;
// Axes on a plot with Bezier Curves
$.jqplot.BezierAxisRenderer.prototype.init = function(options){
$.extend(true, this, options);
var db = this._dataBounds;
// Go through all the series attached to this axis and find
// the min/max bounds for this axis.
for (var i=0; i<this._series.length; i++) {
var s = this._series[i];
var d = s.data;
if (d.length == 4) {
for (var j=0; j<d.length; j++) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
if (d[j][0] < db.min || db.min == null) {
db.min = d[j][0];
}
if (d[j][0] > db.max || db.max == null) {
db.max = d[j][0];
}
}
else {
if (d[j][1] < db.min || db.min == null) {
db.min = d[j][1];
}
if (d[j][1] > db.max || db.max == null) {
db.max = d[j][1];
}
}
}
}
else {
if (this.name == 'xaxis' || this.name == 'x2axis') {
if (d[0][0] < db.min || db.min == null) {
db.min = d[0][0];
}
if (d[0][0] > db.max || db.max == null) {
db.max = d[0][0];
}
for (var j=0; j<5; j+=2) {
if (d[1][j] < db.min || db.min == null) {
db.min = d[1][j];
}
if (d[1][j] > db.max || db.max == null) {
db.max = d[1][j];
}
}
}
else {
if (d[0][1] < db.min || db.min == null) {
db.min = d[0][1];
}
if (d[0][1] > db.max || db.max == null) {
db.max = d[0][1];
}
for (var j=1; j<6; j+=2) {
if (d[1][j] < db.min || db.min == null) {
db.min = d[1][j];
}
if (d[1][j] > db.max || db.max == null) {
db.max = d[1][j];
}
}
}
}
}
};
// setup default renderers for axes and legend so user doesn't have to
// called with scope of plot
function preInit(target, data, options) {
options = options || {};
options.axesDefaults = $.extend(true, {pad:0}, options.axesDefaults);
options.seriesDefaults = options.seriesDefaults || {};
options.legend = $.extend(true, {placement:'outside'}, options.legend);
// only set these if there is a pie series
var setopts = false;
if (options.seriesDefaults.renderer == $.jqplot.BezierCurveRenderer) {
setopts = true;
}
else if (options.series) {
for (var i=0; i < options.series.length; i++) {
if (options.series[i].renderer == $.jqplot.BezierCurveRenderer) {
setopts = true;
}
}
}
if (setopts) {
options.axesDefaults.renderer = $.jqplot.BezierAxisRenderer;
}
}
$.jqplot.preInitHooks.push(preInit);
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,801 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
// Class: $.jqplot.BarRenderer
// A plugin renderer for jqPlot to draw a bar plot.
// Draws series as a line.
$.jqplot.BarRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.BarRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.BarRenderer.prototype.constructor = $.jqplot.BarRenderer;
// called with scope of series.
$.jqplot.BarRenderer.prototype.init = function(options, plot) {
// Group: Properties
//
// prop: barPadding
// Number of pixels between adjacent bars at the same axis value.
this.barPadding = 8;
// prop: barMargin
// Number of pixels between groups of bars at adjacent axis values.
this.barMargin = 10;
// prop: barDirection
// 'vertical' = up and down bars, 'horizontal' = side to side bars
this.barDirection = 'vertical';
// prop: barWidth
// Width of the bar in pixels (auto by devaul). null = calculated automatically.
this.barWidth = null;
// prop: shadowOffset
// offset of the shadow from the slice and offset of
// each succesive stroke of the shadow from the last.
this.shadowOffset = 2;
// prop: shadowDepth
// number of strokes to apply to the shadow,
// each stroke offset shadowOffset from the last.
this.shadowDepth = 5;
// prop: shadowAlpha
// transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.08;
// prop: waterfall
// true to enable waterfall plot.
this.waterfall = false;
// prop: groups
// group bars into this many groups
this.groups = 1;
// prop: varyBarColor
// true to color each bar of a series separately rather than
// have every bar of a given series the same color.
// If used for non-stacked multiple series bar plots, user should
// specify a separate 'seriesColors' array for each series.
// Otherwise, each series will set their bars to the same color array.
// This option has no Effect for stacked bar charts and is disabled.
this.varyBarColor = false;
// prop: highlightMouseOver
// True to highlight slice when moused over.
// This must be false to enable highlightMouseDown to highlight when clicking on a slice.
this.highlightMouseOver = true;
// prop: highlightMouseDown
// True to highlight when a mouse button is pressed over a slice.
// This will be disabled if highlightMouseOver is true.
this.highlightMouseDown = false;
// prop: highlightColors
// an array of colors to use when highlighting a bar.
this.highlightColors = [];
// prop: transposedData
// NOT IMPLEMENTED YET. True if this is a horizontal bar plot and
// x and y values are "transposed". Tranposed, or "swapped", data is
// required prior to rev. 894 builds of jqPlot with horizontal bars.
// Allows backward compatability of bar renderer horizontal bars with
// old style data sets.
this.transposedData = true;
this.renderer.animation = {
show: false,
direction: 'down',
speed: 3000,
_supported: true
};
this._type = 'bar';
// if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver
if (options.highlightMouseDown && options.highlightMouseOver == null) {
options.highlightMouseOver = false;
}
//////
// This is probably wrong here.
// After going back and forth on whether renderer should be the thing
// or extend the thing, it seems that it it best if it is a property
// on the thing. This should be something that is commonized
// among series renderers in the future.
//////
$.extend(true, this, options);
// really should probably do this
$.extend(true, this.renderer, options);
// fill is still needed to properly draw the legend.
// bars have to be filled.
this.fill = true;
// if horizontal bar and animating, reset the default direction
if (this.barDirection === 'horizontal' && this.rendererOptions.animation && this.rendererOptions.animation.direction == null) {
this.renderer.animation.direction = 'left';
}
if (this.waterfall) {
this.fillToZero = false;
this.disableStack = true;
}
if (this.barDirection == 'vertical' ) {
this._primaryAxis = '_xaxis';
this._stackAxis = 'y';
this.fillAxis = 'y';
}
else {
this._primaryAxis = '_yaxis';
this._stackAxis = 'x';
this.fillAxis = 'x';
}
// index of the currenty highlighted point, if any
this._highlightedPoint = null;
// total number of values for all bar series, total number of bar series, and position of this series
this._plotSeriesInfo = null;
// Array of actual data colors used for each data point.
this._dataColors = [];
this._barPoints = [];
// set the shape renderer options
var opts = {lineJoin:'miter', lineCap:'round', fill:true, isarc:false, strokeStyle:this.color, fillStyle:this.color, closePath:this.fill};
this.renderer.shapeRenderer.init(opts);
// set the shadow renderer options
var sopts = {lineJoin:'miter', lineCap:'round', fill:true, isarc:false, angle:this.shadowAngle, offset:this.shadowOffset, alpha:this.shadowAlpha, depth:this.shadowDepth, closePath:this.fill};
this.renderer.shadowRenderer.init(sopts);
plot.postInitHooks.addOnce(postInit);
plot.postDrawHooks.addOnce(postPlotDraw);
plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove);
plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown);
plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp);
plot.eventListenerHooks.addOnce('jqplotClick', handleClick);
plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick);
};
// called with scope of series
function barPreInit(target, data, seriesDefaults, options) {
if (this.rendererOptions.barDirection == 'horizontal') {
this._stackAxis = 'x';
this._primaryAxis = '_yaxis';
}
if (this.rendererOptions.waterfall == true) {
this._data = $.extend(true, [], this.data);
var sum = 0;
var pos = (!this.rendererOptions.barDirection || this.rendererOptions.barDirection === 'vertical' || this.transposedData === false) ? 1 : 0;
for(var i=0; i<this.data.length; i++) {
sum += this.data[i][pos];
if (i>0) {
this.data[i][pos] += this.data[i-1][pos];
}
}
this.data[this.data.length] = (pos == 1) ? [this.data.length+1, sum] : [sum, this.data.length+1];
this._data[this._data.length] = (pos == 1) ? [this._data.length+1, sum] : [sum, this._data.length+1];
}
if (this.rendererOptions.groups > 1) {
this.breakOnNull = true;
var l = this.data.length;
var skip = parseInt(l/this.rendererOptions.groups, 10);
var count = 0;
for (var i=skip; i<l; i+=skip) {
this.data.splice(i+count, 0, [null, null]);
this._plotData.splice(i+count, 0, [null, null]);
this._stackData.splice(i+count, 0, [null, null]);
count++;
}
for (i=0; i<this.data.length; i++) {
if (this._primaryAxis == '_xaxis') {
this.data[i][0] = i+1;
this._plotData[i][0] = i+1;
this._stackData[i][0] = i+1;
}
else {
this.data[i][1] = i+1;
this._plotData[i][1] = i+1;
this._stackData[i][1] = i+1;
}
}
}
}
$.jqplot.preSeriesInitHooks.push(barPreInit);
// needs to be called with scope of series, not renderer.
$.jqplot.BarRenderer.prototype.calcSeriesNumbers = function() {
var nvals = 0;
var nseries = 0;
var paxis = this[this._primaryAxis];
var s, series, pos;
// loop through all series on this axis
for (var i=0; i < paxis._series.length; i++) {
series = paxis._series[i];
if (series === this) {
pos = i;
}
// is the series rendered as a bar?
if (series.renderer.constructor == $.jqplot.BarRenderer) {
// gridData may not be computed yet, use data length insted
nvals += series.data.length;
nseries += 1;
}
}
// return total number of values for all bar series, total number of bar series, and position of this series
return [nvals, nseries, pos];
};
$.jqplot.BarRenderer.prototype.setBarWidth = function() {
// need to know how many data values we have on the approprate axis and figure it out.
var i;
var nvals = 0;
var nseries = 0;
var paxis = this[this._primaryAxis];
var s, series, pos;
var temp = this._plotSeriesInfo = this.renderer.calcSeriesNumbers.call(this);
nvals = temp[0];
nseries = temp[1];
var nticks = paxis.numberTicks;
var nbins = (nticks-1)/2;
// so, now we have total number of axis values.
if (paxis.name == 'xaxis' || paxis.name == 'x2axis') {
if (this._stack) {
this.barWidth = (paxis._offsets.max - paxis._offsets.min) / nvals * nseries - this.barMargin;
}
else {
this.barWidth = ((paxis._offsets.max - paxis._offsets.min)/nbins - this.barPadding * (nseries-1) - this.barMargin*2)/nseries;
// this.barWidth = (paxis._offsets.max - paxis._offsets.min) / nvals - this.barPadding - this.barMargin/nseries;
}
}
else {
if (this._stack) {
this.barWidth = (paxis._offsets.min - paxis._offsets.max) / nvals * nseries - this.barMargin;
}
else {
this.barWidth = ((paxis._offsets.min - paxis._offsets.max)/nbins - this.barPadding * (nseries-1) - this.barMargin*2)/nseries;
// this.barWidth = (paxis._offsets.min - paxis._offsets.max) / nvals - this.barPadding - this.barMargin/nseries;
}
}
return [nvals, nseries];
};
function computeHighlightColors (colors) {
var ret = [];
for (var i=0; i<colors.length; i++){
var rgba = $.jqplot.getColorComponents(colors[i]);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var sum = newrgb[0] + newrgb[1] + newrgb[2];
for (var j=0; j<3; j++) {
// when darkening, lowest color component can be is 60.
newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.3 * (255 - newrgb[j]);
newrgb[j] = parseInt(newrgb[j], 10);
}
ret.push('rgb('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+')');
}
return ret;
}
function getStart(sidx, didx, comp, plot, axis) {
// check if sign change
var seriesIndex = sidx,
prevSeriesIndex = sidx - 1,
start,
prevVal,
aidx = (axis === 'x') ? 0 : 1;
// is this not the first series?
if (seriesIndex > 0) {
prevVal = plot.series[prevSeriesIndex]._plotData[didx][aidx];
// is there a sign change
if ((comp * prevVal) < 0) {
start = getStart(prevSeriesIndex, didx, comp, plot, axis);
}
// no sign change.
else {
start = plot.series[prevSeriesIndex].gridData[didx][aidx];
}
}
// if first series, return value at 0
else {
start = (aidx === 0) ? plot.series[seriesIndex]._xaxis.series_u2p(0) : plot.series[seriesIndex]._yaxis.series_u2p(0);
}
return start;
}
$.jqplot.BarRenderer.prototype.draw = function(ctx, gridData, options, plot) {
var i;
// Ughhh, have to make a copy of options b/c it may be modified later.
var opts = $.extend({}, options);
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine;
var fill = (opts.fill != undefined) ? opts.fill : this.fill;
var xaxis = this.xaxis;
var yaxis = this.yaxis;
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var pointx, pointy;
// clear out data colors.
this._dataColors = [];
this._barPoints = [];
if (this.barWidth == null || this.rendererOptions.barWidth == null) {//check pull request https://bitbucket.org/cleonello/jqplot/pull-request/61/fix-for-issue-513/diff
this.renderer.setBarWidth.call(this);
}
var temp = this._plotSeriesInfo = this.renderer.calcSeriesNumbers.call(this);
var nvals = temp[0];
var nseries = temp[1];
var pos = temp[2];
var points = [];
if (this._stack) {
this._barNudge = 0;
}
else {
this._barNudge = (-Math.abs(nseries/2 - 0.5) + pos) * (this.barWidth + this.barPadding);
}
if (showLine) {
var negativeColors = new $.jqplot.ColorGenerator(this.negativeSeriesColors);
var positiveColors = new $.jqplot.ColorGenerator(this.seriesColors);
var negativeColor = negativeColors.get(this.index);
if (! this.useNegativeColors) {
negativeColor = opts.fillStyle;
}
var positiveColor = opts.fillStyle;
var base;
var xstart;
var ystart;
if (this.barDirection == 'vertical') {
for (var i=0; i<gridData.length; i++) {
if (!this._stack && this.data[i][1] == null) {
continue;
}
points = [];
base = gridData[i][0] + this._barNudge;
// stacked
if (this._stack && this._prevGridData.length) {
ystart = getStart(this.index, i, this._plotData[i][1], plot, 'y');
}
// not stacked
else {
if (this.fillToZero) {
ystart = this._yaxis.series_u2p(0);
}
else if (this.waterfall && i > 0 && i < this.gridData.length-1) {
ystart = this.gridData[i-1][1];
}
else if (this.waterfall && i == 0 && i < this.gridData.length-1) {
if (this._yaxis.min <= 0 && this._yaxis.max >= 0) {
ystart = this._yaxis.series_u2p(0);
}
else if (this._yaxis.min > 0) {
ystart = ctx.canvas.height;
}
else {
ystart = 0;
}
}
else if (this.waterfall && i == this.gridData.length - 1) {
if (this._yaxis.min <= 0 && this._yaxis.max >= 0) {
ystart = this._yaxis.series_u2p(0);
}
else if (this._yaxis.min > 0) {
ystart = ctx.canvas.height;
}
else {
ystart = 0;
}
}
else {
ystart = ctx.canvas.height;
}
}
if ((this.fillToZero && this._plotData[i][1] < 0) || (this.waterfall && this._data[i][1] < 0)) {
if (this.varyBarColor && !this._stack) {
if (this.useNegativeColors) {
opts.fillStyle = negativeColors.next();
}
else {
opts.fillStyle = positiveColors.next();
}
}
else {
opts.fillStyle = negativeColor;
}
}
else {
if (this.varyBarColor && !this._stack) {
opts.fillStyle = positiveColors.next();
}
else {
opts.fillStyle = positiveColor;
}
}
if (!this.fillToZero || this._plotData[i][1] >= 0) {
points.push([base-this.barWidth/2, ystart]);
points.push([base-this.barWidth/2, gridData[i][1]]);
points.push([base+this.barWidth/2, gridData[i][1]]);
points.push([base+this.barWidth/2, ystart]);
}
// for negative bars make sure points are always ordered clockwise
else {
points.push([base-this.barWidth/2, gridData[i][1]]);
points.push([base-this.barWidth/2, ystart]);
points.push([base+this.barWidth/2, ystart]);
points.push([base+this.barWidth/2, gridData[i][1]]);
}
this._barPoints.push(points);
// now draw the shadows if not stacked.
// for stacked plots, they are predrawn by drawShadow
if (shadow && !this._stack) {
var sopts = $.extend(true, {}, opts);
// need to get rid of fillStyle on shadow.
delete sopts.fillStyle;
this.renderer.shadowRenderer.draw(ctx, points, sopts);
}
var clr = opts.fillStyle || this.color;
this._dataColors.push(clr);
this.renderer.shapeRenderer.draw(ctx, points, opts);
}
}
else if (this.barDirection == 'horizontal'){
for (var i=0; i<gridData.length; i++) {
if (!this._stack && this.data[i][0] == null) {
continue;
}
points = [];
base = gridData[i][1] - this._barNudge;
xstart;
if (this._stack && this._prevGridData.length) {
xstart = getStart(this.index, i, this._plotData[i][0], plot, 'x');
}
// not stacked
else {
if (this.fillToZero) {
xstart = this._xaxis.series_u2p(0);
}
else if (this.waterfall && i > 0 && i < this.gridData.length-1) {
xstart = this.gridData[i-1][0];
}
else if (this.waterfall && i == 0 && i < this.gridData.length-1) {
if (this._xaxis.min <= 0 && this._xaxis.max >= 0) {
xstart = this._xaxis.series_u2p(0);
}
else if (this._xaxis.min > 0) {
xstart = 0;
}
else {
xstart = 0;
}
}
else if (this.waterfall && i == this.gridData.length - 1) {
if (this._xaxis.min <= 0 && this._xaxis.max >= 0) {
xstart = this._xaxis.series_u2p(0);
}
else if (this._xaxis.min > 0) {
xstart = 0;
}
else {
xstart = ctx.canvas.width;
}
}
else {
xstart = 0;
}
}
if ((this.fillToZero && this._plotData[i][0] < 0) || (this.waterfall && this._data[i][0] < 0)) {
if (this.varyBarColor && !this._stack) {
if (this.useNegativeColors) {
opts.fillStyle = negativeColors.next();
}
else {
opts.fillStyle = positiveColors.next();
}
}
else {
opts.fillStyle = negativeColor;
}
}
else {
if (this.varyBarColor && !this._stack) {
opts.fillStyle = positiveColors.next();
}
else {
opts.fillStyle = positiveColor;
}
}
if (!this.fillToZero || this._plotData[i][0] >= 0) {
points.push([xstart, base + this.barWidth / 2]);
points.push([xstart, base - this.barWidth / 2]);
points.push([gridData[i][0], base - this.barWidth / 2]);
points.push([gridData[i][0], base + this.barWidth / 2]);
}
else {
points.push([gridData[i][0], base + this.barWidth / 2]);
points.push([gridData[i][0], base - this.barWidth / 2]);
points.push([xstart, base - this.barWidth / 2]);
points.push([xstart, base + this.barWidth / 2]);
}
this._barPoints.push(points);
// now draw the shadows if not stacked.
// for stacked plots, they are predrawn by drawShadow
if (shadow && !this._stack) {
var sopts = $.extend(true, {}, opts);
delete sopts.fillStyle;
this.renderer.shadowRenderer.draw(ctx, points, sopts);
}
var clr = opts.fillStyle || this.color;
this._dataColors.push(clr);
this.renderer.shapeRenderer.draw(ctx, points, opts);
}
}
}
if (this.highlightColors.length == 0) {
this.highlightColors = $.jqplot.computeHighlightColors(this._dataColors);
}
else if (typeof(this.highlightColors) == 'string') {
var temp = this.highlightColors;
this.highlightColors = [];
for (var i=0; i<this._dataColors.length; i++) {
this.highlightColors.push(temp);
}
}
};
// for stacked plots, shadows will be pre drawn by drawShadow.
$.jqplot.BarRenderer.prototype.drawShadow = function(ctx, gridData, options, plot) {
var i;
var opts = (options != undefined) ? options : {};
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine;
var fill = (opts.fill != undefined) ? opts.fill : this.fill;
var xaxis = this.xaxis;
var yaxis = this.yaxis;
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var pointx, points, pointy, nvals, nseries, pos;
if (this._stack && this.shadow) {
if (this.barWidth == null) {
this.renderer.setBarWidth.call(this);
}
var temp = this._plotSeriesInfo = this.renderer.calcSeriesNumbers.call(this);
nvals = temp[0];
nseries = temp[1];
pos = temp[2];
if (this._stack) {
this._barNudge = 0;
}
else {
this._barNudge = (-Math.abs(nseries/2 - 0.5) + pos) * (this.barWidth + this.barPadding);
}
if (showLine) {
if (this.barDirection == 'vertical') {
for (var i=0; i<gridData.length; i++) {
if (this.data[i][1] == null) {
continue;
}
points = [];
var base = gridData[i][0] + this._barNudge;
var ystart;
if (this._stack && this._prevGridData.length) {
ystart = getStart(this.index, i, this._plotData[i][1], plot, 'y');
}
else {
if (this.fillToZero) {
ystart = this._yaxis.series_u2p(0);
}
else {
ystart = ctx.canvas.height;
}
}
points.push([base-this.barWidth/2, ystart]);
points.push([base-this.barWidth/2, gridData[i][1]]);
points.push([base+this.barWidth/2, gridData[i][1]]);
points.push([base+this.barWidth/2, ystart]);
this.renderer.shadowRenderer.draw(ctx, points, opts);
}
}
else if (this.barDirection == 'horizontal'){
for (var i=0; i<gridData.length; i++) {
if (this.data[i][0] == null) {
continue;
}
points = [];
var base = gridData[i][1] - this._barNudge;
var xstart;
if (this._stack && this._prevGridData.length) {
xstart = getStart(this.index, i, this._plotData[i][0], plot, 'x');
}
else {
if (this.fillToZero) {
xstart = this._xaxis.series_u2p(0);
}
else {
xstart = 0;
}
}
points.push([xstart, base+this.barWidth/2]);
points.push([gridData[i][0], base+this.barWidth/2]);
points.push([gridData[i][0], base-this.barWidth/2]);
points.push([xstart, base-this.barWidth/2]);
this.renderer.shadowRenderer.draw(ctx, points, opts);
}
}
}
}
};
function postInit(target, data, options) {
for (var i=0; i<this.series.length; i++) {
if (this.series[i].renderer.constructor == $.jqplot.BarRenderer) {
// don't allow mouseover and mousedown at same time.
if (this.series[i].highlightMouseOver) {
this.series[i].highlightMouseDown = false;
}
}
}
}
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
function postPlotDraw() {
// Memory Leaks patch
if (this.plugins.barRenderer && this.plugins.barRenderer.highlightCanvas) {
this.plugins.barRenderer.highlightCanvas.resetCanvas();
this.plugins.barRenderer.highlightCanvas = null;
}
this.plugins.barRenderer = {highlightedSeriesIndex:null};
this.plugins.barRenderer.highlightCanvas = new $.jqplot.GenericCanvas();
this.eventCanvas._elem.before(this.plugins.barRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-barRenderer-highlight-canvas', this._plotDimensions, this));
this.plugins.barRenderer.highlightCanvas.setContext();
this.eventCanvas._elem.bind('mouseleave', {plot:this}, function (ev) { unhighlight(ev.data.plot); });
}
function highlight (plot, sidx, pidx, points) {
var s = plot.series[sidx];
var canvas = plot.plugins.barRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0,canvas._ctx.canvas.width, canvas._ctx.canvas.height);
s._highlightedPoint = pidx;
plot.plugins.barRenderer.highlightedSeriesIndex = sidx;
var opts = {fillStyle: s.highlightColors[pidx]};
s.renderer.shapeRenderer.draw(canvas._ctx, points, opts);
canvas = null;
}
function unhighlight (plot) {
var canvas = plot.plugins.barRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height);
for (var i=0; i<plot.series.length; i++) {
plot.series[i]._highlightedPoint = null;
}
plot.plugins.barRenderer.highlightedSeriesIndex = null;
plot.target.trigger('jqplotDataUnhighlight');
canvas = null;
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt1 = jQuery.Event('jqplotDataMouseOver');
evt1.pageX = ev.pageX;
evt1.pageY = ev.pageY;
plot.target.trigger(evt1, ins);
if (plot.series[ins[0]].show && plot.series[ins[0]].highlightMouseOver &&
!(ins[0] == plot.plugins.barRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, neighbor.seriesIndex, neighbor.pointIndex, neighbor.points);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseDown(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.barRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, neighbor.seriesIndex, neighbor.pointIndex, neighbor.points);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseUp(ev, gridpos, datapos, neighbor, plot) {
var idx = plot.plugins.barRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
}
function handleClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt = jQuery.Event('jqplotDataClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
function handleRightClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var idx = plot.plugins.barRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
var evt = jQuery.Event('jqplotDataRightClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,235 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.BlockRenderer
* Plugin renderer to draw a x-y block chart. A Block chart has data points displayed as
* colored squares with a text label inside. Data must be supplied in the form:
*
* > [[x1, y1, "label 1", {css}], [x2, y2, "label 2", {css}], ...]
*
* The label and css object are optional. If the label is ommitted, the
* box will collapse unless a css height and/or width is specified.
*
* The css object is an object specifying css properties
* such as:
*
* > {background:'#4f98a5', border:'3px solid gray', padding:'1px'}
*
* Note that css properties specified with the data point override defaults
* specified with the series.
*
*/
$.jqplot.BlockRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.BlockRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.BlockRenderer.prototype.constructor = $.jqplot.BlockRenderer;
// called with scope of a series
$.jqplot.BlockRenderer.prototype.init = function(options) {
// Group: Properties
//
// prop: css
// default css styles that will be applied to all data blocks.
// these values will be overridden by css styles supplied with the
// individulal data points.
this.css = {padding:'2px', border:'1px solid #999', textAlign:'center'};
// prop: escapeHtml
// true to escape html in the box label.
this.escapeHtml = false;
// prop: insertBreaks
// true to turn spaces in data block label into html breaks <br />.
this.insertBreaks = true;
// prop: varyBlockColors
// true to vary the color of each block in this series according to
// the seriesColors array. False to set each block to the color
// specified on this series. This has no effect if a css background color
// option is specified in the renderer css options.
this.varyBlockColors = false;
$.extend(true, this, options);
if (this.css.backgroundColor) {
this.color = this.css.backgroundColor;
}
else if (this.css.background) {
this.color = this.css.background;
}
else if (!this.varyBlockColors) {
this.css.background = this.color;
}
this.canvas = new $.jqplot.BlockCanvas();
this.shadowCanvas = new $.jqplot.BlockCanvas();
this.canvas._plotDimensions = this._plotDimensions;
this.shadowCanvas._plotDimensions = this._plotDimensions;
this._type = 'block';
// group: Methods
//
// Method: moveBlock
// Moves an individual block. More efficient than redrawing
// the whole series by calling plot.drawSeries().
// Properties:
// idx - the 0 based index of the block or point in this series.
// x - the x coordinate in data units (value on x axis) to move the block to.
// y - the y coordinate in data units (value on the y axis) to move the block to.
// duration - optional parameter to create an animated movement. Can be a
// number (higher is slower animation) or 'fast', 'normal' or 'slow'. If not
// provided, the element is moved without any animation.
this.moveBlock = function (idx, x, y, duration) {
// update plotData, stackData, data and gridData
// x and y are in data coordinates.
var el = this.canvas._elem.children(':eq('+idx+')');
this.data[idx][0] = x;
this.data[idx][1] = y;
this._plotData[idx][0] = x;
this._plotData[idx][1] = y;
this._stackData[idx][0] = x;
this._stackData[idx][1] = y;
this.gridData[idx][0] = this._xaxis.series_u2p(x);
this.gridData[idx][1] = this._yaxis.series_u2p(y);
var w = el.outerWidth();
var h = el.outerHeight();
var left = this.gridData[idx][0] - w/2 + 'px';
var top = this.gridData[idx][1] - h/2 + 'px';
if (duration) {
if (parseInt(duration, 10)) {
duration = parseInt(duration, 10);
}
el.animate({left:left, top:top}, duration);
}
else {
el.css({left:left, top:top});
}
el = null;
};
};
// called with scope of series
$.jqplot.BlockRenderer.prototype.draw = function (ctx, gd, options) {
if (this.plugins.pointLabels) {
this.plugins.pointLabels.show = false;
}
var i, el, d, gd, t, css, w, h, left, top;
var opts = (options != undefined) ? options : {};
var colorGenerator = new $.jqplot.ColorGenerator(this.seriesColors);
this.canvas._elem.empty();
for (i=0; i<this.gridData.length; i++) {
d = this.data[i];
gd = this.gridData[i];
t = '';
css = {};
if (typeof d[2] == 'string') {
t = d[2];
}
else if (typeof d[2] == 'object') {
css = d[2];
}
if (typeof d[3] == 'object') {
css = d[3];
}
if (this.insertBreaks){
t = t.replace(/ /g, '<br />');
}
css = $.extend(true, {}, this.css, css);
// create a div
el = $('<div style="position:absolute;margin-left:auto;margin-right:auto;"></div>');
this.canvas._elem.append(el);
// set text
this.escapeHtml ? el.text(t) : el.html(t);
// style it
// remove styles we don't want overridden.
delete css.position;
delete css.marginRight;
delete css.marginLeft;
if (!css.background && !css.backgroundColor && !css.backgroundImage){
css.background = colorGenerator.next();
}
el.css(css);
w = el.outerWidth();
h = el.outerHeight();
left = gd[0] - w/2 + 'px';
top = gd[1] - h/2 + 'px';
el.css({left:left, top:top});
el = null;
}
};
$.jqplot.BlockCanvas = function() {
$.jqplot.ElemContainer.call(this);
this._ctx;
};
$.jqplot.BlockCanvas.prototype = new $.jqplot.ElemContainer();
$.jqplot.BlockCanvas.prototype.constructor = $.jqplot.BlockCanvas;
$.jqplot.BlockCanvas.prototype.createElement = function(offsets, clss, plotDimensions) {
this._offsets = offsets;
var klass = 'jqplot-blockCanvas';
if (clss != undefined) {
klass = clss;
}
var elem;
// if this canvas already has a dom element, don't make a new one.
if (this._elem) {
elem = this._elem.get(0);
}
else {
elem = document.createElement('div');
}
// if new plotDimensions supplied, use them.
if (plotDimensions != undefined) {
this._plotDimensions = plotDimensions;
}
var w = this._plotDimensions.width - this._offsets.left - this._offsets.right + 'px';
var h = this._plotDimensions.height - this._offsets.top - this._offsets.bottom + 'px';
this._elem = $(elem);
this._elem.css({ position: 'absolute', width:w, height:h, left: this._offsets.left, top: this._offsets.top });
this._elem.addClass(klass);
return this._elem;
};
$.jqplot.BlockCanvas.prototype.setContext = function() {
this._ctx = {
canvas:{
width:0,
height:0
},
clearRect:function(){return null;}
};
return this._ctx;
};
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(a){a.jqplot.BlockRenderer=function(){a.jqplot.LineRenderer.call(this)};a.jqplot.BlockRenderer.prototype=new a.jqplot.LineRenderer();a.jqplot.BlockRenderer.prototype.constructor=a.jqplot.BlockRenderer;a.jqplot.BlockRenderer.prototype.init=function(b){this.css={padding:"2px",border:"1px solid #999",textAlign:"center"};this.escapeHtml=false;this.insertBreaks=true;this.varyBlockColors=false;a.extend(true,this,b);if(this.css.backgroundColor){this.color=this.css.backgroundColor}else{if(this.css.background){this.color=this.css.background}else{if(!this.varyBlockColors){this.css.background=this.color}}}this.canvas=new a.jqplot.BlockCanvas();this.shadowCanvas=new a.jqplot.BlockCanvas();this.canvas._plotDimensions=this._plotDimensions;this.shadowCanvas._plotDimensions=this._plotDimensions;this._type="block";this.moveBlock=function(l,j,i,e){var c=this.canvas._elem.children(":eq("+l+")");this.data[l][0]=j;this.data[l][1]=i;this._plotData[l][0]=j;this._plotData[l][1]=i;this._stackData[l][0]=j;this._stackData[l][1]=i;this.gridData[l][0]=this._xaxis.series_u2p(j);this.gridData[l][1]=this._yaxis.series_u2p(i);var k=c.outerWidth();var f=c.outerHeight();var d=this.gridData[l][0]-k/2+"px";var g=this.gridData[l][1]-f/2+"px";if(e){if(parseInt(e,10)){e=parseInt(e,10)}c.animate({left:d,top:g},e)}else{c.css({left:d,top:g})}c=null}};a.jqplot.BlockRenderer.prototype.draw=function(q,o,r){if(this.plugins.pointLabels){this.plugins.pointLabels.show=false}var f,c,l,o,p,k,n,g,e,m;var b=(r!=undefined)?r:{};var j=new a.jqplot.ColorGenerator(this.seriesColors);this.canvas._elem.empty();for(f=0;f<this.gridData.length;f++){l=this.data[f];o=this.gridData[f];p="";k={};if(typeof l[2]=="string"){p=l[2]}else{if(typeof l[2]=="object"){k=l[2]}}if(typeof l[3]=="object"){k=l[3]}if(this.insertBreaks){p=p.replace(/ /g,"<br />")}k=a.extend(true,{},this.css,k);c=a('<div style="position:absolute;margin-left:auto;margin-right:auto;"></div>');this.canvas._elem.append(c);this.escapeHtml?c.text(p):c.html(p);delete k.position;delete k.marginRight;delete k.marginLeft;if(!k.background&&!k.backgroundColor&&!k.backgroundImage){k.background=j.next()}c.css(k);n=c.outerWidth();g=c.outerHeight();e=o[0]-n/2+"px";m=o[1]-g/2+"px";c.css({left:e,top:m});c=null}};a.jqplot.BlockCanvas=function(){a.jqplot.ElemContainer.call(this);this._ctx};a.jqplot.BlockCanvas.prototype=new a.jqplot.ElemContainer();a.jqplot.BlockCanvas.prototype.constructor=a.jqplot.BlockCanvas;a.jqplot.BlockCanvas.prototype.createElement=function(i,e,c){this._offsets=i;var b="jqplot-blockCanvas";if(e!=undefined){b=e}var g;if(this._elem){g=this._elem.get(0)}else{g=document.createElement("div")}if(c!=undefined){this._plotDimensions=c}var d=this._plotDimensions.width-this._offsets.left-this._offsets.right+"px";var f=this._plotDimensions.height-this._offsets.top-this._offsets.bottom+"px";this._elem=a(g);this._elem.css({position:"absolute",width:d,height:f,left:this._offsets.left,top:this._offsets.top});this._elem.addClass(b);return this._elem};a.jqplot.BlockCanvas.prototype.setContext=function(){this._ctx={canvas:{width:0,height:0},clearRect:function(){return null}};return this._ctx}})(jQuery);

