mirror of
https://github.com/EGroupware/egroupware.git
synced 2025-01-08 23:19:04 +01:00
Convert et2_widget_portlet to TS
This commit is contained in:
parent
effa2c52a3
commit
e6477f4b50
@ -1,3 +1,4 @@
|
||||
"use strict";
|
||||
/**
|
||||
* EGroupware eTemplate2 - JS Portlet object - used by Home
|
||||
*
|
||||
@ -9,12 +10,28 @@
|
||||
* @author Nathan Gray
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
var __extends = (this && this.__extends) || (function () {
|
||||
var extendStatics = function (d, b) {
|
||||
extendStatics = Object.setPrototypeOf ||
|
||||
({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
|
||||
function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
|
||||
return extendStatics(d, b);
|
||||
};
|
||||
return function (d, b) {
|
||||
extendStatics(d, b);
|
||||
function __() { this.constructor = d; }
|
||||
d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
|
||||
};
|
||||
})();
|
||||
Object.defineProperty(exports, "__esModule", { value: true });
|
||||
/*egw:uses
|
||||
/vendor/bower-asset/jquery/dist/jquery.js;
|
||||
et2_core_baseWidget;
|
||||
*/
|
||||
|
||||
var et2_core_widget_1 = require("./et2_core_widget");
|
||||
var et2_core_valueWidget_1 = require("./et2_core_valueWidget");
|
||||
var et2_core_inheritance_1 = require("./et2_core_inheritance");
|
||||
var et2_core_DOMWidget_1 = require("./et2_core_DOMWidget");
|
||||
/**
|
||||
* Class which implements the UI of a Portlet
|
||||
*
|
||||
@ -26,379 +43,320 @@
|
||||
* @link http://docs.oasis-open.org/wsrp/v2/wsrp-2.0-spec-os-01.html
|
||||
* @augments et2_baseWidget
|
||||
*/
|
||||
var et2_portlet = (function(){ "use strict"; return et2_valueWidget.extend(
|
||||
{
|
||||
attributes: {
|
||||
"title": {
|
||||
"name": "Title",
|
||||
"description": "Goes in the little bit at the top with the icons",
|
||||
"type": "string",
|
||||
"default": ""
|
||||
},
|
||||
"edit_template": {
|
||||
"name": "Edit template",
|
||||
"description": "Custom eTemplate used to customize / set up the portlet",
|
||||
"type": "string",
|
||||
"default": window.egw_webserverUrl+"/home/templates/default/edit.xet"
|
||||
},
|
||||
"color": {
|
||||
"name": "Color",
|
||||
"description": "Set the portlet color",
|
||||
"type": "string",
|
||||
"default": ''
|
||||
},
|
||||
"settings": {
|
||||
"name": "Customization settings",
|
||||
"description": "Array of customization settings, similar in structure to preference settings",
|
||||
"type": "any",
|
||||
"default": et2_no_init
|
||||
},
|
||||
"actions": {
|
||||
default: {}
|
||||
},
|
||||
"width": { "default": 2, "ignore": true},
|
||||
"height": { "default": 1, "type": "integer"},
|
||||
"rows": {"ignore": true, default: et2_no_init},
|
||||
"cols": {"ignore": true, default: et2_no_init},
|
||||
"resize_ratio": {"ignore": true, default: et2_no_init}, // Portlets are explicitly sized
|
||||
"row": {
|
||||
"name": "Row",
|
||||
"description": "Home page location (row) - handled by home app",
|
||||
"default": 1
|
||||
},
|
||||
"col": {
|
||||
"name": "Column",
|
||||
"description": "Home page location(column) - handled by home app",
|
||||
"default": 1
|
||||
}
|
||||
},
|
||||
|
||||
createNamespace: true,
|
||||
GRID: 55,
|
||||
|
||||
/**
|
||||
* These are the "normal" actions that every portlet is expected to have.
|
||||
* The widget provides default actions for all of these, but they can
|
||||
* be added to or overridden if needed by setting the action attribute.
|
||||
*/
|
||||
default_actions: {
|
||||
edit_settings: {
|
||||
icon: "edit",
|
||||
caption: "Configure",
|
||||
"default": true,
|
||||
hideOnDisabled: true,
|
||||
group: "portlet"
|
||||
},
|
||||
remove_portlet: {
|
||||
icon: "delete",
|
||||
caption: "Remove",
|
||||
group: "portlet"
|
||||
}
|
||||
},
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
*
|
||||
* @memberOf et2_portlet
|
||||
*/
|
||||
init: function()
|
||||
{
|
||||
this._super.apply(this, arguments);
|
||||
|
||||
var self = this;
|
||||
|
||||
// Create DOM nodes
|
||||
this.div = jQuery(document.createElement("div"))
|
||||
.addClass(this.options.class)
|
||||
.addClass("ui-widget ui-widget-content ui-corner-all")
|
||||
.addClass("et2_portlet")
|
||||
/* Gridster */
|
||||
.attr("data-sizex", this.options.width)
|
||||
.attr("data-sizey", this.options.height)
|
||||
.attr("data-row", this.options.row)
|
||||
.attr("data-col", this.options.col)
|
||||
|
||||
.resizable( {
|
||||
autoHide: true,
|
||||
grid: this.GRID,
|
||||
//containment: this.getParent().getDOMNode(),
|
||||
stop: function(event, ui) {
|
||||
self.set_width(Math.round(ui.size.width / self.GRID));
|
||||
self.set_height(Math.round(ui.size.height / self.GRID));
|
||||
self.egw().jsonq("home.home_ui.ajax_set_properties",[self.id, {},{
|
||||
width: self.options.width,
|
||||
