mirror of
https://github.com/EGroupware/egroupware.git
synced 2025-01-27 00:09:13 +01:00
421 lines
12 KiB
TypeScript
421 lines
12 KiB
TypeScript
/**
|
|
* EGroupware eTemplate2 - JS Portlet object - used by Home
|
|
*
|
|
* @license http://opensource.org/licenses/gpl-license.php GPL - GNU General Public License
|
|
* @package home
|
|
* @package etemplate
|
|
* @subpackage api
|
|
* @link https://www.egroupware.org
|
|
* @author Nathan Gray
|
|
*/
|
|
|
|
/*egw:uses
|
|
/vendor/bower-asset/jquery/dist/jquery.js;
|
|
et2_core_baseWidget;
|
|
*/
|
|
|
|
import {et2_createWidget, et2_register_widget, WidgetConfig} from "./et2_core_widget";
|
|
import {et2_valueWidget} from "./et2_core_valueWidget";
|
|
import {ClassWithAttributes} from "./et2_core_inheritance";
|
|
import {et2_action_object_impl, et2_DOMWidget} from "./et2_core_DOMWidget";
|
|
import {egw} from "../jsapi/egw_global";
|
|
import {et2_no_init} from "./et2_core_common";
|
|
import {et2_IResizeable} from "./et2_core_interfaces";
|
|
import {et2_dialog} from "./et2_widget_dialog";
|
|
import {egw_getAppObjectManager, egwActionObject, egwAction, egwActionObjectInterface} from "../egw_action/egw_action.js";
|
|
|
|
/**
|
|
* Class which implements the UI of a Portlet
|
|
*
|
|
* This manages the frame and decoration, but also provides the UI for properties.
|
|
*
|
|
* Portlets are only internal to EGroupware.
|
|
*
|
|
* Home does not fully implement WSRP, but tries not to conflict, ether.
|
|
* @link http://docs.oasis-open.org/wsrp/v2/wsrp-2.0-spec-os-01.html
|
|
* @augments et2_baseWidget
|
|
*/
|
|
export class et2_portlet extends et2_valueWidget
|
|
{
|
|
static readonly _attributes : any = {
|
|
"title": {
|
|
"name": "Title",
|
|
"description": "Goes in the little bit at the top with the icons",
|
|
"type": "string",
|
|
"default": ""
|
|
},
|
|
"edit_template": {
|
|
"name": "Edit template",
|
|
"description": "Custom eTemplate used to customize / set up the portlet",
|
|
"type": "string",
|
|
"default": egw.webserverUrl+"/home/templates/default/edit.xet"
|
|
},
|
|
"color": {
|
|
"name": "Color",
|
|
"description": "Set the portlet color",
|
|
"type": "string",
|
|
"default": ''
|
|
},
|
|
"settings": {
|
|
"name": "Customization settings",
|
|
"description": "Array of customization settings, similar in structure to preference settings",
|
|
"type": "any",
|
|
"default": et2_no_init
|
|
},
|
|
"actions": {
|
|
default: {}
|
|
},
|
|
"width": { "default": 2, "ignore": true},
|
|
"height": { "default": 1, "type": "integer"},
|
|
"rows": {"ignore": true, default: et2_no_init},
|
|
"cols": {"ignore": true, default: et2_no_init},
|
|
"resize_ratio": {"ignore": true, default: et2_no_init}, // Portlets are explicitly sized
|
|
"row": {
|
|
"name": "Row",
|
|
"description": "Home page location (row) - handled by home app",
|
|
"default": 1
|
|
},
|
|
"col": {
|
|
"name": "Column",
|
|
"description": "Home page location(column) - handled by home app",
|
|
"default": 1
|
|
}
|
|
};
|
|
|
|
private GRID : number = 55;
|
|
private settings: any;
|
|
/**
|
|
* These are the "normal" actions that every portlet is expected to have.
|
|
* The widget provides default actions for all of these, but they can
|
|
* be added to or overridden if needed by setting the action attribute.