View File

@ -0,0 +1,759 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
var arrayMax = function( array ){
return Math.max.apply( Math, array );
};
var arrayMin = function( array ){
return Math.min.apply( Math, array );
};
/**
* Class: $.jqplot.BubbleRenderer
* Plugin renderer to draw a bubble chart. A Bubble chart has data points displayed as
* colored circles with an optional text label inside. To use
* the bubble renderer, you must include the bubble renderer like:
*
* > <script language="javascript" type="text/javascript" src="../src/plugins/jqplot.bubbleRenderer.js"></script>
*
* Data must be supplied in
* the form:
*
* > [[x1, y1, r1, <label or {label:'text', color:color}>], ...]
*
* where the label or options
* object is optional.
*
* Note that all bubble colors will be the same
* unless the "varyBubbleColors" option is set to true. Colors can be specified in the data array
* or in the seriesColors array option on the series. If no colors are defined, the default jqPlot
* series of 16 colors are used. Colors are automatically cycled around again if there are more
* bubbles than colors.
*
* Bubbles are autoscaled by default to fit within the chart area while maintaining
* relative sizes. If the "autoscaleBubbles" option is set to false, the r(adius) values
* in the data array a treated as literal pixel values for the radii of the bubbles.
*
* Properties are passed into the bubble renderer in the rendererOptions object of
* the series options like:
*
* > seriesDefaults: {
* > renderer: $.jqplot.BubbleRenderer,
* > rendererOptions: {
* > bubbleAlpha: 0.7,
* > varyBubbleColors: false
* > }
* > }
*
*/
$.jqplot.BubbleRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.BubbleRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.BubbleRenderer.prototype.constructor = $.jqplot.BubbleRenderer;
// called with scope of a series
$.jqplot.BubbleRenderer.prototype.init = function(options, plot) {
// Group: Properties
//
// prop: varyBubbleColors
// True to vary the color of each bubble in this series according to
// the seriesColors array. False to set each bubble to the color
// specified on this series. This has no effect if a css background color
// option is specified in the renderer css options.
this.varyBubbleColors = true;
// prop: autoscaleBubbles
// True to scale the bubble radius based on plot size.
// False will use the radius value as provided as a raw pixel value for
// bubble radius.
this.autoscaleBubbles = true;
// prop: autoscaleMultiplier
// Multiplier the bubble size if autoscaleBubbles is true.
this.autoscaleMultiplier = 1.0;
// prop: autoscalePointsFactor
// Factor which decreases bubble size based on how many bubbles on on the chart.
// 0 means no adjustment for number of bubbles. Negative values will decrease
// size of bubbles as more bubbles are added. Values between 0 and -0.2
// should work well.
this.autoscalePointsFactor = -0.07;
// prop: escapeHtml
// True to escape html in bubble label text.
this.escapeHtml = true;
// prop: highlightMouseOver
// True to highlight bubbles when moused over.
// This must be false to enable highlightMouseDown to highlight when clicking on a slice.
this.highlightMouseOver = true;
// prop: highlightMouseDown
// True to highlight when a mouse button is pressed over a bubble.
// This will be disabled if highlightMouseOver is true.
this.highlightMouseDown = false;
// prop: highlightColors
// An array of colors to use when highlighting a slice. Calculated automatically
// if not supplied.
this.highlightColors = [];
// prop: bubbleAlpha
// Alpha transparency to apply to all bubbles in this series.
this.bubbleAlpha = 1.0;
// prop: highlightAlpha
// Alpha transparency to apply when highlighting bubble.
// Set to value of bubbleAlpha by default.
this.highlightAlpha = null;
// prop: bubbleGradients
// True to color the bubbles with gradient fills instead of flat colors.
// NOT AVAILABLE IN IE due to lack of excanvas support for radial gradient fills.
// will be ignored in IE.
this.bubbleGradients = false;
// prop: showLabels
// True to show labels on bubbles (if any), false to not show.
this.showLabels = true;
// array of [point index, radius] which will be sorted in descending order to plot
// largest points below smaller points.
this.radii = [];
this.maxRadius = 0;
// index of the currenty highlighted point, if any
this._highlightedPoint = null;
// array of jQuery labels.
this.labels = [];
this.bubbleCanvases = [];
this._type = 'bubble';
// if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver
if (options.highlightMouseDown && options.highlightMouseOver == null) {
options.highlightMouseOver = false;
}
$.extend(true, this, options);
if (this.highlightAlpha == null) {
this.highlightAlpha = this.bubbleAlpha;
if (this.bubbleGradients) {
this.highlightAlpha = 0.35;
}
}
this.autoscaleMultiplier = this.autoscaleMultiplier * Math.pow(this.data.length, this.autoscalePointsFactor);
// index of the currenty highlighted point, if any
this._highlightedPoint = null;
// adjust the series colors for options colors passed in with data or for alpha.
// note, this can leave undefined holes in the seriesColors array.
var comps;
for (var i=0; i<this.data.length; i++) {
var color = null;
var d = this.data[i];
this.maxRadius = Math.max(this.maxRadius, d[2]);
if (d[3]) {
if (typeof(d[3]) == 'object') {
color = d[3]['color'];
}
}
if (color == null) {
if (this.seriesColors[i] != null) {
color = this.seriesColors[i];
}
}
if (color && this.bubbleAlpha < 1.0) {
comps = $.jqplot.getColorComponents(color);
color = 'rgba('+comps[0]+', '+comps[1]+', '+comps[2]+', '+this.bubbleAlpha+')';
}
if (color) {
this.seriesColors[i] = color;
}
}
if (!this.varyBubbleColors) {
this.seriesColors = [this.color];
}
this.colorGenerator = new $.jqplot.ColorGenerator(this.seriesColors);
// set highlight colors if none provided
if (this.highlightColors.length == 0) {
for (var i=0; i<this.seriesColors.length; i++){
var rgba = $.jqplot.getColorComponents(this.seriesColors[i]);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var sum = newrgb[0] + newrgb[1] + newrgb[2];
for (var j=0; j<3; j++) {
// when darkening, lowest color component can be is 60.
newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.3 * (255 - newrgb[j]);
newrgb[j] = parseInt(newrgb[j], 10);
}
this.highlightColors.push('rgba('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+', '+this.highlightAlpha+')');
}
}
this.highlightColorGenerator = new $.jqplot.ColorGenerator(this.highlightColors);
var sopts = {fill:true, isarc:true, angle:this.shadowAngle, alpha:this.shadowAlpha, closePath:true};
this.renderer.shadowRenderer.init(sopts);
this.canvas = new $.jqplot.DivCanvas();
this.canvas._plotDimensions = this._plotDimensions;
plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove);
plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown);
plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp);
plot.eventListenerHooks.addOnce('jqplotClick', handleClick);
plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick);
plot.postDrawHooks.addOnce(postPlotDraw);
};
// converts the user data values to grid coordinates and stores them
// in the gridData array.
// Called with scope of a series.
$.jqplot.BubbleRenderer.prototype.setGridData = function(plot) {
// recalculate the grid data
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var data = this._plotData;
this.gridData = [];
var radii = [];
this.radii = [];
var dim = Math.min(plot._height, plot._width);
for (var i=0; i<this.data.length; i++) {
if (data[i] != null) {
this.gridData.push([xp.call(this._xaxis, data[i][0]), yp.call(this._yaxis, data[i][1]), data[i][2]]);
this.radii.push([i, data[i][2]]);
radii.push(data[i][2]);
}
}
var r, val, maxr = this.maxRadius = arrayMax(radii);
var l = this.gridData.length;
if (this.autoscaleBubbles) {
for (var i=0; i<l; i++) {
val = radii[i]/maxr;
r = this.autoscaleMultiplier * dim / 6;
this.gridData[i][2] = r * val;
}
}
this.radii.sort(function(a, b) { return b[1] - a[1]; });
};
// converts any arbitrary data values to grid coordinates and
// returns them. This method exists so that plugins can use a series'
// linerenderer to generate grid data points without overwriting the
// grid data associated with that series.
// Called with scope of a series.
$.jqplot.BubbleRenderer.prototype.makeGridData = function(data, plot) {
// recalculate the grid data
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var gd = [];
var radii = [];
this.radii = [];
var dim = Math.min(plot._height, plot._width);
for (var i=0; i<data.length; i++) {
if (data[i] != null) {
gd.push([xp.call(this._xaxis, data[i][0]), yp.call(this._yaxis, data[i][1]), data[i][2]]);
radii.push(data[i][2]);
this.radii.push([i, data[i][2]]);
}
}
var r, val, maxr = this.maxRadius = arrayMax(radii);
var l = this.gridData.length;
if (this.autoscaleBubbles) {
for (var i=0; i<l; i++) {
val = radii[i]/maxr;
r = this.autoscaleMultiplier * dim / 6;
gd[i][2] = r * val;
}
}
this.radii.sort(function(a, b) { return b[1] - a[1]; });
return gd;
};
// called with scope of series
$.jqplot.BubbleRenderer.prototype.draw = function (ctx, gd, options) {
if (this.plugins.pointLabels) {
this.plugins.pointLabels.show = false;
}
var opts = (options != undefined) ? options : {};
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
this.canvas._elem.empty();
for (var i=0; i<this.radii.length; i++) {
var idx = this.radii[i][0];
var t=null;
var color = null;
var el = null;
var tel = null;
var d = this.data[idx];
var gd = this.gridData[idx];
if (d[3]) {
if (typeof(d[3]) == 'object') {
t = d[3]['label'];
}
else if (typeof(d[3]) == 'string') {
t = d[3];
}
}
// color = (this.varyBubbleColors) ? this.colorGenerator.get(idx) : this.color;
color = this.colorGenerator.get(idx);
// If we're drawing a shadow, expand the canvas dimensions to accomodate.
var canvasRadius = gd[2];
var offset, depth;
if (this.shadow) {
offset = (0.7 + gd[2]/40).toFixed(1);
depth = 1 + Math.ceil(gd[2]/15);
canvasRadius += offset*depth;
}
this.bubbleCanvases[idx] = new $.jqplot.BubbleCanvas();
this.canvas._elem.append(this.bubbleCanvases[idx].createElement(gd[0], gd[1], canvasRadius));
this.bubbleCanvases[idx].setContext();
var ctx = this.bubbleCanvases[idx]._ctx;
var x = ctx.canvas.width/2;
var y = ctx.canvas.height/2;
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [x, y, gd[2], 0, 2*Math.PI], {offset: offset, depth: depth});
}
this.bubbleCanvases[idx].draw(gd[2], color, this.bubbleGradients, this.shadowAngle/180*Math.PI);
// now draw label.
if (t && this.showLabels) {
tel = $('<div style="position:absolute;" class="jqplot-bubble-label"></div>');
if (this.escapeHtml) {
tel.text(t);
}
else {
tel.html(t);
}
this.canvas._elem.append(tel);
var h = $(tel).outerHeight();
var w = $(tel).outerWidth();
var top = gd[1] - 0.5*h;
var left = gd[0] - 0.5*w;
tel.css({top: top, left: left});
this.labels[idx] = $(tel);
}
}
};
$.jqplot.DivCanvas = function() {
$.jqplot.ElemContainer.call(this);
this._ctx;
};
$.jqplot.DivCanvas.prototype = new $.jqplot.ElemContainer();
$.jqplot.DivCanvas.prototype.constructor = $.jqplot.DivCanvas;
$.jqplot.DivCanvas.prototype.createElement = function(offsets, clss, plotDimensions) {
this._offsets = offsets;
var klass = 'jqplot-DivCanvas';
if (clss != undefined) {
klass = clss;
}
var elem;
// if this canvas already has a dom element, don't make a new one.
if (this._elem) {
elem = this._elem.get(0);
}
else {
elem = document.createElement('div');
}
// if new plotDimensions supplied, use them.
if (plotDimensions != undefined) {
this._plotDimensions = plotDimensions;
}
var w = this._plotDimensions.width - this._offsets.left - this._offsets.right + 'px';
var h = this._plotDimensions.height - this._offsets.top - this._offsets.bottom + 'px';
this._elem = $(elem);
this._elem.css({ position: 'absolute', width:w, height:h, left: this._offsets.left, top: this._offsets.top });
this._elem.addClass(klass);
return this._elem;
};
$.jqplot.DivCanvas.prototype.setContext = function() {
this._ctx = {
canvas:{
width:0,
height:0
},
clearRect:function(){return null;}
};
return this._ctx;
};
$.jqplot.BubbleCanvas = function() {
$.jqplot.ElemContainer.call(this);
this._ctx;
};
$.jqplot.BubbleCanvas.prototype = new $.jqplot.ElemContainer();
$.jqplot.BubbleCanvas.prototype.constructor = $.jqplot.BubbleCanvas;
// initialize with the x,y pont of bubble center and the bubble radius.
$.jqplot.BubbleCanvas.prototype.createElement = function(x, y, r) {
var klass = 'jqplot-bubble-point';
var elem;
// if this canvas already has a dom element, don't make a new one.
if (this._elem) {
elem = this._elem.get(0);
}
else {
elem = document.createElement('canvas');
}
elem.width = (r != null) ? 2*r : elem.width;
elem.height = (r != null) ? 2*r : elem.height;
this._elem = $(elem);
var l = (x != null && r != null) ? x - r : this._elem.css('left');
var t = (y != null && r != null) ? y - r : this._elem.css('top');
this._elem.css({ position: 'absolute', left: l, top: t });
this._elem.addClass(klass);
if ($.jqplot.use_excanvas) {
window.G_vmlCanvasManager.init_(document);
elem = window.G_vmlCanvasManager.initElement(elem);
}
return this._elem;
};
$.jqplot.BubbleCanvas.prototype.draw = function(r, color, gradients, angle) {
var ctx = this._ctx;
// r = Math.floor(r*1.04);
// var x = Math.round(ctx.canvas.width/2);
// var y = Math.round(ctx.canvas.height/2);
var x = ctx.canvas.width/2;
var y = ctx.canvas.height/2;
ctx.save();
if (gradients && !$.jqplot.use_excanvas) {
r = r*1.04;
var comps = $.jqplot.getColorComponents(color);
var colorinner = 'rgba('+Math.round(comps[0]+0.8*(255-comps[0]))+', '+Math.round(comps[1]+0.8*(255-comps[1]))+', '+Math.round(comps[2]+0.8*(255-comps[2]))+', '+comps[3]+')';
var colorend = 'rgba('+comps[0]+', '+comps[1]+', '+comps[2]+', 0)';
// var rinner = Math.round(0.35 * r);
// var xinner = Math.round(x - Math.cos(angle) * 0.33 * r);
// var yinner = Math.round(y - Math.sin(angle) * 0.33 * r);
var rinner = 0.35 * r;
var xinner = x - Math.cos(angle) * 0.33 * r;
var yinner = y - Math.sin(angle) * 0.33 * r;
var radgrad = ctx.createRadialGradient(xinner, yinner, rinner, x, y, r);
radgrad.addColorStop(0, colorinner);
radgrad.addColorStop(0.93, color);
radgrad.addColorStop(0.96, colorend);
radgrad.addColorStop(1, colorend);
// radgrad.addColorStop(.98, colorend);
ctx.fillStyle = radgrad;
ctx.fillRect(0,0, ctx.canvas.width, ctx.canvas.height);
}
else {
ctx.fillStyle = color;
ctx.strokeStyle = color;
ctx.lineWidth = 1;
ctx.beginPath();
var ang = 2*Math.PI;
ctx.arc(x, y, r, 0, ang, 0);
ctx.closePath();
ctx.fill();
}
ctx.restore();
};
$.jqplot.BubbleCanvas.prototype.setContext = function() {
this._ctx = this._elem.get(0).getContext("2d");
return this._ctx;
};
$.jqplot.BubbleAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
};
$.jqplot.BubbleAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.BubbleAxisRenderer.prototype.constructor = $.jqplot.BubbleAxisRenderer;
// called with scope of axis object.
$.jqplot.BubbleAxisRenderer.prototype.init = function(options){
$.extend(true, this, options);
var db = this._dataBounds;
var minsidx = 0,
minpidx = 0,
maxsidx = 0,
maxpidx = 0,
maxr = 0,
minr = 0,
minMaxRadius = 0,
maxMaxRadius = 0,
maxMult = 0,
minMult = 0;
// Go through all the series attached to this axis and find
// the min/max bounds for this axis.
for (var i=0; i<this._series.length; i++) {
var s = this._series[i];
var d = s._plotData;
for (var j=0; j<d.length; j++) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
if (d[j][0] < db.min || db.min == null) {
db.min = d[j][0];
minsidx=i;
minpidx=j;
minr = d[j][2];
minMaxRadius = s.maxRadius;
minMult = s.autoscaleMultiplier;
}
if (d[j][0] > db.max || db.max == null) {
db.max = d[j][0];
maxsidx=i;
maxpidx=j;
maxr = d[j][2];
maxMaxRadius = s.maxRadius;
maxMult = s.autoscaleMultiplier;
}
}
else {
if (d[j][1] < db.min || db.min == null) {
db.min = d[j][1];
minsidx=i;
minpidx=j;
minr = d[j][2];
minMaxRadius = s.maxRadius;
minMult = s.autoscaleMultiplier;
}
if (d[j][1] > db.max || db.max == null) {
db.max = d[j][1];
maxsidx=i;
maxpidx=j;
maxr = d[j][2];
maxMaxRadius = s.maxRadius;
maxMult = s.autoscaleMultiplier;
}
}
}
}
var minRatio = minr/minMaxRadius;
var maxRatio = maxr/maxMaxRadius;
// need to estimate the effect of the radius on total axis span and adjust axis accordingly.
var span = db.max - db.min;
// var dim = (this.name == 'xaxis' || this.name == 'x2axis') ? this._plotDimensions.width : this._plotDimensions.height;
var dim = Math.min(this._plotDimensions.width, this._plotDimensions.height);
var minfact = minRatio * minMult/3 * span;
var maxfact = maxRatio * maxMult/3 * span;
db.max += maxfact;
db.min -= minfact;
};
function highlight (plot, sidx, pidx) {
plot.plugins.bubbleRenderer.highlightLabelCanvas.empty();
var s = plot.series[sidx];
var canvas = plot.plugins.bubbleRenderer.highlightCanvas;
var ctx = canvas._ctx;
ctx.clearRect(0,0,ctx.canvas.width, ctx.canvas.height);
s._highlightedPoint = pidx;
plot.plugins.bubbleRenderer.highlightedSeriesIndex = sidx;
var color = s.highlightColorGenerator.get(pidx);
var x = s.gridData[pidx][0],
y = s.gridData[pidx][1],
r = s.gridData[pidx][2];
ctx.save();
ctx.fillStyle = color;
ctx.strokeStyle = color;
ctx.lineWidth = 1;
ctx.beginPath();
ctx.arc(x, y, r, 0, 2*Math.PI, 0);
ctx.closePath();
ctx.fill();
ctx.restore();
// bring label to front
if (s.labels[pidx]) {
plot.plugins.bubbleRenderer.highlightLabel = s.labels[pidx].clone();
plot.plugins.bubbleRenderer.highlightLabel.appendTo(plot.plugins.bubbleRenderer.highlightLabelCanvas);
plot.plugins.bubbleRenderer.highlightLabel.addClass('jqplot-bubble-label-highlight');
}
}
function unhighlight (plot) {
var canvas = plot.plugins.bubbleRenderer.highlightCanvas;
var sidx = plot.plugins.bubbleRenderer.highlightedSeriesIndex;
plot.plugins.bubbleRenderer.highlightLabelCanvas.empty();
canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height);
for (var i=0; i<plot.series.length; i++) {
plot.series[i]._highlightedPoint = null;
}
plot.plugins.bubbleRenderer.highlightedSeriesIndex = null;
plot.target.trigger('jqplotDataUnhighlight');
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var si = neighbor.seriesIndex;
var pi = neighbor.pointIndex;
var ins = [si, pi, neighbor.data, plot.series[si].gridData[pi][2]];
var evt1 = jQuery.Event('jqplotDataMouseOver');
evt1.pageX = ev.pageX;
evt1.pageY = ev.pageY;
plot.target.trigger(evt1, ins);
if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.bubbleRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseDown(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var si = neighbor.seriesIndex;
var pi = neighbor.pointIndex;
var ins = [si, pi, neighbor.data, plot.series[si].gridData[pi][2]];
if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.bubbleRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseUp(ev, gridpos, datapos, neighbor, plot) {
var idx = plot.plugins.bubbleRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
}
function handleClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var si = neighbor.seriesIndex;
var pi = neighbor.pointIndex;
var ins = [si, pi, neighbor.data, plot.series[si].gridData[pi][2]];
var evt = jQuery.Event('jqplotDataClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
function handleRightClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var si = neighbor.seriesIndex;
var pi = neighbor.pointIndex;
var ins = [si, pi, neighbor.data, plot.series[si].gridData[pi][2]];
var idx = plot.plugins.bubbleRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
var evt = jQuery.Event('jqplotDataRightClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
function postPlotDraw() {
// Memory Leaks patch
if (this.plugins.bubbleRenderer && this.plugins.bubbleRenderer.highlightCanvas) {
this.plugins.bubbleRenderer.highlightCanvas.resetCanvas();
this.plugins.bubbleRenderer.highlightCanvas = null;
}
this.plugins.bubbleRenderer = {highlightedSeriesIndex:null};
this.plugins.bubbleRenderer.highlightCanvas = new $.jqplot.GenericCanvas();
this.plugins.bubbleRenderer.highlightLabel = null;
this.plugins.bubbleRenderer.highlightLabelCanvas = $('<div style="position:absolute;"></div>');
var top = this._gridPadding.top;
var left = this._gridPadding.left;
var width = this._plotDimensions.width - this._gridPadding.left - this._gridPadding.right;
var height = this._plotDimensions.height - this._gridPadding.top - this._gridPadding.bottom;
this.plugins.bubbleRenderer.highlightLabelCanvas.css({top:top, left:left, width:width+'px', height:height+'px'});
this.eventCanvas._elem.before(this.plugins.bubbleRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-bubbleRenderer-highlight-canvas', this._plotDimensions, this));
this.eventCanvas._elem.before(this.plugins.bubbleRenderer.highlightLabelCanvas);
var hctx = this.plugins.bubbleRenderer.highlightCanvas.setContext();
}
// setup default renderers for axes and legend so user doesn't have to
// called with scope of plot
function preInit(target, data, options) {
options = options || {};
options.axesDefaults = options.axesDefaults || {};
options.seriesDefaults = options.seriesDefaults || {};
// only set these if there is a Bubble series
var setopts = false;
if (options.seriesDefaults.renderer == $.jqplot.BubbleRenderer) {
setopts = true;
}
else if (options.series) {
for (var i=0; i < options.series.length; i++) {
if (options.series[i].renderer == $.jqplot.BubbleRenderer) {
setopts = true;
}
}
}
if (setopts) {
options.axesDefaults.renderer = $.jqplot.BubbleAxisRenderer;
options.sortData = false;
}
}
$.jqplot.preInitHooks.push(preInit);
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,203 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.CanvasAxisLabelRenderer
* Renderer to draw axis labels with a canvas element to support advanced
* featrues such as rotated text. This renderer uses a separate rendering engine
* to draw the text on the canvas. Two modes of rendering the text are available.
* If the browser has native font support for canvas fonts (currently Mozila 3.5
* and Safari 4), you can enable text rendering with the canvas fillText method.
* You do so by setting the "enableFontSupport" option to true.
*
* Browsers lacking native font support will have the text drawn on the canvas
* using the Hershey font metrics. Even if the "enableFontSupport" option is true
* non-supporting browsers will still render with the Hershey font.
*
*/
$.jqplot.CanvasAxisLabelRenderer = function(options) {
// Group: Properties
// prop: angle
// angle of text, measured clockwise from x axis.
this.angle = 0;
// name of the axis associated with this tick
this.axis;
// prop: show
// whether or not to show the tick (mark and label).
this.show = true;
// prop: showLabel
// whether or not to show the label.
this.showLabel = true;
// prop: label
// label for the axis.
this.label = '';
// prop: fontFamily
// CSS spec for the font-family css attribute.
// Applies only to browsers supporting native font rendering in the
// canvas tag. Currently Mozilla 3.5 and Safari 4.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif';
// prop: fontSize
// CSS spec for font size.
this.fontSize = '11pt';
// prop: fontWeight
// CSS spec for fontWeight: normal, bold, bolder, lighter or a number 100 - 900
this.fontWeight = 'normal';
// prop: fontStretch
// Multiplier to condense or expand font width.
// Applies only to browsers which don't support canvas native font rendering.
this.fontStretch = 1.0;
// prop: textColor
// css spec for the color attribute.
this.textColor = '#666666';
// prop: enableFontSupport
// true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
// If true, label will be drawn with canvas tag native support for fonts.
// If false, label will be drawn with Hershey font metrics.
this.enableFontSupport = true;
// prop: pt2px
// Point to pixel scaling factor, used for computing height of bounding box
// around a label. The labels text renderer has a default setting of 1.4, which
// should be suitable for most fonts. Leave as null to use default. If tops of
// letters appear clipped, increase this. If bounding box seems too big, decrease.
// This is an issue only with the native font renderering capabilities of Mozilla
// 3.5 and Safari 4 since they do not provide a method to determine the font height.
this.pt2px = null;
this._elem;
this._ctx;
this._plotWidth;
this._plotHeight;
this._plotDimensions = {height:null, width:null};
$.extend(true, this, options);
if (options.angle == null && this.axis != 'xaxis' && this.axis != 'x2axis') {
this.angle = -90;
}
var ropts = {fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily};
if (this.pt2px) {
ropts.pt2px = this.pt2px;
}
if (this.enableFontSupport) {
if ($.jqplot.support_canvas_text()) {
this._textRenderer = new $.jqplot.CanvasFontRenderer(ropts);
}
else {
this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts);
}
}
else {
this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts);
}
};
$.jqplot.CanvasAxisLabelRenderer.prototype.init = function(options) {
$.extend(true, this, options);
this._textRenderer.init({fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily});
};
// return width along the x axis
// will check first to see if an element exists.
// if not, will return the computed text box width.
$.jqplot.CanvasAxisLabelRenderer.prototype.getWidth = function(ctx) {
if (this._elem) {
return this._elem.outerWidth(true);
}
else {
var tr = this._textRenderer;
var l = tr.getWidth(ctx);
var h = tr.getHeight(ctx);
var w = Math.abs(Math.sin(tr.angle)*h) + Math.abs(Math.cos(tr.angle)*l);
return w;
}
};
// return height along the y axis.
$.jqplot.CanvasAxisLabelRenderer.prototype.getHeight = function(ctx) {
if (this._elem) {
return this._elem.outerHeight(true);
}
else {
var tr = this._textRenderer;
var l = tr.getWidth(ctx);
var h = tr.getHeight(ctx);
var w = Math.abs(Math.cos(tr.angle)*h) + Math.abs(Math.sin(tr.angle)*l);
return w;
}
};
$.jqplot.CanvasAxisLabelRenderer.prototype.getAngleRad = function() {
var a = this.angle * Math.PI/180;
return a;
};
$.jqplot.CanvasAxisLabelRenderer.prototype.draw = function(ctx, plot) {
// Memory Leaks patch
if (this._elem) {
if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) {
window.G_vmlCanvasManager.uninitElement(this._elem.get(0));
}
this._elem.emptyForce();
this._elem = null;
}
// create a canvas here, but can't draw on it untill it is appended
// to dom for IE compatability.
var elem = plot.canvasManager.getCanvas();
this._textRenderer.setText(this.label, ctx);
var w = this.getWidth(ctx);
var h = this.getHeight(ctx);
elem.width = w;
elem.height = h;
elem.style.width = w;
elem.style.height = h;
elem = plot.canvasManager.initCanvas(elem);
this._elem = $(elem);
this._elem.css({ position: 'absolute'});
this._elem.addClass('jqplot-'+this.axis+'-label');
elem = null;
return this._elem;
};
$.jqplot.CanvasAxisLabelRenderer.prototype.pack = function() {
this._textRenderer.draw(this._elem.get(0).getContext("2d"), this.label);
};
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(a){a.jqplot.CanvasAxisLabelRenderer=function(b){this.angle=0;this.axis;this.show=true;this.showLabel=true;this.label="";this.fontFamily='"Trebuchet MS", Arial, Helvetica, sans-serif';this.fontSize="11pt";this.fontWeight="normal";this.fontStretch=1;this.textColor="#666666";this.enableFontSupport=true;this.pt2px=null;this._elem;this._ctx;this._plotWidth;this._plotHeight;this._plotDimensions={height:null,width:null};a.extend(true,this,b);if(b.angle==null&&this.axis!="xaxis"&&this.axis!="x2axis"){this.angle=-90}var c={fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily};if(this.pt2px){c.pt2px=this.pt2px}if(this.enableFontSupport){if(a.jqplot.support_canvas_text()){this._textRenderer=new a.jqplot.CanvasFontRenderer(c)}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}};a.jqplot.CanvasAxisLabelRenderer.prototype.init=function(b){a.extend(true,this,b);this._textRenderer.init({fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily})};a.jqplot.CanvasAxisLabelRenderer.prototype.getWidth=function(d){if(this._elem){return this._elem.outerWidth(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.sin(f.angle)*e)+Math.abs(Math.cos(f.angle)*c);return b}};a.jqplot.CanvasAxisLabelRenderer.prototype.getHeight=function(d){if(this._elem){return this._elem.outerHeight(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.cos(f.angle)*e)+Math.abs(Math.sin(f.angle)*c);return b}};a.jqplot.CanvasAxisLabelRenderer.prototype.getAngleRad=function(){var b=this.angle*Math.PI/180;return b};a.jqplot.CanvasAxisLabelRenderer.prototype.draw=function(c,f){if(this._elem){if(a.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==undefined){window.G_vmlCanvasManager.uninitElement(this._elem.get(0))}this._elem.emptyForce();this._elem=null}var e=f.canvasManager.getCanvas();this._textRenderer.setText(this.label,c);var b=this.getWidth(c);var d=this.getHeight(c);e.width=b;e.height=d;e.style.width=b;e.style.height=d;e=f.canvasManager.initCanvas(e);this._elem=a(e);this._elem.css({position:"absolute"});this._elem.addClass("jqplot-"+this.axis+"-label");e=null;return this._elem};a.jqplot.CanvasAxisLabelRenderer.prototype.pack=function(){this._textRenderer.draw(this._elem.get(0).getContext("2d"),this.label)}})(jQuery);

View File

@ -0,0 +1,253 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.CanvasAxisTickRenderer
* Renderer to draw axis ticks with a canvas element to support advanced
* featrues such as rotated text. This renderer uses a separate rendering engine
* to draw the text on the canvas. Two modes of rendering the text are available.
* If the browser has native font support for canvas fonts (currently Mozila 3.5
* and Safari 4), you can enable text rendering with the canvas fillText method.
* You do so by setting the "enableFontSupport" option to true.
*
* Browsers lacking native font support will have the text drawn on the canvas
* using the Hershey font metrics. Even if the "enableFontSupport" option is true
* non-supporting browsers will still render with the Hershey font.
*/
$.jqplot.CanvasAxisTickRenderer = function(options) {
// Group: Properties
// prop: mark
// tick mark on the axis. One of 'inside', 'outside', 'cross', '' or null.
this.mark = 'outside';
// prop: showMark
// whether or not to show the mark on the axis.
this.showMark = true;
// prop: showGridline
// whether or not to draw the gridline on the grid at this tick.
this.showGridline = true;
// prop: isMinorTick
// if this is a minor tick.
this.isMinorTick = false;
// prop: angle
// angle of text, measured clockwise from x axis.
this.angle = 0;
// prop: markSize
// Length of the tick marks in pixels. For 'cross' style, length
// will be stoked above and below axis, so total length will be twice this.
this.markSize = 4;
// prop: show
// whether or not to show the tick (mark and label).
this.show = true;
// prop: showLabel
// whether or not to show the label.
this.showLabel = true;
// prop: labelPosition
// 'auto', 'start', 'middle' or 'end'.
// Whether tick label should be positioned so the start, middle, or end
// of the tick mark.
this.labelPosition = 'auto';
this.label = '';
this.value = null;
this._styles = {};
// prop: formatter
// A class of a formatter for the tick text.
// The default $.jqplot.DefaultTickFormatter uses sprintf.
this.formatter = $.jqplot.DefaultTickFormatter;
// prop: formatString
// string passed to the formatter.
this.formatString = '';
// prop: prefix
// String to prepend to the tick label.
// Prefix is prepended to the formatted tick label.
this.prefix = '';
// prop: fontFamily
// css spec for the font-family css attribute.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif';
// prop: fontSize
// CSS spec for font size.
this.fontSize = '10pt';
// prop: fontWeight
// CSS spec for fontWeight
this.fontWeight = 'normal';
// prop: fontStretch
// Multiplier to condense or expand font width.
// Applies only to browsers which don't support canvas native font rendering.
this.fontStretch = 1.0;
// prop: textColor
// css spec for the color attribute.
this.textColor = '#666666';
// prop: enableFontSupport
// true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
// If true, tick label will be drawn with canvas tag native support for fonts.
// If false, tick label will be drawn with Hershey font metrics.
this.enableFontSupport = true;
// prop: pt2px
// Point to pixel scaling factor, used for computing height of bounding box
// around a label. The labels text renderer has a default setting of 1.4, which
// should be suitable for most fonts. Leave as null to use default. If tops of
// letters appear clipped, increase this. If bounding box seems too big, decrease.
// This is an issue only with the native font renderering capabilities of Mozilla
// 3.5 and Safari 4 since they do not provide a method to determine the font height.
this.pt2px = null;
this._elem;
this._ctx;
this._plotWidth;
this._plotHeight;
this._plotDimensions = {height:null, width:null};
$.extend(true, this, options);
var ropts = {fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily};
if (this.pt2px) {
ropts.pt2px = this.pt2px;
}
if (this.enableFontSupport) {
if ($.jqplot.support_canvas_text()) {
this._textRenderer = new $.jqplot.CanvasFontRenderer(ropts);
}
else {
this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts);
}
}
else {
this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts);
}
};
$.jqplot.CanvasAxisTickRenderer.prototype.init = function(options) {
$.extend(true, this, options);
this._textRenderer.init({fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily});
};
// return width along the x axis
// will check first to see if an element exists.
// if not, will return the computed text box width.
$.jqplot.CanvasAxisTickRenderer.prototype.getWidth = function(ctx) {
if (this._elem) {
return this._elem.outerWidth(true);
}
else {
var tr = this._textRenderer;
var l = tr.getWidth(ctx);
var h = tr.getHeight(ctx);
var w = Math.abs(Math.sin(tr.angle)*h) + Math.abs(Math.cos(tr.angle)*l);
return w;
}
};
// return height along the y axis.
$.jqplot.CanvasAxisTickRenderer.prototype.getHeight = function(ctx) {
if (this._elem) {
return this._elem.outerHeight(true);
}
else {
var tr = this._textRenderer;
var l = tr.getWidth(ctx);
var h = tr.getHeight(ctx);
var w = Math.abs(Math.cos(tr.angle)*h) + Math.abs(Math.sin(tr.angle)*l);
return w;
}
};
// return top.
$.jqplot.CanvasAxisTickRenderer.prototype.getTop = function(ctx) {
if (this._elem) {
return this._elem.position().top;
}
else {
return null;
}
};
$.jqplot.CanvasAxisTickRenderer.prototype.getAngleRad = function() {
var a = this.angle * Math.PI/180;
return a;
};
$.jqplot.CanvasAxisTickRenderer.prototype.setTick = function(value, axisName, isMinor) {
this.value = value;
if (isMinor) {
this.isMinorTick = true;
}
return this;
};
$.jqplot.CanvasAxisTickRenderer.prototype.draw = function(ctx, plot) {
if (!this.label) {
this.label = this.prefix + this.formatter(this.formatString, this.value);
}
// Memory Leaks patch
if (this._elem) {
if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) {
window.G_vmlCanvasManager.uninitElement(this._elem.get(0));
}
this._elem.emptyForce();
this._elem = null;
}
// create a canvas here, but can't draw on it untill it is appended
// to dom for IE compatability.
var elem = plot.canvasManager.getCanvas();
this._textRenderer.setText(this.label, ctx);
var w = this.getWidth(ctx);
var h = this.getHeight(ctx);
// canvases seem to need to have width and heigh attributes directly set.
elem.width = w;
elem.height = h;
elem.style.width = w;
elem.style.height = h;
elem.style.textAlign = 'left';
elem.style.position = 'absolute';
elem = plot.canvasManager.initCanvas(elem);
this._elem = $(elem);
this._elem.css(this._styles);
this._elem.addClass('jqplot-'+this.axis+'-tick');
elem = null;
return this._elem;
};
$.jqplot.CanvasAxisTickRenderer.prototype.pack = function() {
this._textRenderer.draw(this._elem.get(0).getContext("2d"), this.label);
};
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(a){a.jqplot.CanvasAxisTickRenderer=function(b){this.mark="outside";this.showMark=true;this.showGridline=true;this.isMinorTick=false;this.angle=0;this.markSize=4;this.show=true;this.showLabel=true;this.labelPosition="auto";this.label="";this.value=null;this._styles={};this.formatter=a.jqplot.DefaultTickFormatter;this.formatString="";this.prefix="";this.fontFamily='"Trebuchet MS", Arial, Helvetica, sans-serif';this.fontSize="10pt";this.fontWeight="normal";this.fontStretch=1;this.textColor="#666666";this.enableFontSupport=true;this.pt2px=null;this._elem;this._ctx;this._plotWidth;this._plotHeight;this._plotDimensions={height:null,width:null};a.extend(true,this,b);var c={fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily};if(this.pt2px){c.pt2px=this.pt2px}if(this.enableFontSupport){if(a.jqplot.support_canvas_text()){this._textRenderer=new a.jqplot.CanvasFontRenderer(c)}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}};a.jqplot.CanvasAxisTickRenderer.prototype.init=function(b){a.extend(true,this,b);this._textRenderer.init({fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily})};a.jqplot.CanvasAxisTickRenderer.prototype.getWidth=function(d){if(this._elem){return this._elem.outerWidth(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.sin(f.angle)*e)+Math.abs(Math.cos(f.angle)*c);return b}};a.jqplot.CanvasAxisTickRenderer.prototype.getHeight=function(d){if(this._elem){return this._elem.outerHeight(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.cos(f.angle)*e)+Math.abs(Math.sin(f.angle)*c);return b}};a.jqplot.CanvasAxisTickRenderer.prototype.getTop=function(b){if(this._elem){return this._elem.position().top}else{return null}};a.jqplot.CanvasAxisTickRenderer.prototype.getAngleRad=function(){var b=this.angle*Math.PI/180;return b};a.jqplot.CanvasAxisTickRenderer.prototype.setTick=function(b,d,c){this.value=b;if(c){this.isMinorTick=true}return this};a.jqplot.CanvasAxisTickRenderer.prototype.draw=function(c,f){if(!this.label){this.label=this.prefix+this.formatter(this.formatString,this.value)}if(this._elem){if(a.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==undefined){window.G_vmlCanvasManager.uninitElement(this._elem.get(0))}this._elem.emptyForce();this._elem=null}var e=f.canvasManager.getCanvas();this._textRenderer.setText(this.label,c);var b=this.getWidth(c);var d=this.getHeight(c);e.width=b;e.height=d;e.style.width=b;e.style.height=d;e.style.textAlign="left";e.style.position="absolute";e=f.canvasManager.initCanvas(e);this._elem=a(e);this._elem.css(this._styles);this._elem.addClass("jqplot-"+this.axis+"-tick");e=null;return this._elem};a.jqplot.CanvasAxisTickRenderer.prototype.pack=function(){this._textRenderer.draw(this._elem.get(0).getContext("2d"),this.label)}})(jQuery);

