From 256b40b169df3c3007e781c16497fe1d070e29e1 Mon Sep 17 00:00:00 2001 From: seek3r Date: Wed, 7 Feb 2001 08:16:55 +0000 Subject: [PATCH] Adding xml-rpc classes which will be needed in future xml-rpc interface to our class --- phpgwapi/inc/class.xmlrpc.inc.php | 895 +++++++++++++++++++++++++++++ phpgwapi/inc/class.xmlrpcs.inc.php | 286 +++++++++ 2 files changed, 1181 insertions(+) create mode 100644 phpgwapi/inc/class.xmlrpc.inc.php create mode 100644 phpgwapi/inc/class.xmlrpcs.inc.php diff --git a/phpgwapi/inc/class.xmlrpc.inc.php b/phpgwapi/inc/class.xmlrpc.inc.php new file mode 100644 index 0000000000..cfcad034be --- /dev/null +++ b/phpgwapi/inc/class.xmlrpc.inc.php @@ -0,0 +1,895 @@ + +// $Id$ + +// License is granted to use or modify this software ("XML-RPC for PHP") +// for commercial or non-commercial use provided the copyright of the author +// is preserved in any distributed or derivative work. + +// THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESSED OR +// IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +// OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +// IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +// INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +// NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +// THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +if (!function_exists('xml_parser_create')) { +// Win 32 fix. From: "Leo West" + if($WINDIR) { + dl("php3_xml.dll"); + } else { + dl("xml.so"); + } +} + +$xmlrpcI4="i4"; +$xmlrpcInt="int"; +$xmlrpcBoolean="boolean"; +$xmlrpcDouble="double"; +$xmlrpcString="string"; +$xmlrpcDateTime="dateTime.iso8601"; +$xmlrpcBase64="base64"; +$xmlrpcArray="array"; +$xmlrpcStruct="struct"; + + +$xmlrpcTypes=array($xmlrpcI4 => 1, + $xmlrpcInt => 1, + $xmlrpcBoolean => 1, + $xmlrpcString => 1, + $xmlrpcDouble => 1, + $xmlrpcDateTime => 1, + $xmlrpcBase64 => 1, + $xmlrpcArray => 2, + $xmlrpcStruct => 3); + +$xmlEntities=array("quot" => '"', + "amp" => "&", + "lt" => "<", + "gt" => ">", + "apos" => "'"); + +$xmlrpcerr["unknown_method"]=1; +$xmlrpcstr["unknown_method"]="Unknown method"; +$xmlrpcerr["invalid_return"]=2; +$xmlrpcstr["invalid_return"]="Invalid return payload: enabling debugging to examine incoming payload"; +$xmlrpcerr["incorrect_params"]=3; +$xmlrpcstr["incorrect_params"]="Incorrect parameters passed to method"; +$xmlrpcerr["introspect_unknown"]=4; +$xmlrpcstr["introspect_unknown"]="Can't introspect: method unknown"; +$xmlrpcerr["http_error"]=5; +$xmlrpcstr["http_error"]="Didn't receive 200 OK from remote server."; + +$xmlrpc_defencoding="UTF-8"; + +// let user errors start at 800 +$xmlrpcerruser=800; +// let XML parse errors start at 100 +$xmlrpcerrxml=100; + +// formulate backslashes for escaping regexp +$xmlrpc_backslash=chr(92).chr(92); + +$xmlrpc_twoslash=$xmlrpc_backslash . $xmlrpc_backslash; +$xmlrpc_twoslash="2SLS"; +// used to store state during parsing +// quick explanation of components: +// st - used to build up a string for evaluation +// ac - used to accumulate values +// qt - used to decide if quotes are needed for evaluation +// cm - used to denote struct or array (comma needed) +// isf - used to indicate a fault +// lv - used to indicate "looking for a value": implements +// the logic to allow values with no types to be strings +// params - used to store parameters in method calls +// method - used to store method name + +$_xh=array(); + +function xmlrpc_entity_decode($string) { + $top=split("&", $string); + $op=""; + $i=0; + while($i "; + break; + case "BOOLEAN": + // special case here: we translate boolean 1 or 0 into PHP + // constants true or false + if ($_xh[$parser]['ac']=='1') + $_xh[$parser]['ac']="true"; + else + $_xh[$parser]['ac']="false"; + $_xh[$parser]['vt']=strtolower($name); + // Drop through intentionally. + case "I4": + case "INT": + case "STRING": + case "DOUBLE": + case "DATETIME.ISO8601": + case "BASE64": + if ($_xh[$parser]['qt']==1) { + // we use double quotes rather than single so backslashification works OK + $_xh[$parser]['st'].="\"". $_xh[$parser]['ac'] . "\""; + } else if ($_xh[$parser]['qt']==2) { + $_xh[$parser]['st'].="base64_decode('". $_xh[$parser]['ac'] . "')"; + } else { + $_xh[$parser]['st'].=$_xh[$parser]['ac']; + } + $_xh[$parser]['ac']=""; $_xh[$parser]['qt']=0; + break; + case "VALUE": + // deal with a string value + if (strlen($_xh[$parser]['ac'])>0 && + $_xh[$parser]['vt']==$xmlrpcString) { + $_xh[$parser]['st'].="\"". $_xh[$parser]['ac'] . "\""; + } + // This if() detects if no scalar was inside + // and pads an empty "". + if($_xh[$parser]['st'][strlen($_xh[$parser]['st'])-1] == '(') { + $_xh[$parser]['st'].= '""'; + } + $_xh[$parser]['st'].=", '" . $_xh[$parser]['vt'] . "')"; + if ($_xh[$parser]['cm']) $_xh[$parser]['st'].=","; + break; + case "MEMBER": + $_xh[$parser]['ac']=""; $_xh[$parser]['qt']=0; + break; + case "DATA": + $_xh[$parser]['ac']=""; $_xh[$parser]['qt']=0; + break; + case "PARAM": + $_xh[$parser]['params'][]=$_xh[$parser]['st']; + break; + case "METHODNAME": + $_xh[$parser]['method']=ereg_replace("^[\n\r\t ]+", "", $_xh[$parser]['ac']); + break; + case "BOOLEAN": + // special case here: we translate boolean 1 or 0 into PHP + // constants true or false + if ($_xh[$parser]['ac']=='1') + $_xh[$parser]['ac']="true"; + else + $_xh[$parser]['ac']="false"; + $_xh[$parser]['vt']=strtolower($name); + break; + default: + break; + } + // if it's a valid type name, set the type + if ($xmlrpcTypes[strtolower($name)]) { + $_xh[$parser]['vt']=strtolower($name); + } + +} + +function xmlrpc_cd($parser, $data) +{ + global $_xh, $xmlrpc_backslash, $xmlrpc_twoslash; + + //if (ereg("^[\n\r \t]+$", $data)) return; + // print "adding [${data}]\n"; + if ($_xh[$parser]['lv']==1) { + $_xh[$parser]['qt']=1; + $_xh[$parser]['lv']=2; + } + if ($_xh[$parser]['qt']) { // quoted string + $_xh[$parser]['ac'].=str_replace('\$', '\\$', + str_replace('"', '\"', + str_replace(chr(92),$xmlrpc_backslash, $data))); + } + else + $_xh[$parser]['ac'].=$data; +} + +function xmlrpc_dh($parser, $data) +{ + global $_xh; + if (substr($data, 0, 1) == "&" && substr($data, -1, 1) == ";") { + if ($_xh[$parser]['lv']==1) { + $_xh[$parser]['qt']=1; + $_xh[$parser]['lv']=2; + } + $_xh[$parser]['ac'].=$data; + } +} + +class xmlrpc_client { + var $path; + var $server; + var $port; + var $errno; + var $errstring; + var $debug=0; + var $username=""; + var $password=""; + + function xmlrpc_client($path, $server, $port=80) { + $this->port=$port; $this->server=$server; $this->path=$path; + } + + function setDebug($in) { + if ($in) { + $this->debug=1; + } else { + $this->debug=0; + } + } + + function setCredentials($u, $p) { + $this->username=$u; + $this->password=$p; + } + + function send($msg, $timeout=0) { + // where msg is an xmlrpcmsg + $msg->debug=$this->debug; + return $this->sendPayloadHTTP10($msg, $this->server, $this->port, + $timeout, $this->username, + $this->password); + } + + function sendPayloadHTTP10($msg, $server, $port, $timeout=0, + $username="", $password="") { + if($timeout>0) + $fp=fsockopen($server, $port, + &$this->errno, &$this->errstr, $timeout); + else + $fp=fsockopen($server, $port, + &$this->errno, &$this->errstr); + if (!