height: self.options.height
|
||||
}],
|
||||
null,
|
||||
self, true, self
|
||||
);
|
||||
// Tell children
|
||||
self.iterateOver(function(widget) {widget.resize();},null,et2_IResizeable);
|
||||
}
|
||||
});
|
||||
this.header = jQuery(document.createElement("div"))
|
||||
.attr('id', this.getInstanceManager().uniqueId+'_'+this.id.replace(/\./g, '-') + '_header')
|
||||
.addClass("ui-widget-header ui-corner-all")
|
||||
.appendTo(this.div)
|
||||
.html(this.options.title);
|
||||
this.content = jQuery(document.createElement("div"))
|
||||
.attr('id', this.getInstanceManager().uniqueId+'_'+this.id.replace(/\./g, '-') + '_content')
|
||||
.appendTo(this.div);
|
||||
|
||||
this.setDOMNode(this.div[0]);
|
||||
},
|
||||
|
||||
destroy: function()
|
||||
{
|
||||
for(var i = 0; i < this._children.length; i++)
|
||||
{
|
||||
// Check for child is a different template and clear it,
|
||||
// since it won't be cleared by destroy()
|
||||
if(this._children[i]._inst != this._inst)
|
||||
{
|
||||
this._children[i]._inst.clear();
|
||||
}
|
||||
}
|
||||
this._super.apply(this, arguments);
|
||||
},
|
||||
|
||||
doLoadingFinished: function() {
|
||||
this.set_color(this.options.color);
|
||||
},
|
||||
|
||||
/**
|
||||
* If anyone asks, return the content node, so content goes inside
|
||||
*/
|
||||
getDOMNode: function(_sender) {
|
||||
if(typeof _sender != 'undefined' && _sender != this)
|
||||
{
|
||||
return this.content[0];
|
||||
}
|
||||
return this._super.apply(this, arguments);
|
||||
},
|
||||
|
||||
/**
|
||||
* Overriden from parent to add in default actions
|
||||
*/
|
||||
set_actions: function(actions)
|
||||
{
|
||||
// Set targets for actions
|
||||
var defaults = {};
|
||||
for(var action_name in this.default_actions)
|
||||
{
|
||||
defaults[action_name] = this.default_actions[action_name];
|
||||
// Translate caption here, as translations aren't available earlier
|
||||
defaults[action_name].caption = this.egw().lang(this.default_actions[action_name].caption);
|
||||
if(typeof this[action_name] == "function")
|
||||
{
|
||||
defaults[action_name].onExecute = jQuery.proxy(this[action_name],this);
|
||||
}
|
||||
}
|
||||
|
||||
// Add in defaults, but let provided actions override them
|
||||
this.options.actions = jQuery.extend(true,{},defaults,actions);
|
||||
this._super.apply(this, [this.options.actions]);
|
||||
},
|
||||
|
||||
/**
|
||||
* Override _link_actions to remove edit action, if there is no settings
|
||||
*
|
||||
* @param Object[ {ID: attributes..}+] as for set_actions
|
||||
*/
|
||||
_link_actions: function(actions)
|
||||
{
|
||||
// Get the top level element
|
||||
var objectManager = egw_getAppObjectManager(true);
|
||||
var widget_object = objectManager.getObjectById(this.id);
|
||||
if (widget_object == null) {
|
||||
// Add a new container to the object manager which will hold the widget
|
||||
// objects
|
||||
widget_object = objectManager.insertObject(false, new egwActionObject(
|
||||
this.id, objectManager, new et2_action_object_impl(this),
|
||||
this._actionManager || objectManager.manager.getActionById(this.id) || objectManager.manager
|
||||
));
|
||||
}
|
||||
|
||||
// Delete all old objects
|
||||
widget_object.clear();
|
||||
|
||||
// Go over the widget & add links - this is where we decide which actions are
|
||||
// 'allowed' for this widget at this time
|
||||
var action_links = [];
|
||||
for(var i in actions)
|
||||
{
|
||||
var id = typeof actions[i].id != 'undefined' ? actions[i].id : i;
|
||||
var action = {
|
||||
actionId: id,
|
||||
enabled: true
|
||||
};
|
||||
|
||||
// If there are no settings, there can be no customization, so remove the edit action
|
||||
if(id == 'edit_settings' && (!this.options.settings || jQuery.isEmptyObject(this.options.settings)))
|
||||
{
|
||||
this.egw().debug("log", "No settings for portlet %o, edit_settings action removed", this);
|
||||
action.enabled = false;
|
||||
}
|
||||
action_links.push(action);
|
||||
}
|
||||
|
||||
widget_object.updateActionLinks(action_links);
|
||||
},
|
||||
|
||||
/**
|
||||
* Create & show a dialog for customizing this portlet
|
||||
*
|
||||
* Properties for customization are sent in the 'settings' attribute
|
||||
*/
|
||||
edit_settings: function(action, sender)
|
||||
{
|
||||
var dialog = et2_createWidget("dialog", {
|
||||
callback: jQuery.proxy(this._process_edit, this),
|
||||
template: this.options.edit_template,
|
||||
value: {
|
||||
content: this.options.settings
|
||||
},
|
||||
buttons: et2_dialog.BUTTONS_OK_CANCEL
|
||||
},this);
|
||||
// Set seperately to avoid translation
|
||||
dialog.set_title(this.egw().lang("Edit") + " " + (this.options.title || ''));
|
||||
},
|
||||
|
||||
_process_edit: function(button_id, value)
|
||||
{
|
||||
if(button_id != et2_dialog.OK_BUTTON) return;
|
||||
|