File diff suppressed because it is too large Load Diff

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,449 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
* included jsDate library by Chris Leonello:
*
* Copyright (c) 2010-2015 Chris Leonello
*
* jsDate is currently available for use in all personal or commercial projects
* under both the MIT and GPL version 2.0 licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* jsDate borrows many concepts and ideas from the Date Instance
* Methods by Ken Snyder along with some parts of Ken's actual code.
*
* Ken's original Date Instance Methods and copyright notice:
*
* Ken Snyder (ken d snyder at gmail dot com)
* 2008-09-10
* version 2.0.2 (http://kendsnyder.com/sandbox/date/)
* Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/)
*
* jqplotToImage function based on Larry Siden's export-jqplot-to-png.js.
* Larry has generously given permission to adapt his code for inclusion
* into jqPlot.
*
* Larry's original code can be found here:
*
* https://github.com/lsiden/export-jqplot-to-png
*
*
*/
(function($) {
// This code is a modified version of the canvastext.js code, copyright below:
//
// This code is released to the public domain by Jim Studt, 2007.
// He may keep some sort of up to date copy at http://www.federated.com/~jim/canvastext/
//
$.jqplot.CanvasTextRenderer = function(options){
this.fontStyle = 'normal'; // normal, italic, oblique [not implemented]
this.fontVariant = 'normal'; // normal, small caps [not implemented]
this.fontWeight = 'normal'; // normal, bold, bolder, lighter, 100 - 900
this.fontSize = '10px';
this.fontFamily = 'sans-serif';
this.fontStretch = 1.0;
this.fillStyle = '#666666';
this.angle = 0;
this.textAlign = 'start';
this.textBaseline = 'alphabetic';
this.text;
this.width;
this.height;
this.pt2px = 1.28;
$.extend(true, this, options);
this.normalizedFontSize = this.normalizeFontSize(this.fontSize);
this.setHeight();
};
$.jqplot.CanvasTextRenderer.prototype.init = function(options) {
$.extend(true, this, options);
this.normalizedFontSize = this.normalizeFontSize(this.fontSize);
this.setHeight();
};
// convert css spec into point size
// returns float
$.jqplot.CanvasTextRenderer.prototype.normalizeFontSize = function(sz) {
sz = String(sz);
var n = parseFloat(sz);
if (sz.indexOf('px') > -1) {
return n/this.pt2px;
}
else if (sz.indexOf('pt') > -1) {
return n;
}
else if (sz.indexOf('em') > -1) {
return n*12;
}
else if (sz.indexOf('%') > -1) {
return n*12/100;
}
// default to pixels;
else {
return n/this.pt2px;
}
};
$.jqplot.CanvasTextRenderer.prototype.fontWeight2Float = function(w) {
// w = normal | bold | bolder | lighter | 100 | 200 | 300 | 400 | 500 | 600 | 700 | 800 | 900
// return values adjusted for Hershey font.
if (Number(w)) {
return w/400;
}
else {
switch (w) {
case 'normal':
return 1;
break;
case 'bold':
return 1.75;
break;
case 'bolder':
return 2.25;
break;
case 'lighter':
return 0.75;
break;
default:
return 1;
break;
}
}
};
$.jqplot.CanvasTextRenderer.prototype.getText = function() {
return this.text;
};
$.jqplot.CanvasTextRenderer.prototype.setText = function(t, ctx) {
this.text = t;
this.setWidth(ctx);
return this;
};
$.jqplot.CanvasTextRenderer.prototype.getWidth = function(ctx) {
return this.width;
};
$.jqplot.CanvasTextRenderer.prototype.setWidth = function(ctx, w) {
if (!w) {
this.width = this.measure(ctx, this.text);
}
else {
this.width = w;
}
return this;
};
// return height in pixels.
$.jqplot.CanvasTextRenderer.prototype.getHeight = function(ctx) {
return this.height;
};
// w - height in pt
// set heigh in px
$.jqplot.CanvasTextRenderer.prototype.setHeight = function(w) {
if (!w) {
//height = this.fontSize /0.75;
this.height = this.normalizedFontSize * this.pt2px;
}
else {
this.height = w;
}
return this;
};
$.jqplot.CanvasTextRenderer.prototype.letter = function (ch)
{
return this.letters[ch];
};
$.jqplot.CanvasTextRenderer.prototype.ascent = function()
{
return this.normalizedFontSize;
};
$.jqplot.CanvasTextRenderer.prototype.descent = function()
{
return 7.0*this.normalizedFontSize/25.0;
};
$.jqplot.CanvasTextRenderer.prototype.measure = function(ctx, str)
{
var total = 0;
var len = str.length;
for (var i = 0; i < len; i++) {
var c = this.letter(str.charAt(i));
if (c) {
total += c.width * this.normalizedFontSize / 25.0 * this.fontStretch;
}
}
return total;
};
$.jqplot.CanvasTextRenderer.prototype.draw = function(ctx,str)
{
var x = 0;
// leave room at bottom for descenders.
var y = this.height*0.72;
var total = 0;
var len = str.length;
var mag = this.normalizedFontSize / 25.0;
ctx.save();
var tx, ty;
// 1st quadrant
if ((-Math.PI/2 <= this.angle && this.angle <= 0) || (Math.PI*3/2 <= this.angle && this.angle <= Math.PI*2)) {
tx = 0;
ty = -Math.sin(this.angle) * this.width;
}
// 4th quadrant
else if ((0 < this.angle && this.angle <= Math.PI/2) || (-Math.PI*2 <= this.angle && this.angle <= -Math.PI*3/2)) {
tx = Math.sin(this.angle) * this.height;
ty = 0;
}
// 2nd quadrant
else if ((-Math.PI < this.angle && this.angle < -Math.PI/2) || (Math.PI <= this.angle && this.angle <= Math.PI*3/2)) {
tx = -Math.cos(this.angle) * this.width;
ty = -Math.sin(this.angle) * this.width - Math.cos(this.angle) * this.height;
}
// 3rd quadrant
else if ((-Math.PI*3/2 < this.angle && this.angle < Math.PI) || (Math.PI/2 < this.angle && this.angle < Math.PI)) {
tx = Math.sin(this.angle) * this.height - Math.cos(this.angle)*this.width;
ty = -Math.cos(this.angle) * this.height;
}
ctx.strokeStyle = this.fillStyle;
ctx.fillStyle = this.fillStyle;
ctx.translate(tx, ty);
ctx.rotate(this.angle);
ctx.lineCap = "round";
// multiplier was 2.0
var fact = (this.normalizedFontSize > 30) ? 2.0 : 2 + (30 - this.normalizedFontSize)/20;
ctx.lineWidth = fact * mag * this.fontWeight2Float(this.fontWeight);
for ( var i = 0; i < len; i++) {
var c = this.letter( str.charAt(i));
if ( !c) {
continue;
}
ctx.beginPath();
var penUp = 1;
var needStroke = 0;
for ( var j = 0; j < c.points.length; j++) {
var a = c.points[j];
if ( a[0] == -1 && a[1] == -1) {
penUp = 1;
continue;
}
if ( penUp) {
ctx.moveTo( x + a[0]*mag*this.fontStretch, y - a[1]*mag);
penUp = false;
} else {
ctx.lineTo( x + a[0]*mag*this.fontStretch, y - a[1]*mag);
}
}
ctx.stroke();
x += c.width*mag*this.fontStretch;
}
ctx.restore();
return total;
};
$.jqplot.CanvasTextRenderer.prototype.letters = {
' ': { width: 16, points: [] },
'!': { width: 10, points: [[5,21],[5,7],[-1,-1],[5,2],[4,1],[5,0],[6,1],[5,2]] },
'"': { width: 16, points: [[4,21],[4,14],[-1,-1],[12,21],[12,14]] },
'#': { width: 21, points: [[11,25],[4,-7],[-1,-1],[17,25],[10,-7],[-1,-1],[4,12],[18,12],[-1,-1],[3,6],[17,6]] },
'$': { width: 20, points: [[8,25],[8,-4],[-1,-1],[12,25],[12,-4],[-1,-1],[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] },
'%': { width: 24, points: [[21,21],[3,0],[-1,-1],[8,21],[10,19],[10,17],[9,15],[7,14],[5,14],[3,16],[3,18],[4,20],[6,21],[8,21],[10,20],[13,19],[16,19],[19,20],[21,21],[-1,-1],[17,7],[15,6],[14,4],[14,2],[16,0],[18,0],[20,1],[21,3],[21,5],[19,7],[17,7]] },
'&': { width: 26, points: [[23,12],[23,13],[22,14],[21,14],[20,13],[19,11],[17,6],[15,3],[13,1],[11,0],[7,0],[5,1],[4,2],[3,4],[3,6],[4,8],[5,9],[12,13],[13,14],[14,16],[14,18],[13,20],[11,21],[9,20],[8,18],[8,16],[9,13],[11,10],[16,3],[18,1],[20,0],[22,0],[23,1],[23,2]] },
'\'': { width: 10, points: [[5,19],[4,20],[5,21],[6,20],[6,18],[5,16],[4,15]] },
'(': { width: 14, points: [[11,25],[9,23],[7,20],[5,16],[4,11],[4,7],[5,2],[7,-2],[9,-5],[11,-7]] },
')': { width: 14, points: [[3,25],[5,23],[7,20],[9,16],[10,11],[10,7],[9,2],[7,-2],[5,-5],[3,-7]] },
'*': { width: 16, points: [[8,21],[8,9],[-1,-1],[3,18],[13,12],[-1,-1],[13,18],[3,12]] },
'+': { width: 26, points: [[13,18],[13,0],[-1,-1],[4,9],[22,9]] },
',': { width: 10, points: [[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] },
'-': { width: 18, points: [[6,9],[12,9]] },
'.': { width: 10, points: [[5,2],[4,1],[5,0],[6,1],[5,2]] },
'/': { width: 22, points: [[20,25],[2,-7]] },
'0': { width: 20, points: [[9,21],[6,20],[4,17],[3,12],[3,9],[4,4],[6,1],[9,0],[11,0],[14,1],[16,4],[17,9],[17,12],[16,17],[14,20],[11,21],[9,21]] },
'1': { width: 20, points: [[6,17],[8,18],[11,21],[11,0]] },
'2': { width: 20, points: [[4,16],[4,17],[5,19],[6,20],[8,21],[12,21],[14,20],[15,19],[16,17],[16,15],[15,13],[13,10],[3,0],[17,0]] },
'3': { width: 20, points: [[5,21],[16,21],[10,13],[13,13],[15,12],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] },
'4': { width: 20, points: [[13,21],[3,7],[18,7],[-1,-1],[13,21],[13,0]] },
'5': { width: 20, points: [[15,21],[5,21],[4,12],[5,13],[8,14],[11,14],[14,13],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] },
'6': { width: 20, points: [[16,18],[15,20],[12,21],[10,21],[7,20],[5,17],[4,12],[4,7],[5,3],[7,1],[10,0],[11,0],[14,1],[16,3],[17,6],[17,7],[16,10],[14,12],[11,13],[10,13],[7,12],[5,10],[4,7]] },
'7': { width: 20, points: [[17,21],[7,0],[-1,-1],[3,21],[17,21]] },
'8': { width: 20, points: [[8,21],[5,20],[4,18],[4,16],[5,14],[7,13],[11,12],[14,11],[16,9],[17,7],[17,4],[16,2],[15,1],[12,0],[8,0],[5,1],[4,2],[3,4],[3,7],[4,9],[6,11],[9,12],[13,13],[15,14],[16,16],[16,18],[15,20],[12,21],[8,21]] },
'9': { width: 20, points: [[16,14],[15,11],[13,9],[10,8],[9,8],[6,9],[4,11],[3,14],[3,15],[4,18],[6,20],[9,21],[10,21],[13,20],[15,18],[16,14],[16,9],[15,4],[13,1],[10,0],[8,0],[5,1],[4,3]] },
':': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],[-1,-1],[5,2],[4,1],[5,0],[6,1],[5,2]] },
';': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],[-1,-1],[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] },
'<': { width: 24, points: [[20,18],[4,9],[20,0]] },
'=': { width: 26, points: [[4,12],[22,12],[-1,-1],[4,6],[22,6]] },
'>': { width: 24, points: [[4,18],[20,9],[4,0]] },
'?': { width: 18, points: [[3,16],[3,17],[4,19],[5,20],[7,21],[11,21],[13,20],[14,19],[15,17],[15,15],[14,13],[13,12],[9,10],[9,7],[-1,-1],[9,2],[8,1],[9,0],[10,1],[9,2]] },
'@': { width: 27, points: [[18,13],[17,15],[15,16],[12,16],[10,15],[9,14],[8,11],[8,8],[9,6],[11,5],[14,5],[16,6],[17,8],[-1,-1],[12,16],[10,14],[9,11],[9,8],[10,6],[11,5],[-1,-1],[18,16],[17,8],[17,6],[19,5],[21,5],[23,7],[24,10],[24,12],[23,15],[22,17],[20,19],[18,20],[15,21],[12,21],[9,20],[7,19],[5,17],[4,15],[3,12],[3,9],[4,6],[5,4],[7,2],[9,1],[12,0],[15,0],[18,1],[20,2],[21,3],[-1,-1],[19,16],[18,8],[18,6],[19,5]] },
'A': { width: 18, points: [[9,21],[1,0],[-1,-1],[9,21],[17,0],[-1,-1],[4,7],[14,7]] },
'B': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[-1,-1],[4,11],[13,11],[16,10],[17,9],[18,7],[18,4],[17,2],[16,1],[13,0],[4,0]] },
'C': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5]] },
'D': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[11,21],[14,20],[16,18],[17,16],[18,13],[18,8],[17,5],[16,3],[14,1],[11,0],[4,0]] },
'E': { width: 19, points: [[4,21],[4,0],[-1,-1],[4,21],[17,21],[-1,-1],[4,11],[12,11],[-1,-1],[4,0],[17,0]] },
'F': { width: 18, points: [[4,21],[4,0],[-1,-1],[4,21],[17,21],[-1,-1],[4,11],[12,11]] },
'G': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[18,8],[-1,-1],[13,8],[18,8]] },
'H': { width: 22, points: [[4,21],[4,0],[-1,-1],[18,21],[18,0],[-1,-1],[4,11],[18,11]] },
'I': { width: 8, points: [[4,21],[4,0]] },
'J': { width: 16, points: [[12,21],[12,5],[11,2],[10,1],[8,0],[6,0],[4,1],[3,2],[2,5],[2,7]] },
'K': { width: 21, points: [[4,21],[4,0],[-1,-1],[18,21],[4,7],[-1,-1],[9,12],[18,0]] },
'L': { width: 17, points: [[4,21],[4,0],[-1,-1],[4,0],[16,0]] },
'M': { width: 24, points: [[4,21],[4,0],[-1,-1],[4,21],[12,0],[-1,-1],[20,21],[12,0],[-1,-1],[20,21],[20,0]] },
'N': { width: 22, points: [[4,21],[4,0],[-1,-1],[4,21],[18,0],[-1,-1],[18,21],[18,0]] },
'O': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21]] },
'P': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,14],[17,12],[16,11],[13,10],[4,10]] },
'Q': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21],[-1,-1],[12,4],[18,-2]] },
'R': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[4,11],[-1,-1],[11,11],[18,0]] },
'S': { width: 20, points: [[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] },
'T': { width: 16, points: [[8,21],[8,0],[-1,-1],[1,21],[15,21]] },
'U': { width: 22, points: [[4,21],[4,6],[5,3],[7,1],[10,0],[12,0],[15,1],[17,3],[18,6],[18,21]] },
'V': { width: 18, points: [[1,21],[9,0],[-1,-1],[17,21],[9,0]] },
'W': { width: 24, points: [[2,21],[7,0],[-1,-1],[12,21],[7,0],[-1,-1],[12,21],[17,0],[-1,-1],[22,21],[17,0]] },
'X': { width: 20, points: [[3,21],[17,0],[-1,-1],[17,21],[3,0]] },
'Y': { width: 18, points: [[1,21],[9,11],[9,0],[-1,-1],[17,21],[9,11]] },
'Z': { width: 20, points: [[17,21],[3,0],[-1,-1],[3,21],[17,21],[-1,-1],[3,0],[17,0]] },
'[': { width: 14, points: [[4,25],[4,-7],[-1,-1],[5,25],[5,-7],[-1,-1],[4,25],[11,25],[-1,-1],[4,-7],[11,-7]] },
'\\': { width: 14, points: [[0,21],[14,-3]] },
']': { width: 14, points: [[9,25],[9,-7],[-1,-1],[10,25],[10,-7],[-1,-1],[3,25],[10,25],[-1,-1],[3,-7],[10,-7]] },
'^': { width: 16, points: [[6,15],[8,18],[10,15],[-1,-1],[3,12],[8,17],[13,12],[-1,-1],[8,17],[8,0]] },
'_': { width: 16, points: [[0,-2],[16,-2]] },
'`': { width: 10, points: [[6,21],[5,20],[4,18],[4,16],[5,15],[6,16],[5,17]] },
'a': { width: 19, points: [[15,14],[15,0],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
'b': { width: 19, points: [[4,21],[4,0],[-1,-1],[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] },
'c': { width: 18, points: [[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
'd': { width: 19, points: [[15,21],[15,0],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
'e': { width: 18, points: [[3,8],[15,8],[15,10],[14,12],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
'f': { width: 12, points: [[10,21],[8,21],[6,20],[5,17],[5,0],[-1,-1],[2,14],[9,14]] },
'g': { width: 19, points: [[15,14],[15,-2],[14,-5],[13,-6],[11,-7],[8,-7],[6,-6],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
'h': { width: 19, points: [[4,21],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] },
'i': { width: 8, points: [[3,21],[4,20],[5,21],[4,22],[3,21],[-1,-1],[4,14],[4,0]] },
'j': { width: 10, points: [[5,21],[6,20],[7,21],[6,22],[5,21],[-1,-1],[6,14],[6,-3],[5,-6],[3,-7],[1,-7]] },
'k': { width: 17, points: [[4,21],[4,0],[-1,-1],[14,14],[4,4],[-1,-1],[8,8],[15,0]] },
'l': { width: 8, points: [[4,21],[4,0]] },
'm': { width: 30, points: [[4,14],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0],[-1,-1],[15,10],[18,13],[20,14],[23,14],[25,13],[26,10],[26,0]] },
'n': { width: 19, points: [[4,14],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] },
'o': { width: 19, points: [[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3],[16,6],[16,8],[15,11],[13,13],[11,14],[8,14]] },
'p': { width: 19, points: [[4,14],[4,-7],[-1,-1],[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] },
'q': { width: 19, points: [[15,14],[15,-7],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
'r': { width: 13, points: [[4,14],[4,0],[-1,-1],[4,8],[5,11],[7,13],[9,14],[12,14]] },
's': { width: 17, points: [[14,11],[13,13],[10,14],[7,14],[4,13],[3,11],[4,9],[6,8],[11,7],[13,6],[14,4],[14,3],[13,1],[10,0],[7,0],[4,1],[3,3]] },
't': { width: 12, points: [[5,21],[5,4],[6,1],[8,0],[10,0],[-1,-1],[2,14],[9,14]] },
'u': { width: 19, points: [[4,14],[4,4],[5,1],[7,0],[10,0],[12,1],[15,4],[-1,-1],[15,14],[15,0]] },
'v': { width: 16, points: [[2,14],[8,0],[-1,-1],[14,14],[8,0]] },
'w': { width: 22, points: [[3,14],[7,0],[-1,-1],[11,14],[7,0],[-1,-1],[11,14],[15,0],[-1,-1],[19,14],[15,0]] },
'x': { width: 17, points: [[3,14],[14,0],[-1,-1],[14,14],[3,0]] },
'y': { width: 16, points: [[2,14],[8,0],[-1,-1],[14,14],[8,0],[6,-4],[4,-6],[2,-7],[1,-7]] },
'z': { width: 17, points: [[14,14],[3,0],[-1,-1],[3,14],[14,14],[-1,-1],[3,0],[14,0]] },
'{': { width: 14, points: [[9,25],[7,24],[6,23],[5,21],[5,19],[6,17],[7,16],[8,14],[8,12],[6,10],[-1,-1],[7,24],[6,22],[6,20],[7,18],[8,17],[9,15],[9,13],[8,11],[4,9],[8,7],[9,5],[9,3],[8,1],[7,0],[6,-2],[6,-4],[7,-6],[-1,-1],[6,8],[8,6],[8,4],[7,2],[6,1],[5,-1],[5,-3],[6,-5],[7,-6],[9,-7]] },
'|': { width: 8, points: [[4,25],[4,-7]] },
'}': { width: 14, points: [[5,25],[7,24],[8,23],[9,21],[9,19],[8,17],[7,16],[6,14],[6,12],[8,10],[-1,-1],[7,24],[8,22],[8,20],[7,18],[6,17],[5,15],[5,13],[6,11],[10,9],[6,7],[5,5],[5,3],[6,1],[7,0],[8,-2],[8,-4],[7,-6],[-1,-1],[8,8],[6,6],[6,4],[7,2],[8,1],[9,-1],[9,-3],[8,-5],[7,-6],[5,-7]] },
'~': { width: 24, points: [[3,6],[3,8],[4,11],[6,12],[8,12],[10,11],[14,8],[16,7],[18,7],[20,8],[21,10],[-1,-1],[3,8],[4,10],[6,11],[8,11],[10,10],[14,7],[16,6],[18,6],[20,7],[21,10],[21,12]] }
};
$.jqplot.CanvasFontRenderer = function(options) {
options = options || {};
if (!options.pt2px) {
options.pt2px = 1.5;
}
$.jqplot.CanvasTextRenderer.call(this, options);
};
$.jqplot.CanvasFontRenderer.prototype = new $.jqplot.CanvasTextRenderer({});
$.jqplot.CanvasFontRenderer.prototype.constructor = $.jqplot.CanvasFontRenderer;
$.jqplot.CanvasFontRenderer.prototype.measure = function(ctx, str)
{
// var fstyle = this.fontStyle+' '+this.fontVariant+' '+this.fontWeight+' '+this.fontSize+' '+this.fontFamily;
var fstyle = this.fontSize+' '+this.fontFamily;
ctx.save();
ctx.font = fstyle;
var w = ctx.measureText(str).width;
ctx.restore();
return w;
};
$.jqplot.CanvasFontRenderer.prototype.draw = function(ctx, str)
{
var x = 0;
// leave room at bottom for descenders.
var y = this.height*0.72;
//var y = 12;
ctx.save();
var tx, ty;
// 1st quadrant
if ((-Math.PI/2 <= this.angle && this.angle <= 0) || (Math.PI*3/2 <= this.angle && this.angle <= Math.PI*2)) {
tx = 0;
ty = -Math.sin(this.angle) * this.width;
}
// 4th quadrant
else if ((0 < this.angle && this.angle <= Math.PI/2) || (-Math.PI*2 <= this.angle && this.angle <= -Math.PI*3/2)) {
tx = Math.sin(this.angle) * this.height;
ty = 0;
}
// 2nd quadrant
else if ((-Math.PI < this.angle && this.angle < -Math.PI/2) || (Math.PI <= this.angle && this.angle <= Math.PI*3/2)) {
tx = -Math.cos(this.angle) * this.width;
ty = -Math.sin(this.angle) * this.width - Math.cos(this.angle) * this.height;
}
// 3rd quadrant
else if ((-Math.PI*3/2 < this.angle && this.angle < Math.PI) || (Math.PI/2 < this.angle && this.angle < Math.PI)) {
tx = Math.sin(this.angle) * this.height - Math.cos(this.angle)*this.width;
ty = -Math.cos(this.angle) * this.height;
}
ctx.strokeStyle = this.fillStyle;
ctx.fillStyle = this.fillStyle;
// var fstyle = this.fontStyle+' '+this.fontVariant+' '+this.fontWeight+' '+this.fontSize+' '+this.fontFamily;
var fstyle = this.fontSize+' '+this.fontFamily;
ctx.font = fstyle;
ctx.translate(tx, ty);
ctx.rotate(this.angle);
ctx.fillText(str, x, y);
// ctx.strokeText(str, x, y);
ctx.restore();
};
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,679 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* class: $.jqplot.CategoryAxisRenderer
* A plugin for jqPlot to render a category style axis, with equal pixel spacing between y data values of a series.
*
* To use this renderer, include the plugin in your source
* > <script type="text/javascript" language="javascript" src="plugins/jqplot.categoryAxisRenderer.js"></script>
*
* and supply the appropriate options to your plot
*
* > {axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer}}}
**/
$.jqplot.CategoryAxisRenderer = function(options) {
$.jqplot.LinearAxisRenderer.call(this);
// prop: sortMergedLabels
// True to sort tick labels when labels are created by merging
// x axis values from multiple series. That is, say you have
// two series like:
// > line1 = [[2006, 4], [2008, 9], [2009, 16]];
// > line2 = [[2006, 3], [2007, 7], [2008, 6]];
// If no label array is specified, tick labels will be collected
// from the x values of the series. With sortMergedLabels
// set to true, tick labels will be:
// > [2006, 2007, 2008, 2009]
// With sortMergedLabels set to false, tick labels will be:
// > [2006, 2008, 2009, 2007]
//
// Note, this property is specified on the renderOptions for the
// axes when creating a plot:
// > axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer, rendererOptions:{sortMergedLabels:true}}}
this.sortMergedLabels = false;
};
$.jqplot.CategoryAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.CategoryAxisRenderer.prototype.constructor = $.jqplot.CategoryAxisRenderer;
$.jqplot.CategoryAxisRenderer.prototype.init = function(options){
this.groups = 1;
this.groupLabels = [];
this._groupLabels = [];
this._grouped = false;
this._barsPerGroup = null;
this.reverse = false;
// prop: tickRenderer
// A class of a rendering engine for creating the ticks labels displayed on the plot,
// See <$.jqplot.AxisTickRenderer>.
// this.tickRenderer = $.jqplot.AxisTickRenderer;
// this.labelRenderer = $.jqplot.AxisLabelRenderer;
$.extend(true, this, {tickOptions:{formatString:'%d'}}, options);
var db = this._dataBounds;
// Go through all the series attached to this axis and find
// the min/max bounds for this axis.
for (var i=0; i<this._series.length; i++) {
var s = this._series[i];
if (s.groups) {
this.groups = s.groups;
}
var d = s.data;
for (var j=0; j<d.length; j++) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
if (d[j][0] < db.min || db.min == null) {
db.min = d[j][0];
}
if (d[j][0] > db.max || db.max == null) {
db.max = d[j][0];
}
}
else {
if (d[j][1] < db.min || db.min == null) {
db.min = d[j][1];
}
if (d[j][1] > db.max || db.max == null) {
db.max = d[j][1];
}
}
}
}
if (this.groupLabels.length) {
this.groups = this.groupLabels.length;
}
};
$.jqplot.CategoryAxisRenderer.prototype.createTicks = function() {
// we're are operating on an axis here
var ticks = this._ticks;
var userTicks = this.ticks;
var name = this.name;
// databounds were set on axis initialization.
var db = this._dataBounds;
var dim, interval;
var min, max;
var pos1, pos2;
var tt, i;
// if we already have ticks, use them.
if (userTicks.length) {
// adjust with blanks if we have groups
if (this.groups > 1 && !this._grouped) {
var l = userTicks.length;
var skip = parseInt(l/this.groups, 10);
var count = 0;
for (var i=skip; i<l; i+=skip) {
userTicks.splice(i+count, 0, ' ');
count++;
}
this._grouped = true;
}
this.min = 0.5;
this.max = userTicks.length + 0.5;
var range = this.max - this.min;
this.numberTicks = 2*userTicks.length + 1;
for (i=0; i<userTicks.length; i++){
tt = this.min + 2 * i * range / (this.numberTicks-1);
// need a marker before and after the tick
var t = new this.tickRenderer(this.tickOptions);
t.showLabel = false;
// t.showMark = true;
t.setTick(tt, this.name);
this._ticks.push(t);
var t = new this.tickRenderer(this.tickOptions);
t.label = userTicks[i];
// t.showLabel = true;
t.showMark = false;
t.showGridline = false;
t.setTick(tt+0.5, this.name);
this._ticks.push(t);
}
// now add the last tick at the end
var t = new this.tickRenderer(this.tickOptions);
t.showLabel = false;
// t.showMark = true;
t.setTick(tt+1, this.name);
this._ticks.push(t);
}
// we don't have any ticks yet, let's make some!
else {
if (name == 'xaxis' || name == 'x2axis') {
dim = this._plotDimensions.width;
}
else {
dim = this._plotDimensions.height;
}
// if min, max and number of ticks specified, user can't specify interval.
if (this.min != null && this.max != null && this.numberTicks != null) {
this.tickInterval = null;
}
// if max, min, and interval specified and interval won't fit, ignore interval.
if (this.min != null && this.max != null && this.tickInterval != null) {
if (parseInt((this.max-this.min)/this.tickInterval, 10) != (this.max-this.min)/this.tickInterval) {
this.tickInterval = null;
}
}
// find out how many categories are in the lines and collect labels
var labels = [];
var numcats = 0;
var min = 0.5;
var max, val;
var isMerged = false;
for (var i=0; i<this._series.length; i++) {
var s = this._series[i];
for (var j=0; j<s.data.length; j++) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
val = s.data[j][0];
}
else {
val = s.data[j][1];
}
if ($.inArray(val, labels) == -1) {
isMerged = true;
numcats += 1;
labels.push(val);
}
}
}
if (isMerged && this.sortMergedLabels) {
if (typeof labels[0] == "string") {
labels.sort();
} else {
labels.sort(function(a,b) { return a - b; });
}
}
// keep a reference to these tick labels to use for redrawing plot (see bug #57)
this.ticks = labels;
// now bin the data values to the right lables.
for (var i=0; i<this._series.length; i++) {
var s = this._series[i];
for (var j=0; j<s.data.length; j++) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
val = s.data[j][0];
}
else {
val = s.data[j][1];
}
// for category axis, force the values into category bins.
// we should have the value in the label array now.
var idx = $.inArray(val, labels)+1;
if (this.name == 'xaxis' || this.name == 'x2axis') {
s.data[j][0] = idx;
}
else {
s.data[j][1] = idx;
}
}
}
// adjust with blanks if we have groups
if (this.groups > 1 && !this._grouped) {
var l = labels.length;
var skip = parseInt(l/this.groups, 10);
var count = 0;
for (var i=skip; i<l; i+=skip+1) {
labels[i] = ' ';
}
this._grouped = true;
}
max = numcats + 0.5;
if (this.numberTicks == null) {
this.numberTicks = 2*numcats + 1;
}
var range = max - min;
this.min = min;
this.max = max;
var track = 0;
// todo: adjust this so more ticks displayed.
var maxVisibleTicks = parseInt(3+dim/10, 10);
var skip = parseInt(numcats/maxVisibleTicks, 10);
if (this.tickInterval == null) {
this.tickInterval = range / (this.numberTicks-1);
}
// if tickInterval is specified, we will ignore any computed maximum.
for (var i=0; i<this.numberTicks; i++){
tt = this.min + i * this.tickInterval;
var t = new this.tickRenderer(this.tickOptions);
// if even tick, it isn't a category, it's a divider
if (i/2 == parseInt(i/2, 10)) {
t.showLabel = false;
t.showMark = true;
}
else {
if (skip>0 && track<skip) {
t.showLabel = false;
track += 1;
}
else {
t.showLabel = true;
track = 0;
}
t.label = t.formatter(t.formatString, labels[(i-1)/2]);
t.showMark = false;
t.showGridline = false;
}
t.setTick(tt, this.name);
this._ticks.push(t);
}
}
};
// called with scope of axis
$.jqplot.CategoryAxisRenderer.prototype.draw = function(ctx, plot) {
if (this.show) {
// populate the axis label and value properties.
// createTicks is a method on the renderer, but
// call it within the scope of the axis.
this.renderer.createTicks.call(this);
// fill a div with axes labels in the right direction.
// Need to pregenerate each axis to get its bounds and
// position it and the labels correctly on the plot.
var dim=0;
var temp;
// Added for theming.
if (this._elem) {
// this._elem.empty();
// Memory Leaks patch
this._elem.emptyForce();
}
this._elem = this._elem || $('<div class="jqplot-axis jqplot-'+this.name+'" style="position:absolute;"></div>');
if (this.name == 'xaxis' || this.name == 'x2axis') {
this._elem.width(this._plotDimensions.width);
}
else {
this._elem.height(this._plotDimensions.height);
}
// create a _label object.
this.labelOptions.axis = this.name;
this._label = new this.labelRenderer(this.labelOptions);
if (this._label.show) {
var elem = this._label.draw(ctx, plot);
elem.appendTo(this._elem);
}
var t = this._ticks;
for (var i=0; i<t.length; i++) {
var tick = t[i];
if (tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) {
var elem = tick.draw(ctx, plot);
elem.appendTo(this._elem);
}
}
this._groupLabels = [];
// now make group labels
for (var i=0; i<this.groupLabels.length; i++)
{
var elem = $('<div style="position:absolute;" class="jqplot-'+this.name+'-groupLabel"></div>');
elem.html(this.groupLabels[i]);
this._groupLabels.push(elem);
elem.appendTo(this._elem);
}
}
return this._elem;
};
// called with scope of axis
$.jqplot.CategoryAxisRenderer.prototype.set = function() {
var dim = 0;
var temp;
var w = 0;
var h = 0;
var lshow = (this._label == null) ? false : this._label.show;
if (this.show) {
var t = this._ticks;
for (var i=0; i<t.length; i++) {
var tick = t[i];
if (tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
temp = tick._elem.outerHeight(true);
}
else {
temp = tick._elem.outerWidth(true);
}
if (temp > dim) {
dim = temp;
}
}
}
var dim2 = 0;
for (var i=0; i<this._groupLabels.length; i++) {
var l = this._groupLabels[i];
if (this.name == 'xaxis' || this.name == 'x2axis') {
temp = l.outerHeight(true);
}
else {
temp = l.outerWidth(true);
}
if (temp > dim2) {
dim2 = temp;
}
}
if (lshow) {
w = this._label._elem.outerWidth(true);
h = this._label._elem.outerHeight(true);
}
if (this.name == 'xaxis') {
dim += dim2 + h;
this._elem.css({'height':dim+'px', left:'0px', bottom:'0px'});
}
else if (this.name == 'x2axis') {
dim += dim2 + h;
this._elem.css({'height':dim+'px', left:'0px', top:'0px'});
}
else if (this.name == 'yaxis') {
dim += dim2 + w;
this._elem.css({'width':dim+'px', left:'0px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css('width', w+'px');
}
}
else {
dim += dim2 + w;
this._elem.css({'width':dim+'px', right:'0px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css('width', w+'px');
}
}
}
};
// called with scope of axis
$.jqplot.CategoryAxisRenderer.prototype.pack = function(pos, offsets) {
var ticks = this._ticks;
var max = this.max;
var min = this.min;
var offmax = offsets.max;
var offmin = offsets.min;
var lshow = (this._label == null) ? false : this._label.show;
var i;
for (var p in pos) {
this._elem.css(p, pos[p]);
}
this._offsets = offsets;
// pixellength will be + for x axes and - for y axes becasue pixels always measured from top left.
var pixellength = offmax - offmin;
var unitlength = max - min;
if (!this.reverse) {
// point to unit and unit to point conversions references to Plot DOM element top left corner.
this.u2p = function(u){
return (u - min) * pixellength / unitlength + offmin;
};
this.p2u = function(p){
return (p - offmin) * unitlength / pixellength + min;
};
if (this.name == 'xaxis' || this.name == 'x2axis'){
this.series_u2p = function(u){
return (u - min) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + min;
};
}
else {
this.series_u2p = function(u){
return (u - max) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + max;
};
}
}
else {
// point to unit and unit to point conversions references to Plot DOM element top left corner.
this.u2p = function(u){
return offmin + (max - u) * pixellength / unitlength;
};
this.p2u = function(p){
return min + (p - offmin) * unitlength / pixellength;
};
if (this.name == 'xaxis' || this.name == 'x2axis'){
this.series_u2p = function(u){
return (max - u) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + max;
};
}
else {
this.series_u2p = function(u){
return (min - u) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + min;
};
}
}
if (this.show) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
for (i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
// will need to adjust auto positioning based on which axis this is.
var temp = (this.name == 'xaxis') ? 1 : -1;
switch (t.labelPosition) {
case 'auto':
// position at end
if (temp * t.angle < 0) {
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
}
// position at start
else {
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
}
break;
case 'end':
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
case 'start':
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
break;
case 'middle':
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
default:
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
}
}
else {
shim = -t.getWidth()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('left', val);
t.pack();
}
}
var labeledge=['bottom', 0];
if (lshow) {
var w = this._label._elem.outerWidth(true);
this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px');
if (this.name == 'xaxis') {
this._label._elem.css('bottom', '0px');
labeledge = ['bottom', this._label._elem.outerHeight(true)];
}
else {
this._label._elem.css('top', '0px');
labeledge = ['top', this._label._elem.outerHeight(true)];
}
this._label.pack();
}
// draw the group labels
var step = parseInt(this._ticks.length/this.groups, 10) + 1;
for (i=0; i<this._groupLabels.length; i++) {
var mid = 0;
var count = 0;
for (var j=i*step; j<(i+1)*step; j++) {
if (j >= this._ticks.length-1) continue; // the last tick does not exist as there is no other group in order to have an empty one.
if (this._ticks[j]._elem && this._ticks[j].label != " ") {
var t = this._ticks[j]._elem;
var p = t.position();
mid += p.left + t.outerWidth(true)/2;
count++;
}
}
mid = mid/count;
this._groupLabels[i].css({'left':(mid - this._groupLabels[i].outerWidth(true)/2)});
this._groupLabels[i].css(labeledge[0], labeledge[1]);
}
}
else {
for (i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
// will need to adjust auto positioning based on which axis this is.
var temp = (this.name == 'yaxis') ? 1 : -1;
switch (t.labelPosition) {
case 'auto':
// position at end
case 'end':
if (temp * t.angle < 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'start':
if (t.angle > 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'middle':
// if (t.angle > 0) {
// shim = -t.getHeight()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
// }
// else {
// shim = -t.getHeight()/2 - t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
// }
shim = -t.getHeight()/2;
break;
default:
shim = -t.getHeight()/2;
break;
}
}
else {
shim = -t.getHeight()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('top', val);
t.pack();
}
}
var labeledge=['left', 0];
if (lshow) {
var h = this._label._elem.outerHeight(true);
this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px');
if (this.name == 'yaxis') {
this._label._elem.css('left', '0px');
labeledge = ['left', this._label._elem.outerWidth(true)];
}
else {
this._label._elem.css('right', '0px');
labeledge = ['right', this._label._elem.outerWidth(true)];
}
this._label.pack();
}
// draw the group labels, position top here, do left after label position.
var step = parseInt(this._ticks.length/this.groups, 10) + 1; // step is one more than before as we don't want to have overlaps in loops
for (i=0; i<this._groupLabels.length; i++) {
var mid = 0;
var count = 0;
for (var j=i*step; j<(i+1)*step; j++) { // j must never reach (i+1)*step as we don't want to have overlap between loops
if (j >= this._ticks.length-1) continue; // the last tick does not exist as there is no other group in order to have an empty one.
if (this._ticks[j]._elem && this._ticks[j].label != " ") {
var t = this._ticks[j]._elem;
var p = t.position();
mid += p.top + t.outerHeight()/2;
count++;
}
}
mid = mid/count;
this._groupLabels[i].css({'top':mid - this._groupLabels[i].outerHeight()/2});
this._groupLabels[i].css(labeledge[0], labeledge[1]);
}
}
}
};
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,116 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.ciParser
* Data Renderer function which converts a custom JSON data object into jqPlot data format.
* Set this as a callable on the jqplot dataRenderer plot option:
*
* > plot = $.jqplot('mychart', [data], { dataRenderer: $.jqplot.ciParser, ... });
*
* Where data is an object in JSON format or a JSON encoded string conforming to the
* City Index API spec.
*
* Note that calling the renderer function is handled internally by jqPlot. The
* user does not have to call the function. The parameters described below will
* automatically be passed to the ciParser function.
*
* Parameters:
* data - JSON encoded string or object.
* plot - reference to jqPlot Plot object.
*
* Returns:
* data array in jqPlot format.
*
*/
$.jqplot.ciParser = function (data, plot) {
var ret = [],
line,
temp,
i, j, k, kk;
if (typeof(data) == "string") {
data = $.jqplot.JSON.parse(data, handleStrings);
}
else if (typeof(data) == "object") {
for (k in data) {
for (i=0; i<data[k].length; i++) {
for (kk in data[k][i]) {
data[k][i][kk] = handleStrings(kk, data[k][i][kk]);
}
}
}
}
else {
return null;
}
// function handleStrings
// Checks any JSON encoded strings to see if they are
// encoded dates. If so, pull out the timestamp.
// Expects dates to be represented by js timestamps.
function handleStrings(key, value) {
var a;
if (value != null) {
if (value.toString().indexOf('Date') >= 0) {
//here we will try to extract the ticks from the Date string in the "value" fields of JSON returned data
a = /^\/Date\((-?[0-9]+)\)\/$/.exec(value);
if (a) {
return parseInt(a[1], 10);
}
}
return value;
}
}
for (var prop in data) {
line = [];
temp = data[prop];
switch (prop) {
case "PriceTicks":
for (i=0; i<temp.length; i++) {
line.push([temp[i]['TickDate'], temp[i]['Price']]);
}
break;
case "PriceBars":
for (i=0; i<temp.length; i++) {
line.push([temp[i]['BarDate'], temp[i]['Open'], temp[i]['High'], temp[i]['Low'], temp[i]['Close']]);
}
break;
}
ret.push(line);
}
return ret;
};
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(a){a.jqplot.ciParser=function(g,l){var m=[],o,n,h,f,e,c;if(typeof(g)=="string"){g=a.jqplot.JSON.parse(g,d)}else{if(typeof(g)=="object"){for(e in g){for(h=0;h<g[e].length;h++){for(c in g[e][h]){g[e][h][c]=d(c,g[e][h][c])}}}}else{return null}}function d(j,k){var i;if(k!=null){if(k.toString().indexOf("Date")>=0){i=/^\/Date\((-?[0-9]+)\)\/$/.exec(k);if(i){return parseInt(i[1],10)}}return k}}for(var b in g){o=[];n=g[b];switch(b){case"PriceTicks":for(h=0;h<n.length;h++){o.push([n[h]["TickDate"],n[h]["Price"]])}break;case"PriceBars":for(h=0;h<n.length;h++){o.push([n[h]["BarDate"],n[h]["Open"],n[h]["High"],n[h]["Low"],n[h]["Close"]])}break}m.push(o)}return m}})(jQuery);