$fp) { + return 0; + } + // Only create the payload if it was not created previously + if(empty($msg->payload)) $msg->createPayload(); + + // thanks to Grant Rauscher + // for this + $credentials=""; + if ($username!="") { + $credentials="Authorization: Basic " . + base64_encode($username . ":" . $password) . "\r\n"; + } + + $op= "POST " . $this->path. " HTTP/1.0\r\nUser-Agent: PHP XMLRPC 1.0\r\n" . + "Host: ". $this->server . "\r\n" . + $credentials . + "Content-Type: text/xml\r\nContent-Length: " . + strlen($msg->payload) . "\r\n\r\n" . + $msg->payload; + + if (!fputs($fp, $op, strlen($op))) { + $this->errstr="Write error"; + return 0; + } + $resp=$msg->parseResponseFile($fp); + fclose($fp); + return $resp; + } + +} // end class xmlrpc_client + +class xmlrpcresp { + var $xv; + var $fn; + var $fs; + var $hdrs; + + function xmlrpcresp($val, $fcode=0, $fstr="") { + if ($fcode!=0) { + $this->fn=$fcode; + $this->fs=htmlspecialchars($fstr); + } else { + $this->xv=$val; + } + } + + function faultCode() { return $this->fn; } + function faultString() { return $this->fs; } + function value() { return $this->xv; } + + function serialize() { + $rs="\n"; + if ($this->fn) { + $rs.=" + + + + faultCode + " . $this->fn . " + + + faultString + " . $this->fs . " + + + +"; + } else { + $rs.="\n\n" . $this->xv->serialize() . + "\n"; + } + $rs.="\n"; + return $rs; + } +} + +class xmlrpcmsg { + var $payload; + var $methodname; + var $params=array(); + var $debug=0; + + function xmlrpcmsg($meth, $pars=0) { + $this->methodname=$meth; + if (is_array($pars) && sizeof($pars)>0) { + for($i=0; $iaddParam($pars[$i]); + } + } + + function xml_header() { + return "\n\n"; + } + + function xml_footer() { + return "\n"; + } + + function createPayload() { + $this->payload=$this->xml_header(); + $this->payload.="" . $this->methodname . "\n"; + // if (sizeof($this->params)) { + $this->payload.="\n"; + for($i=0; $iparams); $i++) { + $p=$this->params[$i]; + $this->payload.="\n" . $p->serialize() . + "\n"; + } + $this->payload.="\n"; + // } + $this->payload.=$this->xml_footer(); + $this->payload=str_replace("\n", "\r\n", $this->payload); + } + + function method($meth="") { + if ($meth!="") { + $this->methodname=$meth; + } + return $this->methodname; + } + + function serialize() { + $this->createPayload(); + return $this->payload; + } + + function addParam($par) { $this->params[]=$par; } + function getParam($i) { return $this->params[$i]; } + function getNumParams() { return sizeof($this->params); } + + function parseResponseFile($fp) { + $ipd=""; + + while($data=fread($fp, 32768)) { + $ipd.=$data; + } + return $this->parseResponse($ipd); + } + + function parseResponse($data="") { + global $_xh,$xmlrpcerr,$xmlrpcstr; + global $xmlrpc_defencoding; + + + $parser = xml_parser_create($xmlrpc_defencoding); + + $_xh[$parser]=array(); + + $_xh[$parser]['st']=""; + $_xh[$parser]['cm']=0; + $_xh[$parser]['isf']=0; + $_xh[$parser]['ac']=""; + + xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true); + xml_set_element_handler($parser, "xmlrpc_se", "xmlrpc_ee"); + xml_set_character_data_handler($parser, "xmlrpc_cd"); + xml_set_default_handler($parser, "xmlrpc_dh"); + $xmlrpc_value=new xmlrpcval; + + $hdrfnd=0; + if ($this->debug) + print "
---GOT---\n" . htmlspecialchars($data) . 