|
|
*/
|
|
protected default_actions : any = {
|
|
edit_settings: {
|
|
icon: "edit",
|
|
caption: "Configure",
|
|
"default": true,
|
|
hideOnDisabled: true,
|
|
group: "portlet"
|
|
},
|
|
remove_portlet: {
|
|
icon: "delete",
|
|
caption: "Remove",
|
|
group: "portlet"
|
|
}
|
|
};
|
|
protected div: JQuery;
|
|
protected header: JQuery;
|
|
protected content: JQuery;
|
|
|
|
/**
|
|
* Constructor
|
|
*
|
|
* @memberOf et2_portlet
|
|
*/
|
|
constructor(_parent, _attrs? : WidgetConfig, _child? : object)
|
|
{
|
|
// Call the inherited constructor
|
|
super(_parent, _attrs, ClassWithAttributes.extendAttributes(et2_portlet._attributes, _child || {}));
|
|
|
|
let self = this;
|
|
|
|
// Create DOM nodes
|
|
this.div = jQuery(document.createElement("div"))
|
|
.addClass(this.options.class)
|
|
.addClass("ui-widget ui-widget-content ui-corner-all")
|
|
.addClass("et2_portlet")
|
|
/* Gridster */
|
|
.attr("data-sizex", this.options.width)
|
|
.attr("data-sizey", this.options.height)
|
|
.attr("data-row", this.options.row)
|
|
.attr("data-col", this.options.col)
|
|
|
|
.resizable( {
|
|
autoHide: true,
|
|
grid: this.GRID,
|
|
//containment: this.getParent().getDOMNode(),
|
|
stop: function(event, ui) {
|
|
self.set_width(Math.round(ui.size.width / self.GRID));
|
|
self.set_height(Math.round(ui.size.height / self.GRID));
|
|
self.egw().jsonq("home.home_ui.ajax_set_properties",[self.id, {},{
|
|
width: self.options.width,
|
|
height: self.options.height
|
|
}],
|
|
null,
|
|
self
|
|
);
|
|
// Tell children
|
|
self.iterateOver(function(widget) {widget.resize();},null,et2_IResizeable);
|
|
}
|
|
});
|
|
this.header = jQuery(document.createElement("div"))
|
|
.attr('id', this.getInstanceManager().uniqueId+'_'+this.id.replace(/\./g, '-') + '_header')
|
|
.addClass("ui-widget-header ui-corner-all")
|
|
.appendTo(this.div)
|
|
.html(this.options.title);
|
|
this.content = jQuery(document.createElement("div"))
|
|
.attr('id', this.getInstanceManager().uniqueId+'_'+this.id.replace(/\./g, '-') + '_content')
|
|
.appendTo(this.div);
|
|
|
|
this.setDOMNode(this.div[0]);
|
|
}
|
|
|
|
destroy()
|
|
{
|
|
for(let i = 0; i < this._children.length; i++)
|
|
{
|
|
// Check for child is a different template and clear it,
|
|
// since it won't be cleared by destroy()
|
|
if(this._children[i].getInstanceManager() != this.getInstanceManager())
|
|
{
|
|
this._children[i].getInstanceManager().clear();
|
|
}
|
|
}
|
|
super.destroy();
|
|
}
|
|
|
|
doLoadingFinished()
|
|
{
|
|
this.set_color(this.options.color);
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* If anyone asks, return the content node, so content goes inside
|
|
*/
|
|
getDOMNode(_sender)
|
|
{
|
|
if(typeof _sender != 'undefined' && _sender != this)
|
|
{
|
|
return this.content[0];
|
|
}
|
|
return super.getDOMNode(_sender);
|
|
}
|
|
|
|
/**
|
|
* Overriden from parent to add in default actions
|
|
*/
|
|
set_actions(actions)
|
|
{
|
|
// Set targets for actions
|
|
let defaults: any = {};
|
|
for(let action_name in this.default_actions)
|
|
{
|
|
defaults[action_name] = this.default_actions[action_name];
|
|
// Translate caption here, as translations aren't available earlier