File diff suppressed because it is too large Load Diff

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,741 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.DateAxisRenderer
* A plugin for a jqPlot to render an axis as a series of date values.
* This renderer has no options beyond those supplied by the <Axis> class.
* It supplies its own tick formatter, so the tickOptions.formatter option
* should not be overridden.
*
* Thanks to Ken Synder for his enhanced Date instance methods which are
* included with this code <http://kendsnyder.com/sandbox/date/>.
*
* To use this renderer, include the plugin in your source
* > <script type="text/javascript" language="javascript" src="plugins/jqplot.dateAxisRenderer.js"></script>
*
* and supply the appropriate options to your plot
*
* > {axes:{xaxis:{renderer:$.jqplot.DateAxisRenderer}}}
*
* Dates can be passed into the axis in almost any recognizable value and
* will be parsed. They will be rendered on the axis in the format
* specified by tickOptions.formatString. e.g. tickOptions.formatString = '%Y-%m-%d'.
*
* Accecptable format codes
* are:
*
* > Code Result Description
* > == Years ==
* > %Y 2008 Four-digit year
* > %y 08 Two-digit year
* > == Months ==
* > %m 09 Two-digit month
* > %#m 9 One or two-digit month
* > %B September Full month name
* > %b Sep Abbreviated month name
* > == Days ==
* > %d 05 Two-digit day of month
* > %#d 5 One or two-digit day of month
* > %e 5 One or two-digit day of month
* > %A Sunday Full name of the day of the week
* > %a Sun Abbreviated name of the day of the week
* > %w 0 Number of the day of the week (0 = Sunday, 6 = Saturday)
* > %o th The ordinal suffix string following the day of the month
* > == Hours ==
* > %H 23 Hours in 24-hour format (two digits)
* > %#H 3 Hours in 24-hour integer format (one or two digits)
* > %I 11 Hours in 12-hour format (two digits)
* > %#I 3 Hours in 12-hour integer format (one or two digits)
* > %p PM AM or PM
* > == Minutes ==
* > %M 09 Minutes (two digits)
* > %#M 9 Minutes (one or two digits)
* > == Seconds ==
* > %S 02 Seconds (two digits)
* > %#S 2 Seconds (one or two digits)
* > %s 1206567625723 Unix timestamp (Seconds past 1970-01-01 00:00:00)
* > == Milliseconds ==
* > %N 008 Milliseconds (three digits)
* > %#N 8 Milliseconds (one to three digits)
* > == Timezone ==
* > %O 360 difference in minutes between local time and GMT
* > %Z Mountain Standard Time Name of timezone as reported by browser
* > %G -06:00 Hours and minutes between GMT
* > == Shortcuts ==
* > %F 2008-03-26 %Y-%m-%d
* > %T 05:06:30 %H:%M:%S
* > %X 05:06:30 %H:%M:%S
* > %x 03/26/08 %m/%d/%y
* > %D 03/26/08 %m/%d/%y
* > %#c Wed Mar 26 15:31:00 2008 %a %b %e %H:%M:%S %Y
* > %v 3-Sep-2008 %e-%b-%Y
* > %R 15:31 %H:%M
* > %r 3:31:00 PM %I:%M:%S %p
* > == Characters ==
* > %n \n Newline
* > %t \t Tab
* > %% % Percent Symbol
*/
$.jqplot.DateAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
this.date = new $.jsDate();
};
var second = 1000;
var minute = 60 * second;
var hour = 60 * minute;
var day = 24 * hour;
var week = 7 * day;
// these are less definitive
var month = 30.4368499 * day;
var year = 365.242199 * day;
var daysInMonths = [31,28,31,30,31,30,31,30,31,30,31,30];
// array of consistent nice intervals. Longer intervals
// will depend on days in month, days in year, etc.
var niceFormatStrings = ['%M:%S.%#N', '%M:%S.%#N', '%M:%S.%#N', '%M:%S', '%M:%S', '%M:%S', '%M:%S', '%H:%M:%S', '%H:%M:%S', '%H:%M', '%H:%M', '%H:%M', '%H:%M', '%H:%M', '%H:%M', '%a %H:%M', '%a %H:%M', '%b %e %H:%M', '%b %e %H:%M', '%b %e %H:%M', '%b %e %H:%M', '%v', '%v', '%v', '%v', '%v', '%v', '%v'];
var niceIntervals = [0.1*second, 0.2*second, 0.5*second, second, 2*second, 5*second, 10*second, 15*second, 30*second, minute, 2*minute, 5*minute, 10*minute, 15*minute, 30*minute, hour, 2*hour, 4*hour, 6*hour, 8*hour, 12*hour, day, 2*day, 3*day, 4*day, 5*day, week, 2*week];
var niceMonthlyIntervals = [];
function bestDateInterval(min, max, titarget) {
// iterate through niceIntervals to find one closest to titarget
var badness = Number.MAX_VALUE;
var temp, bestTi, bestfmt;
for (var i=0, l=niceIntervals.length; i < l; i++) {
temp = Math.abs(titarget - niceIntervals[i]);
if (temp < badness) {
badness = temp;
bestTi = niceIntervals[i];
bestfmt = niceFormatStrings[i];
}
}
return [bestTi, bestfmt];
}
$.jqplot.DateAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.DateAxisRenderer.prototype.constructor = $.jqplot.DateAxisRenderer;
$.jqplot.DateTickFormatter = function(format, val) {
if (!format) {
format = '%Y/%m/%d';
}
return $.jsDate.strftime(val, format);
};
$.jqplot.DateAxisRenderer.prototype.init = function(options){
// prop: tickRenderer
// A class of a rendering engine for creating the ticks labels displayed on the plot,
// See <$.jqplot.AxisTickRenderer>.
// this.tickRenderer = $.jqplot.AxisTickRenderer;
// this.labelRenderer = $.jqplot.AxisLabelRenderer;
this.tickOptions.formatter = $.jqplot.DateTickFormatter;
// prop: tickInset
// Controls the amount to inset the first and last ticks from
// the edges of the grid, in multiples of the tick interval.
// 0 is no inset, 0.5 is one half a tick interval, 1 is a full
// tick interval, etc.
this.tickInset = 0;
// prop: drawBaseline
// True to draw the axis baseline.
this.drawBaseline = true;
// prop: baselineWidth
// width of the baseline in pixels.
this.baselineWidth = null;
// prop: baselineColor
// CSS color spec for the baseline.
this.baselineColor = null;
this.daTickInterval = null;
this._daTickInterval = null;
$.extend(true, this, options);
var db = this._dataBounds,
stats,
sum,
s,
d,
pd,
sd,
intv;
// Go through all the series attached to this axis and find
// the min/max bounds for this axis.
for (var i=0; i<this._series.length; i++) {
stats = {intervals:[], frequencies:{}, sortedIntervals:[], min:null, max:null, mean:null};
sum = 0;
s = this._series[i];
d = s.data;
pd = s._plotData;
sd = s._stackData;
intv = 0;
for (var j=0; j<d.length; j++) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
d[j][0] = new $.jsDate(d[j][0]).getTime();
pd[j][0] = new $.jsDate(d[j][0]).getTime();
sd[j][0] = new $.jsDate(d[j][0]).getTime();
if ((d[j][0] != null && d[j][0] < db.min) || db.min == null) {
db.min = d[j][0];
}
if ((d[j][0] != null && d[j][0] > db.max) || db.max == null) {
db.max = d[j][0];
}
if (j>0) {
intv = Math.abs(d[j][0] - d[j-1][0]);
stats.intervals.push(intv);
if (stats.frequencies.hasOwnProperty(intv)) {
stats.frequencies[intv] += 1;
}
else {
stats.frequencies[intv] = 1;
}
}
sum += intv;
}
else {
d[j][1] = new $.jsDate(d[j][1]).getTime();
pd[j][1] = new $.jsDate(d[j][1]).getTime();
sd[j][1] = new $.jsDate(d[j][1]).getTime();
if ((d[j][1] != null && d[j][1] < db.min) || db.min == null) {
db.min = d[j][1];
}
if ((d[j][1] != null && d[j][1] > db.max) || db.max == null) {
db.max = d[j][1];
}
if (j>0) {
intv = Math.abs(d[j][1] - d[j-1][1]);
stats.intervals.push(intv);
if (stats.frequencies.hasOwnProperty(intv)) {
stats.frequencies[intv] += 1;
}
else {
stats.frequencies[intv] = 1;
}
}
}
sum += intv;
}
if (s.renderer.bands) {
if (s.renderer.bands.hiData.length) {
var bd = s.renderer.bands.hiData;
for (var j=0, l=bd.length; j < l; j++) {
if (this.name === 'xaxis' || this.name === 'x2axis') {
bd[j][0] = new $.jsDate(bd[j][0]).getTime();
if ((bd[j][0] != null && bd[j][0] > db.max) || db.max == null) {
db.max = bd[j][0];
}
}
else {
bd[j][1] = new $.jsDate(bd[j][1]).getTime();
if ((bd[j][1] != null && bd[j][1] > db.max) || db.max == null) {
db.max = bd[j][1];
}
}
}
}
if (s.renderer.bands.lowData.length) {
var bd = s.renderer.bands.lowData;
for (var j=0, l=bd.length; j < l; j++) {
if (this.name === 'xaxis' || this.name === 'x2axis') {
bd[j][0] = new $.jsDate(bd[j][0]).getTime();
if ((bd[j][0] != null && bd[j][0] < db.min) || db.min == null) {
db.min = bd[j][0];
}
}
else {
bd[j][1] = new $.jsDate(bd[j][1]).getTime();
if ((bd[j][1] != null && bd[j][1] < db.min) || db.min == null) {
db.min = bd[j][1];
}
}
}
}
}
var tempf = 0,
tempn=0;
for (var n in stats.frequencies) {
stats.sortedIntervals.push({interval:n, frequency:stats.frequencies[n]});
}
stats.sortedIntervals.sort(function(a, b){
return b.frequency - a.frequency;
});
stats.min = $.jqplot.arrayMin(stats.intervals);
stats.max = $.jqplot.arrayMax(stats.intervals);
stats.mean = sum/d.length;
this._intervalStats.push(stats);
stats = sum = s = d = pd = sd = null;
}
db = null;
};
// called with scope of an axis
$.jqplot.DateAxisRenderer.prototype.reset = function() {
this.min = this._options.min;
this.max = this._options.max;
this.tickInterval = this._options.tickInterval;
this.numberTicks = this._options.numberTicks;
this._autoFormatString = '';
if (this._overrideFormatString && this.tickOptions && this.tickOptions.formatString) {
this.tickOptions.formatString = '';
}
this.daTickInterval = this._daTickInterval;
// this._ticks = this.__ticks;
};
$.jqplot.DateAxisRenderer.prototype.createTicks = function(plot) {
// we're are operating on an axis here
var ticks = this._ticks;
var userTicks = this.ticks;
var name = this.name;
// databounds were set on axis initialization.
var db = this._dataBounds;
var iv = this._intervalStats;
var dim = (this.name.charAt(0) === 'x') ? this._plotDimensions.width : this._plotDimensions.height;
var interval;
var min, max;
var pos1, pos2;
var tt, i;
var threshold = 30;
var insetMult = 1;
var daTickInterval = null;
// if user specified a tick interval, convert to usable.
if (this.tickInterval != null)
{
// if interval is a number or can be converted to one, use it.
// Assume it is in SECONDS!!!
if (Number(this.tickInterval)) {
daTickInterval = [Number(this.tickInterval), 'seconds'];
}
// else, parse out something we can build from.
else if (typeof this.tickInterval == "string") {
var parts = this.tickInterval.split(' ');
if (parts.length == 1) {
daTickInterval = [1, parts[0]];
}
else if (parts.length == 2) {
daTickInterval = [parts[0], parts[1]];
}
}
}
var tickInterval = this.tickInterval;
// if we already have ticks, use them.
// ticks must be in order of increasing value.
min = new $.jsDate((this.min != null) ? this.min : db.min).getTime();
max = new $.jsDate((this.max != null) ? this.max : db.max).getTime();
// see if we're zooming. if we are, don't use the min and max we're given,
// but compute some nice ones. They will be reset later.
var cursor = plot.plugins.cursor;
if (cursor && cursor._zoom && cursor._zoom.zooming) {
this.min = null;
this.max = null;
}
var range = max - min;
if (this.tickOptions == null || !this.tickOptions.formatString) {
this._overrideFormatString = true;
}
if (userTicks.length) {
// ticks could be 1D or 2D array of [val, val, ,,,] or [[val, label], [val, label], ...] or mixed
for (i=0; i<userTicks.length; i++){
var ut = userTicks[i];
var t = new this.tickRenderer(this.tickOptions);
if (ut.constructor == Array) {
t.value = new $.jsDate(ut[0]).getTime();
t.label = ut[1];
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(t.value, this.name);
this._ticks.push(t);
}
else {
t.value = new $.jsDate(ut).getTime();
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(t.value, this.name);
this._ticks.push(t);
}
}
this.numberTicks = userTicks.length;
this.min = this._ticks[0].value;
this.max = this._ticks[this.numberTicks-1].value;
this.daTickInterval = [(this.max - this.min) / (this.numberTicks - 1)/1000, 'seconds'];
}
////////
// We don't have any ticks yet, let's make some!
////////
// special case when there is only one point, make three tick marks to center the point
else if (this.min == null && this.max == null && db.min == db.max)
{
var onePointOpts = $.extend(true, {}, this.tickOptions, {name: this.name, value: null});
var delta = 300000;
this.min = db.min - delta;
this.max = db.max + delta;
this.numberTicks = 3;
for(var i=this.min;i<=this.max;i+= delta)
{
onePointOpts.value = i;
var t = new this.tickRenderer(onePointOpts);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
t.showLabel = false;
t.showMark = false;
this._ticks.push(t);
}
if(this.showTicks) {
this._ticks[1].showLabel = true;
}
if(this.showTickMarks) {
this._ticks[1].showTickMarks = true;
}
}
// if user specified min and max are null, we set those to make best ticks.
else if (this.min == null && this.max == null) {
var opts = $.extend(true, {}, this.tickOptions, {name: this.name, value: null});
// want to find a nice interval
var nttarget,
titarget;
// if no tickInterval or numberTicks options specified, make a good guess.
if (!this.tickInterval && !this.numberTicks) {
var tdim = Math.max(dim, threshold+1);
// how many ticks to put on the axis?
// date labels tend to be long. If ticks not rotated,
// don't use too many and have a high spacing factor.
// If we are rotating ticks, use a lower factor.
var spacingFactor = 115;
if (this.tickRenderer === $.jqplot.CanvasAxisTickRenderer && this.tickOptions.angle) {
spacingFactor = 115 - 40 * Math.abs(Math.sin(this.tickOptions.angle/180*Math.PI));
}
nttarget = Math.ceil((tdim-threshold)/spacingFactor + 1);
titarget = (max - min) / (nttarget - 1);
}
// If tickInterval is specified, we'll try to honor it.
// Not guaranteed to get this interval, but we'll get as close as
// we can.
// tickInterval will be used before numberTicks, that is if
// both are specified, numberTicks will be ignored.
else if (this.tickInterval) {
titarget = new $.jsDate(0).add(daTickInterval[0], daTickInterval[1]).getTime();
}
// if numberTicks specified, try to honor it.
// Not guaranteed, but will try to get close.
else if (this.numberTicks) {
nttarget = this.numberTicks;
titarget = (max - min) / (nttarget - 1);
}
// If we can use an interval of 2 weeks or less, pick best one
if (titarget <= 19*day) {
var ret = bestDateInterval(min, max, titarget);
var tempti = ret[0];
this._autoFormatString = ret[1];
min = new $.jsDate(min);
min = Math.floor((min.getTime() - min.getUtcOffset())/tempti) * tempti + min.getUtcOffset();
nttarget = Math.ceil((max - min) / tempti) + 1;
this.min = min;
this.max = min + (nttarget - 1) * tempti;
// if max is less than max, add an interval
if (this.max < max) {
this.max += tempti;
nttarget += 1;
}
this.tickInterval = tempti;
this.numberTicks = nttarget;
for (var i=0; i<nttarget; i++) {
opts.value = this.min + i * tempti;
t = new this.tickRenderer(opts);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
this._ticks.push(t);
}
insetMult = this.tickInterval;
}
// should we use a monthly interval?
else if (titarget <= 9 * month) {
this._autoFormatString = '%v';
// how many months in an interval?
var intv = Math.round(titarget/month);
if (intv < 1) {
intv = 1;
}
else if (intv > 6) {
intv = 6;
}
// figure out the starting month and ending month.
var mstart = new $.jsDate(min).setDate(1).setHours(0,0,0,0);
// See if max ends exactly on a month
var tempmend = new $.jsDate(max);
var mend = new $.jsDate(max).setDate(1).setHours(0,0,0,0);
if (tempmend.getTime() !== mend.getTime()) {
mend = mend.add(1, 'month');
}
var nmonths = mend.diff(mstart, 'month');
nttarget = Math.ceil(nmonths/intv) + 1;
this.min = mstart.getTime();
this.max = mstart.clone().add((nttarget - 1) * intv, 'month').getTime();
this.numberTicks = nttarget;
for (var i=0; i<nttarget; i++) {
if (i === 0) {
opts.value = mstart.getTime();
}
else {
opts.value = mstart.add(intv, 'month').getTime();
}
t = new this.tickRenderer(opts);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
this._ticks.push(t);
}
insetMult = intv * month;
}
// use yearly intervals
else {
this._autoFormatString = '%v';
// how many years in an interval?
var intv = Math.round(titarget/year);
if (intv < 1) {
intv = 1;
}
// figure out the starting and ending years.
var mstart = new $.jsDate(min).setMonth(0, 1).setHours(0,0,0,0);
var mend = new $.jsDate(max).add(1, 'year').setMonth(0, 1).setHours(0,0,0,0);
var nyears = mend.diff(mstart, 'year');
nttarget = Math.ceil(nyears/intv) + 1;
this.min = mstart.getTime();
this.max = mstart.clone().add((nttarget - 1) * intv, 'year').getTime();
this.numberTicks = nttarget;
for (var i=0; i<nttarget; i++) {
if (i === 0) {
opts.value = mstart.getTime();
}
else {
opts.value = mstart.add(intv, 'year').getTime();
}
t = new this.tickRenderer(opts);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
this._ticks.push(t);
}
insetMult = intv * year;
}
}
////////
// Some option(s) specified, work around that.
////////
else {
if (name == 'xaxis' || name == 'x2axis') {
dim = this._plotDimensions.width;
}
else {
dim = this._plotDimensions.height;
}
// if min, max and number of ticks specified, user can't specify interval.
if (this.min != null && this.max != null && this.numberTicks != null) {
this.tickInterval = null;
}
if (this.tickInterval != null && daTickInterval != null) {
this.daTickInterval = daTickInterval;
}
// if min and max are same, space them out a bit
if (min == max) {
var adj = 24*60*60*500; // 1/2 day
min -= adj;
max += adj;
}
range = max - min;
var optNumTicks = 2 + parseInt(Math.max(0, dim-100)/100, 10);
var rmin, rmax;
rmin = (this.min != null) ? new $.jsDate(this.min).getTime() : min - range/2*(this.padMin - 1);
rmax = (this.max != null) ? new $.jsDate(this.max).getTime() : max + range/2*(this.padMax - 1);
this.min = rmin;
this.max = rmax;
range = this.max - this.min;
if (this.numberTicks == null){
// if tickInterval is specified by user, we will ignore computed maximum.
// max will be equal or greater to fit even # of ticks.
if (this.daTickInterval != null) {
var nc = new $.jsDate(this.max).diff(this.min, this.daTickInterval[1], true);
this.numberTicks = Math.ceil(nc/this.daTickInterval[0]) +1;
// this.max = new $.jsDate(this.min).add(this.numberTicks-1, this.daTickInterval[1]).getTime();
this.max = new $.jsDate(this.min).add((this.numberTicks-1) * this.daTickInterval[0], this.daTickInterval[1]).getTime();
}
else if (dim > 200) {
this.numberTicks = parseInt(3+(dim-200)/100, 10);
}
else {
this.numberTicks = 2;
}
}
insetMult = range / (this.numberTicks-1)/1000;
if (this.daTickInterval == null) {
this.daTickInterval = [insetMult, 'seconds'];
}
for (var i=0; i<this.numberTicks; i++){
var min = new $.jsDate(this.min);
tt = min.add(i*this.daTickInterval[0], this.daTickInterval[1]).getTime();
var t = new this.tickRenderer(this.tickOptions);
// var t = new $.jqplot.AxisTickRenderer(this.tickOptions);
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(tt, this.name);
this._ticks.push(t);
}
}
if (this.tickInset) {
this.min = this.min - this.tickInset * insetMult;
this.max = this.max + this.tickInset * insetMult;
}
if (this._daTickInterval == null) {
this._daTickInterval = this.daTickInterval;
}
ticks = null;
};
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,816 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.DonutRenderer
* Plugin renderer to draw a donut chart.
* x values, if present, will be used as slice labels.
* y values give slice size.
*
* To use this renderer, you need to include the
* donut renderer plugin, for example:
*
* > <script type="text/javascript" src="plugins/jqplot.donutRenderer.js"></script>
*
* Properties described here are passed into the $.jqplot function
* as options on the series renderer. For example:
*
* > plot2 = $.jqplot('chart2', [s1, s2], {
* > seriesDefaults: {
* > renderer:$.jqplot.DonutRenderer,
* > rendererOptions:{
* > sliceMargin: 2,
* > innerDiameter: 110,
* > startAngle: -90
* > }
* > }
* > });
*
* A donut plot will trigger events on the plot target
* according to user interaction. All events return the event object,
* the series index, the point (slice) index, and the point data for
* the appropriate slice.
*
* 'jqplotDataMouseOver' - triggered when user mouseing over a slice.
* 'jqplotDataHighlight' - triggered the first time user mouses over a slice,
* if highlighting is enabled.
* 'jqplotDataUnhighlight' - triggered when a user moves the mouse out of
* a highlighted slice.
* 'jqplotDataClick' - triggered when the user clicks on a slice.
* 'jqplotDataRightClick' - tiggered when the user right clicks on a slice if
* the "captureRightClick" option is set to true on the plot.
*/
$.jqplot.DonutRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.DonutRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.DonutRenderer.prototype.constructor = $.jqplot.DonutRenderer;
// called with scope of a series
$.jqplot.DonutRenderer.prototype.init = function(options, plot) {
// Group: Properties
//
// prop: diameter
// Outer diameter of the donut, auto computed by default
this.diameter = null;
// prop: innerDiameter
// Inner diameter of the donut, auto calculated by default.
// If specified will override thickness value.
this.innerDiameter = null;
// prop: thickness
// thickness of the donut, auto computed by default
// Overridden by if innerDiameter is specified.
this.thickness = null;
// prop: padding
// padding between the donut and plot edges, legend, etc.
this.padding = 20;
// prop: sliceMargin
// angular spacing between donut slices in degrees.
this.sliceMargin = 0;
// prop: ringMargin
// pixel distance between rings, or multiple series in a donut plot.
// null will compute ringMargin based on sliceMargin.
this.ringMargin = null;
// prop: fill
// true or false, whether to fil the slices.
this.fill = true;
// prop: shadowOffset
// offset of the shadow from the slice and offset of
// each succesive stroke of the shadow from the last.
this.shadowOffset = 2;
// prop: shadowAlpha
// transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07;
// prop: shadowDepth
// number of strokes to apply to the shadow,
// each stroke offset shadowOffset from the last.
this.shadowDepth = 5;
// prop: highlightMouseOver
// True to highlight slice when moused over.
// This must be false to enable highlightMouseDown to highlight when clicking on a slice.
this.highlightMouseOver = true;
// prop: highlightMouseDown
// True to highlight when a mouse button is pressed over a slice.
// This will be disabled if highlightMouseOver is true.
this.highlightMouseDown = false;
// prop: highlightColors
// an array of colors to use when highlighting a slice.
this.highlightColors = [];
// prop: dataLabels
// Either 'label', 'value', 'percent' or an array of labels to place on the pie slices.
// Defaults to percentage of each pie slice.
this.dataLabels = 'percent';
// prop: showDataLabels
// true to show data labels on slices.
this.showDataLabels = false;
// prop: totalLabel
// true to show total label in the centre
this.totalLabel = false;
// prop: dataLabelFormatString
// Format string for data labels. If none, '%s' is used for "label" and for arrays, '%d' for value and '%d%%' for percentage.
this.dataLabelFormatString = null;
// prop: dataLabelThreshold
// Threshhold in percentage (0 - 100) of pie area, below which no label will be displayed.
// This applies to all label types, not just to percentage labels.
this.dataLabelThreshold = 3;
// prop: dataLabelPositionFactor
// A Multiplier (0-1) of the pie radius which controls position of label on slice.
// Increasing will slide label toward edge of pie, decreasing will slide label toward center of pie.
this.dataLabelPositionFactor = 0.4;
// prop: dataLabelNudge
// Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelNudge = 0;
// prop: startAngle
// Angle to start drawing donut in degrees.
// According to orientation of canvas coordinate system:
// 0 = on the positive x axis
// -90 = on the positive y axis.
// 90 = on the negaive y axis.
// 180 or - 180 = on the negative x axis.
this.startAngle = 0;
this.tickRenderer = $.jqplot.DonutTickRenderer;
// Used as check for conditions where donut shouldn't be drawn.
this._drawData = true;
this._type = 'donut';
// if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver
if (options.highlightMouseDown && options.highlightMouseOver == null) {
options.highlightMouseOver = false;
}
$.extend(true, this, options);
if (this.diameter != null) {
this.diameter = this.diameter - this.sliceMargin;
}
this._diameter = null;
this._innerDiameter = null;
this._radius = null;
this._innerRadius = null;
this._thickness = null;
// references to the previous series in the plot to properly calculate diameters
// and thicknesses of nested rings.
this._previousSeries = [];
this._numberSeries = 1;
// array of [start,end] angles arrays, one for each slice. In radians.
this._sliceAngles = [];
// index of the currenty highlighted point, if any
this._highlightedPoint = null;
// set highlight colors if none provided
if (this.highlightColors.length == 0) {
for (var i=0; i<this.seriesColors.length; i++){
var rgba = $.jqplot.getColorComponents(this.seriesColors[i]);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var sum = newrgb[0] + newrgb[1] + newrgb[2];
for (var j=0; j<3; j++) {
// when darkening, lowest color component can be is 60.
newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.3 * (255 - newrgb[j]);
newrgb[j] = parseInt(newrgb[j], 10);
}
this.highlightColors.push('rgb('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+')');
}
}
plot.postParseOptionsHooks.addOnce(postParseOptions);
plot.postInitHooks.addOnce(postInit);
plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove);
plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown);
plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp);
plot.eventListenerHooks.addOnce('jqplotClick', handleClick);
plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick);
plot.postDrawHooks.addOnce(postPlotDraw);
};
$.jqplot.DonutRenderer.prototype.setGridData = function(plot) {
// set gridData property. This will hold angle in radians of each data point.
var stack = [];
var td = [];
var sa = this.startAngle/180*Math.PI;
var tot = 0;
// don't know if we have any valid data yet, so set plot to not draw.
this._drawData = false;
for (var i=0; i<this.data.length; i++){
if (this.data[i][1] != 0) {
// we have data, O.K. to draw.
this._drawData = true;
}
stack.push(this.data[i][1]);
td.push([this.data[i][0]]);
if (i>0) {
stack[i] += stack[i-1];
}
tot += this.data[i][1];
}
var fact = Math.PI*2/stack[stack.length - 1];
for (var i=0; i<stack.length; i++) {
td[i][1] = stack[i] * fact;
td[i][2] = this.data[i][1]/tot;
}
this.gridData = td;
};
$.jqplot.DonutRenderer.prototype.makeGridData = function(data, plot) {
var stack = [];
var td = [];
var tot = 0;
var sa = this.startAngle/180*Math.PI;
// don't know if we have any valid data yet, so set plot to not draw.
this._drawData = false;
for (var i=0; i<data.length; i++){
if (this.data[i][1] != 0) {
// we have data, O.K. to draw.
this._drawData = true;
}
stack.push(data[i][1]);
td.push([data[i][0]]);
if (i>0) {
stack[i] += stack[i-1];
}
tot += data[i][1];
}
var fact = Math.PI*2/stack[stack.length - 1];
for (var i=0; i<stack.length; i++) {
td[i][1] = stack[i] * fact;
td[i][2] = data[i][1]/tot;
}
this._totalAmount = tot;
return td;
};
$.jqplot.DonutRenderer.prototype.drawSlice = function (ctx, ang1, ang2, color, isShadow) {
var r = this._diameter / 2;
var ri = r - this._thickness;
var fill = this.fill;
// var lineWidth = this.lineWidth;
ctx.save();
ctx.translate(this._center[0], this._center[1]);
// ctx.translate(this.sliceMargin*Math.cos((ang1+ang2)/2), this.sliceMargin*Math.sin((ang1+ang2)/2));
if (isShadow) {
for (var i=0; i<this.shadowDepth; i++) {
ctx.save();
ctx.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI), this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI));
doDraw();
}
}
else {
doDraw();
}
function doDraw () {
// Fix for IE and Chrome that can't seem to draw circles correctly.
// ang2 should always be <= 2 pi since that is the way the data is converted.
if (ang2 > 6.282 + this.startAngle) {
ang2 = 6.282 + this.startAngle;
if (ang1 > ang2) {
ang1 = 6.281 + this.startAngle;
}
}
// Fix for IE, where it can't seem to handle 0 degree angles. Also avoids
// ugly line on unfilled donuts.
if (ang1 >= ang2) {
return;
}
ctx.beginPath();
ctx.fillStyle = color;
ctx.strokeStyle = color;
// ctx.lineWidth = lineWidth;
ctx.arc(0, 0, r, ang1, ang2, false);
ctx.lineTo(ri*Math.cos(ang2), ri*Math.sin(ang2));
ctx.arc(0,0, ri, ang2, ang1, true);
ctx.closePath();
if (fill) {
ctx.fill();
}
else {
ctx.stroke();
}
}
if (isShadow) {
for (var i=0; i<this.shadowDepth; i++) {
ctx.restore();
}
}
ctx.restore();
};
// called with scope of series
$.jqplot.DonutRenderer.prototype.draw = function (ctx, gd, options, plot) {
var i;
var opts = (options != undefined) ? options : {};
// offset and direction of offset due to legend placement
var offx = 0;
var offy = 0;
var trans = 1;
// var colorGenerator = new this.colorGenerator(this.seriesColors);
if (options.legendInfo && options.legendInfo.placement == 'insideGrid') {
var li = options.legendInfo;
switch (li.location) {
case 'nw':
offx = li.width + li.xoffset;
break;
case 'w':
offx = li.width + li.xoffset;
break;
case 'sw':
offx = li.width + li.xoffset;
break;
case 'ne':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'e':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'se':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'n':
offy = li.height + li.yoffset;
break;
case 's':
offy = li.height + li.yoffset;
trans = -1;
break;
default:
break;
}
}
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine;
var fill = (opts.fill != undefined) ? opts.fill : this.fill;
//see http://stackoverflow.com/questions/20221461/hidpi-retina-plot-drawing
var cw = parseInt(ctx.canvas.style.width);
var ch = parseInt(ctx.canvas.style.height);
var w = cw - offx - 2 * this.padding;
var h = ch - offy - 2 * this.padding;
var mindim = Math.min(w,h);
var d = mindim;
var ringmargin = (this.ringMargin == null) ? this.sliceMargin * 2.0 : this.ringMargin;
for (var i=0; i<this._previousSeries.length; i++) {
d -= 2.0 * this._previousSeries[i]._thickness + 2.0 * ringmargin;
}
this._diameter = this.diameter || d;
if (this.innerDiameter != null) {
var od = (this._numberSeries > 1 && this.index > 0) ? this._previousSeries[0]._diameter : this._diameter;
this._thickness = this.thickness || (od - this.innerDiameter - 2.0*ringmargin*this._numberSeries) / this._numberSeries/2.0;
}
else {
this._thickness = this.thickness || mindim / 2 / (this._numberSeries + 1) * 0.85;
}
if (this._diameter < 6) {
$.jqplot.log("Diameter of donut too small, not rendering.");
return;
}
var r = this._radius = this._diameter/2;
this._innerRadius = this._radius - this._thickness;
var sa = this.startAngle / 180 * Math.PI;
this._center = [(cw - trans * offx)/2 + trans * offx, (ch - trans*offy)/2 + trans * offy];
if (this.shadow) {
var shadowColor = 'rgba(0,0,0,'+this.shadowAlpha+')';
for (var i=0; i<gd.length; i++) {
var ang1 = (i == 0) ? sa : gd[i-1][1] + sa;
// Adjust ang1 and ang2 for sliceMargin
ang1 += this.sliceMargin/180*Math.PI;
this.renderer.drawSlice.call (this, ctx, ang1, gd[i][1]+sa, shadowColor, true);
}
}
for (var i=0; i<gd.length; i++) {
var ang1 = (i == 0) ? sa : gd[i-1][1] + sa;
// Adjust ang1 and ang2 for sliceMargin
ang1 += this.sliceMargin/180*Math.PI;
var ang2 = gd[i][1] + sa;
this._sliceAngles.push([ang1, ang2]);
this.renderer.drawSlice.call (this, ctx, ang1, ang2, this.seriesColors[i], false);
if (this.showDataLabels && gd[i][2]*100 >= this.dataLabelThreshold) {
var fstr, avgang = (ang1+ang2)/2, label;
if (this.dataLabels == 'label') {
fstr = this.dataLabelFormatString || '%s';
label = $.jqplot.sprintf(fstr, gd[i][0]);
}
else if (this.dataLabels == 'value') {
fstr = this.dataLabelFormatString || '%d';
label = $.jqplot.sprintf(fstr, this.data[i][1]);
}
else if (this.dataLabels == 'percent') {
fstr = this.dataLabelFormatString || '%d%%';
label = $.jqplot.sprintf(fstr, gd[i][2]*100);
}
else if (this.dataLabels.constructor == Array) {
fstr = this.dataLabelFormatString || '%s';
label = $.jqplot.sprintf(fstr, this.dataLabels[i]);
}
var fact = this._innerRadius + this._thickness * this.dataLabelPositionFactor + this.sliceMargin + this.dataLabelNudge;
var x = this._center[0] + Math.cos(avgang) * fact + this.canvas._offsets.left;
var y = this._center[1] + Math.sin(avgang) * fact + this.canvas._offsets.top;
var labelelem = $('<span class="jqplot-donut-series jqplot-data-label" style="position:absolute;">' + label + '</span>').insertBefore(plot.eventCanvas._elem);
x -= labelelem.width()/2;
y -= labelelem.height()/2;
x = Math.round(x);
y = Math.round(y);
labelelem.css({left: x, top: y});
}
}
if (this.totalLabel) {
var totalLabel = $('<div class="jqplot-data-label" style="position:absolute">' + this._totalAmount + '</div>').insertAfter(plot.eventCanvas._elem);
totalLabel.css({left: this._center[0], top: this._center[1]});
}
};
$.jqplot.DonutAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
};
$.jqplot.DonutAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.DonutAxisRenderer.prototype.constructor = $.jqplot.DonutAxisRenderer;
// There are no traditional axes on a donut chart. We just need to provide
// dummy objects with properties so the plot will render.
// called with scope of axis object.
$.jqplot.DonutAxisRenderer.prototype.init = function(options){
//
this.tickRenderer = $.jqplot.DonutTickRenderer;
$.extend(true, this, options);
// I don't think I'm going to need _dataBounds here.
// have to go Axis scaling in a way to fit chart onto plot area
// and provide u2p and p2u functionality for mouse cursor, etc.
// for convienence set _dataBounds to 0 and 100 and
// set min/max to 0 and 100.
this._dataBounds = {min:0, max:100};
this.min = 0;
this.max = 100;
this.showTicks = false;
this.ticks = [];
this.showMark = false;
this.show = false;
};
$.jqplot.DonutLegendRenderer = function(){
$.jqplot.TableLegendRenderer.call(this);
};
$.jqplot.DonutLegendRenderer.prototype = new $.jqplot.TableLegendRenderer();
$.jqplot.DonutLegendRenderer.prototype.constructor = $.jqplot.DonutLegendRenderer;
/**
* Class: $.jqplot.DonutLegendRenderer
* Legend Renderer specific to donut plots. Set by default
* when user creates a donut plot.
*/
$.jqplot.DonutLegendRenderer.prototype.init = function(options) {
// Group: Properties
//
// prop: numberRows
// Maximum number of rows in the legend. 0 or null for unlimited.
this.numberRows = null;
// prop: numberColumns
// Maximum number of columns in the legend. 0 or null for unlimited.
this.numberColumns = null;
$.extend(true, this, options);
};
// called with context of legend
$.jqplot.DonutLegendRenderer.prototype.draw = function() {
var legend = this;
if (this.show) {
var series = this._series;
var ss = 'position:absolute;';
ss += (this.background) ? 'background:'+this.background+';' : '';
ss += (this.border) ? 'border:'+this.border+';' : '';
ss += (this.fontSize) ? 'font-size:'+this.fontSize+';' : '';
ss += (this.fontFamily) ? 'font-family:'+this.fontFamily+';' : '';
ss += (this.textColor) ? 'color:'+this.textColor+';' : '';
ss += (this.marginTop != null) ? 'margin-top:'+this.marginTop+';' : '';
ss += (this.marginBottom != null) ? 'margin-bottom:'+this.marginBottom+';' : '';
ss += (this.marginLeft != null) ? 'margin-left:'+this.marginLeft+';' : '';
ss += (this.marginRight != null) ? 'margin-right:'+this.marginRight+';' : '';
this._elem = $('<table class="jqplot-table-legend" style="'+ss+'"></table>');
// Donut charts legends don't go by number of series, but by number of data points
// in the series. Refactor things here for that.
var pad = false,
reverse = false,
nr, nc;
var s = series[0];
var colorGenerator = new $.jqplot.ColorGenerator(s.seriesColors);
if (s.show) {
var pd = s.data;
if (this.numberRows) {
nr = this.numberRows;
if (!this.numberColumns){
nc = Math.ceil(pd.length/nr);
}
else{
nc = this.numberColumns;
}
}
else if (this.numberColumns) {
nc = this.numberColumns;
nr = Math.ceil(pd.length/this.numberColumns);
}
else {
nr = pd.length;
nc = 1;
}
var i, j, tr, td1, td2, lt, rs, color;
var idx = 0;
for (i=0; i<nr; i++) {
if (reverse){
tr = $('<tr class="jqplot-table-legend"></tr>').prependTo(this._elem);
}
else{
tr = $('<tr class="jqplot-table-legend"></tr>').appendTo(this._elem);
}
for (j=0; j<nc; j++) {
if (idx < pd.length){
lt = this.labels[idx] || pd[idx][0].toString();
color = colorGenerator.next();
if (!reverse){
if (i>0){
pad = true;
}
else{
pad = false;
}
}
else{
if (i == nr -1){
pad = false;
}
else{
pad = true;
}
}
rs = (pad) ? this.rowSpacing : '0';
td1 = $('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+rs+';">'+
'<div><div class="jqplot-table-legend-swatch" style="border-color:'+color+';"></div>'+
'</div></td>');
td2 = $('<td class="jqplot-table-legend" style="padding-top:'+rs+';"></td>');
if (this.escapeHtml){
td2.text(lt);
}
else {
td2.html(lt);
}
if (reverse) {
td2.prependTo(tr);
td1.prependTo(tr);
}
else {
td1.appendTo(tr);
td2.appendTo(tr);
}
pad = true;
}
idx++;
}
}
}
}
return this._elem;
};
// setup default renderers for axes and legend so user doesn't have to
// called with scope of plot
function preInit(target, data, options) {
options = options || {};
options.axesDefaults = options.axesDefaults || {};
options.legend = options.legend || {};
options.seriesDefaults = options.seriesDefaults || {};
// only set these if there is a donut series
var setopts = false;
if (options.seriesDefaults.renderer == $.jqplot.DonutRenderer) {
setopts = true;
}
else if (options.series) {
for (var i=0; i < options.series.length; i++) {
if (options.series[i].renderer == $.jqplot.DonutRenderer) {
setopts = true;
}
}
}
if (setopts) {
options.axesDefaults.renderer = $.jqplot.DonutAxisRenderer;
options.legend.renderer = $.jqplot.DonutLegendRenderer;
options.legend.preDraw = true;
options.seriesDefaults.pointLabels = {show: false};
}
}
// called with scope of plot.
function postInit(target, data, options) {
// if multiple series, add a reference to the previous one so that
// donut rings can nest.
for (var i=1; i<this.series.length; i++) {
if (!this.series[i]._previousSeries.length){
for (var j=0; j<i; j++) {
if (this.series[i].renderer.constructor == $.jqplot.DonutRenderer && this.series[j].renderer.constructor == $.jqplot.DonutRenderer) {
this.series[i]._previousSeries.push(this.series[j]);
}
}
}
}
for (i=0; i<this.series.length; i++) {
if (this.series[i].renderer.constructor == $.jqplot.DonutRenderer) {
this.series[i]._numberSeries = this.series.length;
// don't allow mouseover and mousedown at same time.
if (this.series[i].highlightMouseOver) {
this.series[i].highlightMouseDown = false;
}
}
}
}
var postParseOptionsRun = false;
// called with scope of plot
function postParseOptions(options) {
for (var i=0; i<this.series.length; i++) {
this.series[i].seriesColors = this.seriesColors;
this.series[i].colorGenerator = $.jqplot.colorGenerator;
}
}
function highlight (plot, sidx, pidx) {
var s = plot.series[sidx];
var canvas = plot.plugins.donutRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0,canvas._ctx.canvas.width, canvas._ctx.canvas.height);
s._highlightedPoint = pidx;
plot.plugins.donutRenderer.highlightedSeriesIndex = sidx;
s.renderer.drawSlice.call(s, canvas._ctx, s._sliceAngles[pidx][0], s._sliceAngles[pidx][1], s.highlightColors[pidx], false);
}
function unhighlight (plot) {
var canvas = plot.plugins.donutRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height);
for (var i=0; i<plot.series.length; i++) {
plot.series[i]._highlightedPoint = null;
}
plot.plugins.donutRenderer.highlightedSeriesIndex = null;
plot.target.trigger('jqplotDataUnhighlight');
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt1 = jQuery.Event('jqplotDataMouseOver');
evt1.pageX = ev.pageX;
evt1.pageY = ev.pageY;
plot.target.trigger(evt1, ins);
if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.donutRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseDown(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.donutRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseUp(ev, gridpos, datapos, neighbor, plot) {
var idx = plot.plugins.donutRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
}
function handleClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt = jQuery.Event('jqplotDataClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
function handleRightClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var idx = plot.plugins.donutRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
var evt = jQuery.Event('jqplotDataRightClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
function postPlotDraw() {
// Memory Leaks patch
if (this.plugins.donutRenderer && this.plugins.donutRenderer.highlightCanvas) {
this.plugins.donutRenderer.highlightCanvas.resetCanvas();
this.plugins.donutRenderer.highlightCanvas = null;
}
this.plugins.donutRenderer = {highlightedSeriesIndex:null};
this.plugins.donutRenderer.highlightCanvas = new $.jqplot.GenericCanvas();
// do we have any data labels? if so, put highlight canvas before those
// Fix for broken jquery :first selector with canvas (VML) elements.
var labels = $(this.targetId+' .jqplot-data-label');
if (labels.length) {
$(labels[0]).before(this.plugins.donutRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-donutRenderer-highlight-canvas', this._plotDimensions, this));
}
// else put highlight canvas before event canvas.
else {
this.eventCanvas._elem.before(this.plugins.donutRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-donutRenderer-highlight-canvas', this._plotDimensions, this));
}
var hctx = this.plugins.donutRenderer.highlightCanvas.setContext();
this.eventCanvas._elem.bind('mouseleave', {plot:this}, function (ev) { unhighlight(ev.data.plot); });
}
$.jqplot.preInitHooks.push(preInit);
$.jqplot.DonutTickRenderer = function() {
$.jqplot.AxisTickRenderer.call(this);
};
$.jqplot.DonutTickRenderer.prototype = new $.jqplot.AxisTickRenderer();
$.jqplot.DonutTickRenderer.prototype.constructor = $.jqplot.DonutTickRenderer;
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,225 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.Dragable
* Plugin to make plotted points dragable by the user.
*/
$.jqplot.Dragable = function(options) {
// Group: Properties
this.markerRenderer = new $.jqplot.MarkerRenderer({shadow:false});
this.shapeRenderer = new $.jqplot.ShapeRenderer();
this.isDragging = false;
this.isOver = false;
this._ctx;
this._elem;
this._point;
this._gridData;
// prop: color
// CSS color spec for the dragged point (and adjacent line segment or bar).
this.color;
// prop: constrainTo
// Constrain dragging motion to an axis or to none.
// Allowable values are 'none', 'x', 'y'
this.constrainTo = 'none'; // 'x', 'y', or 'none';
$.extend(true, this, options);
};
function DragCanvas() {
$.jqplot.GenericCanvas.call(this);
this.isDragging = false;
this.isOver = false;
this._neighbor;
this._cursors = [];
}
DragCanvas.prototype = new $.jqplot.GenericCanvas();
DragCanvas.prototype.constructor = DragCanvas;
// called within scope of series
$.jqplot.Dragable.parseOptions = function (defaults, opts) {
var options = opts || {};
this.plugins.dragable = new $.jqplot.Dragable(options.dragable);
// since this function is called before series options are parsed,
// we can set this here and it will be overridden if needed.
this.isDragable = $.jqplot.config.enablePlugins;
};
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
// add a new DragCanvas object to the plot plugins to handle drawing on this new canvas.
$.jqplot.Dragable.postPlotDraw = function() {
// Memory Leaks patch
if (this.plugins.dragable && this.plugins.dragable.highlightCanvas) {
this.plugins.dragable.highlightCanvas.resetCanvas();
this.plugins.dragable.highlightCanvas = null;
}
this.plugins.dragable = {previousCursor:'auto', isOver:false};
this.plugins.dragable.dragCanvas = new DragCanvas();
this.eventCanvas._elem.before(this.plugins.dragable.dragCanvas.createElement(this._gridPadding, 'jqplot-dragable-canvas', this._plotDimensions, this));
var dctx = this.plugins.dragable.dragCanvas.setContext();
};
//$.jqplot.preInitHooks.push($.jqplot.Dragable.init);
$.jqplot.preParseSeriesOptionsHooks.push($.jqplot.Dragable.parseOptions);
$.jqplot.postDrawHooks.push($.jqplot.Dragable.postPlotDraw);
$.jqplot.eventListenerHooks.push(['jqplotMouseMove', handleMove]);
$.jqplot.eventListenerHooks.push(['jqplotMouseDown', handleDown]);
$.jqplot.eventListenerHooks.push(['jqplotMouseUp', handleUp]);
function initDragPoint(plot, neighbor) {
var s = plot.series[neighbor.seriesIndex];
var drag = s.plugins.dragable;
// first, init the mark renderer for the dragged point
var smr = s.markerRenderer;
var mr = drag.markerRenderer;
mr.style = smr.style;
mr.lineWidth = smr.lineWidth + 2.5;
mr.size = smr.size + 5;
if (!drag.color) {
var rgba = $.jqplot.getColorComponents(smr.color);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var alpha = (rgba[3] >= 0.6) ? rgba[3]*0.6 : rgba[3]*(2-rgba[3]);
drag.color = 'rgba('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+','+alpha+')';
}
mr.color = drag.color;
mr.init();
var start = (neighbor.pointIndex > 0) ? neighbor.pointIndex - 1 : 0;
var end = neighbor.pointIndex+2;
drag._gridData = s.gridData.slice(start, end);
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
if (plot.plugins.dragable.dragCanvas.isDragging) {
var dc = plot.plugins.dragable.dragCanvas;
var dp = dc._neighbor;
var s = plot.series[dp.seriesIndex];
var drag = s.plugins.dragable;
var gd = s.gridData;
// compute the new grid position with any constraints.
var x = (drag.constrainTo == 'y') ? dp.gridData[0] : gridpos.x;
var y = (drag.constrainTo == 'x') ? dp.gridData[1] : gridpos.y;
// compute data values for any listeners.
var xu = s._xaxis.series_p2u(x);
var yu = s._yaxis.series_p2u(y);
// clear the canvas then redraw effect at new position.
var ctx = dc._ctx;
ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height);
// adjust our gridData for the new mouse position
if (dp.pointIndex > 0) {
drag._gridData[1] = [x, y];
}
else {
drag._gridData[0] = [x, y];
}
plot.series[dp.seriesIndex].draw(dc._ctx, {gridData:drag._gridData, shadow:false, preventJqPlotSeriesDrawTrigger:true, color:drag.color, markerOptions:{color:drag.color, shadow:false}, trendline:{show:false}});
plot.target.trigger('jqplotSeriesPointChange', [dp.seriesIndex, dp.pointIndex, [xu,yu], [x,y]]);
}
else if (neighbor != null) {
var series = plot.series[neighbor.seriesIndex];
if (series.isDragable) {
var dc = plot.plugins.dragable.dragCanvas;
if (!dc.isOver) {
dc._cursors.push(ev.target.style.cursor);
ev.target.style.cursor = "pointer";
}
dc.isOver = true;
}
}
else if (neighbor == null) {
var dc = plot.plugins.dragable.dragCanvas;
if (dc.isOver) {
ev.target.style.cursor = dc._cursors.pop();
dc.isOver = false;
}
}
}
function handleDown(ev, gridpos, datapos, neighbor, plot) {
var dc = plot.plugins.dragable.dragCanvas;
dc._cursors.push(ev.target.style.cursor);
if (neighbor != null) {
var s = plot.series[neighbor.seriesIndex];
var drag = s.plugins.dragable;
if (s.isDragable && !dc.isDragging) {
dc._neighbor = neighbor;
dc.isDragging = true;
initDragPoint(plot, neighbor);
drag.markerRenderer.draw(s.gridData[neighbor.pointIndex][0], s.gridData[neighbor.pointIndex][1], dc._ctx);
ev.target.style.cursor = "move";
plot.target.trigger('jqplotDragStart', [neighbor.seriesIndex, neighbor.pointIndex, gridpos, datapos]);
}
}
// Just in case of a hickup, we'll clear the drag canvas and reset.
else {
var ctx = dc._ctx;
ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height);
dc.isDragging = false;
}
}
function handleUp(ev, gridpos, datapos, neighbor, plot) {
if (plot.plugins.dragable.dragCanvas.isDragging) {
var dc = plot.plugins.dragable.dragCanvas;
// clear the canvas
var ctx = dc._ctx;
ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height);
dc.isDragging = false;
// redraw the series canvas at the new point.
var dp = dc._neighbor;
var s = plot.series[dp.seriesIndex];
var drag = s.plugins.dragable;
// compute the new grid position with any constraints.
var x = (drag.constrainTo == 'y') ? dp.data[0] : datapos[s.xaxis];
var y = (drag.constrainTo == 'x') ? dp.data[1] : datapos[s.yaxis];
// var x = datapos[s.xaxis];
// var y = datapos[s.yaxis];
s.data[dp.pointIndex][0] = x;
s.data[dp.pointIndex][1] = y;
plot.drawSeries({preventJqPlotSeriesDrawTrigger:true}, dp.seriesIndex);
dc._neighbor = null;
ev.target.style.cursor = dc._cursors.pop();
plot.target.trigger('jqplotDragStop', [gridpos, datapos]);
}
}
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(d){d.jqplot.Dragable=function(g){this.markerRenderer=new d.jqplot.MarkerRenderer({shadow:false});this.shapeRenderer=new d.jqplot.ShapeRenderer();this.isDragging=false;this.isOver=false;this._ctx;this._elem;this._point;this._gridData;this.color;this.constrainTo="none";d.extend(true,this,g)};function b(){d.jqplot.GenericCanvas.call(this);this.isDragging=false;this.isOver=false;this._neighbor;this._cursors=[]}b.prototype=new d.jqplot.GenericCanvas();b.prototype.constructor=b;d.jqplot.Dragable.parseOptions=function(i,h){var g=h||{};this.plugins.dragable=new d.jqplot.Dragable(g.dragable);this.isDragable=d.jqplot.config.enablePlugins};d.jqplot.Dragable.postPlotDraw=function(){if(this.plugins.dragable&&this.plugins.dragable.highlightCanvas){this.plugins.dragable.highlightCanvas.resetCanvas();this.plugins.dragable.highlightCanvas=null}this.plugins.dragable={previousCursor:"auto",isOver:false};this.plugins.dragable.dragCanvas=new b();this.eventCanvas._elem.before(this.plugins.dragable.dragCanvas.createElement(this._gridPadding,"jqplot-dragable-canvas",this._plotDimensions,this));var g=this.plugins.dragable.dragCanvas.setContext()};d.jqplot.preParseSeriesOptionsHooks.push(d.jqplot.Dragable.parseOptions);d.jqplot.postDrawHooks.push(d.jqplot.Dragable.postPlotDraw);d.jqplot.eventListenerHooks.push(["jqplotMouseMove",e]);d.jqplot.eventListenerHooks.push(["jqplotMouseDown",c]);d.jqplot.eventListenerHooks.push(["jqplotMouseUp",a]);function f(n,p){var q=n.series[p.seriesIndex];var m=q.plugins.dragable;var h=q.markerRenderer;var i=m.markerRenderer;i.style=h.style;i.lineWidth=h.lineWidth+2.5;i.size=h.size+5;if(!m.color){var l=d.jqplot.getColorComponents(h.color);var o=[l[0],l[1],l[2]];var k=(l[3]>=0.6)?l[3]*0.6:l[3]*(2-l[3]);m.color="rgba("+o[0]+","+o[1]+","+o[2]+","+k+")"}i.color=m.color;i.init();var g=(p.pointIndex>0)?p.pointIndex-1:0;var j=p.pointIndex+2;m._gridData=q.gridData.slice(g,j)}function e(o,l,h,t,m){if(m.plugins.dragable.dragCanvas.isDragging){var u=m.plugins.dragable.dragCanvas;var i=u._neighbor;var w=m.series[i.seriesIndex];var k=w.plugins.dragable;var r=w.gridData;var p=(k.constrainTo=="y")?i.gridData[0]:l.x;var n=(k.constrainTo=="x")?i.gridData[1]:l.y;var g=w._xaxis.series_p2u(p);var q=w._yaxis.series_p2u(n);var v=u._ctx;v.clearRect(0,0,v.canvas.width,v.canvas.height);if(i.pointIndex>0){k._gridData[1]=[p,n]}else{k._gridData[0]=[p,n]}m.series[i.seriesIndex].draw(u._ctx,{gridData:k._gridData,shadow:false,preventJqPlotSeriesDrawTrigger:true,color:k.color,markerOptions:{color:k.color,shadow:false},trendline:{show:false}});m.target.trigger("jqplotSeriesPointChange",[i.seriesIndex,i.pointIndex,[g,q],[p,n]])}else{if(t!=null){var j=m.series[t.seriesIndex];if(j.isDragable){var u=m.plugins.dragable.dragCanvas;if(!u.isOver){u._cursors.push(o.target.style.cursor);o.target.style.cursor="pointer"}u.isOver=true}}else{if(t==null){var u=m.plugins.dragable.dragCanvas;if(u.isOver){o.target.style.cursor=u._cursors.pop();u.isOver=false}}}}}function c(k,i,g,l,j){var m=j.plugins.dragable.dragCanvas;m._cursors.push(k.target.style.cursor);if(l!=null){var o=j.series[l.seriesIndex];var h=o.plugins.dragable;if(o.isDragable&&!m.isDragging){m._neighbor=l;m.isDragging=true;f(j,l);h.markerRenderer.draw(o.gridData[l.pointIndex][0],o.gridData[l.pointIndex][1],m._ctx);k.target.style.cursor="move";j.target.trigger("jqplotDragStart",[l.seriesIndex,l.pointIndex,i,g])}}else{var n=m._ctx;n.clearRect(0,0,n.canvas.width,n.canvas.height);m.isDragging=false}}function a(m,j,g,o,k){if(k.plugins.dragable.dragCanvas.isDragging){var p=k.plugins.dragable.dragCanvas;var q=p._ctx;q.clearRect(0,0,q.canvas.width,q.canvas.height);p.isDragging=false;var h=p._neighbor;var r=k.series[h.seriesIndex];var i=r.plugins.dragable;var n=(i.constrainTo=="y")?h.data[0]:g[r.xaxis];var l=(i.constrainTo=="x")?h.data[1]:g[r.yaxis];r.data[h.pointIndex][0]=n;r.data[h.pointIndex][1]=l;k.drawSeries({preventJqPlotSeriesDrawTrigger:true},h.seriesIndex);p._neighbor=null;m.target.style.cursor=p._cursors.pop();k.target.trigger("jqplotDragStop",[j,g])}}})(jQuery);

View File

@ -0,0 +1,305 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
// class $.jqplot.EnhancedLegendRenderer
// Legend renderer which can specify the number of rows and/or columns in the legend.
$.jqplot.EnhancedLegendRenderer = function(){
$.jqplot.TableLegendRenderer.call(this);
};
$.jqplot.EnhancedLegendRenderer.prototype = new $.jqplot.TableLegendRenderer();
$.jqplot.EnhancedLegendRenderer.prototype.constructor = $.jqplot.EnhancedLegendRenderer;
// called with scope of legend.
$.jqplot.EnhancedLegendRenderer.prototype.init = function(options) {
// prop: numberRows
// Maximum number of rows in the legend. 0 or null for unlimited.
this.numberRows = null;
// prop: numberColumns
// Maximum number of columns in the legend. 0 or null for unlimited.
this.numberColumns = null;
// prop: seriesToggle
// false to not enable series on/off toggling on the legend.
// true or a fadein/fadeout speed (number of milliseconds or 'fast', 'normal', 'slow')
// to enable show/hide of series on click of legend item.
this.seriesToggle = 'normal';
// prop: seriesToggleReplot
// True to replot the chart after toggling series on/off.
// This will set the series show property to false.
// This allows for rescaling or other maniplation of chart.
// Set to an options object (e.g. {resetAxes: true}) for replot options.
this.seriesToggleReplot = false;
// prop: disableIEFading
// true to toggle series with a show/hide method only and not allow fading in/out.
// This is to overcome poor performance of fade in some versions of IE.
this.disableIEFading = true;
$.extend(true, this, options);
if (this.seriesToggle) {
$.jqplot.postDrawHooks.push(postDraw);
}
};
// called with scope of legend
$.jqplot.EnhancedLegendRenderer.prototype.draw = function(offsets, plot) {
var legend = this;
if (this.show) {
var series = this._series;
var s;
var ss = 'position:absolute;';
ss += (this.background) ? 'background:'+this.background+';' : '';
ss += (this.border) ? 'border:'+this.border+';' : '';
ss += (this.fontSize) ? 'font-size:'+this.fontSize+';' : '';
ss += (this.fontFamily) ? 'font-family:'+this.fontFamily+';' : '';
ss += (this.textColor) ? 'color:'+this.textColor+';' : '';
ss += (this.marginTop != null) ? 'margin-top:'+this.marginTop+';' : '';
ss += (this.marginBottom != null) ? 'margin-bottom:'+this.marginBottom+';' : '';
ss += (this.marginLeft != null) ? 'margin-left:'+this.marginLeft+';' : '';
ss += (this.marginRight != null) ? 'margin-right:'+this.marginRight+';' : '';
this._elem = $('<table class="jqplot-table-legend" style="'+ss+'"></table>');
if (this.seriesToggle) {
this._elem.css('z-index', '3');
}
var pad = false,
reverse = false,
nr, nc;
if (this.numberRows) {
nr = this.numberRows;
if (!this.numberColumns){
nc = Math.ceil(series.length/nr);
}
else{
nc = this.numberColumns;
}
}
else if (this.numberColumns) {
nc = this.numberColumns;
nr = Math.ceil(series.length/this.numberColumns);
}
else {
nr = series.length;
nc = 1;
}
var i, j, tr, td1, td2, lt, rs, div, div0, div1;
var idx = 0;
// check to see if we need to reverse
for (i=series.length-1; i>=0; i--) {
if (nc == 1 && series[i]._stack || series[i].renderer.constructor == $.jqplot.BezierCurveRenderer){
reverse = true;
}
}
for (i=0; i<nr; i++) {
tr = $(document.createElement('tr'));
tr.addClass('jqplot-table-legend');
if (reverse){
tr.prependTo(this._elem);
}
else{
tr.appendTo(this._elem);
}
for (j=0; j<nc; j++) {
if (idx < series.length && (series[idx].show || series[idx].showLabel)){
s = series[idx];
lt = this.labels[idx] || s.label.toString();
if (lt) {
var color = s.color;
if (!reverse){
if (i>0){
pad = true;
}
else{
pad = false;
}
}
else{
if (i == nr -1){
pad = false;
}
else{
pad = true;
}
}
rs = (pad) ? this.rowSpacing : '0';
td1 = $(document.createElement('td'));
td1.addClass('jqplot-table-legend jqplot-table-legend-swatch');
td1.css({textAlign: 'center', paddingTop: rs});
div0 = $(document.createElement('div'));
div0.addClass('jqplot-table-legend-swatch-outline');
div1 = $(document.createElement('div'));
div1.addClass('jqplot-table-legend-swatch');
div1.css({backgroundColor: color, borderColor: color});
td1.append(div0.append(div1));
td2 = $(document.createElement('td'));
td2.addClass('jqplot-table-legend jqplot-table-legend-label');
td2.css('paddingTop', rs);
// td1 = $('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+rs+';">'+
// '<div><div class="jqplot-table-legend-swatch" style="background-color:'+color+';border-color:'+color+';"></div>'+
// '</div></td>');
// td2 = $('<td class="jqplot-table-legend" style="padding-top:'+rs+';"></td>');
if (this.escapeHtml){
td2.text(lt);
}
else {
td2.html(lt);
}
if (reverse) {
if (this.showLabels) {td2.prependTo(tr);}
if (this.showSwatches) {td1.prependTo(tr);}
}
else {
if (this.showSwatches) {td1.appendTo(tr);}
if (this.showLabels) {td2.appendTo(tr);}
}
if (this.seriesToggle) {
// add an overlay for clicking series on/off
// div0 = $(document.createElement('div'));
// div0.addClass('jqplot-table-legend-overlay');
// div0.css({position:'relative', left:0, top:0, height:'100%', width:'100%'});
// tr.append(div0);
var speed;
if (typeof(this.seriesToggle) === 'string' || typeof(this.seriesToggle) === 'number') {
if (!$.jqplot.use_excanvas || !this.disableIEFading) {
speed = this.seriesToggle;
}
}
if (this.showSwatches) {
td1.bind('click', {series:s, speed:speed, plot: plot, replot:this.seriesToggleReplot}, handleToggle);
td1.addClass('jqplot-seriesToggle');
}
if (this.showLabels) {
td2.bind('click', {series:s, speed:speed, plot: plot, replot:this.seriesToggleReplot}, handleToggle);
td2.addClass('jqplot-seriesToggle');
}
// for series that are already hidden, add the hidden class
if (!s.show && s.showLabel) {
td1.addClass('jqplot-series-hidden');
td2.addClass('jqplot-series-hidden');
}
}
pad = true;
}
}
idx++;
}
td1 = td2 = div0 = div1 = null;
}
}
return this._elem;
};
var handleToggle = function (ev) {
var d = ev.data,
s = d.series,
replot = d.replot,
plot = d.plot,
speed = d.speed,
sidx = s.index,
showing = false;
if (s.canvas._elem.is(':hidden') || !s.show) {
showing = true;
}
var doLegendToggle = function() {
if (replot) {
var opts = {};
if ($.isPlainObject(replot)) {
$.extend(true, opts, replot);
}
plot.replot(opts);
// if showing, there was no canvas element to fade in, so hide here
// and then do a fade in.
if (showing && speed) {
var s = plot.series[sidx];
if (s.shadowCanvas._elem) {
s.shadowCanvas._elem.hide().fadeIn(speed);
}
s.canvas._elem.hide().fadeIn(speed);
s.canvas._elem.nextAll('.jqplot-point-label.jqplot-series-'+s.index).hide().fadeIn(speed);
}
}
else {
var s = plot.series[sidx];
if (s.canvas._elem.is(':hidden') || !s.show) {
// Not sure if there is a better way to check for showSwatches and showLabels === true.
// Test for "undefined" since default values for both showSwatches and showLables is true.
if (typeof plot.options.legend.showSwatches === 'undefined' || plot.options.legend.showSwatches === true) {
plot.legend._elem.find('td').eq(sidx * 2).addClass('jqplot-series-hidden');
}
if (typeof plot.options.legend.showLabels === 'undefined' || plot.options.legend.showLabels === true) {
plot.legend._elem.find('td').eq((sidx * 2) + 1).addClass('jqplot-series-hidden');
}
}
else {
if (typeof plot.options.legend.showSwatches === 'undefined' || plot.options.legend.showSwatches === true) {
plot.legend._elem.find('td').eq(sidx * 2).removeClass('jqplot-series-hidden');
}
if (typeof plot.options.legend.showLabels === 'undefined' || plot.options.legend.showLabels === true) {
plot.legend._elem.find('td').eq((sidx * 2) + 1).removeClass('jqplot-series-hidden');
}
}
}
};
s.toggleDisplay(ev, doLegendToggle);
};
// called with scope of plot.
var postDraw = function () {
if (this.legend.renderer.constructor == $.jqplot.EnhancedLegendRenderer && this.legend.seriesToggle){
var e = this.legend._elem.detach();
this.eventCanvas._elem.after(e);
}
};
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(c){c.jqplot.EnhancedLegendRenderer=function(){c.jqplot.TableLegendRenderer.call(this)};c.jqplot.EnhancedLegendRenderer.prototype=new c.jqplot.TableLegendRenderer();c.jqplot.EnhancedLegendRenderer.prototype.constructor=c.jqplot.EnhancedLegendRenderer;c.jqplot.EnhancedLegendRenderer.prototype.init=function(d){this.numberRows=null;this.numberColumns=null;this.seriesToggle="normal";this.seriesToggleReplot=false;this.disableIEFading=true;c.extend(true,this,d);if(this.seriesToggle){c.jqplot.postDrawHooks.push(b)}};c.jqplot.EnhancedLegendRenderer.prototype.draw=function(m,y){var f=this;if(this.show){var r=this._series;var u;var w="position:absolute;";w+=(this.background)?"background:"+this.background+";":"";w+=(this.border)?"border:"+this.border+";":"";w+=(this.fontSize)?"font-size:"+this.fontSize+";":"";w+=(this.fontFamily)?"font-family:"+this.fontFamily+";":"";w+=(this.textColor)?"color:"+this.textColor+";":"";w+=(this.marginTop!=null)?"margin-top:"+this.marginTop+";":"";w+=(this.marginBottom!=null)?"margin-bottom:"+this.marginBottom+";":"";w+=(this.marginLeft!=null)?"margin-left:"+this.marginLeft+";":"";w+=(this.marginRight!=null)?"margin-right:"+this.marginRight+";":"";this._elem=c('<table class="jqplot-table-legend" style="'+w+'"></table>');if(this.seriesToggle){this._elem.css("z-index","3")}var C=false,q=false,d,o;if(this.numberRows){d=this.numberRows;if(!this.numberColumns){o=Math.ceil(r.length/d)}else{o=this.numberColumns}}else{if(this.numberColumns){o=this.numberColumns;d=Math.ceil(r.length/this.numberColumns)}else{d=r.length;o=1}}var B,z,e,l,k,n,p,t,h,g;var v=0;for(B=r.length-1;B>=0;B--){if(o==1&&r[B]._stack||r[B].renderer.constructor==c.jqplot.BezierCurveRenderer){q=true}}for(B=0;B<d;B++){e=c(document.createElement("tr"));e.addClass("jqplot-table-legend");if(q){e.prependTo(this._elem)}else{e.appendTo(this._elem)}for(z=0;z<o;z++){if(v<r.length&&(r[v].show||r[v].showLabel)){u=r[v];n=this.labels[v]||u.label.toString();if(n){var x=u.color;if(!q){if(B>0){C=true}else{C=false}}else{if(B==d-1){C=false}else{C=true}}p=(C)?this.rowSpacing:"0";l=c(document.createElement("td"));l.addClass("jqplot-table-legend jqplot-table-legend-swatch");l.css({textAlign:"center",paddingTop:p});h=c(document.createElement("div"));h.addClass("jqplot-table-legend-swatch-outline");g=c(document.createElement("div"));g.addClass("jqplot-table-legend-swatch");g.css({backgroundColor:x,borderColor:x});l.append(h.append(g));k=c(document.createElement("td"));k.addClass("jqplot-table-legend jqplot-table-legend-label");k.css("paddingTop",p);if(this.escapeHtml){k.text(n)}else{k.html(n)}if(q){if(this.showLabels){k.prependTo(e)}if(this.showSwatches){l.prependTo(e)}}else{if(this.showSwatches){l.appendTo(e)}if(this.showLabels){k.appendTo(e)}}if(this.seriesToggle){var A;if(typeof(this.seriesToggle)==="string"||typeof(this.seriesToggle)==="number"){if(!c.jqplot.use_excanvas||!this.disableIEFading){A=this.seriesToggle}}if(this.showSwatches){l.bind("click",{series:u,speed:A,plot:y,replot:this.seriesToggleReplot},a);l.addClass("jqplot-seriesToggle")}if(this.showLabels){k.bind("click",{series:u,speed:A,plot:y,replot:this.seriesToggleReplot},a);k.addClass("jqplot-seriesToggle")}if(!u.show&&u.showLabel){l.addClass("jqplot-series-hidden");k.addClass("jqplot-series-hidden")}}C=true}}v++}l=k=h=g=null}}return this._elem};var a=function(j){var i=j.data,m=i.series,k=i.replot,h=i.plot,f=i.speed,l=m.index,g=false;if(m.canvas._elem.is(":hidden")||!m.show){g=true}var e=function(){if(k){var n={};if(c.isPlainObject(k)){c.extend(true,n,k)}h.replot(n);if(g&&f){var d=h.series[l];if(d.shadowCanvas._elem){d.shadowCanvas._elem.hide().fadeIn(f)}d.canvas._elem.hide().fadeIn(f);d.canvas._elem.nextAll(".jqplot-point-label.jqplot-series-"+d.index).hide().fadeIn(f)}}else{var d=h.series[l];if(d.canvas._elem.is(":hidden")||!d.show){if(typeof h.options.legend.showSwatches==="undefined"||h.options.legend.showSwatches===true){h.legend._elem.find("td").eq(l*2).addClass("jqplot-series-hidden")}if(typeof h.options.legend.showLabels==="undefined"||h.options.legend.showLabels===true){h.legend._elem.find("td").eq((l*2)+1).addClass("jqplot-series-hidden")}}else{if(typeof h.options.legend.showSwatches==="undefined"||h.options.legend.showSwatches===true){h.legend._elem.find("td").eq(l*2).removeClass("jqplot-series-hidden")}if(typeof h.options.legend.showLabels==="undefined"||h.options.legend.showLabels===true){h.legend._elem.find("td").eq((l*2)+1).removeClass("jqplot-series-hidden")}}}};m.toggleDisplay(j,e)};var b=function(){if(this.legend.renderer.constructor==c.jqplot.EnhancedLegendRenderer&&this.legend.seriesToggle){var d=this.legend._elem.detach();this.eventCanvas._elem.after(d)}}})(jQuery);