+		"\n---END---\n
"; + // see if we got an HTTP 200 OK, else bomb + // but only do this if we're using the HTTP protocol. + if (ereg("^HTTP",$data) && + !ereg("^HTTP/[0-9\.]+ 200 ", $data)) { + $errstr= substr($data, 0, strpos($data, "\n")-1); + error_log("HTTP error, got response: " .$errstr); + $r=new xmlrpcresp(0, $xmlrpcerr["http_error"], + $xmlrpcstr["http_error"]. " (" . $errstr . ")"); + xml_parser_free($parser); + return $r; + } + // gotta get rid of headers here + if ((!$hdrfnd) && ereg("^(.*)\r\n\r\n",$data,$_xh[$parser]['ha'])) { + $data=ereg_replace("^.*\r\n\r\n", "", $data); + $hdrfnd=1; + } + + if (!xml_parse($parser, $data, sizeof($data))) { + // thanks to Peter Kocks + if((xml_get_current_line_number($parser)) == 1) + $errstr = "XML error at line 1, check URL"; + else + $errstr = sprintf("XML error: %s at line %d", + xml_error_string(xml_get_error_code($parser)), + xml_get_current_line_number($parser)); + error_log($errstr); + $r=new xmlrpcresp(0, $xmlrpcerr["invalid_return"], + $xmlrpcstr["invalid_return"]); + xml_parser_free($parser); + return $r; + } + xml_parser_free($parser); + if ($this->debug) { + print "
---EVALING---[" . 
+		strlen($_xh[$parser]['st']) . " chars]---\n" . 
+		htmlspecialchars($_xh[$parser]['st']) . ";\n---END---
"; + } + if (strlen($_xh[$parser]['st'])==0) { + // then something odd has happened + // and it's time to generate a client side error + // indicating something odd went on + $r=new xmlrpcresp(0, $xmlrpcerr["invalid_return"], + $xmlrpcstr["invalid_return"]); + } else { + eval('$v=' . $_xh[$parser]['st'] . '; $allOK=1;'); + if ($_xh[$parser]['isf']) { + $f=$v->structmem("faultCode"); + $fs=$v->structmem("faultString"); + $r=new xmlrpcresp($v, $f->scalarval(), + $fs->scalarval()); + } else { + $r=new xmlrpcresp($v); + } + } + $r->hdrs=split('\r?\n', $_xh[$parser]['ha'][1]); + return $r; + } + +} + +class xmlrpcval { + var $me=array(); + var $mytype=0; + + function xmlrpcval($val=-1, $type="") { + global $xmlrpcTypes; + $this->me=array(); + $this->mytype=0; + if ($val!=-1 || $type!="") { + if ($type=="") $type="string"; + if ($xmlrpcTypes[$type]==1) { + $this->addScalar($val,$type); + } + else if ($xmlrpcTypes[$type]==2) + $this->addArray($val); + else if ($xmlrpcTypes[$type]==3) + $this->addStruct($val); + } + } + + function addScalar($val, $type="string") { + global $xmlrpcTypes, $xmlrpcBoolean; + + if ($this->mytype==1) { + echo "xmlrpcval: scalar can have only one value
"; + return 0; + } + $typeof=$xmlrpcTypes[$type]; + if ($typeof!=1) { + echo "xmlrpcval: not a scalar type (${typeof})
"; + return 0; + } + + if ($type==$xmlrpcBoolean) { + if (strcasecmp($val,"true")==0 || $val==1 || $val==true) { + $val=1; + } else { + $val=0; + } + } + + if ($this->mytype==2) { + // we're adding to an array here + $ar=$this->me["array"]; + $ar[]=new xmlrpcval($val, $type); + $this->me["array"]=$ar; + } else { + // a scalar, so set the value and remember we're scalar + $this->me[$type]=$val; + $this->mytype=$typeof; + } + return 1; + } + + function addArray($vals) { + global $xmlrpcTypes; + if ($this->mytype!=0) { + echo "xmlrpcval: already initialized as a [" . + $this->kindOf() . "]