||||
|
||||
// Save settings - server might reply with new content if the portlet needs an update,
|
||||
// but ideally it doesn't
|
||||
this.div.addClass("loading");
|
||||
|
||||
// Pass updated settings, unless we're removing
|
||||
var settings = (typeof value == 'string') ? {} : this.options.settings || {}
|
||||
this.egw().jsonq("home.home_ui.ajax_set_properties",[this.id, settings, value,this.settings?this.settings.group:false],
|
||||
function(data) {
|
||||
// This section not for us
|
||||
if(!data || typeof data.attributes == 'undefined') return false;
|
||||
|
||||
this.div.removeClass("loading");
|
||||
this.set_value(data.content);
|
||||
for(var key in data.attributes)
|
||||
{
|
||||
if(typeof this["set_"+key] == "function")
|
||||
{
|
||||
this["set_"+key].call(this, data.attributes[key]);
|
||||
}
|
||||
else if (this.attributes[key])
|
||||
{
|
||||
this.options[key] = data.attributes[key];
|
||||
}
|
||||
}
|
||||
|
||||
// Flagged as needing to edit settings? Open dialog
|
||||
if(typeof data.edit_settings != 'undefined' && data.edit_settings)
|
||||
{
|
||||
this.edit_settings();
|
||||
}
|
||||
|
||||
// Only resize once, and only if needed
|
||||
if(data.attributes.width || data.attributes.height)
|
||||
{
|
||||
// Tell children
|
||||
try {
|
||||
this.iterateOver(function(widget) {widget.resize();},null,et2_IResizeable);
|
||||
} catch (e) {
|
||||
// Something went wrong, but do not stop
|
||||
egw.debug('warn',e,this);
|
||||
}
|
||||
}
|
||||
},
|
||||
this, true, this
|
||||
);
|
||||
|
||||
// Extend, not replace, because settings has types while value has just value
|
||||
if(typeof value == 'object')
|
||||
{
|
||||
jQuery.extend(this.options.settings, value);
|
||||
}
|
||||
},
|
||||
|
||||
/**
|
||||
* Remove this portlet from the home page
|
||||
*/
|
||||
remove_portlet: function() {
|
||||
var self = this;
|
||||
et2_dialog.show_dialog(function(button_id) {
|
||||
if(button_id != et2_dialog.OK_BUTTON) return;
|
||||
self._process_edit(button_id, '~remove~');
|
||||
self._parent.removeChild(self);
|
||||
self.destroy();
|
||||
},this.egw().lang("Remove"), this.options.title,{},
|
||||
et2_dialog.BUTTONS_OK_CANCEL, et2_dialog.QUESTION_MESSAGE
|
||||
);
|
||||
},
|
||||
|
||||
/**
|
||||
* Set the HTML content of the portlet
|
||||
*
|
||||
* @param value String HTML fragment
|
||||
*/
|
||||
set_value: function(value)
|
||||
{
|
||||
this.content.html(value);
|
||||
},
|
||||
|
||||
/**
|
||||
* Set the content of the header
|
||||
*
|
||||
* @param value String HTML fragment
|
||||
*/
|
||||
set_title: function(value)
|
||||
{
|
||||
this.header.contents()
|
||||
.filter(function() {
|
||||
return this.nodeType === 3;
|
||||
})
|
||||
.remove();
|
||||
this.options.title = value;
|
||||
this.header.append(value);
|
||||
},
|
||||
|
||||
/**
|
||||
* Let this portlet stand out a little by allowing a custom color
|
||||
*/
|
||||
set_color: function(color)
|
||||
{
|
||||
this.options.color = color;
|
||||
this.header.css("backgroundColor", color);
|
||||
this.header.css('color', jQuery.Color(this.header.css("backgroundColor")).lightness() > 0.5 ? 'black':'white');
|
||||
this.content.css("backgroundColor", color);
|
||||
},
|
||||
|
||||
/**
|
||||
* Set the number of grid cells this widget spans
|
||||
*
|
||||
* @param value int Number of horizontal grid cells
|
||||
*/
|
||||
set_width: function(value)
|
||||
{
|
||||
this.options.width = value;
|
||||
this.div.attr("data-sizex", value);
|
||||
// Clear what's there from jQuery, we get width from CSS according to sizex
|
||||
this.div.css('width','');
|
||||
},
|
||||
|
||||
/**
|
||||
* Set the number of vertical grid cells this widget spans
|
||||
*
|
||||
* @param value int Number of vertical grid cells
|
||||
*/
|
||||
set_height: function(value)
|
||||
{
|
||||
this.options.height = value;
|
||||
this.div.attr("data-sizey", value);
|
||||
// Clear what's there from jQuery, we get width from CSS according to sizey
|
||||
this.div.css('height','');
|
||||
}
|
||||
|
||||
});}).call(this);
|
||||
et2_register_widget(et2_portlet, ["portlet"]);
|
||||
var et2_portlet = /** @class */ (function (_super) {
|
||||
__extends(et2_portlet, _super);
|
||||
/**
|
||||
* Constructor
|
||||
*
|
||||
* @memberOf et2_portlet
|
||||
*/
|
||||
function et2_portlet(_parent, _attrs, _child) {
|
||||
var _this =
|
||||
// Call the inherited constructor
|
||||
_super.call(this, _parent, _attrs, et2_core_inheritance_1.ClassWithAttributes.extendAttributes(et2_portlet._attributes, _child || {})) || this;
|
||||
_this.GRID = 55;
|
||||
/**
|
||||
* These are the "normal" actions that every portlet is expected to have.
|
||||
* The widget provides default actions for all of these, but they can
|
||||
* be added to or overridden if needed by setting the action attribute.