View File

@ -0,0 +1,261 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
// class $.jqplot.EnhancedPieLegendRenderer
// Legend renderer which can specify the number of rows and/or columns in the legend
// Similar to EnhancedLegendRenderer, but for pie charts
$.jqplot.EnhancedPieLegendRenderer = function(){
$.jqplot.TableLegendRenderer.call(this);
};
$.jqplot.EnhancedPieLegendRenderer.prototype = new $.jqplot.TableLegendRenderer();
$.jqplot.EnhancedPieLegendRenderer.prototype.constructor = $.jqplot.EnhancedPieLegendRenderer;
// called with scope of legend.
$.jqplot.EnhancedPieLegendRenderer.prototype.init = function(options) {
// prop: numberRows
// Maximum number of rows in the legend. 0 or null for unlimited.
this.numberRows = null;
// prop: numberColumns
// Maximum number of columns in the legend. 0 or null for unlimited.
this.numberColumns = null;
// prop: seriesToggle
// false to not enable series on/off toggling on the legend.
// true or a fadein/fadeout speed (number of milliseconds or 'fast', 'normal', 'slow')
// to enable show/hide of series on click of legend item.
this.seriesToggle = 'normal';
// prop: seriesToggleReplot
// True to replot the chart after toggling series on/off.
// This will set the series show property to false.
// This allows for rescaling or other maniplation of chart.
// Set to an options object (e.g. {resetAxes: true}) for replot options.
this.seriesToggleReplot = false;
// prop: disableIEFading
// true to toggle series with a show/hide method only and not allow fading in/out.
// This is to overcome poor performance of fade in some versions of IE.
this.disableIEFading = true;
// prop: toolTips
// optional array of toolTip text corresponding to each pie slice
this.toolTips = [];
$.extend(true, this, options);
if (this.seriesToggle) {
$.jqplot.postDrawHooks.push(postDraw);
}
};
// called with scope of legend
$.jqplot.EnhancedPieLegendRenderer.prototype.draw = function(offsets, plot) {
var legend = this;
if (this.show) {
var series = this._series;
var s;
var ss = 'position:absolute;';
ss += (this.background) ? 'background:'+this.background+';' : '';
ss += (this.border) ? 'border:'+this.border+';' : '';
ss += (this.fontSize) ? 'font-size:'+this.fontSize+';' : '';
ss += (this.fontFamily) ? 'font-family:'+this.fontFamily+';' : '';
ss += (this.textColor) ? 'color:'+this.textColor+';' : '';
ss += (this.marginTop != null) ? 'margin-top:'+this.marginTop+';' : '';
ss += (this.marginBottom != null) ? 'margin-bottom:'+this.marginBottom+';' : '';
ss += (this.marginLeft != null) ? 'margin-left:'+this.marginLeft+';' : '';
ss += (this.marginRight != null) ? 'margin-right:'+this.marginRight+';' : '';
this._elem = $('<table class="jqplot-table-legend" style="'+ss+'"></table>');
if (this.seriesToggle) {
this._elem.css('z-index', '3');
}
var pad = false,
reverse = false,
nr, nc;
var s = series[0];
var slen = s.data.length;
var colorGenerator = new $.jqplot.ColorGenerator(s.seriesColors);
if (this.numberRows) {
nr = this.numberRows;
if (!this.numberColumns){
nc = Math.ceil(slen/nr);
}
else{
nc = this.numberColumns;
}
}
else if (this.numberColumns) {
nc = this.numberColumns;
nr = Math.ceil(slen/this.numberColumns);
}
else {
nr = slen;
nc = 1;
}
var i, j, tr, td1, td2, lt, rs, div, div0, div1;
var idx = 0;
// check to see if we need to reverse
for (i=series.length-1; i>=0; i--) {
if (nc == 1 && series[i]._stack || series[i].renderer.constructor == $.jqplot.BezierCurveRenderer){
reverse = true;
}
}
for (i=0; i<nr; i++) {
tr = $(document.createElement('tr'));
tr.addClass('jqplot-table-legend');
if (reverse){
tr.prependTo(this._elem);
}
else{
tr.appendTo(this._elem);
}
for (j=0; j<nc; j++) {
if (idx < slen){
lt = this.labels[idx] || s.data[idx][0].toString();
tt = this.toolTips[idx];
if (lt) {
var color = colorGenerator.next();
if (!reverse){
if (i>0){
pad = true;
}
else{
pad = false;
}
}
else{
if (i == nr -1){
pad = false;
}
else{
pad = true;
}
}
rs = (pad) ? this.rowSpacing : '0';
td1 = $(document.createElement('td'));
td1.addClass('jqplot-table-legend jqplot-table-legend-swatch');
td1.css({textAlign: 'center', paddingTop: rs});
div0 = $(document.createElement('div'));
div0.addClass('jqplot-table-legend-swatch-outline');
if (tt !== undefined) {
div0.attr("title", tt);
}
div1 = $(document.createElement('div'));
div1.addClass('jqplot-table-legend-swatch');
div1.css({backgroundColor: color, borderColor: color});
td1.append(div0.append(div1));
td2 = $(document.createElement('td'));
td2.addClass('jqplot-table-legend jqplot-table-legend-label');
td2.css('paddingTop', rs);
if (tt !== undefined) {
td2.attr("title", tt);
}
if (this.escapeHtml){
td2.text(lt);
}
else {
td2.html(lt);
}
if (reverse) {
if (this.showLabels) {td2.prependTo(tr);}
if (this.showSwatches) {td1.prependTo(tr);}
}
else {
if (this.showSwatches) {td1.appendTo(tr);}
if (this.showLabels) {td2.appendTo(tr);}
}
if (this.seriesToggle) {
var speed;
if (typeof(this.seriesToggle) === 'string' || typeof(this.seriesToggle) === 'number') {
if (!$.jqplot.use_excanvas || !this.disableIEFading) {
speed = this.seriesToggle;
}
}
if (this.showSwatches) {
td1.bind('click', {series:s, index:idx, speed:speed, plot: plot, replot:this.seriesToggleReplot}, handleToggle);
td1.addClass('jqplot-seriesToggle');
}
if (this.showLabels) {
td2.bind('click', {series:s, index:idx, speed:speed, plot: plot, replot:this.seriesToggleReplot}, handleToggle);
td2.addClass('jqplot-seriesToggle');
}
// for slices that are already hidden, add the hidden class
if (s.showSlice[idx] === false && s.showLabel) {
td1.addClass('jqplot-series-hidden');
td2.addClass('jqplot-series-hidden');
}
}
pad = true;
}
}
idx++;
}
td1 = td2 = div0 = div1 = null;
}
}
return this._elem;
};
var handleToggle = function (ev) {
var d = ev.data,
replot = d.replot,
plot = d.plot,
idx = d.index;
d.series.showSlice[idx] = (d.series.showSlice[idx] === false) ? true : false;
var opts = {};
if ($.isPlainObject(replot)) {
$.extend(true, opts, replot);
}
plot.replot(opts);
};
// called with scope of plot.
var postDraw = function () {
if (this.legend.renderer.constructor == $.jqplot.EnhancedPieLegendRenderer && this.legend.seriesToggle) {
var e = this.legend._elem.detach();
this.eventCanvas._elem.after(e);
}
};
})(jQuery);

View File

@ -0,0 +1,943 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.FunnelRenderer
* Plugin renderer to draw a funnel chart.
* x values, if present, will be used as labels.
* y values give area size.
*
* Funnel charts will draw a single series
* only.
*
* To use this renderer, you need to include the
* funnel renderer plugin, for example:
*
* > <script type="text/javascript" src="plugins/jqplot.funnelRenderer.js"></script>
*
* Properties described here are passed into the $.jqplot function
* as options on the series renderer. For example:
*
* > plot2 = $.jqplot('chart2', [s1, s2], {
* > seriesDefaults: {
* > renderer:$.jqplot.FunnelRenderer,
* > rendererOptions:{
* > sectionMargin: 12,
* > widthRatio: 0.3
* > }
* > }
* > });
*
* IMPORTANT
*
* *The funnel renderer will reorder data in descending order* so the largest value in
* the data set is first and displayed on top of the funnel. Data will then
* be displayed in descending order down the funnel. The area of each funnel
* section will correspond to the value of each data point relative to the sum
* of all values. That is section area is proportional to section value divided by
* sum of all section values.
*
* If your data is not in descending order when passed into the plot, *it will be
* reordered* when stored in the series.data property. A copy of the unordered
* data is kept in the series._unorderedData property.
*
* A funnel plot will trigger events on the plot target
* according to user interaction. All events return the event object,
* the series index, the point (section) index, and the point data for
* the appropriate section. *Note* the point index will referr to the ordered
* data, not the original unordered data.
*
* 'jqplotDataMouseOver' - triggered when mousing over a section.
* 'jqplotDataHighlight' - triggered the first time user mouses over a section,
* if highlighting is enabled.
* 'jqplotDataUnhighlight' - triggered when a user moves the mouse out of
* a highlighted section.
* 'jqplotDataClick' - triggered when the user clicks on a section.
* 'jqplotDataRightClick' - tiggered when the user right clicks on a section if
* the "captureRightClick" option is set to true on the plot.
*/
$.jqplot.FunnelRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.FunnelRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.FunnelRenderer.prototype.constructor = $.jqplot.FunnelRenderer;
// called with scope of a series
$.jqplot.FunnelRenderer.prototype.init = function(options, plot) {
// Group: Properties
//
// prop: padding
// padding between the funnel and plot edges, legend, etc.
this.padding = {top: 20, right: 20, bottom: 20, left: 20};
// prop: sectionMargin
// spacing between funnel sections in pixels.
this.sectionMargin = 6;
// prop: fill
// true or false, whether to fill the areas.
this.fill = true;
// prop: shadowOffset
// offset of the shadow from the area and offset of
// each succesive stroke of the shadow from the last.
this.shadowOffset = 2;
// prop: shadowAlpha
// transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07;
// prop: shadowDepth
// number of strokes to apply to the shadow,
// each stroke offset shadowOffset from the last.
this.shadowDepth = 5;
// prop: highlightMouseOver
// True to highlight area when moused over.
// This must be false to enable highlightMouseDown to highlight when clicking on a area.
this.highlightMouseOver = true;
// prop: highlightMouseDown
// True to highlight when a mouse button is pressed over a area.
// This will be disabled if highlightMouseOver is true.
this.highlightMouseDown = false;
// prop: highlightColors
// array of colors to use when highlighting an area.
this.highlightColors = [];
// prop: widthRatio
// The ratio of the width of the top of the funnel to the bottom.
// a ratio of 0 will make an upside down pyramid.
this.widthRatio = 0.2;
// prop: lineWidth
// width of line if areas are stroked and not filled.
this.lineWidth = 2;
// prop: dataLabels
// Either 'label', 'value', 'percent' or an array of labels to place on the pie slices.
// Defaults to percentage of each pie slice.
this.dataLabels = 'percent';
// prop: showDataLabels
// true to show data labels on slices.
this.showDataLabels = false;
// prop: dataLabelFormatString
// Format string for data labels. If none, '%s' is used for "label" and for arrays, '%d' for value and '%d%%' for percentage.
this.dataLabelFormatString = null;
// prop: dataLabelThreshold
// Threshhold in percentage (0 - 100) of pie area, below which no label will be displayed.
// This applies to all label types, not just to percentage labels.
this.dataLabelThreshold = 3;
this._type = 'funnel';
this.tickRenderer = $.jqplot.FunnelTickRenderer;
// if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver
if (options.highlightMouseDown && options.highlightMouseOver == null) {
options.highlightMouseOver = false;
}
$.extend(true, this, options);
// index of the currenty highlighted point, if any
this._highlightedPoint = null;
// lengths of bases, or horizontal sides of areas of trapezoid.
this._bases = [];
// total area
this._atot;
// areas of segments.
this._areas = [];
// vertical lengths of segments.
this._lengths = [];
// angle of the funnel to vertical.
this._angle;
this._dataIndices = [];
// sort data
this._unorderedData = $.extend(true, [], this.data);
var idxs = $.extend(true, [], this.data);
for (var i=0; i<idxs.length; i++) {
idxs[i].push(i);
}
this.data.sort( function (a, b) { return b[1] - a[1]; } );
idxs.sort( function (a, b) { return b[1] - a[1]; });
for (var i=0; i<idxs.length; i++) {
this._dataIndices.push(idxs[i][2]);
}
// set highlight colors if none provided
if (this.highlightColors.length == 0) {
for (var i=0; i<this.seriesColors.length; i++){
var rgba = $.jqplot.getColorComponents(this.seriesColors[i]);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var sum = newrgb[0] + newrgb[1] + newrgb[2];
for (var j=0; j<3; j++) {
// when darkening, lowest color component can be is 60.
newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.4 * (255 - newrgb[j]);
newrgb[j] = parseInt(newrgb[j], 10);
}
this.highlightColors.push('rgb('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+')');
}
}
plot.postParseOptionsHooks.addOnce(postParseOptions);
plot.postInitHooks.addOnce(postInit);
plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove);
plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown);
plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp);
plot.eventListenerHooks.addOnce('jqplotClick', handleClick);
plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick);
plot.postDrawHooks.addOnce(postPlotDraw);
};
// gridData will be of form [label, percentage of total]
$.jqplot.FunnelRenderer.prototype.setGridData = function(plot) {
// set gridData property. This will hold angle in radians of each data point.
var sum = 0;
var td = [];
for (var i=0; i<this.data.length; i++){
sum += this.data[i][1];
td.push([this.data[i][0], this.data[i][1]]);
}
// normalize y values, so areas are proportional.
for (var i=0; i<td.length; i++) {
td[i][1] = td[i][1]/sum;
}
this._bases = new Array(td.length + 1);
this._lengths = new Array(td.length);
this.gridData = td;
};
$.jqplot.FunnelRenderer.prototype.makeGridData = function(data, plot) {
// set gridData property. This will hold angle in radians of each data point.
var sum = 0;
var td = [];
for (var i=0; i<this.data.length; i++){
sum += this.data[i][1];
td.push([this.data[i][0], this.data[i][1]]);
}
// normalize y values, so areas are proportional.
for (var i=0; i<td.length; i++) {
td[i][1] = td[i][1]/sum;
}
this._bases = new Array(td.length + 1);
this._lengths = new Array(td.length);
return td;
};
$.jqplot.FunnelRenderer.prototype.drawSection = function (ctx, vertices, color, isShadow) {
var fill = this.fill;
var lineWidth = this.lineWidth;
ctx.save();
if (isShadow) {
for (var i=0; i<this.shadowDepth; i++) {
ctx.save();
ctx.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI), this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI));
doDraw();
}
}
else {
doDraw();
}
function doDraw () {
ctx.beginPath();
ctx.fillStyle = color;
ctx.strokeStyle = color;
ctx.lineWidth = lineWidth;
ctx.moveTo(vertices[0][0], vertices[0][1]);
for (var i=1; i<4; i++) {
ctx.lineTo(vertices[i][0], vertices[i][1]);
}
ctx.closePath();
if (fill) {
ctx.fill();
}
else {
ctx.stroke();
}
}
if (isShadow) {
for (var i=0; i<this.shadowDepth; i++) {
ctx.restore();
}
}
ctx.restore();
};
// called with scope of series
$.jqplot.FunnelRenderer.prototype.draw = function (ctx, gd, options, plot) {
var i;
var opts = (options != undefined) ? options : {};
// offset and direction of offset due to legend placement
var offx = 0;
var offy = 0;
var trans = 1;
this._areas = [];
// var colorGenerator = new this.colorGenerator(this.seriesColors);
if (options.legendInfo && options.legendInfo.placement == 'insideGrid') {
var li = options.legendInfo;
switch (li.location) {
case 'nw':
offx = li.width + li.xoffset;
break;
case 'w':
offx = li.width + li.xoffset;
break;
case 'sw':
offx = li.width + li.xoffset;
break;
case 'ne':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'e':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'se':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'n':
offy = li.height + li.yoffset;
break;
case 's':
offy = li.height + li.yoffset;
trans = -1;
break;
default:
break;
}
}
var loff = (trans==1) ? this.padding.left + offx : this.padding.left;
var toff = (trans==1) ? this.padding.top + offy : this.padding.top;
var roff = (trans==-1) ? this.padding.right + offx : this.padding.right;
var boff = (trans==-1) ? this.padding.bottom + offy : this.padding.bottom;
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine;
var fill = (opts.fill != undefined) ? opts.fill : this.fill;
var cw = ctx.canvas.width;
var ch = ctx.canvas.height;
this._bases[0] = cw - loff - roff;
var ltot = this._length = ch - toff - boff;
var hend = this._bases[0]*this.widthRatio;
this._atot = ltot/2 * (this._bases[0] + this._bases[0]*this.widthRatio);
this._angle = Math.atan((this._bases[0] - hend)/2/ltot);
for (i=0; i<gd.length; i++) {
this._areas.push(gd[i][1] * this._atot);
}
var guess, err, count, lsum=0;
var tolerance = 0.0001;
for (i=0; i<this._areas.length; i++) {
guess = this._areas[i]/this._bases[i];
err = 999999;
this._lengths[i] = guess;
count = 0;
while (err > this._lengths[i]*tolerance && count < 100) {
this._lengths[i] = this._areas[i]/(this._bases[i] - this._lengths[i] * Math.tan(this._angle));
err = Math.abs(this._lengths[i] - guess);
this._bases[i+1] = this._bases[i] - (2*this._lengths[i]*Math.tan(this._angle));
guess = this._lengths[i];
count++;
}
lsum += this._lengths[i];
}
// figure out vertices of each section
this._vertices = new Array(gd.length);
// these are 4 coners of entire trapezoid
var p0 = [loff, toff],
p1 = [loff+this._bases[0], toff],
p2 = [loff + (this._bases[0] - this._bases[this._bases.length-1])/2, toff + this._length],
p3 = [p2[0] + this._bases[this._bases.length-1], p2[1]];
// equations of right and left sides, returns x, y values given height of section (y value)
function findleft (l) {
var m = (p0[1] - p2[1])/(p0[0] - p2[0]);
var b = p0[1] - m*p0[0];
var y = l + p0[1];
return [(y - b)/m, y];
}
function findright (l) {
var m = (p1[1] - p3[1])/(p1[0] - p3[0]);
var b = p1[1] - m*p1[0];
var y = l + p1[1];
return [(y - b)/m, y];
}
var x = offx, y = offy;
var h=0, adj=0;
for (i=0; i<gd.length; i++) {
this._vertices[i] = new Array();
var v = this._vertices[i];
var sm = this.sectionMargin;
if (i == 0) {
adj = 0;
}
if (i == 1) {
adj = sm/3;
}
else if (i > 0 && i < gd.length-1) {
adj = sm/2;
}
else if (i == gd.length -1) {
adj = 2*sm/3;
}
v.push(findleft(h+adj));
v.push(findright(h+adj));
h += this._lengths[i];
if (i == 0) {
adj = -2*sm/3;
}
else if (i > 0 && i < gd.length-1) {
adj = -sm/2;
}
else if (i == gd.length - 1) {
adj = 0;
}
v.push(findright(h+adj));
v.push(findleft(h+adj));
}
if (this.shadow) {
var shadowColor = 'rgba(0,0,0,'+this.shadowAlpha+')';
for (var i=0; i<gd.length; i++) {
this.renderer.drawSection.call (this, ctx, this._vertices[i], shadowColor, true);
}
}
for (var i=0; i<gd.length; i++) {
var v = this._vertices[i];
this.renderer.drawSection.call (this, ctx, v, this.seriesColors[i]);
if (this.showDataLabels && gd[i][1]*100 >= this.dataLabelThreshold) {
var fstr, label;
if (this.dataLabels == 'label') {
fstr = this.dataLabelFormatString || '%s';
label = $.jqplot.sprintf(fstr, gd[i][0]);
}
else if (this.dataLabels == 'value') {
fstr = this.dataLabelFormatString || '%d';
label = $.jqplot.sprintf(fstr, this.data[i][1]);
}
else if (this.dataLabels == 'percent') {
fstr = this.dataLabelFormatString || '%d%%';
label = $.jqplot.sprintf(fstr, gd[i][1]*100);
}
else if (this.dataLabels.constructor == Array) {
fstr = this.dataLabelFormatString || '%s';
label = $.jqplot.sprintf(fstr, this.dataLabels[this._dataIndices[i]]);
}
var fact = (this._radius ) * this.dataLabelPositionFactor + this.sliceMargin + this.dataLabelNudge;
var x = (v[0][0] + v[1][0])/2 + this.canvas._offsets.left;
var y = (v[1][1] + v[2][1])/2 + this.canvas._offsets.top;
var labelelem = $('<span class="jqplot-funnel-series jqplot-data-label" style="position:absolute;">' + label + '</span>').insertBefore(plot.eventCanvas._elem);
x -= labelelem.width()/2;
y -= labelelem.height()/2;
x = Math.round(x);
y = Math.round(y);
labelelem.css({left: x, top: y});
}
}
};
$.jqplot.FunnelAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
};
$.jqplot.FunnelAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.FunnelAxisRenderer.prototype.constructor = $.jqplot.FunnelAxisRenderer;
// There are no traditional axes on a funnel chart. We just need to provide
// dummy objects with properties so the plot will render.
// called with scope of axis object.
$.jqplot.FunnelAxisRenderer.prototype.init = function(options){
//
this.tickRenderer = $.jqplot.FunnelTickRenderer;
$.extend(true, this, options);
// I don't think I'm going to need _dataBounds here.
// have to go Axis scaling in a way to fit chart onto plot area
// and provide u2p and p2u functionality for mouse cursor, etc.
// for convienence set _dataBounds to 0 and 100 and
// set min/max to 0 and 100.
this._dataBounds = {min:0, max:100};
this.min = 0;
this.max = 100;
this.showTicks = false;
this.ticks = [];
this.showMark = false;
this.show = false;
};
/**
* Class: $.jqplot.FunnelLegendRenderer
* Legend Renderer specific to funnel plots. Set by default
* when the user creates a funnel plot.
*/
$.jqplot.FunnelLegendRenderer = function(){
$.jqplot.TableLegendRenderer.call(this);
};
$.jqplot.FunnelLegendRenderer.prototype = new $.jqplot.TableLegendRenderer();
$.jqplot.FunnelLegendRenderer.prototype.constructor = $.jqplot.FunnelLegendRenderer;
$.jqplot.FunnelLegendRenderer.prototype.init = function(options) {
// Group: Properties
//
// prop: numberRows
// Maximum number of rows in the legend. 0 or null for unlimited.
this.numberRows = null;
// prop: numberColumns
// Maximum number of columns in the legend. 0 or null for unlimited.
this.numberColumns = null;
$.extend(true, this, options);
};
// called with context of legend
$.jqplot.FunnelLegendRenderer.prototype.draw = function() {
var legend = this;
if (this.show) {
var series = this._series;
var ss = 'position:absolute;';
ss += (this.background) ? 'background:'+this.background+';' : '';
ss += (this.border) ? 'border:'+this.border+';' : '';
ss += (this.fontSize) ? 'font-size:'+this.fontSize+';' : '';
ss += (this.fontFamily) ? 'font-family:'+this.fontFamily+';' : '';
ss += (this.textColor) ? 'color:'+this.textColor+';' : '';
ss += (this.marginTop != null) ? 'margin-top:'+this.marginTop+';' : '';
ss += (this.marginBottom != null) ? 'margin-bottom:'+this.marginBottom+';' : '';
ss += (this.marginLeft != null) ? 'margin-left:'+this.marginLeft+';' : '';
ss += (this.marginRight != null) ? 'margin-right:'+this.marginRight+';' : '';
this._elem = $('<table class="jqplot-table-legend" style="'+ss+'"></table>');
// Funnel charts legends don't go by number of series, but by number of data points
// in the series. Refactor things here for that.
var pad = false,
reverse = false,
nr, nc;
var s = series[0];
var colorGenerator = new $.jqplot.ColorGenerator(s.seriesColors);
if (s.show) {
var pd = s.data;
if (this.numberRows) {
nr = this.numberRows;
if (!this.numberColumns){
nc = Math.ceil(pd.length/nr);
}
else{
nc = this.numberColumns;
}
}
else if (this.numberColumns) {
nc = this.numberColumns;
nr = Math.ceil(pd.length/this.numberColumns);
}
else {
nr = pd.length;
nc = 1;
}
var i, j, tr, td1, td2, lt, rs, color;
var idx = 0;
for (i=0; i<nr; i++) {
if (reverse){
tr = $('<tr class="jqplot-table-legend"></tr>').prependTo(this._elem);
}
else{
tr = $('<tr class="jqplot-table-legend"></tr>').appendTo(this._elem);
}
for (j=0; j<nc; j++) {
if (idx < pd.length){
lt = this.labels[idx] || pd[idx][0].toString();
color = colorGenerator.next();
if (!reverse){
if (i>0){
pad = true;
}
else{
pad = false;
}
}
else{
if (i == nr -1){
pad = false;
}
else{
pad = true;
}
}
rs = (pad) ? this.rowSpacing : '0';
td1 = $('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+rs+';">'+
'<div><div class="jqplot-table-legend-swatch" style="border-color:'+color+';"></div>'+
'</div></td>');
td2 = $('<td class="jqplot-table-legend" style="padding-top:'+rs+';"></td>');
if (this.escapeHtml){
td2.text(lt);
}
else {
td2.html(lt);
}
if (reverse) {
td2.prependTo(tr);
td1.prependTo(tr);
}
else {
td1.appendTo(tr);
td2.appendTo(tr);
}
pad = true;
}
idx++;
}
}
}
}
return this._elem;
};
// $.jqplot.FunnelLegendRenderer.prototype.pack = function(offsets) {
// if (this.show) {
// // fake a grid for positioning
// var grid = {_top:offsets.top, _left:offsets.left, _right:offsets.right, _bottom:this._plotDimensions.height - offsets.bottom};
// if (this.placement == 'insideGrid') {
// switch (this.location) {
// case 'nw':
// var a = grid._left + this.xoffset;
// var b = grid._top + this.yoffset;
// this._elem.css('left', a);
// this._elem.css('top', b);
// break;
// case 'n':
// var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
// var b = grid._top + this.yoffset;
// this._elem.css('left', a);
// this._elem.css('top', b);
// break;
// case 'ne':
// var a = offsets.right + this.xoffset;
// var b = grid._top + this.yoffset;
// this._elem.css({right:a, top:b});
// break;
// case 'e':
// var a = offsets.right + this.xoffset;
// var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
// this._elem.css({right:a, top:b});
// break;
// case 'se':
// var a = offsets.right + this.xoffset;
// var b = offsets.bottom + this.yoffset;
// this._elem.css({right:a, bottom:b});
// break;
// case 's':
// var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
// var b = offsets.bottom + this.yoffset;
// this._elem.css({left:a, bottom:b});
// break;
// case 'sw':
// var a = grid._left + this.xoffset;
// var b = offsets.bottom + this.yoffset;
// this._elem.css({left:a, bottom:b});
// break;
// case 'w':
// var a = grid._left + this.xoffset;
// var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
// this._elem.css({left:a, top:b});
// break;
// default: // same as 'se'
// var a = grid._right - this.xoffset;
// var b = grid._bottom + this.yoffset;
// this._elem.css({right:a, bottom:b});
// break;
// }
//
// }
// else {
// switch (this.location) {
// case 'nw':
// var a = this._plotDimensions.width - grid._left + this.xoffset;
// var b = grid._top + this.yoffset;
// this._elem.css('right', a);
// this._elem.css('top', b);
// break;
// case 'n':
// var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
// var b = this._plotDimensions.height - grid._top + this.yoffset;
// this._elem.css('left', a);
// this._elem.css('bottom', b);
// break;
// case 'ne':
// var a = this._plotDimensions.width - offsets.right + this.xoffset;
// var b = grid._top + this.yoffset;
// this._elem.css({left:a, top:b});
// break;
// case 'e':
// var a = this._plotDimensions.width - offsets.right + this.xoffset;
// var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
// this._elem.css({left:a, top:b});
// break;
// case 'se':
// var a = this._plotDimensions.width - offsets.right + this.xoffset;
// var b = offsets.bottom + this.yoffset;
// this._elem.css({left:a, bottom:b});
// break;
// case 's':
// var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
// var b = this._plotDimensions.height - offsets.bottom + this.yoffset;
// this._elem.css({left:a, top:b});
// break;
// case 'sw':
// var a = this._plotDimensions.width - grid._left + this.xoffset;
// var b = offsets.bottom + this.yoffset;
// this._elem.css({right:a, bottom:b});
// break;
// case 'w':
// var a = this._plotDimensions.width - grid._left + this.xoffset;
// var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
// this._elem.css({right:a, top:b});
// break;
// default: // same as 'se'
// var a = grid._right - this.xoffset;
// var b = grid._bottom + this.yoffset;
// this._elem.css({right:a, bottom:b});
// break;
// }
// }
// }
// };
// setup default renderers for axes and legend so user doesn't have to
// called with scope of plot
function preInit(target, data, options) {
options = options || {};
options.axesDefaults = options.axesDefaults || {};
options.legend = options.legend || {};
options.seriesDefaults = options.seriesDefaults || {};
// only set these if there is a funnel series
var setopts = false;
if (options.seriesDefaults.renderer == $.jqplot.FunnelRenderer) {
setopts = true;
}
else if (options.series) {
for (var i=0; i < options.series.length; i++) {
if (options.series[i].renderer == $.jqplot.FunnelRenderer) {
setopts = true;
}
}
}
if (setopts) {
options.axesDefaults.renderer = $.jqplot.FunnelAxisRenderer;
options.legend.renderer = $.jqplot.FunnelLegendRenderer;
options.legend.preDraw = true;
options.sortData = false;
options.seriesDefaults.pointLabels = {show: false};
}
}
function postInit(target, data, options) {
// if multiple series, add a reference to the previous one so that
// funnel rings can nest.
for (var i=0; i<this.series.length; i++) {
if (this.series[i].renderer.constructor == $.jqplot.FunnelRenderer) {
// don't allow mouseover and mousedown at same time.
if (this.series[i].highlightMouseOver) {
this.series[i].highlightMouseDown = false;
}
}
}
}
// called with scope of plot
function postParseOptions(options) {
for (var i=0; i<this.series.length; i++) {
this.series[i].seriesColors = this.seriesColors;
this.series[i].colorGenerator = $.jqplot.colorGenerator;
}
}
function highlight (plot, sidx, pidx) {
var s = plot.series[sidx];
var canvas = plot.plugins.funnelRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0,canvas._ctx.canvas.width, canvas._ctx.canvas.height);
s._highlightedPoint = pidx;
plot.plugins.funnelRenderer.highlightedSeriesIndex = sidx;
s.renderer.drawSection.call(s, canvas._ctx, s._vertices[pidx], s.highlightColors[pidx], false);
}
function unhighlight (plot) {
var canvas = plot.plugins.funnelRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height);
for (var i=0; i<plot.series.length; i++) {
plot.series[i]._highlightedPoint = null;
}
plot.plugins.funnelRenderer.highlightedSeriesIndex = null;
plot.target.trigger('jqplotDataUnhighlight');
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt1 = jQuery.Event('jqplotDataMouseOver');
evt1.pageX = ev.pageX;
evt1.pageY = ev.pageY;
plot.target.trigger(evt1, ins);
if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.funnelRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseDown(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.funnelRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseUp(ev, gridpos, datapos, neighbor, plot) {
var idx = plot.plugins.funnelRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
}
function handleClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt = jQuery.Event('jqplotDataClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
function handleRightClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var idx = plot.plugins.funnelRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
var evt = jQuery.Event('jqplotDataRightClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
function postPlotDraw() {
// Memory Leaks patch
if (this.plugins.funnelRenderer && this.plugins.funnelRenderer.highlightCanvas) {
this.plugins.funnelRenderer.highlightCanvas.resetCanvas();
this.plugins.funnelRenderer.highlightCanvas = null;
}
this.plugins.funnelRenderer = {};
this.plugins.funnelRenderer.highlightCanvas = new $.jqplot.GenericCanvas();
// do we have any data labels? if so, put highlight canvas before those
var labels = $(this.targetId+' .jqplot-data-label');
if (labels.length) {
$(labels[0]).before(this.plugins.funnelRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-funnelRenderer-highlight-canvas', this._plotDimensions, this));
}
// else put highlight canvas before event canvas.
else {
this.eventCanvas._elem.before(this.plugins.funnelRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-funnelRenderer-highlight-canvas', this._plotDimensions, this));
}
var hctx = this.plugins.funnelRenderer.highlightCanvas.setContext();
this.eventCanvas._elem.bind('mouseleave', {plot:this}, function (ev) { unhighlight(ev.data.plot); });
}
$.jqplot.preInitHooks.push(preInit);
$.jqplot.FunnelTickRenderer = function() {
$.jqplot.AxisTickRenderer.call(this);
};
$.jqplot.FunnelTickRenderer.prototype = new $.jqplot.AxisTickRenderer();
$.jqplot.FunnelTickRenderer.prototype.constructor = $.jqplot.FunnelTickRenderer;
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,465 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
$.jqplot.eventListenerHooks.push(['jqplotMouseMove', handleMove]);
/**
* Class: $.jqplot.Highlighter
* Plugin which will highlight data points when they are moused over.
*
* To use this plugin, include the js
* file in your source:
*
* > <script type="text/javascript" src="plugins/jqplot.highlighter.js"></script>
*
* A tooltip providing information about the data point is enabled by default.
* To disable the tooltip, set "showTooltip" to false.
*
* You can control what data is displayed in the tooltip with various
* options. The "tooltipAxes" option controls whether the x, y or both
* data values are displayed.
*
* Some chart types (e.g. hi-low-close) have more than one y value per
* data point. To display the additional values in the tooltip, set the
* "yvalues" option to the desired number of y values present (3 for a hlc chart).
*
* By default, data values will be formatted with the same formatting
* specifiers as used to format the axis ticks. A custom format code
* can be supplied with the tooltipFormatString option. This will apply
* to all values in the tooltip.
*
* For more complete control, the "formatString" option can be set. This
* Allows conplete control over tooltip formatting. Values are passed to
* the format string in an order determined by the "tooltipAxes" and "yvalues"
* options. So, if you have a hi-low-close chart and you just want to display
* the hi-low-close values in the tooltip, you could set a formatString like:
*
* > highlighter: {
* > tooltipAxes: 'y',
* > yvalues: 3,
* > formatString:'<table class="jqplot-highlighter">
* > <tr><td>hi:</td><td>%s</td></tr>
* > <tr><td>low:</td><td>%s</td></tr>
* > <tr><td>close:</td><td>%s</td></tr></table>'
* > }
*
*/
$.jqplot.Highlighter = function(options) {
// Group: Properties
//
//prop: show
// true to show the highlight.
this.show = $.jqplot.config.enablePlugins;
// prop: markerRenderer
// Renderer used to draw the marker of the highlighted point.
// Renderer will assimilate attributes from the data point being highlighted,
// so no attributes need set on the renderer directly.
// Default is to turn off shadow drawing on the highlighted point.
this.markerRenderer = new $.jqplot.MarkerRenderer({shadow:false});
// prop: showMarker
// true to show the marker
this.showMarker = true;
// prop: lineWidthAdjust
// Pixels to add to the lineWidth of the highlight.
this.lineWidthAdjust = 2.5;
// prop: sizeAdjust
// Pixels to add to the overall size of the highlight.
this.sizeAdjust = 5;
// prop: showTooltip
// Show a tooltip with data point values.
this.showTooltip = true;
// prop: tooltipLocation
// Where to position tooltip, 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw'
this.tooltipLocation = 'nw';
// prop: fadeTooltip
// true = fade in/out tooltip, flase = show/hide tooltip
this.fadeTooltip = true;
// prop: tooltipFadeSpeed
// 'slow', 'def', 'fast', or number of milliseconds.
this.tooltipFadeSpeed = "fast";
// prop: tooltipOffset
// Pixel offset of tooltip from the highlight.
this.tooltipOffset = 2;
// prop: tooltipAxes
// Which axes to display in tooltip, 'x', 'y' or 'both', 'xy' or 'yx'
// 'both' and 'xy' are equivalent, 'yx' reverses order of labels.
this.tooltipAxes = 'both';
// prop; tooltipSeparator
// String to use to separate x and y axes in tooltip.
this.tooltipSeparator = ', ';
// prop; tooltipContentEditor
// Function used to edit/augment/replace the formatted tooltip contents.
// Called as str = tooltipContentEditor(str, seriesIndex, pointIndex)
// where str is the generated tooltip html and seriesIndex and pointIndex identify
// the data point being highlighted. Should return the html for the tooltip contents.
this.tooltipContentEditor = null;
// prop: useAxesFormatters
// Use the x and y axes formatters to format the text in the tooltip.
this.useAxesFormatters = true;
// prop: tooltipFormatString
// sprintf format string for the tooltip.
// Uses Ash Searle's javascript sprintf implementation
// found here: http://hexmen.com/blog/2007/03/printf-sprintf/
// See http://perldoc.perl.org/functions/sprintf.html for reference.
// Additional "p" and "P" format specifiers added by Chris Leonello.
this.tooltipFormatString = '%.5P';
// prop: formatString
// alternative to tooltipFormatString
// will format the whole tooltip text, populating with x, y values as
// indicated by tooltipAxes option. So, you could have a tooltip like:
// 'Date: %s, number of cats: %d' to format the whole tooltip at one go.
// If useAxesFormatters is true, values will be formatted according to
// Axes formatters and you can populate your tooltip string with
// %s placeholders.
this.formatString = null;
// prop: yvalues
// Number of y values to expect in the data point array.
// Typically this is 1. Certain plots, like OHLC, will
// have more y values in each data point array.
this.yvalues = 1;
// prop: bringSeriesToFront
// This option requires jQuery 1.4+
// True to bring the series of the highlighted point to the front
// of other series.
this.bringSeriesToFront = false;
this._tooltipElem;
this.isHighlighting = false;
this.currentNeighbor = null;
$.extend(true, this, options);
};
var locations = ['nw', 'n', 'ne', 'e', 'se', 's', 'sw', 'w'];
var locationIndicies = {'nw':0, 'n':1, 'ne':2, 'e':3, 'se':4, 's':5, 'sw':6, 'w':7};
var oppositeLocations = ['se', 's', 'sw', 'w', 'nw', 'n', 'ne', 'e'];
// axis.renderer.tickrenderer.formatter
// called with scope of plot
$.jqplot.Highlighter.init = function (target, data, opts){
var options = opts || {};
// add a highlighter attribute to the plot
this.plugins.highlighter = new $.jqplot.Highlighter(options.highlighter);
};
// called within scope of series
$.jqplot.Highlighter.parseOptions = function (defaults, options) {
// Add a showHighlight option to the series
// and set it to true by default.
this.showHighlight = true;
};
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
$.jqplot.Highlighter.postPlotDraw = function() {
// Memory Leaks patch
if (this.plugins.highlighter && this.plugins.highlighter.highlightCanvas) {
this.plugins.highlighter.highlightCanvas.resetCanvas();
this.plugins.highlighter.highlightCanvas = null;
}
if (this.plugins.highlighter && this.plugins.highlighter._tooltipElem) {
this.plugins.highlighter._tooltipElem.emptyForce();
this.plugins.highlighter._tooltipElem = null;
}
this.plugins.highlighter.highlightCanvas = new $.jqplot.GenericCanvas();
this.eventCanvas._elem.before(this.plugins.highlighter.highlightCanvas.createElement(this._gridPadding, 'jqplot-highlight-canvas', this._plotDimensions, this));
this.plugins.highlighter.highlightCanvas.setContext();
var elem = document.createElement('div');
this.plugins.highlighter._tooltipElem = $(elem);
elem = null;
this.plugins.highlighter._tooltipElem.addClass('jqplot-highlighter-tooltip');
this.plugins.highlighter._tooltipElem.css({position:'absolute', display:'none'});
this.eventCanvas._elem.before(this.plugins.highlighter._tooltipElem);
};
$.jqplot.preInitHooks.push($.jqplot.Highlighter.init);
$.jqplot.preParseSeriesOptionsHooks.push($.jqplot.Highlighter.parseOptions);
$.jqplot.postDrawHooks.push($.jqplot.Highlighter.postPlotDraw);
function draw(plot, neighbor) {
var hl = plot.plugins.highlighter;
var s = plot.series[neighbor.seriesIndex];
var smr = s.markerRenderer;
var mr = hl.markerRenderer;
mr.style = smr.style;
mr.lineWidth = smr.lineWidth + hl.lineWidthAdjust;
mr.size = smr.size + hl.sizeAdjust;
var rgba = $.jqplot.getColorComponents(smr.color);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var alpha = (rgba[3] >= 0.6) ? rgba[3]*0.6 : rgba[3]*(2-rgba[3]);
mr.color = 'rgba('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+','+alpha+')';
mr.init();
mr.draw(s.gridData[neighbor.pointIndex][0], s.gridData[neighbor.pointIndex][1], hl.highlightCanvas._ctx);
}
function showTooltip(plot, series, neighbor) {
// neighbor looks like: {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}
// gridData should be x,y pixel coords on the grid.
// add the plot._gridPadding to that to get x,y in the target.
var hl = plot.plugins.highlighter;
var elem = hl._tooltipElem;
var serieshl = series.highlighter || {};
var opts = $.extend(true, {}, hl, serieshl);
if (opts.useAxesFormatters) {
var xf = series._xaxis._ticks[0].formatter;
var yf = series._yaxis._ticks[0].formatter;
var xfstr = series._xaxis._ticks[0].formatString;
var yfstr = series._yaxis._ticks[0].formatString;
var str;
var xstr = xf(xfstr, neighbor.data[0]);
var ystrs = [];
for (var i=1; i<opts.yvalues+1; i++) {
ystrs.push(yf(yfstr, neighbor.data[i]));
}
if (typeof opts.formatString === 'string') {
switch (opts.tooltipAxes) {
case 'both':
case 'xy':
ystrs.unshift(xstr);
ystrs.unshift(opts.formatString);
str = $.jqplot.sprintf.apply($.jqplot.sprintf, ystrs);
break;
case 'yx':
ystrs.push(xstr);
ystrs.unshift(opts.formatString);
str = $.jqplot.sprintf.apply($.jqplot.sprintf, ystrs);
break;
case 'x':
str = $.jqplot.sprintf.apply($.jqplot.sprintf, [opts.formatString, xstr]);
break;
case 'y':
ystrs.unshift(opts.formatString);
str = $.jqplot.sprintf.apply($.jqplot.sprintf, ystrs);
break;
default: // same as xy
ystrs.unshift(xstr);
ystrs.unshift(opts.formatString);
str = $.jqplot.sprintf.apply($.jqplot.sprintf, ystrs);
break;
}
}
else {
switch (opts.tooltipAxes) {
case 'both':
case 'xy':
str = xstr;
for (var i=0; i<ystrs.length; i++) {
str += opts.tooltipSeparator + ystrs[i];
}
break;
case 'yx':
str = '';
for (var i=0; i<ystrs.length; i++) {
str += ystrs[i] + opts.tooltipSeparator;
}
str += xstr;
break;
case 'x':
str = xstr;
break;
case 'y':
str = ystrs.join(opts.tooltipSeparator);
break;
default: // same as 'xy'
str = xstr;
for (var i=0; i<ystrs.length; i++) {
str += opts.tooltipSeparator + ystrs[i];
}
break;
}
}
}
else {
var str;
if (typeof opts.formatString === 'string') {
str = $.jqplot.sprintf.apply($.jqplot.sprintf, [opts.formatString].concat(neighbor.data));
}
else {
if (opts.tooltipAxes == 'both' || opts.tooltipAxes == 'xy') {
str = $.jqplot.sprintf(opts.tooltipFormatString, neighbor.data[0]) + opts.tooltipSeparator + $.jqplot.sprintf(opts.tooltipFormatString, neighbor.data[1]);
}
else if (opts.tooltipAxes == 'yx') {
str = $.jqplot.sprintf(opts.tooltipFormatString, neighbor.data[1]) + opts.tooltipSeparator + $.jqplot.sprintf(opts.tooltipFormatString, neighbor.data[0]);
}
else if (opts.tooltipAxes == 'x') {
str = $.jqplot.sprintf(opts.tooltipFormatString, neighbor.data[0]);
}
else if (opts.tooltipAxes == 'y') {
str = $.jqplot.sprintf(opts.tooltipFormatString, neighbor.data[1]);
}
}
}
if ($.isFunction(opts.tooltipContentEditor)) {
// args str, seriesIndex, pointIndex are essential so the hook can look up
// extra data for the point.
str = opts.tooltipContentEditor(str, neighbor.seriesIndex, neighbor.pointIndex, plot);
}
elem.html(str);
var gridpos = {x:neighbor.gridData[0], y:neighbor.gridData[1]};
var ms = 0;
var fact = 0.707;
if (series.markerRenderer.show == true) {
ms = (series.markerRenderer.size + opts.sizeAdjust)/2;
}
var loc = locations;
if (series.fillToZero && series.fill && neighbor.data[1] < 0) {
loc = oppositeLocations;
}
switch (loc[locationIndicies[opts.tooltipLocation]]) {
case 'nw':
var x = gridpos.x + plot._gridPadding.left - elem.outerWidth(true) - opts.tooltipOffset - fact * ms;
var y = gridpos.y + plot._gridPadding.top - opts.tooltipOffset - elem.outerHeight(true) - fact * ms;
break;
case 'n':
var x = gridpos.x + plot._gridPadding.left - elem.outerWidth(true)/2;
var y = gridpos.y + plot._gridPadding.top - opts.tooltipOffset - elem.outerHeight(true) - ms;
break;
case 'ne':
var x = gridpos.x + plot._gridPadding.left + opts.tooltipOffset + fact * ms;
var y = gridpos.y + plot._gridPadding.top - opts.tooltipOffset - elem.outerHeight(true) - fact * ms;
break;
case 'e':
var x = gridpos.x + plot._gridPadding.left + opts.tooltipOffset + ms;
var y = gridpos.y + plot._gridPadding.top - elem.outerHeight(true)/2;
break;
case 'se':
var x = gridpos.x + plot._gridPadding.left + opts.tooltipOffset + fact * ms;
var y = gridpos.y + plot._gridPadding.top + opts.tooltipOffset + fact * ms;
break;
case 's':
var x = gridpos.x + plot._gridPadding.left - elem.outerWidth(true)/2;
var y = gridpos.y + plot._gridPadding.top + opts.tooltipOffset + ms;
break;
case 'sw':
var x = gridpos.x + plot._gridPadding.left - elem.outerWidth(true) - opts.tooltipOffset - fact * ms;
var y = gridpos.y + plot._gridPadding.top + opts.tooltipOffset + fact * ms;
break;
case 'w':
var x = gridpos.x + plot._gridPadding.left - elem.outerWidth(true) - opts.tooltipOffset - ms;
var y = gridpos.y + plot._gridPadding.top - elem.outerHeight(true)/2;
break;
default: // same as 'nw'
var x = gridpos.x + plot._gridPadding.left - elem.outerWidth(true) - opts.tooltipOffset - fact * ms;
var y = gridpos.y + plot._gridPadding.top - opts.tooltipOffset - elem.outerHeight(true) - fact * ms;
break;
}
elem.css('left', x);
elem.css('top', y);
if (opts.fadeTooltip) {
// Fix for stacked up animations. Thnanks Trevor!
elem.stop(true,true).fadeIn(opts.tooltipFadeSpeed);
}
else {
elem.show();
}
elem = null;
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
var hl = plot.plugins.highlighter;
var c = plot.plugins.cursor;
if (hl.show) {
if (neighbor == null && hl.isHighlighting) {
var evt = jQuery.Event('jqplotHighlighterUnhighlight');
plot.target.trigger(evt);
var ctx = hl.highlightCanvas._ctx;
ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height);
if (hl.fadeTooltip) {
hl._tooltipElem.fadeOut(hl.tooltipFadeSpeed);
}
else {
hl._tooltipElem.hide();
}
if (hl.bringSeriesToFront) {
plot.restorePreviousSeriesOrder();
}
hl.isHighlighting = false;
hl.currentNeighbor = null;
ctx = null;
}
else if (neighbor != null && plot.series[neighbor.seriesIndex].showHighlight && !hl.isHighlighting) {
var evt = jQuery.Event('jqplotHighlighterHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data, plot];
plot.target.trigger(evt, ins);
hl.isHighlighting = true;
hl.currentNeighbor = neighbor;
if (hl.showMarker) {
draw(plot, neighbor);
}
if (plot.series[neighbor.seriesIndex].show && hl.showTooltip && (!c || !c._zoom.started)) {
showTooltip(plot, plot.series[neighbor.seriesIndex], neighbor);
}
if (hl.bringSeriesToFront) {
plot.moveSeriesToFront(neighbor.seriesIndex);
}
}
// check to see if we're highlighting the wrong point.
else if (neighbor != null && hl.isHighlighting && hl.currentNeighbor != neighbor) {
// highlighting the wrong point.
// if new series allows highlighting, highlight new point.
if (plot.series[neighbor.seriesIndex].showHighlight) {
var ctx = hl.highlightCanvas._ctx;
ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height);
hl.isHighlighting = true;
hl.currentNeighbor = neighbor;
if (hl.showMarker) {
draw(plot, neighbor);
}
if (plot.series[neighbor.seriesIndex].show && hl.showTooltip && (!c || !c._zoom.started)) {
showTooltip(plot, plot.series[neighbor.seriesIndex], neighbor);
}
if (hl.bringSeriesToFront) {
plot.moveSeriesToFront(neighbor.seriesIndex);
}
}
}
}
}
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,475 @@
/*
2010-11-01 Chris Leonello
Slightly modified version of the original json2.js to put JSON
functions under the $.jqplot namespace.
licensing and orignal comments follow:
http://www.JSON.org/json2.js
2010-08-25
Public Domain.
NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.
See http://www.JSON.org/js.html
This code should be minified before deployment.
See http://javascript.crockford.com/jsmin.html
USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO
NOT CONTROL.
This file creates a global JSON object containing two methods: stringify
and parse.
$.jqplot.JSON.stringify(value, replacer, space)
value any JavaScript value, usually an object or array.
replacer an optional parameter that determines how object
values are stringified for objects. It can be a
function or an array of strings.
space an optional parameter that specifies the indentation
of nested structures. If it is omitted, the text will
be packed without extra whitespace. If it is a number,
it will specify the number of spaces to indent at each
level. If it is a string (such as '\t' or '&nbsp;'),
it contains the characters used to indent at each level.
This method produces a JSON text from a JavaScript value.
When an object value is found, if the object contains a toJSON
method, its toJSON method will be called and the result will be
stringified. A toJSON method does not serialize: it returns the
value represented by the name/value pair that should be serialized,
or undefined if nothing should be serialized. The toJSON method
will be passed the key associated with the value, and this will be
bound to the value
For example, this would serialize Dates as ISO strings.
Date.prototype.toJSON = function (key) {
function f(n) {
// Format integers to have at least two digits.
return n < 10 ? '0' + n : n;
}
return this.getUTCFullYear() + '-' +
f(this.getUTCMonth() + 1) + '-' +
f(this.getUTCDate()) + 'T' +
f(this.getUTCHours()) + ':' +
f(this.getUTCMinutes()) + ':' +
f(this.getUTCSeconds()) + 'Z';
};
You can provide an optional replacer method. It will be passed the
key and value of each member, with this bound to the containing
object. The value that is returned from your method will be
serialized. If your method returns undefined, then the member will
be excluded from the serialization.
If the replacer parameter is an array of strings, then it will be
used to select the members to be serialized. It filters the results
such that only members with keys listed in the replacer array are
stringified.
Values that do not have JSON representations, such as undefined or
functions, will not be serialized. Such values in objects will be
dropped; in arrays they will be replaced with null. You can use
a replacer function to replace those with JSON values.
$.jqplot.JSON.stringify(undefined) returns undefined.
The optional space parameter produces a stringification of the
value that is filled with line breaks and indentation to make it
easier to read.
If the space parameter is a non-empty string, then that string will
be used for indentation. If the space parameter is a number, then
the indentation will be that many spaces.
Example:
text = $.jqplot.JSON.stringify(['e', {pluribus: 'unum'}]);
// text is '["e",{"pluribus":"unum"}]'
text = $.jqplot.JSON.stringify(['e', {pluribus: 'unum'}], null, '\t');
// text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]'
text = $.jqplot.JSON.stringify([new Date()], function (key, value) {
return this[key] instanceof Date ?
'Date(' + this[key] + ')' : value;
});
// text is '["Date(---current time---)"]'
$.jqplot.JSON.parse(text, reviver)
This method parses a JSON text to produce an object or array.
It can throw a SyntaxError exception.
The optional reviver parameter is a function that can filter and
transform the results. It receives each of the keys and values,
and its return value is used instead of the original value.
If it returns what it received, then the structure is not modified.
If it returns undefined then the member is deleted.
Example:
// Parse the text. Values that look like ISO date strings will
// be converted to Date objects.
myData = $.jqplot.JSON.parse(text, function (key, value) {
var a;
if (typeof value === 'string') {
a =
/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value);
if (a) {
return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4],
+a[5], +a[6]));
}
}
return value;
});
myData = $.jqplot.JSON.parse('["Date(09/09/2001)"]', function (key, value) {
var d;
if (typeof value === 'string' &&
value.slice(0, 5) === 'Date(' &&
value.slice(-1) === ')') {
d = new Date(value.slice(5, -1));
if (d) {
return d;
}
}
return value;
});
This is a reference implementation. You are free to copy, modify, or
redistribute.
*/
(function($) {
$.jqplot.JSON = window.JSON;
if (!window.JSON) {
$.jqplot.JSON = {};
}
function f(n) {
// Format integers to have at least two digits.
return n < 10 ? '0' + n : n;
}
if (typeof Date.prototype.toJSON !== 'function') {
Date.prototype.toJSON = function (key) {
return isFinite(this.valueOf()) ?
this.getUTCFullYear() + '-' +
f(this.getUTCMonth() + 1) + '-' +
f(this.getUTCDate()) + 'T' +
f(this.getUTCHours()) + ':' +
f(this.getUTCMinutes()) + ':' +
f(this.getUTCSeconds()) + 'Z' : null;
};
String.prototype.toJSON =
Number.prototype.toJSON =
Boolean.prototype.toJSON = function (key) {
return this.valueOf();
};
}
var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
gap,
indent,
meta = { // table of character substitutions
'\b': '\\b',
'\t': '\\t',
'\n': '\\n',
'\f': '\\f',
'\r': '\\r',
'"' : '\\"',
'\\': '\\\\'
},
rep;
function quote(string) {
// If the string contains no control characters, no quote characters, and no
// backslash characters, then we can safely slap some quotes around it.
// Otherwise we must also replace the offending characters with safe escape
// sequences.
escapable.lastIndex = 0;
return escapable.test(string) ?
'"' + string.replace(escapable, function (a) {
var c = meta[a];
return typeof c === 'string' ? c :
'\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
}) + '"' :
'"' + string + '"';
}
function str(key, holder) {
// Produce a string from holder[key].
var i, // The loop counter.
k, // The member key.
v, // The member value.
length,
mind = gap,
partial,
value = holder[key];
// If the value has a toJSON method, call it to obtain a replacement value.
if (value && typeof value === 'object' &&
typeof value.toJSON === 'function') {
value = value.toJSON(key);
}
// If we were called with a replacer function, then call the replacer to
// obtain a replacement value.
if (typeof rep === 'function') {
value = rep.call(holder, key, value);
}
// What happens next depends on the value's type.
switch (typeof value) {
case 'string':
return quote(value);
case 'number':
// JSON numbers must be finite. Encode non-finite numbers as null.
return isFinite(value) ? String(value) : 'null';
case 'boolean':
case 'null':
// If the value is a boolean or null, convert it to a string. Note:
// typeof null does not produce 'null'. The case is included here in
// the remote chance that this gets fixed someday.
return String(value);
// If the type is 'object', we might be dealing with an object or an array or
// null.
case 'object':
// Due to a specification blunder in ECMAScript, typeof null is 'object',
// so watch out for that case.
if (!value) {
return 'null';
}
// Make an array to hold the partial results of stringifying this object value.
gap += indent;
partial = [];
// Is the value an array?
if (Object.prototype.toString.apply(value) === '[object Array]') {
// The value is an array. Stringify every element. Use null as a placeholder
// for non-JSON values.
length = value.length;
for (i = 0; i < length; i += 1) {
partial[i] = str(i, value) || 'null';
}
// Join all of the elements together, separated with commas, and wrap them in
// brackets.
v = partial.length === 0 ? '[]' :
gap ? '[\n' + gap +
partial.join(',\n' + gap) + '\n' +
mind + ']' :
'[' + partial.join(',') + ']';
gap = mind;
return v;
}
// If the replacer is an array, use it to select the members to be stringified.
if (rep && typeof rep === 'object') {
length = rep.length;
for (i = 0; i < length; i += 1) {
k = rep[i];
if (typeof k === 'string') {
v = str(k, value);
if (v) {
partial.push(quote(k) + (gap ? ': ' : ':') + v);
}
}
}
} else {
// Otherwise, iterate through all of the keys in the object.
for (k in value) {
if (Object.hasOwnProperty.call(value, k)) {
v = str(k, value);
if (v) {
partial.push(quote(k) + (gap ? ': ' : ':') + v);
}
}
}
}
// Join all of the member texts together, separated with commas,
// and wrap them in braces.
v = partial.length === 0 ? '{}' :
gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' +
mind + '}' : '{' + partial.join(',') + '}';
gap = mind;
return v;
}
}
// If the JSON object does not yet have a stringify method, give it one.
if (typeof $.jqplot.JSON.stringify !== 'function') {
$.jqplot.JSON.stringify = function (value, replacer, space) {
// The stringify method takes a value and an optional replacer, and an optional
// space parameter, and returns a JSON text. The replacer can be a function
// that can replace values, or an array of strings that will select the keys.
// A default replacer method can be provided. Use of the space parameter can
// produce text that is more easily readable.
var i;
gap = '';
indent = '';
// If the space parameter is a number, make an indent string containing that
// many spaces.
if (typeof space === 'number') {
for (i = 0; i < space; i += 1) {
indent += ' ';
}
// If the space parameter is a string, it will be used as the indent string.
} else if (typeof space === 'string') {
indent = space;
}
// If there is a replacer, it must be a function or an array.
// Otherwise, throw an error.
rep = replacer;
if (replacer && typeof replacer !== 'function' &&
(typeof replacer !== 'object' ||
typeof replacer.length !== 'number')) {
throw new Error('$.jqplot.JSON.stringify');
}
// Make a fake root object containing our value under the key of ''.
// Return the result of stringifying the value.
return str('', {'': value});
};
}
// If the JSON object does not yet have a parse method, give it one.
if (typeof $.jqplot.JSON.parse !== 'function') {
$.jqplot.JSON.parse = function (text, reviver) {
// The parse method takes a text and an optional reviver function, and returns
// a JavaScript value if the text is a valid JSON text.
var j;
function walk(holder, key) {
// The walk method is used to recursively walk the resulting structure so
// that modifications can be made.
var k, v, value = holder[key];
if (value && typeof value === 'object') {
for (k in value) {
if (Object.hasOwnProperty.call(value, k)) {
v = walk(value, k);
if (v !== undefined) {
value[k] = v;
} else {
delete value[k];
}
}
}
}
return reviver.call(holder, key, value);
}
// Parsing happens in four stages. In the first stage, we replace certain
// Unicode characters with escape sequences. JavaScript handles many characters
// incorrectly, either silently deleting them, or treating them as line endings.
text = String(text);
cx.lastIndex = 0;
if (cx.test(text)) {
text = text.replace(cx, function (a) {
return '\\u' +
('0000' + a.charCodeAt(0).toString(16)).slice(-4);
});
}
// In the second stage, we run the text against regular expressions that look
// for non-JSON patterns. We are especially concerned with '()' and 'new'
// because they can cause invocation, and '=' because it can cause mutation.
// But just to be safe, we want to reject all unexpected forms.
// We split the second stage into 4 regexp operations in order to work around
// crippling inefficiencies in IE's and Safari's regexp engines. First we
// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we
// replace all simple value tokens with ']' characters. Third, we delete all
// open brackets that follow a colon or comma or that begin the text. Finally,
// we look to see that the remaining characters are only whitespace or ']' or
// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval.
if (/^[\],:{}\s]*$/.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@').replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']').replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) {
// In the third stage we use the eval function to compile the text into a
// JavaScript structure. The '{' operator is subject to a syntactic ambiguity
// in JavaScript: it can begin a block or an object literal. We wrap the text
// in parens to eliminate the ambiguity.
j = eval('(' + text + ')');
// In the optional fourth stage, we recursively walk the new structure, passing
// each name/value pair to a reviver function for possible transformation.
return typeof reviver === 'function' ?
walk({'': j}, '') : j;
}
// If the text is not JSON parseable, then a SyntaxError is thrown.
throw new SyntaxError('$.jqplot.JSON.parse');
};
}
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function($){$.jqplot.JSON=window.JSON;if(!window.JSON){$.jqplot.JSON={}}function f(n){return n<10?"0"+n:n}if(typeof Date.prototype.toJSON!=="function"){Date.prototype.toJSON=function(key){return isFinite(this.valueOf())?this.getUTCFullYear()+"-"+f(this.getUTCMonth()+1)+"-"+f(this.getUTCDate())+"T"+f(this.getUTCHours())+":"+f(this.getUTCMinutes())+":"+f(this.getUTCSeconds())+"Z":null};String.prototype.toJSON=Number.prototype.toJSON=Boolean.prototype.toJSON=function(key){return this.valueOf()}}var cx=/[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,escapable=/[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,gap,indent,meta={"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},rep;function quote(string){escapable.lastIndex=0;return escapable.test(string)?'"'+string.replace(escapable,function(a){var c=meta[a];return typeof c==="string"?c:"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)})+'"':'"'+string+'"'}function str(key,holder){var i,k,v,length,mind=gap,partial,value=holder[key];if(value&&typeof value==="object"&&typeof value.toJSON==="function"){value=value.toJSON(key)}if(typeof rep==="function"){value=rep.call(holder,key,value)}switch(typeof value){case"string":return quote(value);case"number":return isFinite(value)?String(value):"null";case"boolean":case"null":return String(value);case"object":if(!value){return"null"}gap+=indent;partial=[];if(Object.prototype.toString.apply(value)==="[object Array]"){length=value.length;for(i=0;i<length;i+=1){partial[i]=str(i,value)||"null"}v=partial.length===0?"[]":gap?"[\n"+gap+partial.join(",\n"+gap)+"\n"+mind+"]":"["+partial.join(",")+"]";gap=mind;return v}if(rep&&typeof rep==="object"){length=rep.length;for(i=0;i<length;i+=1){k=rep[i];if(typeof k==="string"){v=str(k,value);if(v){partial.push(quote(k)+(gap?": ":":")+v)}}}}else{for(k in value){if(Object.hasOwnProperty.call(value,k)){v=str(k,value);if(v){partial.push(quote(k)+(gap?": ":":")+v)}}}}v=partial.length===0?"{}":gap?"{\n"+gap+partial.join(",\n"+gap)+"\n"+mind+"}":"{"+partial.join(",")+"}";gap=mind;return v}}if(typeof $.jqplot.JSON.stringify!=="function"){$.jqplot.JSON.stringify=function(value,replacer,space){var i;gap="";indent="";if(typeof space==="number"){for(i=0;i<space;i+=1){indent+=" "}}else{if(typeof space==="string"){indent=space}}rep=replacer;if(replacer&&typeof replacer!=="function"&&(typeof replacer!=="object"||typeof replacer.length!=="number")){throw new Error("$.jqplot.JSON.stringify")}return str("",{"":value})}}if(typeof $.jqplot.JSON.parse!=="function"){$.jqplot.JSON.parse=function(text,reviver){var j;function walk(holder,key){var k,v,value=holder[key];if(value&&typeof value==="object"){for(k in value){if(Object.hasOwnProperty.call(value,k)){v=walk(value,k);if(v!==undefined){value[k]=v}else{delete value[k]}}}}return reviver.call(holder,key,value)}text=String(text);cx.lastIndex=0;if(cx.test(text)){text=text.replace(cx,function(a){return"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)})}if(/^[\],:{}\s]*$/.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,""))){j=eval("("+text+")");return typeof reviver==="function"?walk({"":j},""):j}throw new SyntaxError("$.jqplot.JSON.parse")}}})(jQuery);