"; + return 0; + } + $this->mytype=$xmlrpcTypes["array"]; + $this->me["array"]=$vals; + return 1; + } + + function addStruct($vals) { + global $xmlrpcTypes; + if ($this->mytype!=0) { + echo "xmlrpcval: already initialized as a [" . + $this->kindOf() . "]
"; + return 0; + } + $this->mytype=$xmlrpcTypes["struct"]; + $this->me["struct"]=$vals; + return 1; + } + + function dump($ar) { + reset($ar); + while ( list( $key, $val ) = each( $ar ) ) { + echo "$key => $val
"; + if ($key == 'array') + while ( list( $key2, $val2 ) = each( $val ) ) { + echo "-- $key2 => $val2
"; + } + } + } + + function kindOf() { + switch($this->mytype) { + case 3: + return "struct"; + break; + case 2: + return "array"; + break; + case 1: + return "scalar"; + break; + default: + return "undef"; + } + } + + function serializedata($typ, $val) { + $rs=""; + global $xmlrpcTypes, $xmlrpcBase64, $xmlrpcString; + switch($xmlrpcTypes[$typ]) { + case 3: + // struct + $rs.="\n"; + reset($val); + while(list($key2, $val2)=each($val)) { + $rs.="${key2}\n"; + $rs.=$this->serializeval($val2); + $rs.="\n"; + } + $rs.=""; + break; + case 2: + // array + $rs.="\n\n"; + for($i=0; $iserializeval($val[$i]); + } + $rs.="\n"; + break; + case 1: + switch ($typ) { + case $xmlrpcBase64: + $rs.="<${typ}>" . base64_encode($val) . ""; + break; + case $xmlrpcBoolean: + $rs.="<${typ}>" . ($val ? "1" : "0") . ""; + break; + case $xmlrpcString: + $rs.="<${typ}>" . htmlspecialchars($val). ""; + break; + default: + $rs.="<${typ}>${val}"; + } + break; + default: + break; + } + return $rs; + } + + function serialize() { + return $this->serializeval($this); + } + + function serializeval($o) { + global $xmlrpcTypes; + $rs=""; + $ar=$o->me; + reset($ar); + list($typ, $val) = each($ar); + $rs.=""; + $rs.=$this->serializedata($typ, $val); + $rs.="\n"; + return $rs; + } + + function structmem($m) { + $nv=$this->me["struct"][$m]; + return $nv; + } + + function structreset() { + reset($this->me["struct"]); + } + + function structeach() { + return each($this->me["struct"]); + } + + function scalarval() { + global $xmlrpcBoolean, $xmlrpcBase64; + reset($this->me); + list($a,$b)=each($this->me); + return $b; + } + + function scalartyp() { + global $xmlrpcI4, $xmlrpcInt; + reset($this->me); + list($a,$b)=each($this->me); + if ($a==$xmlrpcI4) + $a=$xmlrpcInt; + return $a; + } + + function arraymem($m) { + $nv=$this->me["array"][$m]; + return $nv; + } + + function arraysize() { + reset($this->me); + list($a,$b)=each($this->me); + return sizeof($b); + } +} + +// date helpers +function iso8601_encode($timet, $utc=0) { + // return an ISO8601 encoded string + // really, timezones ought to be supported + // but the XML-RPC spec says: + // + // "Don't assume a timezone. It should be specified by the server in its + // documentation what assumptions it makes about timezones." + // + // these routines always assume localtime unless + // $utc is set to 1, in which case UTC is assumed + // and an adjustment for locale is made when encoding + if (!