|
|
defaults[action_name].caption = this.egw().lang(this.default_actions[action_name].caption);
|
|
if(typeof this[action_name] == "function")
|
|
{
|
|
defaults[action_name].onExecute = jQuery.proxy(this[action_name],this);
|
|
}
|
|
}
|
|
|
|
// Add in defaults, but let provided actions override them
|
|
this.options.actions = jQuery.extend(true,{},defaults,actions);
|
|
super.set_actions(this.options.actions);
|
|
}
|
|
|
|
/**
|
|
* Override _link_actions to remove edit action, if there is no settings
|
|
*
|
|
* @param actions
|
|
*/
|
|
_link_actions(actions)
|
|
{
|
|
// Get the top level element
|
|
let objectManager = <egwActionObject><unknown>egw_getAppObjectManager(true);
|
|
let widget_object =objectManager.getObjectById(this.id);
|
|
if (widget_object == null)
|
|
{
|
|
// Add a new container to the object manager which will hold the widget
|
|
// objects
|
|
widget_object = objectManager.insertObject(false, new egwActionObject(
|
|
this.id, objectManager, <egwActionObjectInterface><unknown>new et2_action_object_impl(<et2_DOMWidget><unknown>this).getAOI(),
|
|
this._actionManager || (<egwAction><unknown>objectManager.manager).getActionById(this.id) || objectManager.manager
|
|
));
|
|
}
|
|
|
|
// Delete all old objects
|
|
widget_object.clear();
|
|
|
|
// Go over the widget & add links - this is where we decide which actions are
|
|
// 'allowed' for this widget at this time
|
|
let action_links = [];
|
|
for(let i in actions)
|
|
{
|
|
let id = typeof actions[i].id != 'undefined' ? actions[i].id : i;
|
|
let action = {
|
|
actionId: id,
|
|
enabled: true
|
|
};
|
|
|
|
// If there are no settings, there can be no customization, so remove the edit action
|
|
if(id == 'edit_settings' && (!this.options.settings || jQuery.isEmptyObject(this.options.settings)))
|
|
{
|
|
this.egw().debug("log", "No settings for portlet %o, edit_settings action removed", this);
|
|
action.enabled = false;
|
|
}
|
|
action_links.push(action);
|
|
}
|
|
|
|
widget_object.updateActionLinks(action_links);
|
|
}
|
|
|
|
/**
|
|
* Create & show a dialog for customizing this portlet
|
|
*
|
|
* Properties for customization are sent in the 'settings' attribute
|
|
*/
|
|
edit_settings()
|
|
{
|
|
let dialog = <et2_dialog>et2_createWidget("dialog", {
|
|
callback: jQuery.proxy(this._process_edit, this),
|
|
template: this.options.edit_template,
|
|
value: {
|
|
content: this.options.settings
|
|
},
|
|
buttons: et2_dialog.BUTTONS_OK_CANCEL
|
|
},this);
|
|
// Set seperately to avoid translation
|
|
dialog.set_title(this.egw().lang("Edit") + " " + (this.options.title || ''));
|
|
}
|
|
|
|
_process_edit(button_id, value)
|
|
{
|
|
if(button_id != et2_dialog.OK_BUTTON) return;
|
|
|
|
|
|
// Save settings - server might reply with new content if the portlet needs an update,
|
|
// but ideally it doesn't
|
|
this.div.addClass("loading");
|
|
|
|
// Pass updated settings, unless we're removing
|
|
let settings = (typeof value == 'string') ? {} : this.options.settings || {};
|
|
this.egw().jsonq("home.home_ui.ajax_set_properties",[this.id, settings, value, this.settings ? this.settings.group : false],
|
|
function(data) {
|
|
// This section not for us