View File

@ -0,0 +1,534 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* class: $.jqplot.LogAxisRenderer
* A plugin for a jqPlot to render a logarithmic axis.
*
* To use this renderer, include the plugin in your source
* > <script type="text/javascript" language="javascript" src="plugins/jqplot.logAxisRenderer.js"></script>
*
* and supply the appropriate options to your plot
*
* > {axes:{xaxis:{renderer:$.jqplot.LogAxisRenderer}}}
**/
$.jqplot.LogAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
// prop: axisDefaults
// Default properties which will be applied directly to the series.
//
// Group: Properties
//
// Properties
//
// base - the logarithmic base, commonly 2, 10 or Math.E
// tickDistribution - Deprecated. "power" distribution of ticks
// always used. Option has no effect.
this.axisDefaults = {
base : 10,
tickDistribution :'power'
};
};
$.jqplot.LogAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.LogAxisRenderer.prototype.constructor = $.jqplot.LogAxisRenderer;
$.jqplot.LogAxisRenderer.prototype.init = function(options) {
// prop: drawBaseline
// True to draw the axis baseline.
this.drawBaseline = true;
// prop: minorTicks
// Number of ticks to add between "major" ticks.
// Major ticks are ticks supplied by user or auto computed.
// Minor ticks cannot be created by user.
this.minorTicks = 'auto';
this._scalefact = 1.0;
$.extend(true, this, options);
this._autoFormatString = '%d';
this._overrideFormatString = false;
for (var d in this.renderer.axisDefaults) {
if (this[d] == null) {
this[d] = this.renderer.axisDefaults[d];
}
}
this.resetDataBounds();
};
$.jqplot.LogAxisRenderer.prototype.createTicks = function(plot) {
// we're are operating on an axis here
var ticks = this._ticks;
var userTicks = this.ticks;
var name = this.name;
var db = this._dataBounds;
var dim = (this.name.charAt(0) === 'x') ? this._plotDimensions.width : this._plotDimensions.height;
var interval;
var min, max;
var pos1, pos2;
var tt, i;
var threshold = 30;
// For some reason scalefactor is screwing up ticks.
this._scalefact = (Math.max(dim, threshold+1) - threshold)/300;
// if we already have ticks, use them.
// ticks must be in order of increasing value.
if (userTicks.length) {
// ticks could be 1D or 2D array of [val, val, ,,,] or [[val, label], [val, label], ...] or mixed
for (i=0; i<userTicks.length; i++){
var ut = userTicks[i];
var t = new this.tickRenderer(this.tickOptions);
if (ut.constructor == Array) {
t.value = ut[0];
t.label = ut[1];
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(ut[0], this.name);
this._ticks.push(t);
}
else if ($.isPlainObject(ut)) {
$.extend(true, t, ut);
t.axis = this.name;
this._ticks.push(t);
}
else {
t.value = ut;
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(ut, this.name);
this._ticks.push(t);
}
}
this.numberTicks = userTicks.length;
this.min = this._ticks[0].value;
this.max = this._ticks[this.numberTicks-1].value;
}
// we don't have any ticks yet, let's make some!
else if (this.min == null && this.max == null) {
min = db.min * (2 - this.padMin);
max = db.max * this.padMax;
// if min and max are same, space them out a bit
if (min == max) {
var adj = 0.05;
min = min*(1-adj);
max = max*(1+adj);
}
// perform some checks
if (this.min != null && this.min <= 0) {
throw new Error("Log axis minimum must be greater than 0");
}
if (this.max != null && this.max <= 0) {
throw new Error("Log axis maximum must be greater than 0");
}
function findCeil (val) {
var order = Math.pow(10, Math.floor(Math.log(val)/Math.LN10));
return Math.ceil(val/order) * order;
}
function findFloor(val) {
var order = Math.pow(10, Math.floor(Math.log(val)/Math.LN10));
return Math.floor(val/order) * order;
}
// var range = max - min;
var rmin, rmax;
// for power distribution, open up range to get a nice power of axis.renderer.base.
// power distribution won't respect the user's min/max settings.
rmin = Math.pow(this.base, Math.floor(Math.log(min)/Math.log(this.base)));
rmax = Math.pow(this.base, Math.ceil(Math.log(max)/Math.log(this.base)));
// // if min and max are same, space them out a bit
// if (rmin === rmax) {
// var adj = 0.05;
// rmin = rmin*(1-adj);
// rmax = rmax*(1+adj);
// }
// Handle case where a data value was zero
if (rmin === 0) {
rmin = 1;
}
var order = Math.round(Math.log(rmin)/Math.LN10);
if (this.tickOptions == null || !this.tickOptions.formatString) {
this._overrideFormatString = true;
}
this.min = rmin;
this.max = rmax;
var range = this.max - this.min;
var minorTicks = (this.minorTicks === 'auto') ? 0 : this.minorTicks;
var numberTicks;
if (this.numberTicks == null){
if (dim > 140) {
numberTicks = Math.round(Math.log(this.max/this.min)/Math.log(this.base) + 1);
if (numberTicks < 2) {
numberTicks = 2;
}
if (minorTicks === 0) {
var temp = dim/(numberTicks - 1);
if (temp < 100) {
minorTicks = 0;
}
else if (temp < 190) {
minorTicks = 1;
}
else if (temp < 250) {
minorTicks = 3;
}
else if (temp < 600) {
minorTicks = 4;
}
else {
minorTicks = 9;
}
}
}
else {
numberTicks = 2;
if (minorTicks === 0) {
minorTicks = 1;
}
minorTicks = 0;
}
}
else {
numberTicks = this.numberTicks;
}
if (order >= 0 && minorTicks !== 3) {
this._autoFormatString = '%d';
}
// Adjust format string for case with 3 ticks where we'll have like 1, 2.5, 5, 7.5, 10
else if (order <= 0 && minorTicks === 3) {
var temp = -(order - 1);
this._autoFormatString = '%.'+ Math.abs(order-1) + 'f';
}
// Adjust format string for values less than 1.
else if (order < 0) {
var temp = -order;
this._autoFormatString = '%.'+ Math.abs(order) + 'f';
}
else {
this._autoFormatString = '%d';
}
var to, t, val, tt1, spread, interval;
for (var i=0; i<numberTicks; i++){
tt = Math.pow(this.base, i - numberTicks + 1) * this.max;
t = new this.tickRenderer(this.tickOptions);
if (this._overrideFormatString) {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(tt, this.name);
this._ticks.push(t);
if (minorTicks && i<numberTicks-1) {
tt1 = Math.pow(this.base, i - numberTicks + 2) * this.max;
spread = tt1 - tt;
interval = tt1 / (minorTicks+1);
for (var j=minorTicks-1; j>=0; j--) {
val = tt1-interval*(j+1);
t = new this.tickRenderer(this.tickOptions);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(val, this.name);
this._ticks.push(t);
}
}
}
}
// min and max are set as would be the case with zooming
else if (this.min != null && this.max != null) {
var opts = $.extend(true, {}, this.tickOptions, {name: this.name, value: null});
var nt, ti;
// don't have an interval yet, pick one that gives the most
// "round" ticks we can get.
if (this.numberTicks == null && this.tickInterval == null) {
// var threshold = 30;
var tdim = Math.max(dim, threshold+1);
var nttarget = Math.ceil((tdim-threshold)/35 + 1);
var ret = $.jqplot.LinearTickGenerator.bestConstrainedInterval(this.min, this.max, nttarget);
this._autoFormatString = ret[3];
nt = ret[2];
ti = ret[4];
for (var i=0; i<nt; i++) {
opts.value = this.min + i * ti;
t = new this.tickRenderer(opts);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
this._ticks.push(t);
}
}
// for loose zoom, number ticks and interval are also set.
else if (this.numberTicks != null && this.tickInterval != null) {
nt = this.numberTicks;
for (var i=0; i<nt; i++) {
opts.value = this.min + i * this.tickInterval;
t = new this.tickRenderer(opts);
if (this._overrideFormatString && this._autoFormatString != '') {
t.formatString = this._autoFormatString;
}
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
this._ticks.push(t);
}
}
}
};
$.jqplot.LogAxisRenderer.prototype.pack = function(pos, offsets) {
var lb = parseInt(this.base, 10);
var ticks = this._ticks;
var trans = function (v) { return Math.log(v)/Math.log(lb); };
var invtrans = function (v) { return Math.pow(Math.E, (Math.log(lb)*v)); };
var max = trans(this.max);
var min = trans(this.min);
var offmax = offsets.max;
var offmin = offsets.min;
var lshow = (this._label == null) ? false : this._label.show;
for (var p in pos) {
this._elem.css(p, pos[p]);
}
this._offsets = offsets;
// pixellength will be + for x axes and - for y axes becasue pixels always measured from top left.
var pixellength = offmax - offmin;
var unitlength = max - min;
// point to unit and unit to point conversions references to Plot DOM element top left corner.
this.p2u = function(p){
return invtrans((p - offmin) * unitlength / pixellength + min);
};
this.u2p = function(u){
return (trans(u) - min) * pixellength / unitlength + offmin;
};
if (this.name == 'xaxis' || this.name == 'x2axis'){
this.series_u2p = function(u){
return (trans(u) - min) * pixellength / unitlength;
};
this.series_p2u = function(p){
return invtrans(p * unitlength / pixellength + min);
};
}
// yaxis is max at top of canvas.
else {
this.series_u2p = function(u){
return (trans(u) - max) * pixellength / unitlength;
};
this.series_p2u = function(p){
return invtrans(p * unitlength / pixellength + max);
};
}
if (this.show) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
for (var i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
switch (t.labelPosition) {
case 'auto':
// position at end
if (t.angle < 0) {
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
}
// position at start
else {
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
}
break;
case 'end':
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
case 'start':
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
break;
case 'middle':
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
default:
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
}
}
else {
shim = -t.getWidth()/2;
}
// var shim = t.getWidth()/2;
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('left', val);
t.pack();
}
}
if (lshow) {
var w = this._label._elem.outerWidth(true);
this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px');
if (this.name == 'xaxis') {
this._label._elem.css('bottom', '0px');
}
else {
this._label._elem.css('top', '0px');
}
this._label.pack();
}
}
else {
for (var i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
switch (t.labelPosition) {
case 'auto':
// position at end
case 'end':
if (t.angle < 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'start':
if (t.angle > 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'middle':
// if (t.angle > 0) {
// shim = -t.getHeight()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
// }
// else {
// shim = -t.getHeight()/2 - t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
// }
shim = -t.getHeight()/2;
break;
default:
shim = -t.getHeight()/2;
break;
}
}
else {
shim = -t.getHeight()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('top', val);
t.pack();
}
}
if (lshow) {
var h = this._label._elem.outerHeight(true);
this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px');
if (this.name == 'yaxis') {
this._label._elem.css('left', '0px');
}
else {
this._label._elem.css('right', '0px');
}
this._label.pack();
}
}
}
};
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,611 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
// class: $.jqplot.MekkoAxisRenderer
// An axis renderer for a Mekko chart.
// Should be used with a Mekko chart where the mekkoRenderer is used on the series.
// Displays the Y axis as a range from 0 to 1 (0 to 100%) and the x axis with a tick
// for each series scaled to the sum of all the y values.
$.jqplot.MekkoAxisRenderer = function() {
};
// called with scope of axis object.
$.jqplot.MekkoAxisRenderer.prototype.init = function(options){
// prop: tickMode
// How to space the ticks on the axis.
// 'bar' will place a tick at the width of each bar.
// This is the default for the x axis.
// 'even' will place ticks at even intervals. This is
// the default for x2 axis and y axis. y axis cannot be changed.
this.tickMode;
// prop: barLabelRenderer
// renderer to use to draw labels under each bar.
this.barLabelRenderer = $.jqplot.AxisLabelRenderer;
// prop: barLabels
// array of labels to put under each bar.
this.barLabels = this.barLabels || [];
// prop: barLabelOptions
// options object to pass to the bar label renderer.
this.barLabelOptions = {};
this.tickOptions = $.extend(true, {showGridline:false}, this.tickOptions);
this._barLabels = [];
$.extend(true, this, options);
if (this.name == 'yaxis') {
this.tickOptions.formatString = this.tickOptions.formatString || "%d\%";
}
var db = this._dataBounds;
db.min = 0;
// for y axes, scale always go from 0 to 1 (0 to 100%)
if (this.name == 'yaxis' || this.name == 'y2axis') {
db.max = 100;
this.tickMode = 'even';
}
// For x axes, scale goes from 0 to sum of all y values.
else if (this.name == 'xaxis'){
this.tickMode = (this.tickMode == null) ? 'bar' : this.tickMode;
for (var i=0; i<this._series.length; i++) {
db.max += this._series[i]._sumy;
}
}
else if (this.name == 'x2axis'){
this.tickMode = (this.tickMode == null) ? 'even' : this.tickMode;
for (var i=0; i<this._series.length; i++) {
db.max += this._series[i]._sumy;
}
}
};
// called with scope of axis
$.jqplot.MekkoAxisRenderer.prototype.draw = function(ctx, plot) {
if (this.show) {
// populate the axis label and value properties.
// createTicks is a method on the renderer, but
// call it within the scope of the axis.
this.renderer.createTicks.call(this);
// fill a div with axes labels in the right direction.
// Need to pregenerate each axis to get its bounds and
// position it and the labels correctly on the plot.
var dim=0;
var temp;
var elem = document.createElement('div');
this._elem = $(elem);
this._elem.addClass('jqplot-axis jqplot-'+this.name);
this._elem.css('position', 'absolute');
elem = null;
if (this.name == 'xaxis' || this.name == 'x2axis') {
this._elem.width(this._plotDimensions.width);
}
else {
this._elem.height(this._plotDimensions.height);
}
// draw the axis label
// create a _label object.
this.labelOptions.axis = this.name;
this._label = new this.labelRenderer(this.labelOptions);
if (this._label.show) {
this._elem.append(this._label.draw(ctx));
}
var t, tick, elem;
if (this.showTicks) {
t = this._ticks;
for (var i=0; i<t.length; i++) {
tick = t[i];
if (tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) {
this._elem.append(tick.draw(ctx));
}
}
}
// draw the series labels
for (i=0; i<this.barLabels.length; i++) {
this.barLabelOptions.axis = this.name;
this.barLabelOptions.label = this.barLabels[i];
this._barLabels.push(new this.barLabelRenderer(this.barLabelOptions));
if (this.tickMode != 'bar') {
this._barLabels[i].show = false;
}
if (this._barLabels[i].show) {
var elem = this._barLabels[i].draw(ctx, plot);
elem.removeClass('jqplot-'+this.name+'-label');
elem.addClass('jqplot-'+this.name+'-tick');
elem.addClass('jqplot-mekko-barLabel');
elem.appendTo(this._elem);
elem = null;
}
}
}
return this._elem;
};
// called with scope of an axis
$.jqplot.MekkoAxisRenderer.prototype.reset = function() {
this.min = this._min;
this.max = this._max;
this.tickInterval = this._tickInterval;
this.numberTicks = this._numberTicks;
// this._ticks = this.__ticks;
};
// called with scope of axis
$.jqplot.MekkoAxisRenderer.prototype.set = function() {
var dim = 0;
var temp;
var w = 0;
var h = 0;
var lshow = (this._label == null) ? false : this._label.show;
if (this.show && this.showTicks) {
var t = this._ticks;
for (var i=0; i<t.length; i++) {
var tick = t[i];
if (tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
temp = tick._elem.outerHeight(true);
}
else {
temp = tick._elem.outerWidth(true);
}
if (temp > dim) {
dim = temp;
}
}
}
if (lshow) {
w = this._label._elem.outerWidth(true);
h = this._label._elem.outerHeight(true);
}
if (this.name == 'xaxis') {
dim = dim + h;
this._elem.css({'height':dim+'px', left:'0px', bottom:'0px'});
}
else if (this.name == 'x2axis') {
dim = dim + h;
this._elem.css({'height':dim+'px', left:'0px', top:'0px'});
}
else if (this.name == 'yaxis') {
dim = dim + w;
this._elem.css({'width':dim+'px', left:'0px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css('width', w+'px');
}
}
else {
dim = dim + w;
this._elem.css({'width':dim+'px', right:'0px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css('width', w+'px');
}
}
}
};
// called with scope of axis
$.jqplot.MekkoAxisRenderer.prototype.createTicks = function() {
// we're are operating on an axis here
var ticks = this._ticks;
var userTicks = this.ticks;
var name = this.name;
// databounds were set on axis initialization.
var db = this._dataBounds;
var dim, interval;
var min, max;
var pos1, pos2;
var t, tt, i, j;
// if we already have ticks, use them.
// ticks must be in order of increasing value.
if (userTicks.length) {
// ticks could be 1D or 2D array of [val, val, ,,,] or [[val, label], [val, label], ...] or mixed
for (i=0; i<userTicks.length; i++){
var ut = userTicks[i];
var t = new this.tickRenderer(this.tickOptions);
if (ut.constructor == Array) {
t.value = ut[0];
t.label = ut[1];
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(ut[0], this.name);
this._ticks.push(t);
}
else {
t.value = ut;
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(ut, this.name);
this._ticks.push(t);
}
}
this.numberTicks = userTicks.length;
this.min = this._ticks[0].value;
this.max = this._ticks[this.numberTicks-1].value;
this.tickInterval = (this.max - this.min) / (this.numberTicks - 1);
}
// we don't have any ticks yet, let's make some!
else {
if (name == 'xaxis' || name == 'x2axis') {
dim = this._plotDimensions.width;
}
else {
dim = this._plotDimensions.height;
}
// if min, max and number of ticks specified, user can't specify interval.
if (this.min != null && this.max != null && this.numberTicks != null) {
this.tickInterval = null;
}
min = (this.min != null) ? this.min : db.min;
max = (this.max != null) ? this.max : db.max;
// if min and max are same, space them out a bit.+
if (min == max) {
var adj = 0.05;
if (min > 0) {
adj = Math.max(Math.log(min)/Math.LN10, 0.05);
}
min -= adj;
max += adj;
}
var range = max - min;
var rmin, rmax;
var temp, prev, curr;
var ynumticks = [3,5,6,11,21];
// yaxis divide ticks in nice intervals from 0 to 1.
if (this.name == 'yaxis' || this.name == 'y2axis') {
this.min = 0;
this.max = 100;
// user didn't specify number of ticks.
if (!this.numberTicks){
if (this.tickInterval) {
this.numberTicks = 3 + Math.ceil(range / this.tickInterval);
}
else {
temp = 2 + Math.ceil((dim-(this.tickSpacing-1))/this.tickSpacing);
for (i=0; i<ynumticks.length; i++) {
curr = temp/ynumticks[i];
if (curr == 1) {
this.numberTicks = ynumticks[i];
break;
}
else if (curr > 1) {
prev = curr;
continue;
}
else if (curr < 1) {
// was prev or is curr closer to one?
if (Math.abs(prev - 1) < Math.abs(curr - 1)) {
this.numberTicks = ynumticks[i-1];
break;
}
else {
this.numberTicks = ynumticks[i];
break;
}
}
else if (i == ynumticks.length -1) {
this.numberTicks = ynumticks[i];
}
}
this.tickInterval = range / (this.numberTicks - 1);
}
}
// user did specify number of ticks.
else {
this.tickInterval = range / (this.numberTicks - 1);
}
for (var i=0; i<this.numberTicks; i++){
tt = this.min + i * this.tickInterval;
t = new this.tickRenderer(this.tickOptions);
// var t = new $.jqplot.AxisTickRenderer(this.tickOptions);
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(tt, this.name);
this._ticks.push(t);
}
}
// for x axes, have number ot ticks equal to number of series and ticks placed
// at sum of y values for each series.
else if (this.tickMode == 'bar') {
this.min = 0;
this.numberTicks = this._series.length + 1;
t = new this.tickRenderer(this.tickOptions);
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(0, this.name);
this._ticks.push(t);
temp = 0;
for (i=1; i<this.numberTicks; i++){
temp += this._series[i-1]._sumy;
t = new this.tickRenderer(this.tickOptions);
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(temp, this.name);
this._ticks.push(t);
}
this.max = this.max || temp;
// if user specified a max and it is greater than sum, add a tick
if (this.max > temp) {
t = new this.tickRenderer(this.tickOptions);
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(this.max, this.name);
this._ticks.push(t);
}
}
else if (this.tickMode == 'even') {
this.min = 0;
this.max = this.max || db.max;
// get a desired number of ticks
var nt = 2 + Math.ceil((dim-(this.tickSpacing-1))/this.tickSpacing);
range = this.max - this.min;
this.numberTicks = nt;
this.tickInterval = range / (this.numberTicks - 1);
for (i=0; i<this.numberTicks; i++){
tt = this.min + i * this.tickInterval;
t = new this.tickRenderer(this.tickOptions);
// var t = new $.jqplot.AxisTickRenderer(this.tickOptions);
if (!this.showTicks) {
t.showLabel = false;
t.showMark = false;
}
else if (!this.showTickMarks) {
t.showMark = false;
}
t.setTick(tt, this.name);
this._ticks.push(t);
}
}
}
};
// called with scope of axis
$.jqplot.MekkoAxisRenderer.prototype.pack = function(pos, offsets) {
var ticks = this._ticks;
var max = this.max;
var min = this.min;
var offmax = offsets.max;
var offmin = offsets.min;
var lshow = (this._label == null) ? false : this._label.show;
for (var p in pos) {
this._elem.css(p, pos[p]);
}
this._offsets = offsets;
// pixellength will be + for x axes and - for y axes becasue pixels always measured from top left.
var pixellength = offmax - offmin;
var unitlength = max - min;
// point to unit and unit to point conversions references to Plot DOM element top left corner.
this.p2u = function(p){
return (p - offmin) * unitlength / pixellength + min;
};
this.u2p = function(u){
return (u - min) * pixellength / unitlength + offmin;
};
if (this.name == 'xaxis' || this.name == 'x2axis'){
this.series_u2p = function(u){
return (u - min) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + min;
};
}
else {
this.series_u2p = function(u){
return (u - max) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + max;
};
}
if (this.show) {
if (this.name == 'xaxis' || this.name == 'x2axis') {
for (var i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
// will need to adjust auto positioning based on which axis this is.
var temp = (this.name == 'xaxis') ? 1 : -1;
switch (t.labelPosition) {
case 'auto':
// position at end
if (temp * t.angle < 0) {
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
}
// position at start
else {
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
}
break;
case 'end':
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
case 'start':
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
break;
case 'middle':
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
default:
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
}
}
else {
shim = -t.getWidth()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('left', val);
t.pack();
}
}
var w;
if (lshow) {
w = this._label._elem.outerWidth(true);
this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px');
if (this.name == 'xaxis') {
this._label._elem.css('bottom', '0px');
}
else {
this._label._elem.css('top', '0px');
}
this._label.pack();
}
// now show the labels under the bars.
var b, l, r;
for (var i=0; i<this.barLabels.length; i++) {
b = this._barLabels[i];
if (b.show) {
w = b.getWidth();
l = this._ticks[i].getLeft() + this._ticks[i].getWidth();
r = this._ticks[i+1].getLeft();
b._elem.css('left', (r+l-w)/2+'px');
b._elem.css('top', this._ticks[i]._elem.css('top'));
b.pack();
}
}
}
else {
for (var i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
// will need to adjust auto positioning based on which axis this is.
var temp = (this.name == 'yaxis') ? 1 : -1;
switch (t.labelPosition) {
case 'auto':
// position at end
case 'end':
if (temp * t.angle < 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'start':
if (t.angle > 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'middle':
shim = -t.getHeight()/2;
break;
default:
shim = -t.getHeight()/2;
break;
}
}
else {
shim = -t.getHeight()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('top', val);
t.pack();
}
}
if (lshow) {
var h = this._label._elem.outerHeight(true);
this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px');
if (this.name == 'yaxis') {
this._label._elem.css('left', '0px');
}
else {
this._label._elem.css('right', '0px');
}
this._label.pack();
}
}
}
};
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,437 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.MekkoRenderer
* Draws a Mekko style chart which shows 3 dimensional data on a 2 dimensional graph.
* the <$.jqplot.MekkoAxisRenderer> should be used with mekko charts. The mekko renderer
* overrides the default legend renderer with its own $.jqplot.MekkoLegendRenderer
* which allows more flexibility to specify number of rows and columns in the legend.
*
* Data is specified per bar in the chart. You can specify data as an array of y values, or as
* an array of [label, value] pairs. Note that labels are used only on the first series.
* Labels on subsequent series are ignored:
*
* > bar1 = [['shirts', 8],['hats', 14],['shoes', 6],['gloves', 16],['dolls', 12]];
* > bar2 = [15,6,9,13,6];
* > bar3 = [['grumpy',4],['sneezy',2],['happy',7],['sleepy',9],['doc',7]];
*
* If you want to place labels for each bar under the axis, you use the barLabels option on
* the axes. The bar labels can be styled with the ".jqplot-mekko-barLabel" css class.
*
* > barLabels = ['Mickey Mouse', 'Donald Duck', 'Goofy'];
* > axes:{xaxis:{barLabels:barLabels}}
*
*/
$.jqplot.MekkoRenderer = function(){
this.shapeRenderer = new $.jqplot.ShapeRenderer();
// prop: borderColor
// color of the borders between areas on the chart
this.borderColor = null;
// prop: showBorders
// True to draw borders lines between areas on the chart.
// False will draw borders lines with the same color as the area.
this.showBorders = true;
};
// called with scope of series.
$.jqplot.MekkoRenderer.prototype.init = function(options, plot) {
this.fill = false;
this.fillRect = true;
this.strokeRect = true;
this.shadow = false;
// width of bar on x axis.
this._xwidth = 0;
this._xstart = 0;
$.extend(true, this.renderer, options);
// set the shape renderer options
var opts = {lineJoin:'miter', lineCap:'butt', isarc:false, fillRect:this.fillRect, strokeRect:this.strokeRect};
this.renderer.shapeRenderer.init(opts);
plot.axes.x2axis._series.push(this);
this._type = 'mekko';
};
// Method: setGridData
// converts the user data values to grid coordinates and stores them
// in the gridData array. Will convert user data into appropriate
// rectangles.
// Called with scope of a series.
$.jqplot.MekkoRenderer.prototype.setGridData = function(plot) {
// recalculate the grid data
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var data = this._plotData;
this.gridData = [];
// figure out width on x axis.
// this._xwidth = this._sumy / plot._sumy * this.canvas.getWidth();
this._xwidth = xp(this._sumy) - xp(0);
if (this.index>0) {
this._xstart = plot.series[this.index-1]._xstart + plot.series[this.index-1]._xwidth;
}
var totheight = this.canvas.getHeight();
var sumy = 0;
var cury;
var curheight;
for (var i=0; i<data.length; i++) {
if (data[i] != null) {
sumy += data[i][1];
cury = totheight - (sumy / this._sumy * totheight);
curheight = data[i][1] / this._sumy * totheight;
this.gridData.push([this._xstart, cury, this._xwidth, curheight]);
}
}
};
// Method: makeGridData
// converts any arbitrary data values to grid coordinates and
// returns them. This method exists so that plugins can use a series'
// linerenderer to generate grid data points without overwriting the
// grid data associated with that series.
// Called with scope of a series.
$.jqplot.MekkoRenderer.prototype.makeGridData = function(data, plot) {
// recalculate the grid data
// figure out width on x axis.
var xp = this._xaxis.series_u2p;
var totheight = this.canvas.getHeight();
var sumy = 0;
var cury;
var curheight;
var gd = [];
for (var i=0; i<data.length; i++) {
if (data[i] != null) {
sumy += data[i][1];
cury = totheight - (sumy / this._sumy * totheight);
curheight = data[i][1] / this._sumy * totheight;
gd.push([this._xstart, cury, this._xwidth, curheight]);
}
}
return gd;
};
// called within scope of series.
$.jqplot.MekkoRenderer.prototype.draw = function(ctx, gd, options) {
var i;
var opts = (options != undefined) ? options : {};
var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine;
var colorGenerator = new $.jqplot.ColorGenerator(this.seriesColors);
ctx.save();
if (gd.length) {
if (showLine) {
for (i=0; i<gd.length; i++){
opts.fillStyle = colorGenerator.next();
if (this.renderer.showBorders) {
opts.strokeStyle = this.renderer.borderColor;
}
else {
opts.strokeStyle = opts.fillStyle;
}
this.renderer.shapeRenderer.draw(ctx, gd[i], opts);
}
}
}
ctx.restore();
};
$.jqplot.MekkoRenderer.prototype.drawShadow = function(ctx, gd, options) {
// This is a no-op, no shadows on mekko charts.
};
/**
* Class: $.jqplot.MekkoLegendRenderer
* Legend renderer used by mekko charts with options for
* controlling number or rows and columns as well as placement
* outside of plot area.
*
*/
$.jqplot.MekkoLegendRenderer = function(){
//
};
$.jqplot.MekkoLegendRenderer.prototype.init = function(options) {
// prop: numberRows
// Maximum number of rows in the legend. 0 or null for unlimited.
this.numberRows = null;
// prop: numberColumns
// Maximum number of columns in the legend. 0 or null for unlimited.
this.numberColumns = null;
// this will override the placement option on the Legend object
this.placement = "outside";
$.extend(true, this, options);
};
// called with scope of legend
$.jqplot.MekkoLegendRenderer.prototype.draw = function() {
var legend = this;
if (this.show) {
var series = this._series;
var ss = 'position:absolute;';
ss += (this.background) ? 'background:'+this.background+';' : '';
ss += (this.border) ? 'border:'+this.border+';' : '';
ss += (this.fontSize) ? 'font-size:'+this.fontSize+';' : '';
ss += (this.fontFamily) ? 'font-family:'+this.fontFamily+';' : '';
ss += (this.textColor) ? 'color:'+this.textColor+';' : '';
this._elem = $('<table class="jqplot-table-legend" style="'+ss+'"></table>');
// Mekko charts legends don't go by number of series, but by number of data points
// in the series. Refactor things here for that.
var pad = false,
reverse = true, // mekko charts are always stacked, so reverse
nr, nc;
var s = series[0];
var colorGenerator = new $.jqplot.ColorGenerator(s.seriesColors);
if (s.show) {
var pd = s.data;
if (this.numberRows) {
nr = this.numberRows;
if (!this.numberColumns){
nc = Math.ceil(pd.length/nr);
}
else{
nc = this.numberColumns;
}
}
else if (this.numberColumns) {
nc = this.numberColumns;
nr = Math.ceil(pd.length/this.numberColumns);
}
else {
nr = pd.length;
nc = 1;
}
var i, j, tr, td1, td2, lt, rs, color;
var idx = 0;
for (i=0; i<nr; i++) {
if (reverse){
tr = $('<tr class="jqplot-table-legend"></tr>').prependTo(this._elem);
}
else{
tr = $('<tr class="jqplot-table-legend"></tr>').appendTo(this._elem);
}
for (j=0; j<nc; j++) {
if (idx < pd.length) {
lt = this.labels[idx] || pd[idx][0].toString();
color = colorGenerator.next();
if (!reverse){
if (i>0){
pad = true;
}
else{
pad = false;
}
}
else{
if (i == nr -1){
pad = false;
}
else{
pad = true;
}
}
rs = (pad) ? this.rowSpacing : '0';
td1 = $('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+rs+';">'+
'<div><div class="jqplot-table-legend-swatch" style="border-color:'+color+';"></div>'+
'</div></td>');
td2 = $('<td class="jqplot-table-legend" style="padding-top:'+rs+';"></td>');
if (this.escapeHtml){
td2.text(lt);
}
else {
td2.html(lt);
}
if (reverse) {
td2.prependTo(tr);
td1.prependTo(tr);
}
else {
td1.appendTo(tr);
td2.appendTo(tr);
}
pad = true;
}
idx++;
}
}
tr = null;
td1 = null;
td2 = null;
}
}
return this._elem;
};
$.jqplot.MekkoLegendRenderer.prototype.pack = function(offsets) {
if (this.show) {
// fake a grid for positioning
var grid = {_top:offsets.top, _left:offsets.left, _right:offsets.right, _bottom:this._plotDimensions.height - offsets.bottom};
if (this.placement == 'insideGrid') {
switch (this.location) {
case 'nw':
var a = grid._left + this.xoffset;
var b = grid._top + this.yoffset;
this._elem.css('left', a);
this._elem.css('top', b);
break;
case 'n':
var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
var b = grid._top + this.yoffset;
this._elem.css('left', a);
this._elem.css('top', b);
break;
case 'ne':
var a = offsets.right + this.xoffset;
var b = grid._top + this.yoffset;
this._elem.css({right:a, top:b});
break;
case 'e':
var a = offsets.right + this.xoffset;
var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
this._elem.css({right:a, top:b});
break;
case 'se':
var a = offsets.right + this.xoffset;
var b = offsets.bottom + this.yoffset;
this._elem.css({right:a, bottom:b});
break;
case 's':
var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
var b = offsets.bottom + this.yoffset;
this._elem.css({left:a, bottom:b});
break;
case 'sw':
var a = grid._left + this.xoffset;
var b = offsets.bottom + this.yoffset;
this._elem.css({left:a, bottom:b});
break;
case 'w':
var a = grid._left + this.xoffset;
var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
this._elem.css({left:a, top:b});
break;
default: // same as 'se'
var a = grid._right - this.xoffset;
var b = grid._bottom + this.yoffset;
this._elem.css({right:a, bottom:b});
break;
}
}
else {
switch (this.location) {
case 'nw':
var a = this._plotDimensions.width - grid._left + this.xoffset;
var b = grid._top + this.yoffset;
this._elem.css('right', a);
this._elem.css('top', b);
break;
case 'n':
var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
var b = this._plotDimensions.height - grid._top + this.yoffset;
this._elem.css('left', a);
this._elem.css('bottom', b);
break;
case 'ne':
var a = this._plotDimensions.width - offsets.right + this.xoffset;
var b = grid._top + this.yoffset;
this._elem.css({left:a, top:b});
break;
case 'e':
var a = this._plotDimensions.width - offsets.right + this.xoffset;
var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
this._elem.css({left:a, top:b});
break;
case 'se':
var a = this._plotDimensions.width - offsets.right + this.xoffset;
var b = offsets.bottom + this.yoffset;
this._elem.css({left:a, bottom:b});
break;
case 's':
var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2;
var b = this._plotDimensions.height - offsets.bottom + this.yoffset;
this._elem.css({left:a, top:b});
break;
case 'sw':
var a = this._plotDimensions.width - grid._left + this.xoffset;
var b = offsets.bottom + this.yoffset;
this._elem.css({right:a, bottom:b});
break;
case 'w':
var a = this._plotDimensions.width - grid._left + this.xoffset;
var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2;
this._elem.css({right:a, top:b});
break;
default: // same as 'se'
var a = grid._right - this.xoffset;
var b = grid._bottom + this.yoffset;
this._elem.css({right:a, bottom:b});
break;
}
}
}
};
// setup default renderers for axes and legend so user doesn't have to
// called with scope of plot
function preInit(target, data, options) {
options = options || {};
options.axesDefaults = options.axesDefaults || {};
options.legend = options.legend || {};
options.seriesDefaults = options.seriesDefaults || {};
var setopts = false;
if (options.seriesDefaults.renderer == $.jqplot.MekkoRenderer) {
setopts = true;
}
else if (options.series) {
for (var i=0; i < options.series.length; i++) {
if (options.series[i].renderer == $.jqplot.MekkoRenderer) {
setopts = true;
}
}
}
if (setopts) {
options.axesDefaults.renderer = $.jqplot.MekkoAxisRenderer;
options.legend.renderer = $.jqplot.MekkoLegendRenderer;
options.legend.preDraw = true;
}
}
$.jqplot.preInitHooks.push(preInit);
})(jQuery);