$utc) { + $t=strftime("%Y%m%dT%H:%M:%S", $timet); + } else { + if (function_exists("gmstrftime")) + // gmstrftime doesn't exist in some versions + // of PHP + $t=gmstrftime("%Y%m%dT%H:%M:%S", $timet); + else { + $t=strftime("%Y%m%dT%H:%M:%S", $timet-date("Z")); + } + } + return $t; +} + +function iso8601_decode($idate, $utc=0) { + // return a timet in the localtime, or UTC + $t=0; + if (ereg("([0-9]{4})([0-9]{2})([0-9]{2})T([0-9]{2}):([0-9]{2}):([0-9]{2})", + $idate, $regs)) { + if ($utc) { + $t=gmmktime($regs[4], $regs[5], $regs[6], $regs[2], $regs[3], $regs[1]); + } else { + $t=mktime($regs[4], $regs[5], $regs[6], $regs[2], $regs[3], $regs[1]); + } + } + return $t; +} + +/**************************************************************** +* xmlrpc_decode takes a message in PHP xmlrpc object format and * +* tranlates it into native PHP types. * +* * +* author: Dan Libby (dan@libby.com) * +****************************************************************/ +function xmlrpc_decode($xmlrpc_val) { + $kind = $xmlrpc_val->kindOf(); + + if($kind == "scalar") { + return $xmlrpc_val->scalarval(); + } + else if($kind == "array") { + $size = $xmlrpc_val->arraysize(); + $arr = array(); + + for($i = 0; $i < $size; $i++) { + array_append($arr, xmlrpc_decode($xmlrpc_val->arraymem($i)) ); + } + return $arr; + } + else if($kind == "struct") { + $xmlrpc_val->structreset(); + $arr = array(); + + while(list($key,$value)=$xmlrpc_val->structeach()) { + $arr[$key] = xmlrpc_decode($value); + } + return $arr; + } +} + +/**************************************************************** +* xmlrpc_encode takes native php types and encodes them into * +* xmlrpc PHP object format. * +* BUG: All sequential arrays are turned into structs. I don't * +* know of a good way to determine if an array is sequential * +* only. * +* * +* feature creep -- could support more types via optional type * +* argument. * +* * +* author: Dan Libby (dan@libby.com) * +****************************************************************/ +function xmlrpc_encode($php_val) { + global $xmlrpcInt; + global $xmlrpcDouble; + global $xmlrpcString; + global $xmlrpcArray; + global $xmlrpcStruct; + + $type = gettype($php_val); + $xmlrpc_val = new xmlrpcval; + + switch($type) { + case "array": + case "object": + $arr = array(); + while (list($k,$v) = each($php_val)) { + $arr[$k] = xmlrpc_encode($v); + } + $xmlrpc_val->addStruct($arr); + break; + case "integer": + $xmlrpc_val->addScalar($php_val, $xmlrpcInt); + break; + case "double": + $xmlrpc_val->addScalar($php_val, $xmlrpcDouble); + break; + case "string": + $xmlrpc_val->addScalar($php_val, $xmlrpcString); + break; + case "unknown type": + default: + $xmlrpc_val = false; + break; + } + return $xmlrpc_val; +} + +?> \ No newline at end of file diff --git a/phpgwapi/inc/class.xmlrpcs.inc.php b/phpgwapi/inc/class.xmlrpcs.inc.php new file mode 100644 index 0000000000..12f231d0a3 --- /dev/null +++ b/phpgwapi/inc/class.xmlrpcs.inc.php @@ -0,0 +1,286 @@ + +// $Id$ + +// License is granted to use or modify this software ("XML-RPC for PHP") +// for commercial or non-commercial use provided the copyright of the author +// is preserved in any distributed or derivative work. + +// THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESSED OR +// IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +// OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +// IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +// INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +// NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +// THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// XML