|
||||
*/
|
||||
_this.default_actions = {
|
||||
edit_settings: {
|
||||
icon: "edit",
|
||||
caption: "Configure",
|
||||
"default": true,
|
||||
hideOnDisabled: true,
|
||||
group: "portlet"
|
||||
},
|
||||
remove_portlet: {
|
||||
icon: "delete",
|
||||
caption: "Remove",
|
||||
group: "portlet"
|
||||
}
|
||||
};
|
||||
var self = _this;
|
||||
// Create DOM nodes
|
||||
_this.div = jQuery(document.createElement("div"))
|
||||
.addClass(_this.options.class)
|
||||
.addClass("ui-widget ui-widget-content ui-corner-all")
|
||||
.addClass("et2_portlet")
|
||||
/* Gridster */
|
||||
.attr("data-sizex", _this.options.width)
|
||||
.attr("data-sizey", _this.options.height)
|
||||
.attr("data-row", _this.options.row)
|
||||
.attr("data-col", _this.options.col)
|
||||
.resizable({
|
||||
autoHide: true,
|
||||
grid: _this.GRID,
|
||||
//containment: this.getParent().getDOMNode(),
|
||||
stop: function (event, ui) {
|
||||
self.set_width(Math.round(ui.size.width / self.GRID));
|
||||
self.set_height(Math.round(ui.size.height / self.GRID));
|
||||
self.egw().jsonq("home.home_ui.ajax_set_properties", [self.id, {}, {
|
||||
width: self.options.width,
|
||||
height: self.options.height
|
||||
}], null, self);
|
||||
// Tell children
|
||||
self.iterateOver(function (widget) { widget.resize(); }, null, et2_IResizeable);
|
||||
}
|
||||
});
|
||||
_this.header = jQuery(document.createElement("div"))
|
||||
.attr('id', _this.getInstanceManager().uniqueId + '_' + _this.id.replace(/\./g, '-') + '_header')
|
||||
.addClass("ui-widget-header ui-corner-all")
|
||||
.appendTo(_this.div)
|
||||
.html(_this.options.title);
|
||||
_this.content = jQuery(document.createElement("div"))
|
||||
.attr('id', _this.getInstanceManager().uniqueId + '_' + _this.id.replace(/\./g, '-') + '_content')
|
||||
.appendTo(_this.div);
|
||||
_this.setDOMNode(_this.div[0]);
|
||||
return _this;
|
||||
}
|
||||
et2_portlet.prototype.destroy = function () {
|
||||
for (var i = 0; i < this._children.length; i++) {
|
||||
// Check for child is a different template and clear it,
|
||||
// since it won't be cleared by destroy()
|
||||
if (this._children[i].getInstanceManager() != this.getInstanceManager()) {
|
||||
this._children[i].getInstanceManager().clear();
|
||||
}
|
||||
}
|
||||
_super.prototype.destroy.call(this);
|
||||
};
|
||||
et2_portlet.prototype.doLoadingFinished = function () {
|
||||
this.set_color(this.options.color);
|
||||
return true;
|
||||
};
|
||||
/**
|
||||
* If anyone asks, return the content node, so content goes inside
|
||||
*/
|
||||
et2_portlet.prototype.getDOMNode = function (_sender) {
|
||||
if (typeof _sender != 'undefined' && _sender != this) {
|
||||
return this.content[0];
|
||||
}
|
||||
return _super.prototype.getDOMNode.call(this, _sender);
|
||||
};
|
||||
/**
|
||||
* Overriden from parent to add in default actions
|
||||
*/
|
||||
et2_portlet.prototype.set_actions = function (actions) {
|
||||
// Set targets for actions
|
||||
var defaults = {};
|
||||
for (var action_name in this.default_actions) {
|
||||
defaults[action_name] = this.default_actions[action_name];
|
||||
// Translate caption here, as translations aren't available earlier
|
||||
defaults[action_name].caption = this.egw().lang(this.default_actions[action_name].caption);
|
||||
if (typeof this[action_name] == "function") {
|
||||
defaults[action_name].onExecute = jQuery.proxy(this[action_name], this);
|
||||
}
|
||||
}
|
||||
// Add in defaults, but let provided actions override them
|
||||
this.options.actions = jQuery.extend(true, {}, defaults, actions);
|
||||
_super.prototype.set_actions.call(this, [this.options.actions]);
|
||||
};
|
||||
/**
|
||||
* Override _link_actions to remove edit action, if there is no settings
|
||||
*
|
||||
* @param actions
|
||||
*/
|
||||
et2_portlet.prototype._link_actions = function (actions) {
|
||||
// Get the top level element
|
||||
var objectManager = egw_getAppObjectManager(true);
|
||||
var widget_object = objectManager.getObjectById(this.id);
|
||||
if (widget_object == null) {
|
||||
// Add a new container to the object manager which will hold the widget
|
||||
// objects
|
||||
widget_object = objectManager.insertObject(false, new egwActionObject(this.id, objectManager, new et2_core_DOMWidget_1.et2_action_object_impl(this), this._actionManager || objectManager.manager.getActionById(this.id) || objectManager.manager));
|
||||
}
|
||||
// Delete all old objects
|
||||
widget_object.clear();
|
||||
// Go over the widget & add links - this is where we decide which actions are
|
||||
// 'allowed' for this widget at this time
|
||||
var action_links = [];
|
||||
for (var i in actions) {
|
||||
var id = typeof actions[i].id != 'undefined' ? actions[i].id : i;
|
||||
var action = {
|
||||
actionId: id,
|
||||
enabled: true
|
||||
};
|
||||
// If there are no settings, there can be no customization, so remove the edit action
|
||||