|
|
if(!data || typeof data.attributes == 'undefined') return false;
|
|
|
|
this.div.removeClass("loading");
|
|
this.set_value(data.content);
|
|
for(let key in data.attributes)
|
|
{
|
|
if(typeof this["set_"+key] == "function")
|
|
{
|
|
this["set_"+key].call(this, data.attributes[key]);
|
|
}
|
|
else if (this.attributes[key])
|
|
{
|
|
this.options[key] = data.attributes[key];
|
|
}
|
|
}
|
|
|
|
// Flagged as needing to edit settings? Open dialog
|
|
if(typeof data.edit_settings != 'undefined' && data.edit_settings)
|
|
{
|
|
this.edit_settings();
|
|
}
|
|
|
|
// Only resize once, and only if needed
|
|
if(data.attributes.width || data.attributes.height)
|
|
{
|
|
// Tell children
|
|
try {
|
|
this.iterateOver(function(widget) {widget.resize();},null,et2_IResizeable);
|
|
} catch (e) {
|
|
// Something went wrong, but do not stop
|
|
egw.debug('warn',e,this);
|
|
}
|
|
}
|
|
},
|
|
this);
|
|
|
|
// Extend, not replace, because settings has types while value has just value
|
|
if(typeof value == 'object')
|
|
{
|
|
jQuery.extend(this.options.settings, value);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Remove this portlet from the home page
|
|
*/
|
|
remove_portlet()
|
|
{
|
|
let self = this;
|
|
et2_dialog.show_dialog(function(button_id) {
|
|
if(button_id != et2_dialog.OK_BUTTON) return;
|
|
self._process_edit(button_id, '~remove~');
|
|
self.getParent().removeChild(self);
|
|
self.destroy();
|
|
},this.egw().lang("Remove"), this.options.title,{},
|
|
et2_dialog.BUTTONS_OK_CANCEL, et2_dialog.QUESTION_MESSAGE
|
|
);
|
|
}
|
|
|
|
/**
|
|
* Set the HTML content of the portlet
|
|
*
|
|
* @param value String HTML fragment
|
|
*/
|
|
set_value(value)
|
|
{
|
|
this.content.html(value);
|
|
}
|
|
|
|
/**
|
|
* Set the content of the header
|
|
*
|
|
* @param value String HTML fragment
|
|
*/
|
|
set_title(value)
|
|
{
|
|
this.header.contents()
|
|
.filter(function() {
|
|
return this.nodeType === 3;
|
|
})
|
|
.remove();
|
|
this.options.title = value;
|
|
this.header.append(value);
|
|
}
|
|
|
|
/**
|
|
* Let this portlet stand out a little by allowing a custom color
|
|
*/
|
|
set_color(color)
|
|
{
|
|
this.options.color = color;
|
|
this.header.css("backgroundColor", color);
|
|
this.header.css('color', jQuery.Color(this.header.css("backgroundColor")).lightness() > 0.5 ? 'black':'white');
|
|
this.content.css("backgroundColor", color);
|
|
}
|
|
|
|
/**
|
|
* Set the number of grid cells this widget spans
|
|
*
|
|
* @param value int Number of horizontal grid cells
|
|
*/
|
|
set_width(value)
|
|
{
|
|
this.options.width = value;
|
|
this.div.attr("data-sizex", value);
|
|
// Clear what's there from jQuery, we get width from CSS according to sizex
|
|
this.div.css('width','');
|
|
}
|
|
|
|
/**
|
|
* Set the number of vertical grid cells this widget spans
|
|
*
|
|
* @param value int Number of vertical grid cells
|
|
*/
|
|
set_height(value)
|
|
{
|
|
this.options.height = value;
|
|
this.div.attr("data-sizey", value);
|
|
// Clear what's there from jQuery, we get width from CSS according to sizey
|
|
this.div.css('height','');
|
|
}
|
|
}
|
|
et2_register_widget(et2_portlet, ["portlet"]);
|
|
|