File diff suppressed because one or more lines are too long

File diff suppressed because it is too large Load Diff

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,45 @@
/**
* jqplot.jquerymobile plugin
* jQuery Mobile virtual event support.
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2011 Takashi Okamoto
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
*/
(function($) {
function postInit(target, data, options){
this.bindCustomEvents = function() {
this.eventCanvas._elem.bind('vclick', {plot:this}, this.onClick);
this.eventCanvas._elem.bind('dblclick', {plot:this}, this.onDblClick);
this.eventCanvas._elem.bind('taphold', {plot:this}, this.onDblClick);
this.eventCanvas._elem.bind('vmousedown', {plot:this}, this.onMouseDown);
this.eventCanvas._elem.bind('vmousemove', {plot:this}, this.onMouseMove);
this.eventCanvas._elem.bind('mouseenter', {plot:this}, this.onMouseEnter);
this.eventCanvas._elem.bind('mouseleave', {plot:this}, this.onMouseLeave);
if (this.captureRightClick) {
this.eventCanvas._elem.bind('vmouseup', {plot:this}, this.onRightClick);
this.eventCanvas._elem.get(0).oncontextmenu = function() {
return false;
};
}
else {
this.eventCanvas._elem.bind('vmouseup', {plot:this}, this.onMouseUp);
}
};
this.plugins.mobile = true;
}
$.jqplot.postInitHooks.push(postInit);
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(b){function a(e,d,c){this.bindCustomEvents=function(){this.eventCanvas._elem.bind("vclick",{plot:this},this.onClick);this.eventCanvas._elem.bind("dblclick",{plot:this},this.onDblClick);this.eventCanvas._elem.bind("taphold",{plot:this},this.onDblClick);this.eventCanvas._elem.bind("vmousedown",{plot:this},this.onMouseDown);this.eventCanvas._elem.bind("vmousemove",{plot:this},this.onMouseMove);this.eventCanvas._elem.bind("mouseenter",{plot:this},this.onMouseEnter);this.eventCanvas._elem.bind("mouseleave",{plot:this},this.onMouseLeave);if(this.captureRightClick){this.eventCanvas._elem.bind("vmouseup",{plot:this},this.onRightClick);this.eventCanvas._elem.get(0).oncontextmenu=function(){return false}}else{this.eventCanvas._elem.bind("vmouseup",{plot:this},this.onMouseUp)}};this.plugins.mobile=true}b.jqplot.postInitHooks.push(a)})(jQuery);

View File

@ -0,0 +1,373 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.OHLCRenderer
* jqPlot Plugin to draw Open Hi Low Close, Candlestick and Hi Low Close charts.
*
* To use this plugin, include the renderer js file in
* your source:
*
* > <script type="text/javascript" src="plugins/jqplot.ohlcRenderer.js"></script>
*
* You will most likely want to use a date axis renderer
* for the x axis also, so include the date axis render js file also:
*
* > <script type="text/javascript" src="plugins/jqplot.dateAxisRenderer.js"></script>
*
* Then you set the renderer in the series options on your plot:
*
* > series: [{renderer:$.jqplot.OHLCRenderer}]
*
* For OHLC and candlestick charts, data should be specified
* like so:
*
* > dat = [['07/06/2009',138.7,139.68,135.18,135.4], ['06/29/2009',143.46,144.66,139.79,140.02], ...]
*
* If the data array has only 4 values per point instead of 5,
* the renderer will create a Hi Low Close chart instead. In that case,
* data should be supplied like:
*
* > dat = [['07/06/2009',139.68,135.18,135.4], ['06/29/2009',144.66,139.79,140.02], ...]
*
* To generate a candlestick chart instead of an OHLC chart,
* set the "candlestick" option to true:
*
* > series: [{renderer:$.jqplot.OHLCRenderer, rendererOptions:{candleStick:true}}],
*
*/
$.jqplot.OHLCRenderer = function(){
// subclass line renderer to make use of some of its methods.
$.jqplot.LineRenderer.call(this);
// prop: candleStick
// true to render chart as candleStick.
// Must have an open price, cannot be a hlc chart.
this.candleStick = false;
// prop: tickLength
// length of the line in pixels indicating open and close price.
// Default will auto calculate based on plot width and
// number of points displayed.
this.tickLength = 'auto';
// prop: bodyWidth
// width of the candlestick body in pixels. Default will auto calculate
// based on plot width and number of candlesticks displayed.
this.bodyWidth = 'auto';
// prop: openColor
// color of the open price tick mark. Default is series color.
this.openColor = null;
// prop: closeColor
// color of the close price tick mark. Default is series color.
this.closeColor = null;
// prop: wickColor
// color of the hi-lo line thorugh the candlestick body.
// Default is the series color.
this.wickColor = null;
// prop: fillUpBody
// true to render an "up" day (close price greater than open price)
// with a filled candlestick body.
this.fillUpBody = false;
// prop: fillDownBody
// true to render a "down" day (close price lower than open price)
// with a filled candlestick body.
this.fillDownBody = true;
// prop: upBodyColor
// Color of candlestick body of an "up" day. Default is series color.
this.upBodyColor = null;
// prop: downBodyColor
// Color of candlestick body on a "down" day. Default is series color.
this.downBodyColor = null;
// prop: hlc
// true if is a hi-low-close chart (no open price).
// This is determined automatically from the series data.
this.hlc = false;
// prop: lineWidth
// Width of the hi-low line and open/close ticks.
// Must be set in the rendererOptions for the series.
this.lineWidth = 1.5;
this._tickLength;
this._bodyWidth;
};
$.jqplot.OHLCRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.OHLCRenderer.prototype.constructor = $.jqplot.OHLCRenderer;
// called with scope of series.
$.jqplot.OHLCRenderer.prototype.init = function(options) {
options = options || {};
// lineWidth has to be set on the series, changes in renderer
// constructor have no effect. set the default here
// if no renderer option for lineWidth is specified.
this.lineWidth = options.lineWidth || 1.5;
$.jqplot.LineRenderer.prototype.init.call(this, options);
this._type = 'ohlc';
// set the yaxis data bounds here to account for hi and low values
var db = this._yaxis._dataBounds;
var d = this._plotData;
// if data points have less than 5 values, force a hlc chart.
if (d[0].length < 5) {
this.renderer.hlc = true;
for (var j=0; j<d.length; j++) {
if (d[j][2] < db.min || db.min == null) {
db.min = d[j][2];
}
if (d[j][1] > db.max || db.max == null) {
db.max = d[j][1];
}
}
}
else {
for (var j=0; j<d.length; j++) {
if (d[j][3] < db.min || db.min == null) {
db.min = d[j][3];
}
if (d[j][2] > db.max || db.max == null) {
db.max = d[j][2];
}
}
}
};
// called within scope of series.
$.jqplot.OHLCRenderer.prototype.draw = function(ctx, gd, options) {
var d = this.data;
var xmin = this._xaxis.min;
var xmax = this._xaxis.max;
// index of last value below range of plot.
var xminidx = 0;
// index of first value above range of plot.
var xmaxidx = d.length;
var xp = this._xaxis.series_u2p;
var yp = this._yaxis.series_u2p;
var i, prevColor, ops, b, h, w, a, points;
var o;
var r = this.renderer;
var opts = (options != undefined) ? options : {};
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
var fill = (opts.fill != undefined) ? opts.fill : this.fill;
var fillAndStroke = (opts.fillAndStroke != undefined) ? opts.fillAndStroke : this.fillAndStroke;
r.bodyWidth = (opts.bodyWidth != undefined) ? opts.bodyWidth : r.bodyWidth;
r.tickLength = (opts.tickLength != undefined) ? opts.tickLength : r.tickLength;
ctx.save();
if (this.show) {
var x, open, hi, low, close;
// need to get widths based on number of points shown,
// not on total number of points. Use the results
// to speed up drawing in next step.
for (var i=0; i<d.length; i++) {
if (d[i][0] < xmin) {
xminidx = i;
}
else if (d[i][0] < xmax) {
xmaxidx = i+1;
}
}
var dwidth = this.gridData[xmaxidx-1][0] - this.gridData[xminidx][0];
var nvisiblePoints = xmaxidx - xminidx;
try {
var dinterval = Math.abs(this._xaxis.series_u2p(parseInt(this._xaxis._intervalStats[0].sortedIntervals[0].interval, 10)) - this._xaxis.series_u2p(0));
}
catch (e) {
var dinterval = dwidth / nvisiblePoints;
}
if (r.candleStick) {
if (typeof(r.bodyWidth) == 'number') {
r._bodyWidth = r.bodyWidth;
}
else {
r._bodyWidth = Math.min(20, dinterval/1.65);
}
}
else {
if (typeof(r.tickLength) == 'number') {
r._tickLength = r.tickLength;
}
else {
r._tickLength = Math.min(10, dinterval/3.5);
}
}
for (var i=xminidx; i<xmaxidx; i++) {
x = xp(d[i][0]);
if (r.hlc) {
open = null;
hi = yp(d[i][1]);
low = yp(d[i][2]);
close = yp(d[i][3]);
}
else {
open = yp(d[i][1]);
hi = yp(d[i][2]);
low = yp(d[i][3]);
close = yp(d[i][4]);
}
o = {};
if (r.candleStick && !r.hlc) {
w = r._bodyWidth;
a = x - w/2;
// draw candle
// determine if candle up or down
// up, remember grid coordinates increase downward
if (close < open) {
// draw wick
if (r.wickColor) {
o.color = r.wickColor;
}
else if (r.downBodyColor) {
o.color = r.upBodyColor;
}
ops = $.extend(true, {}, opts, o);
r.shapeRenderer.draw(ctx, [[x, hi], [x, close]], ops);
r.shapeRenderer.draw(ctx, [[x, open], [x, low]], ops);
o = {};
b = close;
h = open - close;
// if color specified, use it
if (r.fillUpBody) {
o.fillRect = true;
}
else {
o.strokeRect = true;
w = w - this.lineWidth;
a = x - w/2;
}
if (r.upBodyColor) {
o.color = r.upBodyColor;
o.fillStyle = r.upBodyColor;
}
points = [a, b, w, h];
}
// down
else if (close > open) {
// draw wick
if (r.wickColor) {
o.color = r.wickColor;
}
else if (r.downBodyColor) {
o.color = r.downBodyColor;
}
ops = $.extend(true, {}, opts, o);
r.shapeRenderer.draw(ctx, [[x, hi], [x, open]], ops);
r.shapeRenderer.draw(ctx, [[x, close], [x, low]], ops);
o = {};
b = open;
h = close - open;
// if color specified, use it
if (r.fillDownBody) {
o.fillRect = true;
}
else {
o.strokeRect = true;
w = w - this.lineWidth;
a = x - w/2;
}
if (r.downBodyColor) {
o.color = r.downBodyColor;
o.fillStyle = r.downBodyColor;
}
points = [a, b, w, h];
}
// even, open = close
else {
// draw wick
if (r.wickColor) {
o.color = r.wickColor;
}
ops = $.extend(true, {}, opts, o);
r.shapeRenderer.draw(ctx, [[x, hi], [x, low]], ops);
o = {};
o.fillRect = false;
o.strokeRect = false;
a = [x - w/2, open];
b = [x + w/2, close];
w = null;
h = null;
points = [a, b];
}
ops = $.extend(true, {}, opts, o);
r.shapeRenderer.draw(ctx, points, ops);
}
else {
prevColor = opts.color;
if (r.openColor) {
opts.color = r.openColor;
}
// draw open tick
if (!r.hlc) {
r.shapeRenderer.draw(ctx, [[x-r._tickLength, open], [x, open]], opts);
}
opts.color = prevColor;
// draw wick
if (r.wickColor) {
opts.color = r.wickColor;
}
r.shapeRenderer.draw(ctx, [[x, hi], [x, low]], opts);
opts.color = prevColor;
// draw close tick
if (r.closeColor) {
opts.color = r.closeColor;
}
r.shapeRenderer.draw(ctx, [[x, close], [x+r._tickLength, close]], opts);
opts.color = prevColor;
}
}
}
ctx.restore();
};
$.jqplot.OHLCRenderer.prototype.drawShadow = function(ctx, gd, options) {
// This is a no-op, shadows drawn with lines.
};
// called with scope of plot.
$.jqplot.OHLCRenderer.checkOptions = function(target, data, options) {
// provide some sensible highlighter options by default
// These aren't good for hlc, only for ohlc or candlestick
if (!options.highlighter) {
options.highlighter = {
showMarker:false,
tooltipAxes: 'y',
yvalues: 4,
formatString:'<table class="jqplot-highlighter"><tr><td>date:</td><td>%s</td></tr><tr><td>open:</td><td>%s</td></tr><tr><td>hi:</td><td>%s</td></tr><tr><td>low:</td><td>%s</td></tr><tr><td>close:</td><td>%s</td></tr></table>'
};
}
};
//$.jqplot.preInitHooks.push($.jqplot.OHLCRenderer.checkOptions);
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(a){a.jqplot.OHLCRenderer=function(){a.jqplot.LineRenderer.call(this);this.candleStick=false;this.tickLength="auto";this.bodyWidth="auto";this.openColor=null;this.closeColor=null;this.wickColor=null;this.fillUpBody=false;this.fillDownBody=true;this.upBodyColor=null;this.downBodyColor=null;this.hlc=false;this.lineWidth=1.5;this._tickLength;this._bodyWidth};a.jqplot.OHLCRenderer.prototype=new a.jqplot.LineRenderer();a.jqplot.OHLCRenderer.prototype.constructor=a.jqplot.OHLCRenderer;a.jqplot.OHLCRenderer.prototype.init=function(e){e=e||{};this.lineWidth=e.lineWidth||1.5;a.jqplot.LineRenderer.prototype.init.call(this,e);this._type="ohlc";var b=this._yaxis._dataBounds;var f=this._plotData;if(f[0].length<5){this.renderer.hlc=true;for(var c=0;c<f.length;c++){if(f[c][2]<b.min||b.min==null){b.min=f[c][2]}if(f[c][1]>b.max||b.max==null){b.max=f[c][1]}}}else{for(var c=0;c<f.length;c++){if(f[c][3]<b.min||b.min==null){b.min=f[c][3]}if(f[c][2]>b.max||b.max==null){b.max=f[c][2]}}}};a.jqplot.OHLCRenderer.prototype.draw=function(A,N,j){var J=this.data;var v=this._xaxis.min;var z=this._xaxis.max;var l=0;var K=J.length;var p=this._xaxis.series_u2p;var G=this._yaxis.series_u2p;var D,E,f,M,F,n,O,C;var y;var u=this.renderer;var s=(j!=undefined)?j:{};var k=(s.shadow!=undefined)?s.shadow:this.shadow;var B=(s.fill!=undefined)?s.fill:this.fill;var c=(s.fillAndStroke!=undefined)?s.fillAndStroke:this.fillAndStroke;u.bodyWidth=(s.bodyWidth!=undefined)?s.bodyWidth:u.bodyWidth;u.tickLength=(s.tickLength!=undefined)?s.tickLength:u.tickLength;A.save();if(this.show){var m,q,g,Q,t;for(var D=0;D<J.length;D++){if(J[D][0]<v){l=D}else{if(J[D][0]<z){K=D+1}}}var I=this.gridData[K-1][0]-this.gridData[l][0];var L=K-l;try{var P=Math.abs(this._xaxis.series_u2p(parseInt(this._xaxis._intervalStats[0].sortedIntervals[0].interval,10))-this._xaxis.series_u2p(0))}catch(H){var P=I/L}if(u.candleStick){if(typeof(u.bodyWidth)=="number"){u._bodyWidth=u.bodyWidth}else{u._bodyWidth=Math.min(20,P/1.65)}}else{if(typeof(u.tickLength)=="number"){u._tickLength=u.tickLength}else{u._tickLength=Math.min(10,P/3.5)}}for(var D=l;D<K;D++){m=p(J[D][0]);if(u.hlc){q=null;g=G(J[D][1]);Q=G(J[D][2]);t=G(J[D][3])}else{q=G(J[D][1]);g=G(J[D][2]);Q=G(J[D][3]);t=G(J[D][4])}y={};if(u.candleStick&&!u.hlc){n=u._bodyWidth;O=m-n/2;if(t<q){if(u.wickColor){y.color=u.wickColor}else{if(u.downBodyColor){y.color=u.upBodyColor}}f=a.extend(true,{},s,y);u.shapeRenderer.draw(A,[[m,g],[m,t]],f);u.shapeRenderer.draw(A,[[m,q],[m,Q]],f);y={};M=t;F=q-t;if(u.fillUpBody){y.fillRect=true}else{y.strokeRect=true;n=n-this.lineWidth;O=m-n/2}if(u.upBodyColor){y.color=u.upBodyColor;y.fillStyle=u.upBodyColor}C=[O,M,n,F]}else{if(t>q){if(u.wickColor){y.color=u.wickColor}else{if(u.downBodyColor){y.color=u.downBodyColor}}f=a.extend(true,{},s,y);u.shapeRenderer.draw(A,[[m,g],[m,q]],f);u.shapeRenderer.draw(A,[[m,t],[m,Q]],f);y={};M=q;F=t-q;if(u.fillDownBody){y.fillRect=true}else{y.strokeRect=true;n=n-this.lineWidth;O=m-n/2}if(u.downBodyColor){y.color=u.downBodyColor;y.fillStyle=u.downBodyColor}C=[O,M,n,F]}else{if(u.wickColor){y.color=u.wickColor}f=a.extend(true,{},s,y);u.shapeRenderer.draw(A,[[m,g],[m,Q]],f);y={};y.fillRect=false;y.strokeRect=false;O=[m-n/2,q];M=[m+n/2,t];n=null;F=null;C=[O,M]}}f=a.extend(true,{},s,y);u.shapeRenderer.draw(A,C,f)}else{E=s.color;if(u.openColor){s.color=u.openColor}if(!u.hlc){u.shapeRenderer.draw(A,[[m-u._tickLength,q],[m,q]],s)}s.color=E;if(u.wickColor){s.color=u.wickColor}u.shapeRenderer.draw(A,[[m,g],[m,Q]],s);s.color=E;if(u.closeColor){s.color=u.closeColor}u.shapeRenderer.draw(A,[[m,t],[m+u._tickLength,t]],s);s.color=E}}}A.restore()};a.jqplot.OHLCRenderer.prototype.drawShadow=function(b,d,c){};a.jqplot.OHLCRenderer.checkOptions=function(d,c,b){if(!b.highlighter){b.highlighter={showMarker:false,tooltipAxes:"y",yvalues:4,formatString:'<table class="jqplot-highlighter"><tr><td>date:</td><td>%s</td></tr><tr><td>open:</td><td>%s</td></tr><tr><td>hi:</td><td>%s</td></tr><tr><td>low:</td><td>%s</td></tr><tr><td>close:</td><td>%s</td></tr></table>'}}}})(jQuery);

View File

@ -0,0 +1,946 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.PieRenderer
* Plugin renderer to draw a pie chart.
* x values, if present, will be used as slice labels.
* y values give slice size.
*
* To use this renderer, you need to include the
* pie renderer plugin, for example:
*
* > <script type="text/javascript" src="plugins/jqplot.pieRenderer.js"></script>
*
* Properties described here are passed into the $.jqplot function
* as options on the series renderer. For example:
*
* > plot2 = $.jqplot('chart2', [s1, s2], {
* > seriesDefaults: {
* > renderer:$.jqplot.PieRenderer,
* > rendererOptions:{
* > sliceMargin: 2,
* > startAngle: -90
* > }
* > }
* > });
*
* A pie plot will trigger events on the plot target
* according to user interaction. All events return the event object,
* the series index, the point (slice) index, and the point data for
* the appropriate slice.
*
* 'jqplotDataMouseOver' - triggered when user mouseing over a slice.
* 'jqplotDataHighlight' - triggered the first time user mouses over a slice,
* if highlighting is enabled.
* 'jqplotDataUnhighlight' - triggered when a user moves the mouse out of
* a highlighted slice.
* 'jqplotLegendHighlight' - triggered the first time user mouses over a legend,
* if highlighting is enabled.
* 'jqplotLegendUnhighlight' - triggered when a user moves the mouse out of
* a highlighted legend.
* 'jqplotDataClick' - triggered when the user clicks on a slice.
* 'jqplotDataRightClick' - tiggered when the user right clicks on a slice if
* the "captureRightClick" option is set to true on the plot.
*/
$.jqplot.PieRenderer = function(){
$.jqplot.LineRenderer.call(this);
};
$.jqplot.PieRenderer.prototype = new $.jqplot.LineRenderer();
$.jqplot.PieRenderer.prototype.constructor = $.jqplot.PieRenderer;
// called with scope of a series
$.jqplot.PieRenderer.prototype.init = function(options, plot) {
// Group: Properties
//
// prop: diameter
// Outer diameter of the pie, auto computed by default
this.diameter = null;
// prop: padding
// padding between the pie and plot edges, legend, etc.
this.padding = 20;
// prop: sliceMargin
// angular spacing between pie slices in degrees.
this.sliceMargin = 0;
// prop: fill
// true or false, whether to fil the slices.
this.fill = true;
// prop: shadowOffset
// offset of the shadow from the slice and offset of
// each succesive stroke of the shadow from the last.
this.shadowOffset = 2;
// prop: shadowAlpha
// transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07;
// prop: shadowDepth
// number of strokes to apply to the shadow,
// each stroke offset shadowOffset from the last.
this.shadowDepth = 5;
// prop: highlightMouseOver
// True to highlight slice when moused over.
// This must be false to enable highlightMouseDown to highlight when clicking on a slice.
this.highlightMouseOver = true;
// prop: highlightMouseDown
// True to highlight when a mouse button is pressed over a slice.
// This will be disabled if highlightMouseOver is true.
this.highlightMouseDown = false;
// prop: highlightColors
// an array of colors to use when highlighting a slice.
this.highlightColors = [];
// prop: dataLabels
// Either 'label', 'value', 'percent' or an array of labels to place on the pie slices.
// Defaults to percentage of each pie slice.
this.dataLabels = 'percent';
// prop: showDataLabels
// true to show data labels on slices.
this.showDataLabels = false;
// prop: dataLabelFormatString
// Format string for data labels. If none, '%s' is used for "label" and for arrays, '%d' for value and '%d%%' for percentage.
this.dataLabelFormatString = null;
// prop: dataLabelThreshold
// Threshhold in percentage (0-100) of pie area, below which no label will be displayed.
// This applies to all label types, not just to percentage labels.
this.dataLabelThreshold = 3;
// prop: dataLabelPositionFactor
// A Multiplier (0-1) of the pie radius which controls position of label on slice.
// Increasing will slide label toward edge of pie, decreasing will slide label toward center of pie.
this.dataLabelPositionFactor = 0.52;
// prop: dataLabelNudge
// Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelNudge = 2;
// prop: dataLabelCenterOn
// True to center the data label at its position.
// False to set the inside facing edge of the label at its position.
this.dataLabelCenterOn = true;
// prop: startAngle
// Angle to start drawing pie in degrees.
// According to orientation of canvas coordinate system:
// 0 = on the positive x axis
// -90 = on the positive y axis.
// 90 = on the negaive y axis.
// 180 or - 180 = on the negative x axis.
this.startAngle = 0;
this.tickRenderer = $.jqplot.PieTickRenderer;
// prop: showSlice
// Array for whether the pie chart slice for a data element should be displayed.
// Containsg true or false for each data element. If not specified, defaults to true.
this.showSlice = [];
// Used as check for conditions where pie shouldn't be drawn.
this._drawData = true;
this._type = 'pie';
// if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver
if (options.highlightMouseDown && options.highlightMouseOver == null) {
options.highlightMouseOver = false;
}
$.extend(true, this, options);
if (this.sliceMargin < 0) {
this.sliceMargin = 0;
}
this._diameter = null;
this._radius = null;
// array of [start,end] angles arrays, one for each slice. In radians.
this._sliceAngles = [];
// index of the currenty highlighted point, if any
this._highlightedPoint = null;
// set highlight colors if none provided
if (this.highlightColors.length == 0) {
for (var i=0; i<this.seriesColors.length; i++){
var rgba = $.jqplot.getColorComponents(this.seriesColors[i]);
var newrgb = [rgba[0], rgba[1], rgba[2]];
var sum = newrgb[0] + newrgb[1] + newrgb[2];
for (var j=0; j<3; j++) {
// when darkening, lowest color component can be is 60.
newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.3 * (255 - newrgb[j]);
newrgb[j] = parseInt(newrgb[j], 10);
}
this.highlightColors.push('rgb('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+')');
}
}
this.highlightColorGenerator = new $.jqplot.ColorGenerator(this.highlightColors);
plot.postParseOptionsHooks.addOnce(postParseOptions);
plot.postInitHooks.addOnce(postInit);
plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove);
plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown);
plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp);
plot.eventListenerHooks.addOnce('jqplotClick', handleClick);
plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick);
plot.postDrawHooks.addOnce(postPlotDraw);
};
$.jqplot.PieRenderer.prototype.setGridData = function(plot) {
// set gridData property. This will hold angle in radians of each data point.
var stack = [];
var td = [];
var sa = this.startAngle/180*Math.PI;
var tot = 0;
// don't know if we have any valid data yet, so set plot to not draw.
this._drawData = false;
for (var i=0; i<this.data.length; i++){
if (this.data[i][1] != 0) {
// we have data, O.K. to draw.
this._drawData = true;
if (this.showSlice[i] === undefined) {
this.showSlice[i] = true;
}
}
stack.push(this.data[i][1]);
td.push([this.data[i][0]]);
if (i>0) {
stack[i] += stack[i-1];
}
tot += this.data[i][1];
}
var fact = Math.PI*2/stack[stack.length - 1];
for (var i=0; i<stack.length; i++) {
td[i][1] = stack[i] * fact;
td[i][2] = this.data[i][1]/tot;
}
this.gridData = td;
};
$.jqplot.PieRenderer.prototype.makeGridData = function(data, plot) {
var stack = [];
var td = [];
var tot = 0;
var sa = this.startAngle/180*Math.PI;
// don't know if we have any valid data yet, so set plot to not draw.
this._drawData = false;
for (var i=0; i<data.length; i++){
if (this.data[i][1] != 0) {
// we have data, O.K. to draw.
this._drawData = true;
}
stack.push(data[i][1]);
td.push([data[i][0]]);
if (i>0) {
stack[i] += stack[i-1];
}
tot += data[i][1];
}
var fact = Math.PI*2/stack[stack.length - 1];
for (var i=0; i<stack.length; i++) {
td[i][1] = stack[i] * fact;
td[i][2] = data[i][1]/tot;
}
return td;
};
function calcRadiusAdjustment(ang) {
return Math.sin((ang - (ang-Math.PI) / 8 / Math.PI )/2.0);
}
function calcRPrime(ang1, ang2, sliceMargin, fill, lineWidth) {
var rprime = 0;
var ang = ang2 - ang1;
var absang = Math.abs(ang);
var sm = sliceMargin;
if (fill == false) {
sm += lineWidth;
}
if (sm > 0 && absang > 0.01 && absang < 6.282) {
rprime = parseFloat(sm) / 2.0 / calcRadiusAdjustment(ang);
}
return rprime;
}
$.jqplot.PieRenderer.prototype.drawSlice = function (ctx, ang1, ang2, color, isShadow) {
if (this._drawData) {
var r = this._radius;
var fill = this.fill;
var lineWidth = this.lineWidth;
var sm = this.sliceMargin;
if (this.fill == false) {
sm += this.lineWidth;
}
ctx.save();
ctx.translate(this._center[0], this._center[1]);
var rprime = calcRPrime(ang1, ang2, this.sliceMargin, this.fill, this.lineWidth);
var transx = rprime * Math.cos((ang1 + ang2) / 2.0);
var transy = rprime * Math.sin((ang1 + ang2) / 2.0);
if ((ang2 - ang1) <= Math.PI) {
r -= rprime;
}
else {
r += rprime;
}
ctx.translate(transx, transy);
if (isShadow) {
for (var i=0, l=this.shadowDepth; i<l; i++) {
ctx.save();
ctx.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI), this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI));
doDraw(r);
}
for (var i=0, l=this.shadowDepth; i<l; i++) {
ctx.restore();
}
}
else {
doDraw(r);
}
ctx.restore();
}
function doDraw (rad) {
// Fix for IE and Chrome that can't seem to draw circles correctly.
// ang2 should always be <= 2 pi since that is the way the data is converted.
// 2Pi = 6.2831853, Pi = 3.1415927
if (ang2 > 6.282 + this.startAngle) {
ang2 = 6.282 + this.startAngle;
if (ang1 > ang2) {
ang1 = 6.281 + this.startAngle;
}
}
// Fix for IE, where it can't seem to handle 0 degree angles. Also avoids
// ugly line on unfilled pies.
if (ang1 >= ang2) {
return;
}
ctx.beginPath();
ctx.fillStyle = color;
ctx.strokeStyle = color;
ctx.lineWidth = lineWidth;
ctx.arc(0, 0, rad, ang1, ang2, false);
ctx.lineTo(0,0);
ctx.closePath();
if (fill) {
ctx.fill();
}
else {
ctx.stroke();
}
}
};
// called with scope of series
$.jqplot.PieRenderer.prototype.draw = function (ctx, gd, options, plot) {
var i;
var opts = (options != undefined) ? options : {};
// offset and direction of offset due to legend placement
var offx = 0;
var offy = 0;
var trans = 1;
var colorGenerator = new $.jqplot.ColorGenerator(this.seriesColors);
var sliceColor;
if (options.legendInfo && options.legendInfo.placement == 'insideGrid') {
var li = options.legendInfo;
switch (li.location) {
case 'nw':
offx = li.width + li.xoffset;
break;
case 'w':
offx = li.width + li.xoffset;
break;
case 'sw':
offx = li.width + li.xoffset;
break;
case 'ne':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'e':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'se':
offx = li.width + li.xoffset;
trans = -1;
break;
case 'n':
offy = li.height + li.yoffset;
break;
case 's':
offy = li.height + li.yoffset;
trans = -1;
break;
default:
break;
}
}
var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow;
var fill = (opts.fill != undefined) ? opts.fill : this.fill;
//see http://stackoverflow.com/questions/20221461/hidpi-retina-plot-drawing
var cw = parseInt(ctx.canvas.style.width);
var ch = parseInt(ctx.canvas.style.height);
//
var w = cw - offx - 2 * this.padding;
var h = ch - offy - 2 * this.padding;
var mindim = Math.min(w,h);
var d = mindim;
// Fixes issue #272. Thanks hugwijst!
// reset slice angles array.
this._sliceAngles = [];
var sm = this.sliceMargin;
if (this.fill == false) {
sm += this.lineWidth;
}
var rprime;
var maxrprime = 0;
var ang, ang1, ang2, shadowColor;
var sa = this.startAngle / 180 * Math.PI;
// have to pre-draw shadows, so loop throgh here and calculate some values also.
for (var i=0, l=gd.length; i<l; i++) {
ang1 = (i == 0) ? sa : gd[i-1][1] + sa;
ang2 = gd[i][1] + sa;
this._sliceAngles.push([ang1, ang2]);
rprime = calcRPrime(ang1, ang2, this.sliceMargin, this.fill, this.lineWidth);
if (Math.abs(ang2-ang1) > Math.PI) {
maxrprime = Math.max(rprime, maxrprime);
}
}
if (this.diameter != null && this.diameter > 0) {
this._diameter = this.diameter - 2*maxrprime;
}
else {
this._diameter = d - 2*maxrprime;
}
// Need to check for undersized pie. This can happen if
// plot area too small and legend is too big.
if (this._diameter < 6) {
$.jqplot.log('Diameter of pie too small, not rendering.');
return;
}
var r = this._radius = this._diameter/2;
this._center = [(cw - trans * offx)/2 + trans * offx + maxrprime * Math.cos(sa), (ch - trans*offy)/2 + trans * offy + maxrprime * Math.sin(sa)];
if (this.shadow) {
for (var i=0, l=gd.length; i<l; i++) {
shadowColor = 'rgba(0,0,0,'+this.shadowAlpha+')';
this.renderer.drawSlice.call (this, ctx, this._sliceAngles[i][0], this._sliceAngles[i][1], shadowColor, true);
}
}
for (var i=0; i<gd.length; i++) {
sliceColor = colorGenerator.next();
if (this.showSlice[i]) {
this.renderer.drawSlice.call (this, ctx, this._sliceAngles[i][0], this._sliceAngles[i][1], sliceColor, false);
if (this.showDataLabels && gd[i][2]*100 >= this.dataLabelThreshold) {
var fstr, avgang = (this._sliceAngles[i][0] + this._sliceAngles[i][1])/2, label;
if (this.dataLabels == 'label') {
fstr = this.dataLabelFormatString || '%s';
label = $.jqplot.sprintf(fstr, gd[i][0]);
}
else if (this.dataLabels == 'value') {
fstr = this.dataLabelFormatString || '%d';
label = $.jqplot.sprintf(fstr, this.data[i][1]);
}
else if (this.dataLabels == 'percent') {
fstr = this.dataLabelFormatString || '%d%%';
label = $.jqplot.sprintf(fstr, gd[i][2]*100);
}
else if (this.dataLabels.constructor == Array) {
fstr = this.dataLabelFormatString || '%s';
label = $.jqplot.sprintf(fstr, this.dataLabels[i]);
}
var fact = (this._radius ) * this.dataLabelPositionFactor + this.sliceMargin + this.dataLabelNudge;
var x = this._center[0] + Math.cos(avgang) * fact + this.canvas._offsets.left;
var y = this._center[1] + Math.sin(avgang) * fact + this.canvas._offsets.top;
var labelelem = $('<div class="jqplot-pie-series jqplot-data-label" style="position:absolute;">' + label + '</div>').insertBefore(plot.eventCanvas._elem);
if (this.dataLabelCenterOn) {
x -= labelelem.width()/2;
y -= labelelem.height()/2;
}
else {
x -= labelelem.width() * Math.sin(avgang/2);
y -= labelelem.height()/2;
}
x = Math.round(x);
y = Math.round(y);
labelelem.css({left: x, top: y});
}
}
}
};
$.jqplot.PieAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
};
$.jqplot.PieAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.PieAxisRenderer.prototype.constructor = $.jqplot.PieAxisRenderer;
// There are no traditional axes on a pie chart. We just need to provide
// dummy objects with properties so the plot will render.
// called with scope of axis object.
$.jqplot.PieAxisRenderer.prototype.init = function(options){
//
this.tickRenderer = $.jqplot.PieTickRenderer;
$.extend(true, this, options);
// I don't think I'm going to need _dataBounds here.
// have to go Axis scaling in a way to fit chart onto plot area
// and provide u2p and p2u functionality for mouse cursor, etc.
// for convienence set _dataBounds to 0 and 100 and
// set min/max to 0 and 100.
this._dataBounds = {min:0, max:100};
this.min = 0;
this.max = 100;
this.showTicks = false;
this.ticks = [];
this.showMark = false;
this.show = false;
};
$.jqplot.PieLegendRenderer = function(){
$.jqplot.TableLegendRenderer.call(this);
};
$.jqplot.PieLegendRenderer.prototype = new $.jqplot.TableLegendRenderer();
$.jqplot.PieLegendRenderer.prototype.constructor = $.jqplot.PieLegendRenderer;
/**
* Class: $.jqplot.PieLegendRenderer
* Legend Renderer specific to pie plots. Set by default
* when user creates a pie plot.
*/
$.jqplot.PieLegendRenderer.prototype.init = function(options) {
// Group: Properties
//
// prop: numberRows
// Maximum number of rows in the legend. 0 or null for unlimited.
this.numberRows = null;
// prop: numberColumns
// Maximum number of columns in the legend. 0 or null for unlimited.
this.numberColumns = null;
// prop: width
// Fixed with of legend. 0 or null for auto size
this.width = null;
$.extend(true, this, options);
};
// called with context of legend
$.jqplot.PieLegendRenderer.prototype.draw = function() {
var legend = this;
if (this.show) {
var series = this._series;
this._elem = $(document.createElement('table'));
this._elem.addClass('jqplot-table-legend');
var ss = {position:'absolute'};
if (this.background) {
ss['background'] = this.background;
}
if (this.border) {
ss['border'] = this.border;
}
if (this.fontSize) {
ss['fontSize'] = this.fontSize;
}
if (this.fontFamily) {
ss['fontFamily'] = this.fontFamily;
}
if (this.textColor) {
ss['textColor'] = this.textColor;
}
if (this.marginTop != null) {
ss['marginTop'] = this.marginTop;
}
if (this.marginBottom != null) {
ss['marginBottom'] = this.marginBottom;
}
if (this.marginLeft != null) {
ss['marginLeft'] = this.marginLeft;
}
if (this.marginRight != null) {
ss['marginRight'] = this.marginRight;
}
this._elem.css(ss);
// Pie charts legends don't go by number of series, but by number of data points
// in the series. Refactor things here for that.
var pad = false,
reverse = false,
nr,
nc;
var s = series[0];
var colorGenerator = new $.jqplot.ColorGenerator(s.seriesColors);
if (s.show) {
var pd = s.data;
if (this.numberRows) {
nr = this.numberRows;
if (!this.numberColumns){
nc = Math.ceil(pd.length/nr);
}
else{
nc = this.numberColumns;
}
}
else if (this.numberColumns) {
nc = this.numberColumns;
nr = Math.ceil(pd.length/this.numberColumns);
}
else {
nr = pd.length;
nc = 1;
}
var i, j;
var tr, td1, td2;
var lt, tt, rs, color;
var idx = 0;
var div0, div1;
for (i=0; i<nr; i++) {
tr = $(document.createElement('tr'));
tr.addClass('jqplot-table-legend');
if (reverse){
tr.prependTo(this._elem);
}
else{
tr.appendTo(this._elem);
}
for (j=0; j<nc; j++) {
if (idx < pd.length) {
tt = '';
if (this.labels[idx]) {
lt = this.labels[idx];
}
else {
if (typeof pd[idx][0] === 'object') {
lt = pd[idx][0][0].toString();
tt = pd[idx][0][1].toString();
}
else {
lt = pd[idx][0].toString();
}
}
//lt = this.labels[idx] || pd[idx][0].toString();
color = colorGenerator.next();
if (!reverse){
if (i>0){
pad = true;
}
else{
pad = false;
}
}
else{
if (i == nr -1){
pad = false;
}
else{
pad = true;
}
}
rs = (pad) ? this.rowSpacing : '0';
td1 = $(document.createElement('td'));
td1.addClass('jqplot-table-legend jqplot-table-legend-swatch');
td1.css({textAlign: 'center', paddingTop: rs});
div0 = $(document.createElement('div'));
div0.addClass('jqplot-table-legend-swatch-outline');
if (tt !== '') {
div0.attr("title", tt);
}
div1 = $(document.createElement('div'));
div1.addClass('jqplot-table-legend-swatch');
div1.css({backgroundColor: color, borderColor: color});
td1.append(div0.append(div1));
td2 = $(document.createElement('td'));
td2.addClass('jqplot-table-legend jqplot-table-legend-label');
td2.css('paddingTop', rs);
if (this.escapeHtml){
td2.text(lt);
}
else {
td2.html('<a title="' + tt + '">' + lt + "</a>");
}
if (reverse) {
td2.prependTo(tr);
td1.prependTo(tr);
}
else {
td1.appendTo(tr);
td2.appendTo(tr);
}
pad = true;
}
idx++;
}
}
}
}
return this._elem;
};
$.jqplot.PieRenderer.prototype.handleMove = function(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
plot.target.trigger('jqplotDataMouseOver', ins);
if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.pieRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
plot.target.trigger('jqplotDataHighlight', ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
};
// this.eventCanvas._elem.bind($.jqplot.eventListenerHooks[i][0], {plot:this}, $.jqplot.eventListenerHooks[i][1]);
// setup default renderers for axes and legend so user doesn't have to
// called with scope of plot
function preInit(target, data, options) {
options = options || {};
options.axesDefaults = options.axesDefaults || {};
options.legend = options.legend || {};
options.seriesDefaults = options.seriesDefaults || {};
// only set these if there is a pie series
var setopts = false;
if (options.seriesDefaults.renderer == $.jqplot.PieRenderer) {
setopts = true;
}
else if (options.series) {
for (var i=0; i < options.series.length; i++) {
if (options.series[i].renderer == $.jqplot.PieRenderer) {
setopts = true;
}
}
}
if (setopts) {
options.axesDefaults.renderer = $.jqplot.PieAxisRenderer;
options.legend.renderer = options.legend.renderer || $.jqplot.PieLegendRenderer;
options.legend.preDraw = true;
options.seriesDefaults.pointLabels = {show: false};
}
}
function postInit(target, data, options) {
for (var i=0; i<this.series.length; i++) {
if (this.series[i].renderer.constructor == $.jqplot.PieRenderer) {
// don't allow mouseover and mousedown at same time.
if (this.series[i].highlightMouseOver) {
this.series[i].highlightMouseDown = false;
}
}
}
}
// called with scope of plot
function postParseOptions(options) {
for (var i=0; i<this.series.length; i++) {
this.series[i].seriesColors = this.seriesColors;
this.series[i].colorGenerator = $.jqplot.colorGenerator;
}
}
function highlight (plot, sidx, pidx) {
if (plot.series[sidx].showSlice[pidx]) {
var s = plot.series[sidx];
var canvas = plot.plugins.pieRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0,canvas._ctx.canvas.width, canvas._ctx.canvas.height);
s._highlightedPoint = pidx;
plot.plugins.pieRenderer.highlightedSeriesIndex = sidx;
s.renderer.drawSlice.call(s, canvas._ctx, s._sliceAngles[pidx][0], s._sliceAngles[pidx][1], s.highlightColorGenerator.get(pidx), false);
}
}
function unhighlight (plot) {
var canvas = plot.plugins.pieRenderer.highlightCanvas;
canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height);
for (var i=0; i<plot.series.length; i++) {
plot.series[i]._highlightedPoint = null;
}
plot.plugins.pieRenderer.highlightedSeriesIndex = null;
plot.target.trigger('jqplotDataUnhighlight');
}
function handleMove(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt1 = jQuery.Event('jqplotDataMouseOver');
evt1.pageX = ev.pageX;
evt1.pageY = ev.pageY;
plot.target.trigger(evt1, ins);
if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.pieRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseDown(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.pieRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) {
var evt = jQuery.Event('jqplotDataHighlight');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
highlight (plot, ins[0], ins[1]);
}
}
else if (neighbor == null) {
unhighlight (plot);
}
}
function handleMouseUp(ev, gridpos, datapos, neighbor, plot) {
var idx = plot.plugins.pieRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
}
function handleClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var evt = jQuery.Event('jqplotDataClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
function handleRightClick(ev, gridpos, datapos, neighbor, plot) {
if (neighbor) {
var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data];
var idx = plot.plugins.pieRenderer.highlightedSeriesIndex;
if (idx != null && plot.series[idx].highlightMouseDown) {
unhighlight(plot);
}
var evt = jQuery.Event('jqplotDataRightClick');
evt.which = ev.which;
evt.pageX = ev.pageX;
evt.pageY = ev.pageY;
plot.target.trigger(evt, ins);
}
}
// called within context of plot
// create a canvas which we can draw on.
// insert it before the eventCanvas, so eventCanvas will still capture events.
function postPlotDraw() {
// Memory Leaks patch
if (this.plugins.pieRenderer && this.plugins.pieRenderer.highlightCanvas) {
this.plugins.pieRenderer.highlightCanvas.resetCanvas();
this.plugins.pieRenderer.highlightCanvas = null;
}
this.plugins.pieRenderer = {highlightedSeriesIndex:null};
this.plugins.pieRenderer.highlightCanvas = new $.jqplot.GenericCanvas();
// do we have any data labels? if so, put highlight canvas before those
var labels = $(this.targetId+' .jqplot-data-label');
if (labels.length) {
$(labels[0]).before(this.plugins.pieRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-pieRenderer-highlight-canvas', this._plotDimensions, this));
}
// else put highlight canvas before event canvas.
else {
this.eventCanvas._elem.before(this.plugins.pieRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-pieRenderer-highlight-canvas', this._plotDimensions, this));
}
var hctx = this.plugins.pieRenderer.highlightCanvas.setContext();
this.eventCanvas._elem.bind('mouseleave', {plot:this}, function (ev) { unhighlight(ev.data.plot); });
}
$.jqplot.preInitHooks.push(preInit);
$.jqplot.PieTickRenderer = function() {
$.jqplot.AxisTickRenderer.call(this);
};
$.jqplot.PieTickRenderer.prototype = new $.jqplot.AxisTickRenderer();
$.jqplot.PieTickRenderer.prototype.constructor = $.jqplot.PieTickRenderer;
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,379 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
/**
* Class: $.jqplot.PointLabels
* Plugin for putting labels at the data points.
*
* To use this plugin, include the js
* file in your source:
*
* > <script type="text/javascript" src="plugins/jqplot.pointLabels.js"></script>
*
* By default, the last value in the data ponit array in the data series is used
* for the label. For most series renderers, extra data can be added to the
* data point arrays and the last value will be used as the label.
*
* For instance,
* this series:
*
* > [[1,4], [3,5], [7,2]]
*
* Would, by default, use the y values in the labels.
* Extra data can be added to the series like so:
*
* > [[1,4,'mid'], [3 5,'hi'], [7,2,'low']]
*
* And now the point labels would be 'mid', 'low', and 'hi'.
*
* Options to the point labels and a custom labels array can be passed into the
* "pointLabels" option on the series option like so:
*
* > series:[{pointLabels:{
* > labels:['mid', 'hi', 'low'],
* > location:'se',
* > ypadding: 12
* > }
* > }]
*
* A custom labels array in the options takes precendence over any labels
* in the series data. If you have a custom labels array in the options,
* but still want to use values from the series array as labels, set the
* "labelsFromSeries" option to true.
*
* By default, html entities (<, >, etc.) are escaped in point labels.
* If you want to include actual html markup in the labels,
* set the "escapeHTML" option to false.
*
*/
$.jqplot.PointLabels = function(options) {
// Group: Properties
//
// prop: show
// show the labels or not.
this.show = $.jqplot.config.enablePlugins;
// prop: location
// compass location where to position the label around the point.
// 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw'
this.location = 'n';
// prop: labelsFromSeries
// true to use labels within data point arrays.
this.labelsFromSeries = false;
// prop: seriesLabelIndex
// array index for location of labels within data point arrays.
// if null, will use the last element of the data point array.
this.seriesLabelIndex = null;
// prop: labels
// array of arrays of labels, one array for each series.
this.labels = [];
// actual labels that will get displayed.
// needed to preserve user specified labels in labels array.
this._labels = [];
// prop: stackedValue
// true to display value as stacked in a stacked plot.
// no effect if labels is specified.
this.stackedValue = false;
// prop: ypadding
// vertical padding in pixels between point and label
this.ypadding = 6;
// prop: xpadding
// horizontal padding in pixels between point and label
this.xpadding = 6;
// prop: escapeHTML
// true to escape html entities in the labels.
// If you want to include markup in the labels, set to false.
this.escapeHTML = true;
// prop: edgeTolerance
// Number of pixels that the label must be away from an axis
// boundary in order to be drawn. Negative values will allow overlap
// with the grid boundaries.
this.edgeTolerance = -5;
// prop: formatter
// A class of a formatter for the tick text. sprintf by default.
this.formatter = $.jqplot.DefaultTickFormatter;
// prop: formatString
// string passed to the formatter.
this.formatString = '';
// prop: hideZeros
// true to not show a label for a value which is 0.
this.hideZeros = false;
this._elems = [];
$.extend(true, this, options);
};
var locations = ['nw', 'n', 'ne', 'e', 'se', 's', 'sw', 'w'];
var locationIndicies = {'nw':0, 'n':1, 'ne':2, 'e':3, 'se':4, 's':5, 'sw':6, 'w':7};
var oppositeLocations = ['se', 's', 'sw', 'w', 'nw', 'n', 'ne', 'e'];
// called with scope of a series
$.jqplot.PointLabels.init = function (target, data, seriesDefaults, opts, plot){
var options = $.extend(true, {}, seriesDefaults, opts);
options.pointLabels = options.pointLabels || {};
if (this.renderer.constructor === $.jqplot.BarRenderer && this.barDirection === 'horizontal' && !options.pointLabels.location) {
options.pointLabels.location = 'e';
}
// add a pointLabels attribute to the series plugins
this.plugins.pointLabels = new $.jqplot.PointLabels(options.pointLabels);
this.plugins.pointLabels.setLabels.call(this);
};
// called with scope of series
$.jqplot.PointLabels.prototype.setLabels = function() {
var p = this.plugins.pointLabels;
var labelIdx;
if (p.seriesLabelIndex != null) {
labelIdx = p.seriesLabelIndex;
}
else if (this.renderer.constructor === $.jqplot.BarRenderer && this.barDirection === 'horizontal') {
labelIdx = (this._plotData[0].length < 3) ? 0 : this._plotData[0].length -1;
}
else {
labelIdx = (this._plotData.length === 0) ? 0 : this._plotData[0].length -1;
}
p._labels = [];
if (p.labels.length === 0 || p.labelsFromSeries) {
if (p.stackedValue) {
if (this._plotData.length && this._plotData[0].length){
// var idx = p.seriesLabelIndex || this._plotData[0].length -1;
for (var i=0; i<this._plotData.length; i++) {
p._labels.push(this._plotData[i][labelIdx]);
}
}
}
else {
// var d = this._plotData;
var d = this.data;
if (this.renderer.constructor === $.jqplot.BarRenderer && this.waterfall) {
d = this._data;
}
if (d.length && d[0].length) {
// var idx = p.seriesLabelIndex || d[0].length -1;
for (var i=0; i<d.length; i++) {
p._labels.push(d[i][labelIdx]);
}
}
d = null;
}
}
else if (p.labels.length){
p._labels = p.labels;
}
};
$.jqplot.PointLabels.prototype.xOffset = function(elem, location, padding) {
location = location || this.location;
padding = padding || this.xpadding;
var offset;
switch (location) {
case 'nw':
offset = -elem.outerWidth(true) - this.xpadding;
break;
case 'n':
offset = -elem.outerWidth(true)/2;
break;
case 'ne':
offset = this.xpadding;
break;
case 'e':
offset = this.xpadding;
break;
case 'se':
offset = this.xpadding;
break;
case 's':
offset = -elem.outerWidth(true)/2;
break;
case 'sw':
offset = -elem.outerWidth(true) - this.xpadding;
break;
case 'w':
offset = -elem.outerWidth(true) - this.xpadding;
break;
default: // same as 'nw'
offset = -elem.outerWidth(true) - this.xpadding;
break;
}
return offset;
};
$.jqplot.PointLabels.prototype.yOffset = function(elem, location, padding) {
location = location || this.location;
padding = padding || this.xpadding;
var offset;
switch (location) {
case 'nw':
offset = -elem.outerHeight(true) - this.ypadding;
break;
case 'n':
offset = -elem.outerHeight(true) - this.ypadding;
break;
case 'ne':
offset = -elem.outerHeight(true) - this.ypadding;
break;
case 'e':
offset = -elem.outerHeight(true)/2;
break;
case 'se':
offset = this.ypadding;
break;
case 's':
offset = this.ypadding;
break;
case 'sw':
offset = this.ypadding;
break;
case 'w':
offset = -elem.outerHeight(true)/2;
break;
default: // same as 'nw'
offset = -elem.outerHeight(true) - this.ypadding;
break;
}
return offset;
};
// called with scope of series
$.jqplot.PointLabels.draw = function (sctx, options, plot) {
var p = this.plugins.pointLabels;
// set labels again in case they have changed.
p.setLabels.call(this);
// remove any previous labels
for (var i=0; i<p._elems.length; i++) {
// Memory Leaks patch
// p._elems[i].remove();
if(p._elems[i]) {
p._elems[i].emptyForce();
}
}
p._elems.splice(0, p._elems.length);
if (p.show) {
var ax = '_'+this._stackAxis+'axis';
if (!p.formatString) {
p.formatString = this[ax]._ticks[0].formatString;
p.formatter = this[ax]._ticks[0].formatter;
}
var pd = this._plotData;
var ppd = this._prevPlotData;
var xax = this._xaxis;
var yax = this._yaxis;
var elem, helem;
for (var i=0, l=p._labels.length; i < l; i++) {
var label = p._labels[i];
if (label == null || (p.hideZeros && parseFloat(label) == 0)) {
continue;
}
label = p.formatter(p.formatString, label);
helem = document.createElement('div');
p._elems[i] = $(helem);
elem = p._elems[i];
elem.addClass('jqplot-point-label jqplot-series-'+this.index+' jqplot-point-'+i);
elem.css('position', 'absolute');
elem.insertAfter(sctx.canvas);
if (p.escapeHTML) {
elem.text(label);
}
else {
elem.html(label);
}
var location = p.location;
if ((this.fillToZero && pd[i][1] < 0) || (this.fillToZero && this._type === 'bar' && this.barDirection === 'horizontal' && pd[i][0] < 0) || (this.waterfall && parseInt(label, 10)) < 0) {
location = oppositeLocations[locationIndicies[location]];
}
var ell = xax.u2p(pd[i][0]) + p.xOffset(elem, location);
var elt = yax.u2p(pd[i][1]) + p.yOffset(elem, location);
// we have stacked chart but are not showing stacked values,
// place labels in center.
if (this._stack && !p.stackedValue) {
if (this.barDirection === "vertical") {
elt = (this._barPoints[i][0][1] + this._barPoints[i][1][1]) / 2 + plot._gridPadding.top - 0.5 * elem.outerHeight(true);
}
else {
ell = (this._barPoints[i][2][0] + this._barPoints[i][0][0]) / 2 + plot._gridPadding.left - 0.5 * elem.outerWidth(true);
}
}
if (this.renderer.constructor == $.jqplot.BarRenderer) {
if (this.barDirection == "vertical") {
ell += this._barNudge;
}
else {
elt -= this._barNudge;
}
}
elem.css('left', ell);
elem.css('top', elt);
var elr = ell + elem.width();
var elb = elt + elem.height();
var et = p.edgeTolerance;
var scl = $(sctx.canvas).position().left;
var sct = $(sctx.canvas).position().top;
var scr = sctx.canvas.width + scl;
var scb = sctx.canvas.height + sct;
// if label is outside of allowed area, remove it
if (ell - et < scl || elt - et < sct || elr + et > scr || elb + et > scb) {
elem.remove();
}
elem = null;
helem = null;
}
// finally, animate them if the series is animated
// if (this.renderer.animation && this.renderer.animation._supported && this.renderer.animation.show && plot._drawCount < 2) {
// var sel = '.jqplot-point-label.jqplot-series-'+this.index;
// $(sel).hide();
// $(sel).fadeIn(1000);
// }
}
};
$.jqplot.postSeriesInitHooks.push($.jqplot.PointLabels.init);
$.jqplot.postDrawSeriesHooks.push($.jqplot.PointLabels.draw);
})(jQuery);