if (id == 'edit_settings' && (!this.options.settings || jQuery.isEmptyObject(this.options.settings))) {
|
||||
this.egw().debug("log", "No settings for portlet %o, edit_settings action removed", this);
|
||||
action.enabled = false;
|
||||
}
|
||||
action_links.push(action);
|
||||
}
|
||||
widget_object.updateActionLinks(action_links);
|
||||
};
|
||||
/**
|
||||
* Create & show a dialog for customizing this portlet
|
||||
*
|
||||
* Properties for customization are sent in the 'settings' attribute
|
||||
*/
|
||||
et2_portlet.prototype.edit_settings = function () {
|
||||
var dialog = et2_createWidget("dialog", {
|
||||
callback: jQuery.proxy(this._process_edit, this),
|
||||
template: this.options.edit_template,
|
||||
value: {
|
||||
content: this.options.settings
|
||||
},
|
||||
buttons: et2_dialog.BUTTONS_OK_CANCEL
|
||||
}, this);
|
||||
// Set seperately to avoid translation
|
||||
dialog.set_title(this.egw().lang("Edit") + " " + (this.options.title || ''));
|
||||
};
|
||||
et2_portlet.prototype._process_edit = function (button_id, value) {
|
||||
if (button_id != et2_dialog.OK_BUTTON)
|
||||
return;
|
||||
// Save settings - server might reply with new content if the portlet needs an update,
|
||||
// but ideally it doesn't
|
||||
this.div.addClass("loading");
|
||||
// Pass updated settings, unless we're removing
|
||||
var settings = (typeof value == 'string') ? {} : this.options.settings || {};
|
||||
this.egw().jsonq("home.home_ui.ajax_set_properties", [this.id, settings, value, this.settings ? this.settings.group : false], function (data) {
|
||||
// This section not for us
|
||||
if (!data || typeof data.attributes == 'undefined')
|
||||
return false;
|
||||
this.div.removeClass("loading");
|
||||
this.set_value(data.content);
|
||||
for (var key in data.attributes) {
|
||||
if (typeof this["set_" + key] == "function") {
|
||||
this["set_" + key].call(this, data.attributes[key]);
|
||||
}
|
||||
else if (this.attributes[key]) {
|
||||
this.options[key] = data.attributes[key];
|
||||
}
|
||||
}
|
||||
// Flagged as needing to edit settings? Open dialog
|
||||
if (typeof data.edit_settings != 'undefined' && data.edit_settings) {
|
||||
this.edit_settings();
|
||||
}
|
||||
// Only resize once, and only if needed
|
||||
if (data.attributes.width || data.attributes.height) {
|
||||
// Tell children
|
||||
try {
|
||||
this.iterateOver(function (widget) { widget.resize(); }, null, et2_IResizeable);
|
||||
}
|
||||
catch (e) {
|
||||
// Something went wrong, but do not stop
|
||||
egw.debug('warn', e, this);
|
||||
}
|
||||
}
|
||||
}, this);
|
||||
// Extend, not replace, because settings has types while value has just value
|
||||
if (typeof value == 'object') {
|
||||
jQuery.extend(this.options.settings, value);
|
||||
}
|
||||
};
|
||||
/**
|
||||
* Remove this portlet from the home page
|
||||
*/
|
||||
et2_portlet.prototype.remove_portlet = function () {
|
||||
var self = this;
|
||||
et2_dialog.show_dialog(function (button_id) {
|
||||
if (button_id != et2_dialog.OK_BUTTON)
|
||||
return;
|
||||
self._process_edit(button_id, '~remove~');
|
||||
self.getParent().removeChild(self);
|
||||
self.destroy();
|
||||
}, this.egw().lang("Remove"), this.options.title, {}, et2_dialog.BUTTONS_OK_CANCEL, et2_dialog.QUESTION_MESSAGE);
|
||||
};
|
||||
/**
|
||||
* Set the HTML content of the portlet
|
||||
*
|
||||
* @param value String HTML fragment
|
||||
*/
|
||||
et2_portlet.prototype.set_value = function (value) {
|
||||
this.content.html(value);
|
||||
};
|
||||
/**
|
||||
* Set the content of the header
|
||||
*
|
||||
* @param value String HTML fragment
|
||||
*/
|
||||
et2_portlet.prototype.set_title = function (value) {
|
||||
this.header.contents()
|
||||
.filter(function () {
|
||||
return this.nodeType === 3;
|
||||
})
|
||||
.remove();
|
||||
this.options.title = value;
|
||||
this.header.append(value);
|
||||
};
|
||||
/**
|
||||
* Let this portlet stand out a little by allowing a custom color
|
||||
*/
|
||||
et2_portlet.prototype.set_color = function (color) {
|
||||
this.options.color = color;
|
||||
this.header.css("backgroundColor", color);
|
||||
this.header.css('color', jQuery.Color(this.header.css("backgroundColor")).lightness() > 0.5 ? 'black' : 'white');
|
||||
this.content.css("backgroundColor", color);
|
||||
};
|
||||
/**
|
||||
* Set the number of grid cells this widget spans
|
||||
*
|
||||
* @param value int Number of horizontal grid cells
|
||||
*/
|
||||
et2_portlet.prototype.set_width = function (value) {
|
||||
this.options.width = value;
|
||||
this.div.attr("data-sizex", value);
|
||||
// Clear what's there from jQuery, we get width from CSS according to sizex
|
||||
this.div.css('width', '');
|
||||
};
|
||||
/**
|
||||
* Set the number of vertical grid cells this widget spans
|
||||
*
|
||||
* @param value int Number of vertical grid cells
|
||||
*/
|
||||
et2_portlet.prototype.set_height = function (value) {
|
||||
this.options.height = value;
|
||||
this.div.attr("data-sizey", value);
|
||||