RPC Server class +// requires: xmlrpc.inc + +// listMethods: either a string, or nothing +$_xmlrpcs_listMethods_sig=array(array($xmlrpcArray, $xmlrpcString), + array($xmlrpcArray)); +$_xmlrpcs_listMethods_doc='This method lists all the methods that the XML-RPC server knows how to dispatch'; +function _xmlrpcs_listMethods($server, $m) { + global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap; + $v=new xmlrpcval(); + $dmap=$server->dmap; + $outAr=array(); + for(reset($dmap); list($key, $val)=each($dmap); ) { + $outAr[]=new xmlrpcval($key, "string"); + } + $dmap=$_xmlrpcs_dmap; + for(reset($dmap); list($key, $val)=each($dmap); ) { + $outAr[]=new xmlrpcval($key, "string"); + } + $v->addArray($outAr); + return new xmlrpcresp($v); +} + +$_xmlrpcs_methodSignature_sig=array(array($xmlrpcArray, $xmlrpcString)); +$_xmlrpcs_methodSignature_doc='Returns an array of known signatures (an array of arrays) for the method name passed. If no signatures are known, returns a none-array (test for type != array to detect missing signature)'; +function _xmlrpcs_methodSignature($server, $m) { + global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap; + + $methName=$m->getParam(0); + $methName=$methName->scalarval(); + if (ereg("^system\.", $methName)) { + $dmap=$_xmlrpcs_dmap; $sysCall=1; + } else { + $dmap=$server->dmap; $sysCall=0; + } + // print "\n"; + if (isset($dmap[$methName])) { + if ($dmap[$methName]["signature"]) { + $sigs=array(); + $thesigs=$dmap[$methName]["signature"]; + for($i=0; $igetParam(0); + $methName=$methName->scalarval(); + if (ereg("^system\.", $methName)) { + $dmap=$_xmlrpcs_dmap; $sysCall=1; + } else { + $dmap=$server->dmap; $sysCall=0; + } + // print "\n"; + if (isset($dmap[$methName])) { + if ($dmap[$methName]["docstring"]) { + $r=new xmlrpcresp(new xmlrpcval($dmap[$methName]["docstring"]), + "string"); + } else { + $r=new xmlrpcresp(new xmlrpcval("", "string")); + } + } else { + $r=new xmlrpcresp(0, + $xmlrpcerr["introspect_unknown"], + $xmlrpcstr["introspect_unknown"]); + } + return $r; +} + +$_xmlrpcs_dmap=array( + "system.listMethods" => + array("function" => "_xmlrpcs_listMethods", + "signature" => $_xmlrpcs_listMethods_sig, + "docstring" => $_xmlrpcs_listMethods_doc), + "system.methodHelp" => + array("function" => "_xmlrpcs_methodHelp", + "signature" => $_xmlrpcs_methodHelp_sig, + "docstring" => $_xmlrpcs_methodHelp_doc), + "system.methodSignature" => + array("function" => "_xmlrpcs_methodSignature", + "signature" => $_xmlrpcs_methodSignature_sig, + "docstring" => $_xmlrpcs_methodSignature_doc) + ); + +$_xmlrpc_debuginfo=""; +function xmlrpc_debugmsg($m) { + global $_xmlrpc_debuginfo; + $_xmlrpc_debuginfo=$_xmlrpc_debuginfo . $m . "\n"; +} + +class xmlrpc_server { + var $dmap=array(); + + function xmlrpc_server($dispMap, $serviceNow=1) { + global $HTTP_RAW_POST_DATA; + // dispMap is a despatch array of methods + // mapped to function names and signatures + // if a method + // doesn't appear in the map then an unknown + // method error is generated + $this->dmap=$dispMap; + if ($serviceNow) { + $this->service(); + } + } + + function serializeDebug() { + global $_xmlrpc_debuginfo; + if ($_xmlrpc_debuginfo!