View File

@ -1,3 +0,0 @@
/* jqPlot 1.0.8r1250 | (c) 2009-2013 Chris Leonello | jplot.com
jsDate | (c) 2010-2013 Chris Leonello
*/(function(c){c.jqplot.PointLabels=function(e){this.show=c.jqplot.config.enablePlugins;this.location="n";this.labelsFromSeries=false;this.seriesLabelIndex=null;this.labels=[];this._labels=[];this.stackedValue=false;this.ypadding=6;this.xpadding=6;this.escapeHTML=true;this.edgeTolerance=-5;this.formatter=c.jqplot.DefaultTickFormatter;this.formatString="";this.hideZeros=false;this._elems=[];c.extend(true,this,e)};var a=["nw","n","ne","e","se","s","sw","w"];var d={nw:0,n:1,ne:2,e:3,se:4,s:5,sw:6,w:7};var b=["se","s","sw","w","nw","n","ne","e"];c.jqplot.PointLabels.init=function(j,h,f,g,i){var e=c.extend(true,{},f,g);e.pointLabels=e.pointLabels||{};if(this.renderer.constructor===c.jqplot.BarRenderer&&this.barDirection==="horizontal"&&!e.pointLabels.location){e.pointLabels.location="e"}this.plugins.pointLabels=new c.jqplot.PointLabels(e.pointLabels);this.plugins.pointLabels.setLabels.call(this)};c.jqplot.PointLabels.prototype.setLabels=function(){var f=this.plugins.pointLabels;var h;if(f.seriesLabelIndex!=null){h=f.seriesLabelIndex}else{if(this.renderer.constructor===c.jqplot.BarRenderer&&this.barDirection==="horizontal"){h=(this._plotData[0].length<3)?0:this._plotData[0].length-1}else{h=(this._plotData.length===0)?0:this._plotData[0].length-1}}f._labels=[];if(f.labels.length===0||f.labelsFromSeries){if(f.stackedValue){if(this._plotData.length&&this._plotData[0].length){for(var e=0;e<this._plotData.length;e++){f._labels.push(this._plotData[e][h])}}}else{var g=this.data;if(this.renderer.constructor===c.jqplot.BarRenderer&&this.waterfall){g=this._data}if(g.length&&g[0].length){for(var e=0;e<g.length;e++){f._labels.push(g[e][h])}}g=null}}else{if(f.labels.length){f._labels=f.labels}}};c.jqplot.PointLabels.prototype.xOffset=function(f,e,g){e=e||this.location;g=g||this.xpadding;var h;switch(e){case"nw":h=-f.outerWidth(true)-this.xpadding;break;case"n":h=-f.outerWidth(true)/2;break;case"ne":h=this.xpadding;break;case"e":h=this.xpadding;break;case"se":h=this.xpadding;break;case"s":h=-f.outerWidth(true)/2;break;case"sw":h=-f.outerWidth(true)-this.xpadding;break;case"w":h=-f.outerWidth(true)-this.xpadding;break;default:h=-f.outerWidth(true)-this.xpadding;break}return h};c.jqplot.PointLabels.prototype.yOffset=function(f,e,g){e=e||this.location;g=g||this.xpadding;var h;switch(e){case"nw":h=-f.outerHeight(true)-this.ypadding;break;case"n":h=-f.outerHeight(true)-this.ypadding;break;case"ne":h=-f.outerHeight(true)-this.ypadding;break;case"e":h=-f.outerHeight(true)/2;break;case"se":h=this.ypadding;break;case"s":h=this.ypadding;break;case"sw":h=this.ypadding;break;case"w":h=-f.outerHeight(true)/2;break;default:h=-f.outerHeight(true)-this.ypadding;break}return h};c.jqplot.PointLabels.draw=function(x,j,v){var t=this.plugins.pointLabels;t.setLabels.call(this);for(var w=0;w<t._elems.length;w++){t._elems[w].emptyForce()}t._elems.splice(0,t._elems.length);if(t.show){var r="_"+this._stackAxis+"axis";if(!t.formatString){t.formatString=this[r]._ticks[0].formatString;t.formatter=this[r]._ticks[0].formatter}var E=this._plotData;var D=this._prevPlotData;var A=this._xaxis;var q=this._yaxis;var z,f;for(var w=0,u=t._labels.length;w<u;w++){var o=t._labels[w];if(o==null||(t.hideZeros&&parseInt(o,10)==0)){continue}o=t.formatter(t.formatString,o);f=document.createElement("div");t._elems[w]=c(f);z=t._elems[w];z.addClass("jqplot-point-label jqplot-series-"+this.index+" jqplot-point-"+w);z.css("position","absolute");z.insertAfter(x.canvas);if(t.escapeHTML){z.text(o)}else{z.html(o)}var g=t.location;if((this.fillToZero&&E[w][1]<0)||(this.fillToZero&&this._type==="bar"&&this.barDirection==="horizontal"&&E[w][0]<0)||(this.waterfall&&parseInt(o,10))<0){g=b[d[g]]}var n=A.u2p(E[w][0])+t.xOffset(z,g);var h=q.u2p(E[w][1])+t.yOffset(z,g);if(this._stack&&!t.stackedValue){if(this.barDirection==="vertical"){h=(this._barPoints[w][0][1]+this._barPoints[w][1][1])/2+v._gridPadding.top-0.5*z.outerHeight(true)}else{n=(this._barPoints[w][2][0]+this._barPoints[w][0][0])/2+v._gridPadding.left-0.5*z.outerWidth(true)}}if(this.renderer.constructor==c.jqplot.BarRenderer){if(this.barDirection=="vertical"){n+=this._barNudge}else{h-=this._barNudge}}z.css("left",n);z.css("top",h);var k=n+z.width();var s=h+z.height();var C=t.edgeTolerance;var e=c(x.canvas).position().left;var y=c(x.canvas).position().top;var B=x.canvas.width+e;var m=x.canvas.height+y;if(n-C<e||h-C<y||k+C>B||s+C>m){z.remove()}z=null;f=null}}};c.jqplot.postSeriesInitHooks.push(c.jqplot.PointLabels.init);c.jqplot.postDrawSeriesHooks.push(c.jqplot.PointLabels.draw)})(jQuery);

View File

@ -0,0 +1,728 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
$.jqplot.PyramidAxisRenderer = function() {
$.jqplot.LinearAxisRenderer.call(this);
};
$.jqplot.PyramidAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer();
$.jqplot.PyramidAxisRenderer.prototype.constructor = $.jqplot.PyramidAxisRenderer;
// called with scope of axis
$.jqplot.PyramidAxisRenderer.prototype.init = function(options){
// Group: Properties
//
// prop: position
// Position of axis. Values are: top, bottom , left, center, right.
// By default, x and x2 axes are bottom, y axis is center.
this.position = null;
// prop: drawBaseline
// True to draw the axis baseline.
this.drawBaseline = true;
// prop: baselineWidth
// width of the baseline in pixels.
this.baselineWidth = null;
// prop: baselineColor
// CSS color spec for the baseline.
this.baselineColor = null;
this.tickSpacingFactor = 25;
this._type = 'pyramid';
this._splitAxis = false;
this._splitLength = null;
this.category = false;
this._autoFormatString = '';
this._overrideFormatString = false;
$.extend(true, this, options);
this.renderer.options = options;
this.resetDataBounds = this.renderer.resetDataBounds;
this.resetDataBounds();
};
$.jqplot.PyramidAxisRenderer.prototype.resetDataBounds = function() {
// Go through all the series attached to this axis and find
// the min/max bounds for this axis.
var db = this._dataBounds;
db.min = null;
db.max = null;
var temp;
for (var i=0; i<this._series.length; i++) {
var s = this._series[i];
var d = s._plotData;
for (var j=0, l=d.length; j<l; j++) {
if (this.name.charAt(0) === 'x') {
temp = d[j][1];
if ((temp !== null && temp < db.min) || db.min === null) {
db.min = temp;
}
if ((temp !== null && temp > db.max) || db.max === null) {
db.max = temp;
}
}
else {
temp = d[j][0];
if ((temp !== null && temp < db.min) || db.min === null) {
db.min = temp;
}
if ((temp !== null && temp > db.max) || db.max === null) {
db.max = temp;
}
}
}
}
};
// called with scope of axis
$.jqplot.PyramidAxisRenderer.prototype.draw = function(ctx, plot) {
if (this.show) {
// populate the axis label and value properties.
// createTicks is a method on the renderer, but
// call it within the scope of the axis.
this.renderer.createTicks.call(this, plot);
// fill a div with axes labels in the right direction.
// Need to pregenerate each axis to get its bounds and
// position it and the labels correctly on the plot.
var dim=0;
var temp;
// Added for theming.
if (this._elem) {
// Memory Leaks patch
//this._elem.empty();
this._elem.emptyForce();
this._elem = null;
}
this._elem = $(document.createElement('div'));
this._elem.addClass('jqplot-axis jqplot-'+this.name);
this._elem.css('position', 'absolute');
if (this.name == 'xaxis' || this.name == 'x2axis') {
this._elem.width(this._plotDimensions.width);
}
else {
this._elem.height(this._plotDimensions.height);
}
// create a _label object.
this.labelOptions.axis = this.name;
this._label = new this.labelRenderer(this.labelOptions);
if (this._label.show) {
var elem = this._label.draw(ctx, plot);
elem.appendTo(this._elem);
elem = null;
}
var t = this._ticks;
var tick;
for (var i=0; i<t.length; i++) {
tick = t[i];
if (tick.show && tick.showLabel && (!tick.isMinorTick)) {
this._elem.append(tick.draw(ctx, plot));
}
}
tick = null;
t = null;
}
return this._elem;
};
// Note, primes can be found on http://primes.utm.edu/
var _primes = [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97, 101, 103, 107, 109, 113, 127, 131, 137, 139, 149, 151, 157, 163, 167, 173, 179, 181, 191, 193, 197, 199, 211, 223, 227, 229, 233, 239, 241, 251, 257, 263, 269, 271, 277, 281, 283, 293, 307, 311, 313, 317, 331, 337, 347, 349, 353, 359, 367, 373, 379, 383, 389, 397, 401, 409, 419, 421, 431, 433, 439, 443, 449, 457, 461, 463, 467, 479, 487, 491, 499, 503, 509, 521, 523, 541, 547, 557, 563, 569, 571, 577, 587, 593, 599, 601, 607, 613, 617, 619, 631, 641, 643, 647, 653, 659, 661, 673, 677, 683, 691, 701, 709, 719, 727, 733, 739, 743, 751, 757, 761, 769, 773, 787, 797, 809, 811, 821, 823, 827, 829, 839, 853, 857, 859, 863, 877, 881, 883, 887, 907, 911, 919, 929, 937, 941, 947, 953, 967, 971, 977, 983, 991, 997];
var _primesHash = {};
for (var i =0, l = _primes.length; i < l; i++) {
_primesHash[_primes[i]] = _primes[i];
}
// called with scope of axis
$.jqplot.PyramidAxisRenderer.prototype.createTicks = function(plot) {
// we're are operating on an axis here
var userTicks = this.ticks;
// databounds were set on axis initialization.
var db = this._dataBounds;
var dim;
var interval;
var min;
var max;
var range;
var pos1;
var pos2;
var tt;
var i;
var l;
var s;
// get a copy of user's settings for min/max.
var userMin = this.min;
var userMax = this.max;
var ut;
var t;
var threshold;
var tdim;
var scalefact;
var ret;
var tumin;
var tumax;
var maxVisibleTicks;
var val;
var skip = null;
var temp;
// if we already have ticks, use them.
// ticks must be in order of increasing value.
if (userTicks.length) {
// ticks could be 1D or 2D array of [val, val, ,,,] or [[val, label], [val, label], ...] or mixed
for (i=0, l=userTicks.length; i<l; i++){
ut = userTicks[i];
t = new this.tickRenderer(this.tickOptions);
if ($.isArray(ut)) {
t.value = ut[0];
t.label = ut[1];
t.setTick(ut[0], this.name);
this._ticks.push(t);
}
else if ($.isPlainObject(ut)) {
$.extend(true, t, ut);
t.axis = this.name;
this._ticks.push(t);
}
else {
if (typeof ut === 'string') {
val = i + plot.defaultAxisStart;
}
else {
val = ut;
}
t.value = val;
t.label = ut;
t.axis = this.name;
this._ticks.push(t);
}
}
this.numberTicks = userTicks.length;
this.min = this._ticks[0].value;
this.max = this._ticks[this.numberTicks-1].value;
this.tickInterval = (this.max - this.min) / (this.numberTicks - 1);
// use user specified tickInterval if there is one
if (this._options.tickInterval) {
// hide every tick except for ticks on interval
var ti = this._options.tickInterval;
for (i=0; i<this.numberTicks; i++) {
if (i%ti !== 0) {
// this._ticks[i].show = false;
this._ticks[i].isMinorTick = true;
}
}
}
else {
// check if we have too many ticks
dim = (this.name.charAt(0) === 'x') ? this._plotDimensions.width : this._plotDimensions.height;
maxVisibleTicks = Math.round(2.0 + dim/this.tickSpacingFactor);
if (this.numberTicks > maxVisibleTicks) {
// check for number of ticks we can skip
temp = this.numberTicks - 1;
for (i=2; i<temp; i++) {
if (temp % i === 0 && temp/i < maxVisibleTicks) {
skip = i-1;
break;
}
}
if (skip !== null) {
var count = 1;
for (i=1, l=this._ticks.length; i<l; i++) {
if (count <= skip) {
this._ticks[i].show = false;
count += 1;
}
else {
count = 1;
}
}
}
}
}
// if category style, add minor ticks in between
temp = [];
if (this.category) {
// turn off gridline and mark on first tick
this._ticks[0].showGridline = false;
this._ticks[0].showMark = false;
for (i=this._ticks.length-1; i>0; i--) {
t = new this.tickRenderer(this.tickOptions);
t.value = this._ticks[i-1].value + this.tickInterval/2.0;
t.label = '';
t.showLabel = false;
t.axis = this.name;
this._ticks[i].showGridline = false;
this._ticks[i].showMark = false;
this._ticks.splice(i, 0, t);
// temp.push(t);
}
// merge in the new ticks
// for (i=1, l=temp.length; i<l; i++) {
// this._ticks.splice(i, 0, temp[i]);
// }
// now add a tick at beginning and end
t = new this.tickRenderer(this.tickOptions);
t.value = this._ticks[0].value - this.tickInterval/2.0;
t.label = '';
t.showLabel = false;
t.axis = this.name;
this._ticks.unshift(t);
t = new this.tickRenderer(this.tickOptions);
t.value = this._ticks[this._ticks.length-1].value + this.tickInterval/2.0;
t.label = '';
t.showLabel = false;
t.axis = this.name;
this._ticks.push(t);
this.tickInterval = this.tickInterval / 2.0;
this.numberTicks = this._ticks.length;
this.min = this._ticks[0].value;
this.max = this._ticks[this._ticks.length-1].value;
}
}
// we don't have any ticks yet, let's make some!
else {
if (this.name.charAt(0) === 'x') {
dim = this._plotDimensions.width;
// make sure x axis is symetric about 0.
var tempmax = Math.max(db.max, Math.abs(db.min));
var tempmin = Math.min(db.min, -tempmax);
// min = ((this.min != null) ? this.min : tempmin);
// max = ((this.max != null) ? this.max : tempmax);
min = tempmin;
max = tempmax;
range = max - min;
if (this.tickOptions == null || !this.tickOptions.formatString) {
this._overrideFormatString = true;
}
threshold = 30;
tdim = Math.max(dim, threshold+1);
scalefact = (tdim-threshold)/300.0;
ret = $.jqplot.LinearTickGenerator(min, max, scalefact);
// calculate a padded max and min, points should be less than these
// so that they aren't too close to the edges of the plot.
// User can adjust how much padding is allowed with pad, padMin and PadMax options.
tumin = min + range*(this.padMin - 1);
tumax = max - range*(this.padMax - 1);
if (min < tumin || max > tumax) {
tumin = min - range*(this.padMin - 1);
tumax = max + range*(this.padMax - 1);
ret = $.jqplot.LinearTickGenerator(tumin, tumax, scalefact);
}
this.min = ret[0];
this.max = ret[1];
this.numberTicks = ret[2];
this._autoFormatString = ret[3];
this.tickInterval = ret[4];
}
else {
dim = this._plotDimensions.height;
// ticks will be on whole integers like 1, 2, 3, ... or 1, 4, 7, ...
min = db.min;
max = db.max;
s = this._series[0];
this._ticks = [];
range = max - min;
// if range is a prime, will get only 2 ticks, expand range in that case.
if (_primesHash[range]) {
range += 1;
max += 1;
}
this.max = max;
this.min = min;
maxVisibleTicks = Math.round(2.0 + dim/this.tickSpacingFactor);
if (range + 1 <= maxVisibleTicks) {
this.numberTicks = range + 1;
this.tickInterval = 1.0;
}
else {
// figure out a round number of ticks to skip in every interval
// range / ti + 1 = nt
// ti = range / (nt - 1)
for (var i=maxVisibleTicks; i>1; i--) {
if (range/(i - 1) === Math.round(range/(i - 1))) {
this.numberTicks = i;
this.tickInterval = range/(i - 1);
break;
}
}
}
}
if (this._overrideFormatString && this._autoFormatString != '') {
this.tickOptions = this.tickOptions || {};
this.tickOptions.formatString = this._autoFormatString;
}
var labelval;
for (i=0; i<this.numberTicks; i++) {
this.tickOptions.axis = this.name;
labelval = this.min + this.tickInterval * i;
if (this.name.charAt(0) === 'x') {
labelval = Math.abs(labelval);
}
// this.tickOptions.label = String (labelval);
this.tickOptions.value = this.min + this.tickInterval * i;
t = new this.tickRenderer(this.tickOptions);
t.label = t.prefix + t.formatter(t.formatString, labelval);
this._ticks.push(t);
// for x axis, if y axis is in middle, add a symetrical 0 tick
if (this.name.charAt(0) === 'x' && plot.axes.yMidAxis.show && this.tickOptions.value === 0) {
this._splitAxis = true;
this._splitLength = plot.axes.yMidAxis.getWidth();
// t.value = -this.max/2000.0;
t = new this.tickRenderer(this.tickOptions);
this._ticks.push(t);
t.value = this.max/2000.0;
}
}
t = null;
}
};
// called with scope of axis
$.jqplot.PyramidAxisRenderer.prototype.set = function() {
var dim = 0;
var temp;
var w = 0;
var h = 0;
var i;
var t;
var tick;
var lshow = (this._label == null) ? false : this._label.show;
if (this.show) {
t = this._ticks;
l = t.length;
for (i=0; i<l; i++) {
tick = t[i];
if (!tick._breakTick && tick.show && tick.showLabel && !tick.isMinorTick) {
if (this.name.charAt(0) === 'x') {
temp = tick._elem.outerHeight(true);
}
else {
temp = tick._elem.outerWidth(true);
}
if (temp > dim) {
dim = temp;
}
}
}
if (this.name === 'yMidAxis') {
for (i=0; i<l; i++) {
tick = t[i];
if (tick._elem) {
temp = (dim - tick._elem.outerWidth(true))/2.0;
tick._elem.css('left', temp);
}
}
}
tick = null;
t = null;
if (lshow) {
w = this._label._elem.outerWidth(true);
h = this._label._elem.outerHeight(true);
}
if (this.name === 'xaxis') {
dim = dim + h;
this._elem.css({'height':dim+'px', left:'0px', bottom:'0px'});
}
else if (this.name === 'x2axis') {
dim = dim + h;
this._elem.css({'height':dim+'px', left:'0px', top:'0px'});
}
else if (this.name === 'yaxis') {
dim = dim + w;
this._elem.css({'width':dim+'px', left:'0px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css('width', w+'px');
}
}
else if (this.name === 'yMidAxis') {
// don't include width of label at all in width of axis?
// dim = (dim > w) ? dim : w;
var temp = dim/2.0 - w/2.0;
this._elem.css({'width':dim+'px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css({width: w, left: temp, top: 0});
}
}
else {
dim = dim + w;
this._elem.css({'width':dim+'px', right:'0px', top:'0px'});
if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) {
this._label._elem.css('width', w+'px');
}
}
}
};
$.jqplot.PyramidAxisRenderer.prototype.pack = function(pos, offsets) {
// Add defaults for repacking from resetTickValues function.
pos = pos || {};
offsets = offsets || this._offsets;
var ticks = this._ticks;
var max = this.max;
var min = this.min;
var offmax = offsets.max;
var offmin = offsets.min;
var lshow = (this._label == null) ? false : this._label.show;
for (var p in pos) {
this._elem.css(p, pos[p]);
}
this._offsets = offsets;
// pixellength will be + for x axes and - for y axes becasue pixels always measured from top left.
var pixellength = offmax - offmin;
var unitlength = max - min;
var sl = this._splitLength;
// point to unit and unit to point conversions references to Plot DOM element top left corner.
if (this._splitAxis) {
pixellength -= this._splitLength;
// don't know that this one is correct.
this.p2u = function(p){
return (p - offmin) * unitlength / pixellength + min;
};
this.u2p = function(u){
if (u <= 0) {
return (u - min) * pixellength / unitlength + offmin;
}
else {
return (u - min) * pixellength / unitlength + offmin + sl;
}
};
this.series_u2p = function(u){
if (u <= 0) {
return (u - min) * pixellength / unitlength;
}
else {
return (u - min) * pixellength / unitlength + sl;
}
};
// don't know that this one is correct.
this.series_p2u = function(p){
return p * unitlength / pixellength + min;
};
}
else {
this.p2u = function(p){
return (p - offmin) * unitlength / pixellength + min;
};
this.u2p = function(u){
return (u - min) * pixellength / unitlength + offmin;
};
if (this.name.charAt(0) === 'x'){
this.series_u2p = function(u){
return (u - min) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + min;
};
}
else {
this.series_u2p = function(u){
return (u - max) * pixellength / unitlength;
};
this.series_p2u = function(p){
return p * unitlength / pixellength + max;
};
}
}
if (this.show) {
if (this.name.charAt(0) === 'x') {
for (var i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
// will need to adjust auto positioning based on which axis this is.
var temp = (this.name == 'xaxis') ? 1 : -1;
switch (t.labelPosition) {
case 'auto':
// position at end
if (temp * t.angle < 0) {
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
}
// position at start
else {
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
}
break;
case 'end':
shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
case 'start':
shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
break;
case 'middle':
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
default:
shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
break;
}
}
else {
shim = -t.getWidth()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('left', val);
t.pack();
}
}
if (lshow) {
var w = this._label._elem.outerWidth(true);
this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px');
if (this.name == 'xaxis') {
this._label._elem.css('bottom', '0px');
}
else {
this._label._elem.css('top', '0px');
}
this._label.pack();
}
}
else {
for (var i=0; i<ticks.length; i++) {
var t = ticks[i];
if (t.show && t.showLabel && !t.isMinorTick) {
var shim;
if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) {
// will need to adjust auto positioning based on which axis this is.
var temp = (this.name == 'yaxis') ? 1 : -1;
switch (t.labelPosition) {
case 'auto':
// position at end
case 'end':
if (temp * t.angle < 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'start':
if (t.angle > 0) {
shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2;
}
else {
shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2;
}
break;
case 'middle':
// if (t.angle > 0) {
// shim = -t.getHeight()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2;
// }
// else {
// shim = -t.getHeight()/2 - t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2;
// }
shim = -t.getHeight()/2;
break;
default:
shim = -t.getHeight()/2;
break;
}
}
else {
shim = -t.getHeight()/2;
}
var val = this.u2p(t.value) + shim + 'px';
t._elem.css('top', val);
t.pack();
}
}
if (lshow) {
var h = this._label._elem.outerHeight(true);
if (this.name !== 'yMidAxis') {
this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px');
}
if (this.name == 'yaxis') {
this._label._elem.css('left', '0px');
}
else if (this.name !== 'yMidAxis') {
this._label._elem.css('right', '0px');
}
this._label.pack();
}
}
}
ticks = null;
};
})(jQuery);

File diff suppressed because one or more lines are too long

View File

@ -0,0 +1,429 @@
/**
* jqPlot
* Pure JavaScript plotting plugin using jQuery
*
* Version: 1.0.9
* Revision: d96a669
*
* Copyright (c) 2009-2016 Chris Leonello
* jqPlot is currently available for use in all personal or commercial projects
* under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL
* version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can
* choose the license that best suits your project and use it accordingly.
*
* Although not required, the author would appreciate an email letting him
* know of any substantial use of jqPlot. You can reach the author at:
* chris at jqplot dot com or see http://www.jqplot.com/info.php .
*
* If you are feeling kind and generous, consider supporting the project by
* making a donation at: http://www.jqplot.com/donate.php .
*
* sprintf functions contained in jqplot.sprintf.js by Ash Searle:
*
* version 2007.04.27
* author Ash Searle
* http://hexmen.com/blog/2007/03/printf-sprintf/
* http://hexmen.com/js/sprintf.js
* The author (Ash Searle) has placed this code in the public domain:
* "This code is unrestricted: you are free to use it however you like."
*
*/
(function($) {
// Class: $.jqplot.CanvasGridRenderer
// The default jqPlot grid renderer, creating a grid on a canvas element.
// The renderer has no additional options beyond the <Grid> class.
$.jqplot.PyramidGridRenderer = function(){
$.jqplot.CanvasGridRenderer.call(this);
};
$.jqplot.PyramidGridRenderer.prototype = new $.jqplot.CanvasGridRenderer();
$.jqplot.PyramidGridRenderer.prototype.constructor = $.jqplot.PyramidGridRenderer;
// called with context of Grid object
$.jqplot.CanvasGridRenderer.prototype.init = function(options) {
this._ctx;
this.plotBands = {
show: false,
color: 'rgb(230, 219, 179)',
axis: 'y',
start: null,
interval: 10
};
$.extend(true, this, options);
// set the shadow renderer options
var sopts = {lineJoin:'miter', lineCap:'round', fill:false, isarc:false, angle:this.shadowAngle, offset:this.shadowOffset, alpha:this.shadowAlpha, depth:this.shadowDepth, lineWidth:this.shadowWidth, closePath:false, strokeStyle:this.shadowColor};
this.renderer.shadowRenderer.init(sopts);
};
$.jqplot.PyramidGridRenderer.prototype.draw = function() {
this._ctx = this._elem.get(0).getContext("2d");
var ctx = this._ctx;
var axes = this._axes;
var xp = axes.xaxis.u2p;
var yp = axes.yMidAxis.u2p;
var xnudge = axes.xaxis.max/1000.0;
var xp0 = xp(0);
var xpn = xp(xnudge);
var ax = ['xaxis', 'yaxis', 'x2axis', 'y2axis','yMidAxis'];
// Add the grid onto the grid canvas. This is the bottom most layer.
ctx.save();
ctx.clearRect(0, 0, this._plotDimensions.width, this._plotDimensions.height);
ctx.fillStyle = this.backgroundColor || this.background;
ctx.fillRect(this._left, this._top, this._width, this._height);
if (this.plotBands.show) {
ctx.save();
var pb = this.plotBands;
ctx.fillStyle = pb.color;
var axis;
var x, y, w, h;
// find axis to work with
if (pb.axis.charAt(0) === 'x') {
if (axes.xaxis.show) {
axis = axes.xaxis;
}
}
else if (pb.axis.charAt(0) === 'y') {
if (axes.yaxis.show) {
axis = axes.yaxis;
}
else if (axes.y2axis.show) {
axis = axes.y2axis;
}
else if (axes.yMidAxis.show) {
axis = axes.yMidAxis;
}
}
if (axis !== undefined) {
// draw some rectangles
var start = pb.start;
if (start === null) {
start = axis.min;
}
for (var i = start; i < axis.max; i += 2 * pb.interval) {
if (axis.name.charAt(0) === 'y') {
x = this._left;
if ((i + pb.interval) < axis.max) {
y = axis.series_u2p(i + pb.interval) + this._top;
}
else {
y = axis.series_u2p(axis.max) + this._top;
}
w = this._right - this._left;
h = axis.series_u2p(start) - axis.series_u2p(start + pb.interval);
ctx.fillRect(x, y, w, h);
}
// else {
// y = 0;
// x = axis.series_u2p(i);
// h = this._height;
// w = axis.series_u2p(start + pb.interval) - axis.series_u2p(start);
// }
}
}
ctx.restore();
}
ctx.save();
ctx.lineJoin = 'miter';
ctx.lineCap = 'butt';
ctx.lineWidth = this.gridLineWidth;
ctx.strokeStyle = this.gridLineColor;
var b, e, s, m;
for (var i=5; i>0; i--) {
var name = ax[i-1];
var axis = axes[name];
var ticks = axis._ticks;
var numticks = ticks.length;
if (axis.show) {
if (axis.drawBaseline) {
var bopts = {};
if (axis.baselineWidth !== null) {
bopts.lineWidth = axis.baselineWidth;
}
if (axis.baselineColor !== null) {
bopts.strokeStyle = axis.baselineColor;
}
switch (name) {
case 'xaxis':
if (axes.yMidAxis.show) {
drawLine (this._left, this._bottom, xp0, this._bottom, bopts);
drawLine (xpn, this._bottom, this._right, this._bottom, bopts);
}
else {
drawLine (this._left, this._bottom, this._right, this._bottom, bopts);
}
break;
case 'yaxis':
drawLine (this._left, this._bottom, this._left, this._top, bopts);
break;
case 'yMidAxis':
drawLine(xp0, this._bottom, xp0, this._top, bopts);
drawLine(xpn, this._bottom, xpn, this._top, bopts);
break;
case 'x2axis':
if (axes.yMidAxis.show) {
drawLine (this._left, this._top, xp0, this._top, bopts);
drawLine (xpn, this._top, this._right, this._top, bopts);
}
else {
drawLine (this._left, this._bottom, this._right, this._bottom, bopts);
}
break;
case 'y2axis':
drawLine (this._right, this._bottom, this._right, this._top, bopts);
break;
}
}
for (var j=numticks; j>0; j--) {
var t = ticks[j-1];
if (t.show) {
var pos = Math.round(axis.u2p(t.value)) + 0.5;
switch (name) {
case 'xaxis':
// draw the grid line if we should
if (t.showGridline && this.drawGridlines && (!t.isMinorTick || axis.showMinorTicks)) {
drawLine(pos, this._top, pos, this._bottom);
}
// draw the mark
if (t.showMark && t.mark && (!t.isMinorTick || axis.showMinorTicks)) {
s = t.markSize;
m = t.mark;
var pos = Math.round(axis.u2p(t.value)) + 0.5;
switch (m) {
case 'outside':
b = this._bottom;
e = this._bottom+s;
break;
case 'inside':
b = this._bottom-s;
e = this._bottom;
break;
case 'cross':
b = this._bottom-s;
e = this._bottom+s;
break;
default:
b = this._bottom;
e = this._bottom+s;
break;
}
// draw the shadow
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [[pos,b],[pos,e]], {lineCap:'butt', lineWidth:this.gridLineWidth, offset:this.gridLineWidth*0.75, depth:2, fill:false, closePath:false});
}
// draw the line
drawLine(pos, b, pos, e);
}
break;
case 'yaxis':
// draw the grid line
if (t.showGridline && this.drawGridlines && (!t.isMinorTick || axis.showMinorTicks)) {
drawLine(this._right, pos, this._left, pos);
}
// draw the mark
if (t.showMark && t.mark && (!t.isMinorTick || axis.showMinorTicks)) {
s = t.markSize;
m = t.mark;
var pos = Math.round(axis.u2p(t.value)) + 0.5;
switch (m) {
case 'outside':
b = this._left-s;
e = this._left;
break;
case 'inside':
b = this._left;
e = this._left+s;
break;
case 'cross':
b = this._left-s;
e = this._left+s;
break;
default:
b = this._left-s;
e = this._left;
break;
}
// draw the shadow
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [[b, pos], [e, pos]], {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false});
}
drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor});
}
break;
case 'yMidAxis':
// draw the grid line
if (t.showGridline && this.drawGridlines && (!t.isMinorTick || axis.showMinorTicks)) {
drawLine(this._left, pos, xp0, pos);
drawLine(xpn, pos, this._right, pos);
}
// draw the mark
if (t.showMark && t.mark && (!t.isMinorTick || axis.showMinorTicks)) {
s = t.markSize;
m = t.mark;
var pos = Math.round(axis.u2p(t.value)) + 0.5;
b = xp0;
e = xp0 + s;
// draw the shadow
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [[b, pos], [e, pos]], {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false});
}
drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor});
b = xpn - s;
e = xpn;
// draw the shadow
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [[b, pos], [e, pos]], {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false});
}
drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor});
}
break;
case 'x2axis':
// draw the grid line
if (t.showGridline && this.drawGridlines && (!t.isMinorTick || axis.showMinorTicks)) {
drawLine(pos, this._bottom, pos, this._top);
}
// draw the mark
if (t.showMark && t.mark && (!t.isMinorTick || axis.showMinorTicks)) {
s = t.markSize;
m = t.mark;
var pos = Math.round(axis.u2p(t.value)) + 0.5;
switch (m) {
case 'outside':
b = this._top-s;
e = this._top;
break;
case 'inside':
b = this._top;
e = this._top+s;
break;
case 'cross':
b = this._top-s;
e = this._top+s;
break;
default:
b = this._top-s;
e = this._top;
break;
}
// draw the shadow
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [[pos,b],[pos,e]], {lineCap:'butt', lineWidth:this.gridLineWidth, offset:this.gridLineWidth*0.75, depth:2, fill:false, closePath:false});
}
drawLine(pos, b, pos, e);
}
break;
case 'y2axis':
// draw the grid line
if (t.showGridline && this.drawGridlines && (!t.isMinorTick || axis.showMinorTicks)) {
drawLine(this._left, pos, this._right, pos);
}
// draw the mark
if (t.showMark && t.mark && (!t.isMinorTick || axis.showMinorTicks)) {
s = t.markSize;
m = t.mark;
var pos = Math.round(axis.u2p(t.value)) + 0.5;
switch (m) {
case 'outside':
b = this._right;
e = this._right+s;
break;
case 'inside':
b = this._right-s;
e = this._right;
break;
case 'cross':
b = this._right-s;
e = this._right+s;
break;
default:
b = this._right;
e = this._right+s;
break;
}
// draw the shadow
if (this.shadow) {
this.renderer.shadowRenderer.draw(ctx, [[b, pos], [e, pos]], {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false});
}
drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor});
}
break;
default:
break;
}
}
}
t = null;
}
axis = null;
ticks = null;
}
ctx.restore();
function drawLine(bx, by, ex, ey, opts) {
ctx.save();
opts = opts || {};
if (opts.lineWidth == null || opts.lineWidth != 0){
$.extend(true, ctx, opts);
ctx.beginPath();
ctx.moveTo(bx, by);
ctx.lineTo(ex, ey);
ctx.stroke();
}
ctx.restore();
}
if (this.shadow) {
if (axes.yMidAxis.show) {
var points = [[this._left, this._bottom], [xp0, this._bottom]];
this.renderer.shadowRenderer.draw(ctx, points);
var points = [[xpn, this._bottom], [this._right, this._bottom], [this._right, this._top]];
this.renderer.shadowRenderer.draw(ctx, points);
var points = [[xp0, this._bottom], [xp0, this._top]];
this.renderer.shadowRenderer.draw(ctx, points);
}
else {
var points = [[this._left, this._bottom], [this._right, this._bottom], [this._right, this._top]];
this.renderer.shadowRenderer.draw(ctx, points);
}
}
// Now draw border around grid. Use axis border definitions. start at
// upper left and go clockwise.
if (this.borderWidth != 0 && this.drawBorder) {
if (axes.yMidAxis.show) {
drawLine (this._left, this._top, xp0, this._top, {lineCap:'round', strokeStyle:axes.x2axis.borderColor, lineWidth:axes.x2axis.borderWidth});
drawLine (xpn, this._top, this._right, this._top, {lineCap:'round', strokeStyle:axes.x2axis.borderColor, lineWidth:axes.x2axis.borderWidth});
drawLine (this._right, this._top, this._right, this._bottom, {lineCap:'round', strokeStyle:axes.y2axis.borderColor, lineWidth:axes.y2axis.borderWidth});
drawLine (this._right, this._bottom, xpn, this._bottom, {lineCap:'round', strokeStyle:axes.xaxis.borderColor, lineWidth:axes.xaxis.borderWidth});
drawLine (xp0, this._bottom, this._left, this._bottom, {lineCap:'round', strokeStyle:axes.xaxis.borderColor, lineWidth:axes.xaxis.borderWidth});
drawLine (this._left, this._bottom, this._left, this._top, {lineCap:'round', strokeStyle:axes.yaxis.borderColor, lineWidth:axes.yaxis.borderWidth});
drawLine (xp0, this._bottom, xp0, this._top, {lineCap:'round', strokeStyle:axes.yaxis.borderColor, lineWidth:axes.yaxis.borderWidth});
drawLine (xpn, this._bottom, xpn, this._top, {lineCap:'round', strokeStyle:axes.yaxis.borderColor, lineWidth:axes.yaxis.borderWidth});
}
else {
drawLine (this._left, this._top, this._right, this._top, {lineCap:'round', strokeStyle:axes.x2axis.borderColor, lineWidth:axes.x2axis.borderWidth});
drawLine (this._right, this._top, this._right, this._bottom, {lineCap:'round', strokeStyle:axes.y2axis.borderColor, lineWidth:axes.y2axis.borderWidth});
drawLine (this._right, this._bottom, this._left, this._bottom, {lineCap:'round', strokeStyle:axes.xaxis.borderColor, lineWidth:axes.xaxis.borderWidth});
drawLine (this._left, this._bottom, this._left, this._top, {lineCap:'round', strokeStyle:axes.yaxis.borderColor, lineWidth:axes.yaxis.borderWidth});
}
}
// ctx.lineWidth = this.borderWidth;
// ctx.strokeStyle = this.borderColor;
// ctx.strokeRect(this._left, this._top, this._width, this._height);
ctx.restore();
ctx = null;
axes = null;
};
})(jQuery);

File diff suppressed because one or more lines are too long

Some files were not shown because too many files have changed in this diff Show More