// Clear what's there from jQuery, we get width from CSS according to sizey
|
||||
this.div.css('height', '');
|
||||
};
|
||||
et2_portlet._attributes = {
|
||||
"title": {
|
||||
"name": "Title",
|
||||
"description": "Goes in the little bit at the top with the icons",
|
||||
"type": "string",
|
||||
"default": ""
|
||||
},
|
||||
"edit_template": {
|
||||
"name": "Edit template",
|
||||
"description": "Custom eTemplate used to customize / set up the portlet",
|
||||
"type": "string",
|
||||
"default": egw.webserverUrl + "/home/templates/default/edit.xet"
|
||||
},
|
||||
"color": {
|
||||
"name": "Color",
|
||||
"description": "Set the portlet color",
|
||||
"type": "string",
|
||||
"default": ''
|
||||
},
|
||||
"settings": {
|
||||
"name": "Customization settings",
|
||||
"description": "Array of customization settings, similar in structure to preference settings",
|
||||
"type": "any",
|
||||
"default": et2_no_init
|
||||
},
|
||||
"actions": {
|
||||
default: {}
|
||||
},
|
||||
"width": { "default": 2, "ignore": true },
|
||||
"height": { "default": 1, "type": "integer" },
|
||||
"rows": { "ignore": true, default: et2_no_init },
|
||||
"cols": { "ignore": true, default: et2_no_init },
|
||||
"resize_ratio": { "ignore": true, default: et2_no_init },
|
||||
"row": {
|
||||
"name": "Row",
|
||||
"description": "Home page location (row) - handled by home app",
|
||||
"default": 1
|
||||
},
|
||||
"col": {
|
||||
"name": "Column",
|
||||
"description": "Home page location(column) - handled by home app",
|
||||
"default": 1
|
||||
}
|
||||
};
|
||||
return et2_portlet;
|
||||
}(et2_core_valueWidget_1.et2_valueWidget));
|
||||
et2_core_widget_1.et2_register_widget(et2_portlet, ["portlet"]);
|
||||
//# sourceMappingURL=et2_widget_portlet.js.map
|
416
api/js/etemplate/et2_widget_portlet.ts
Normal file
416
api/js/etemplate/et2_widget_portlet.ts
Normal file
@ -0,0 +1,416 @@
|
||||
/**
|
||||
* EGroupware eTemplate2 - JS Portlet object - used by Home
|
||||
*
|
||||
* @license http://opensource.org/licenses/gpl-license.php GPL - GNU General Public License
|
||||
* @package home
|
||||
* @package etemplate
|
||||
* @subpackage api
|
||||
* @link http://www.egroupware.org
|
||||
* @author Nathan Gray
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/*egw:uses
|
||||
/vendor/bower-asset/jquery/dist/jquery.js;
|
||||
et2_core_baseWidget;
|
||||
*/
|
||||
|
||||
import {et2_register_widget, WidgetConfig} from "./et2_core_widget";
|
||||
import {et2_valueWidget} from "./et2_core_valueWidget";
|
||||
import {ClassWithAttributes} from "./et2_core_inheritance";
|
||||
import {et2_action_object_impl, et2_DOMWidget} from "./et2_core_DOMWidget";
|
||||
|
||||
/**
|
||||
* Class which implements the UI of a Portlet
|
||||
*
|
||||
* This manages the frame and decoration, but also provides the UI for properties.
|
||||
*
|
||||
* Portlets are only internal to EGroupware.
|
||||
*
|
||||
* Home does not fully implement WSRP, but tries not to conflict, ether.
|
||||
* @link http://docs.oasis-open.org/wsrp/v2/wsrp-2.0-spec-os-01.html
|
||||
* @augments et2_baseWidget
|
||||
*/
|
||||
class et2_portlet extends et2_valueWidget
|
||||
{
|
||||
static readonly _attributes : any = {
|
||||
"title": {
|
||||
"name": "Title",
|
||||
"description": "Goes in the little bit at the top with the icons",
|
||||
"type": "string",
|
||||
"default": ""
|
||||
},
|
||||
"edit_template": {
|
||||
"name": "Edit template",
|
||||
"description": "Custom eTemplate used to customize / set up the portlet",
|
||||
"type": "string",
|
||||
"default": egw.webserverUrl+"/home/templates/default/edit.xet"
|
||||
},
|
||||
"color": {
|
||||
"name": "Color",
|
||||
"description": "Set the portlet color",
|
||||
"type": "string",
|
||||
"default": ''
|
||||
},
|
||||
"settings": {
|
||||
"name": "Customization settings",
|
||||
"description": "Array of customization settings, similar in structure to preference settings",
|
||||
"type": "any",
|
||||
"default": et2_no_init
|
||||
},
|
||||
"actions": {
|
||||
default: {}
|
||||
},
|
||||
"width": { "default": 2, "ignore": true},
|
||||
"height": { "default": 1, "type": "integer"},
|
||||
"rows": {"ignore": true, default: et2_no_init},
|
||||
"cols": {"ignore": true, default: et2_no_init},
|
||||
"resize_ratio": {"ignore": true, default: et2_no_init}, // Portlets are explicitly sized
|
||||
"row": {
|
||||
"name": "Row",
|
||||
"description": "Home page location (row) - handled by home app",
|
||||
"default": 1
|
||||
},
|
||||
"col": {
|
||||
"name": "Column",
|
||||
"description": "Home page location(column) - handled by home app",
|
||||
"default": 1
|
||||
}
|
||||
};
|
||||
|
||||
private GRID : number = 55;
|
||||
private settings: any;
|
||||
/**
|
||||
* These are the "normal" actions that every portlet is expected to have.
|
||||
* The widget provides default actions for all of these, but they can
|
||||
* be added to or overridden if needed by setting the action attribute.