="") + return "\n"; + else + return ""; + } + + function service() { + $r=$this->parseRequest(); + $payload="\n" . + $this->serializeDebug() . + $r->serialize(); + Header("Content-type: text/xml\nContent-length: " . + strlen($payload)); + print $payload; + } + + function verifySignature($in, $sig) { + for($i=0; $igetNumParams()+1) { + $itsOK=1; + for($n=0; $n<$in->getNumParams(); $n++) { + $p=$in->getParam($n); + // print "\n"; + if ($p->kindOf() == "scalar") { + $pt=$p->scalartyp(); + } else { + $pt=$p->kindOf(); + } + // $n+1 as first type of sig is return type + if ($pt != $cursig[$n+1]) { + $itsOK=0; + $pno=$n+1; $wanted=$cursig[$n+1]; $got=$pt; + break; + } + } + if ($itsOK) + return array(1); + } + } + return array(0, "Wanted ${wanted}, got ${got} at param ${pno})"); + } + + function parseRequest($data="") { + global $_xh,$HTTP_RAW_POST_DATA; + global $xmlrpcerr, $xmlrpcstr, $xmlrpcerrxml, $xmlrpc_defencoding, + $_xmlrpcs_dmap; + + + + if ($data=="") { + $data=$HTTP_RAW_POST_DATA; + } + $parser = xml_parser_create($xmlrpc_defencoding); + + $_xh[$parser]=array(); + $_xh[$parser]['st']=""; + $_xh[$parser]['cm']=0; + $_xh[$parser]['isf']=0; + $_xh[$parser]['params']=array(); + $_xh[$parser]['method']=""; + + // decompose incoming XML into request structure + + xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true); + xml_set_element_handler($parser, "xmlrpc_se", "xmlrpc_ee"); + xml_set_character_data_handler($parser, "xmlrpc_cd"); + xml_set_default_handler($parser, "xmlrpc_dh"); + if (!xml_parse($parser, $data, 1)) { + // return XML error as a faultCode + $r=new xmlrpcresp(0, + $xmlrpcerrxml+xml_get_error_code($parser), + sprintf("XML error: %s at line %d", + xml_error_string(xml_get_error_code($parser)), + xml_get_current_line_number($parser))); + xml_parser_free($parser); + } else { + xml_parser_free($parser); + $m=new xmlrpcmsg($_xh[$parser]['method']); + // now add parameters in + for($i=0; $i\n"; + $plist.="$i - " . $_xh[$parser]['params'][$i]. " \n"; + eval('$m->addParam(' . $_xh[$parser]['params'][$i]. ");"); + } + xmlrpc_debugmsg($plist); + // now to deal with the method + $methName=$_xh[$parser]['method']; + if (ereg("^system\.", $methName)) { + $dmap=$_xmlrpcs_dmap; $sysCall=1; + } else { + $dmap=$this->dmap; $sysCall=0; + } + if (isset($dmap[$methName]['function'])) { + // dispatch if exists + if (isset($dmap[$methName]['signature'])) { + $sr=$this->verifySignature($m, + $dmap[$methName]['signature'] ); + } + if ( (!isset($dmap[$methName]['signature'])) + || $sr[0]) { + // if no signature or correct signature + if ($sysCall) { + eval('$r=' . $dmap[$methName]['function'] . + '($this, $m);'); + } else { + eval('$r=' . $dmap[$methName]['function'] . + '($m);'); + } + } else { + $r=new xmlrpcresp(0, + $xmlrpcerr["incorrect_params"], + $xmlrpcstr["incorrect_params"].": ". $sr[1]); + } + } else { + // else prepare error response + $r=new xmlrpcresp(0, + $xmlrpcerr["unknown_method"], + $xmlrpcstr["unknown_method"]); + } + } + return $r; + } + + function echoInput() { + global $HTTP_RAW_POST_DATA; + + // a debugging routine: just echos back the input + // packet as a string value + + $r=new xmlrpcresp; + $r->xv=new xmlrpcval( "'Aha said I: '" . $HTTP_RAW_POST_DATA, "string"); + print $r->serialize(); + } +} + +?> \ No newline at end of file