|
||||
*/
|
||||
protected default_actions : any = {
|
||||
edit_settings: {
|
||||
icon: "edit",
|
||||
caption: "Configure",
|
||||
"default": true,
|
||||
hideOnDisabled: true,
|
||||
group: "portlet"
|
||||
},
|
||||
remove_portlet: {
|
||||
icon: "delete",
|
||||
caption: "Remove",
|
||||
group: "portlet"
|
||||
}
|
||||
};
|
||||
protected div: JQuery;
|
||||
protected header: JQuery;
|
||||
protected content: JQuery;
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
*
|
||||
* @memberOf et2_portlet
|
||||
*/
|
||||
constructor(_parent, _attrs? : WidgetConfig, _child? : object)
|
||||
{
|
||||
// Call the inherited constructor
|
||||
super(_parent, _attrs, ClassWithAttributes.extendAttributes(et2_portlet._attributes, _child || {}));
|
||||
|
||||
let self = this;
|
||||
|
||||
// Create DOM nodes
|
||||
this.div = jQuery(document.createElement("div"))
|
||||
.addClass(this.options.class)
|
||||
.addClass("ui-widget ui-widget-content ui-corner-all")
|
||||
.addClass("et2_portlet")
|
||||
/* Gridster */
|
||||
.attr("data-sizex", this.options.width)
|
||||
.attr("data-sizey", this.options.height)
|
||||
.attr("data-row", this.options.row)
|
||||
.attr("data-col", this.options.col)
|
||||
|
||||
.resizable( {
|
||||
autoHide: true,
|
||||
grid: this.GRID,
|
||||
//containment: this.getParent().getDOMNode(),
|
||||
stop: function(event, ui) {
|
||||
self.set_width(Math.round(ui.size.width / self.GRID));
|
||||
self.set_height(Math.round(ui.size.height / self.GRID));
|
||||
self.egw().jsonq("home.home_ui.ajax_set_properties",[self.id, {},{
|
||||
width: self.options.width,
|
||||
height: self.options.height
|
||||
}],
|
||||
null,
|
||||
self
|
||||
);
|
||||
// Tell children
|
||||
self.iterateOver(function(widget) {widget.resize();},null,et2_IResizeable);
|
||||
}
|
||||
});
|
||||
this.header = jQuery(document.createElement("div"))
|
||||
.attr('id', this.getInstanceManager().uniqueId+'_'+this.id.replace(/\./g, '-') + '_header')
|
||||
.addClass("ui-widget-header ui-corner-all")
|
||||
.appendTo(this.div)
|
||||
.html(this.options.title);
|
||||
this.content = jQuery(document.createElement("div"))
|
||||
.attr('id', this.getInstanceManager().uniqueId+'_'+this.id.replace(/\./g, '-') + '_content')
|
||||
.appendTo(this.div);
|
||||
|
||||
this.setDOMNode(this.div[0]);
|
||||
}
|
||||
|
||||
destroy()
|
||||
{
|
||||
for(let i = 0; i < this._children.length; i++)
|
||||
{
|
||||
// Check for child is a different template and clear it,
|
||||
// since it won't be cleared by destroy()
|
||||
if(this._children[i].getInstanceManager() != this.getInstanceManager())
|
||||
{
|
||||
this._children[i].getInstanceManager().clear();
|
||||
}
|
||||
}
|
||||
super.destroy();
|
||||
}
|
||||
|
||||
doLoadingFinished()
|
||||
{
|
||||
this.set_color(this.options.color);
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* If anyone asks, return the content node, so content goes inside
|
||||
*/
|
||||
getDOMNode(_sender)
|
||||
{
|
||||
if(typeof _sender != 'undefined' && _sender != this)
|
||||
{
|
||||
return this.content[0];
|
||||
}
|
||||
return super.getDOMNode(_sender);
|
||||
}
|
||||
|
||||
/**
|
||||
* Overriden from parent to add in default actions
|
||||
*/
|
||||
set_actions(actions)
|
||||
{
|
||||
// Set targets for actions
|
||||
let defaults: any = {};
|
||||
for(let action_name in this.default_actions)
|
||||
{
|
||||
defaults[action_name] = this.default_actions[action_name];
|
||||
// Translate caption here, as translations aren't available earlier
|
||||
defaults[action_name].caption = this.egw().lang(this.default_actions[action_name].caption);
|
||||
if(typeof this[action_name] == "function")
|
||||
{
|
||||
defaults[action_name].onExecute = jQuery.proxy(this[action_name],this);
|
||||
}
|
||||
}
|
||||
|
||||
// Add in defaults, but let provided actions override them
|
||||
this.options.actions = jQuery.extend(true,{},defaults,actions);
|
||||
super.set_actions([this.options.actions]);
|
||||
}
|
||||
|
||||
/**
|
||||
* Override _link_actions to remove edit action, if there is no settings
|
||||
*
|
||||
* @param actions
|
||||
*/
|
||||
_link_actions(actions)
|
||||
{
|
||||
// Get the top level element
|
||||
let objectManager = <egwActionObject><unknown>egw_getAppObjectManager(true);
|
||||
let widget_object =objectManager.getObjectById(this.id);
|
||||
if (widget_object == null)
|
||||
{
|
||||
// Add a new container to the object manager which will hold the widget
|
||||
// objects
|
||||
widget_object = objectManager.insertObject(false, new egwActionObject(
|
||||
this.id, objectManager, <egwActionObjectInterface><unknown>new et2_action_object_impl(<et2_DOMWidget><unknown>this),
|
||||
this._actionManager || (<egwAction><unknown>objectManager.manager).getActionById(this.id) || objectManager.manager
|
||||
));
|
||||
}
|
||||
|
||||
// Delete all old objects
|
||||
widget_object.clear();
|
||||
|
||||
// Go over the widget & add links - this is where we decide which actions are
|
||||
// 'allowed' for this widget at this time
|
||||
let action_links = [];
|
||||
for(let i in actions)
|
||||
{
|
||||
let id = typeof actions[i].id != 'undefined' ? actions[i].id : i;
|
||||
let action = {
|
||||
actionId: id,
|
||||
enabled: true
|
||||
};
|
||||
|
||||
// If there are no settings, there can be no customization, so remove the edit action
|
||||
if(id == 'edit_settings' && (!this.options.settings || jQuery.isEmptyObject(this.options.settings)))
|
||||
{
|
||||
this.egw().debug("log", "No settings for portlet %o, edit_settings action removed", this);
|
||||
action.enabled = false;
|
||||
}
|
||||
action_links.push(action);
|
||||
}
|
||||
|
||||
widget_object.updateActionLinks(action_links);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create & show a dialog for customizing this portlet
|
||||
*
|
||||
* Properties for customization are sent in the 'settings' attribute
|
||||
*/
|
||||
edit_settings()
|
||||
{
|
||||
let dialog = et2_createWidget("dialog", {
|
||||
callback: jQuery.proxy(this._process_edit, this),
|
||||
template: this.options.edit_template,
|
||||
value: {
|
||||
content: this.options.settings
|
||||
},
|
||||
buttons: et2_dialog.BUTTONS_OK_CANCEL
|
||||
},this);
|
||||
// Set seperately to avoid translation
|
||||
dialog.set_title(this.egw().lang("Edit") + " " + (this.options.title || ''));
|
||||
}
|
||||
|
||||
_process_edit(button_id, value)
|
||||
{
|
||||
if(button_id != et2_dialog.OK_BUTTON) return;
|
||||
|
||||
|
||||
// Save settings - server might reply with new content if the portlet needs an update,
|
||||
// but ideally it doesn't
|
||||
this.div.addClass("loading");
|
||||
|
||||
// Pass updated settings, unless we're removing
|
||||
let settings = (typeof value == 'string') ? {} : this.options.settings || {};
|
||||
this.egw().jsonq("home.home_ui.ajax_set_properties",[this.id, settings, value, this.settings ? this.settings.group : false],
|
||||
function(data) {
|
||||
// This section not for us
|
||||
if(!data || typeof data.attributes == 'undefined') return false;
|
||||
|
||||
this.div.removeClass("loading");
|
||||
this.set_value(data.content);
|
||||
for(let key in data.attributes)
|
||||
{
|
||||
if(typeof this["set_"+key] == "function")
|
||||
{
|
||||
this["set_"+key].call(this, data.attributes[key]);
|
||||
}
|
||||
else if (this.attributes[key])
|
||||
{
|
||||
this.options[key] = data.attributes[key];
|
||||
}
|
||||
}
|
||||
|
||||
// Flagged as needing to edit settings? Open dialog
|
||||
if(typeof data.edit_settings != 'undefined' && data.edit_settings)
|
||||
{
|
||||
this.edit_settings();
|
||||
}
|
||||
|
||||
// Only resize once, and only if needed
|
||||
if(data.attributes.width || data.attributes.height)
|
||||
{
|
||||
// Tell children
|
||||
try {
|
||||
this.iterateOver(function(widget) {widget.resize();},null,et2_IResizeable);
|
||||
} catch (e) {
|
||||
// Something went wrong, but do not stop
|
||||
egw.debug('warn',e,this);
|
||||
}
|
||||
}
|
||||
},
|
||||
this);
|
||||
|
||||
// Extend, not replace, because settings has types while value has just value
|
||||
if(typeof value == 'object')
|
||||
{
|
||||
jQuery.extend(this.options.settings, value);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove this portlet from the home page
|
||||
*/
|
||||
remove_portlet()
|
||||
{
|
||||
let self = this;
|
||||
et2_dialog.show_dialog(function(button_id) {
|
||||
if(button_id != et2_dialog.OK_BUTTON) return;
|
||||
self._process_edit(button_id, '~remove~');
|
||||
self.getParent().removeChild(self);
|
||||
self.destroy();
|
||||
},this.egw().lang("Remove"), this.options.title,{},
|
||||
et2_dialog.BUTTONS_OK_CANCEL, et2_dialog.QUESTION_MESSAGE
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the HTML content of the portlet
|
||||
*
|
||||
* @param value String HTML fragment
|
||||
*/
|
||||
set_value(value)
|
||||
{
|
||||
this.content.html(value);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the content of the header
|
||||
*
|
||||
* @param value String HTML fragment
|
||||
*/
|
||||
set_title(value)
|
||||
{
|
||||
this.header.contents()
|
||||
.filter(function() {
|
||||
return this.nodeType === 3;
|
||||
})
|
||||
.remove();
|
||||
this.options.title = value;
|
||||
this.header.append(value);
|
||||
}
|
||||
|
||||
/**
|
||||
* Let this portlet stand out a little by allowing a custom color
|
||||
*/
|
||||
set_color(color)
|
||||
{
|
||||
this.options.color = color;
|
||||
this.header.css("backgroundColor", color);
|
||||
this.header.css('color', jQuery.Color(this.header.css("backgroundColor")).lightness() > 0.5 ? 'black':'white');
|
||||
this.content.css("backgroundColor", color);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the number of grid cells this widget spans
|
||||
*
|
||||
* @param value int Number of horizontal grid cells
|
||||
*/
|
||||
set_width(value)
|
||||
{
|
||||
this.options.width = value;
|
||||
this.div.attr("data-sizex", value);
|
||||
// Clear what's there from jQuery, we get width from CSS according to sizex
|
||||
this.div.css('width','');
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the number of vertical grid cells this widget spans
|
||||
*
|
||||
* @param value int Number of vertical grid cells
|
||||
*/
|
||||
set_height(value)
|
||||
{
|
||||
this.options.height = value;
|
||||
this.div.attr("data-sizey", value);
|
||||
// Clear what's there from jQuery, we get width from CSS according to sizey
|
||||
this.div.css('height','');
|
||||
}
|
||||
}
|
||||
et2_register_widget(et2_portlet, ["portlet"]);
|
||||
|
Loading…
Reference in New Issue
Block a user