rclone/fs/cache/cache.go
Nick Craig-Wood 70c8566cb8 fs: Pin created backends until parents are finalized
This attempts to solve the backend lifecycle problem by

- Pinning backends mentioned on the command line into the cache
  indefinitely

- Unpinning backends when the containing structure (VFS, wrapping
  backend) is destroyed

See: https://forum.rclone.org/t/rclone-rc-backend-command-not-working-as-expected/18834
2020-09-01 18:21:03 +01:00

117 lines
3.0 KiB
Go

// Package cache implements the Fs cache
package cache
import (
"runtime"
"sync"
"github.com/rclone/rclone/fs"
"github.com/rclone/rclone/lib/cache"
)
var (
c = cache.New()
mu sync.Mutex // mutex to protect remap
remap = map[string]string{} // map user supplied names to canonical names
)
// Canonicalize looks up fsString in the mapping from user supplied
// names to canonical names and return the canonical form
func Canonicalize(fsString string) string {
mu.Lock()
canonicalName, ok := remap[fsString]
mu.Unlock()
if !ok {
return fsString
}
fs.Debugf(nil, "fs cache: switching user supplied name %q for canonical name %q", fsString, canonicalName)
return canonicalName
}
// Put in a mapping from fsString => canonicalName if they are different
func addMapping(fsString, canonicalName string) {
if canonicalName == fsString {
return
}
mu.Lock()
remap[fsString] = canonicalName
mu.Unlock()
}
// GetFn gets an fs.Fs named fsString either from the cache or creates
// it afresh with the create function
func GetFn(fsString string, create func(fsString string) (fs.Fs, error)) (f fs.Fs, err error) {
fsString = Canonicalize(fsString)
created := false
value, err := c.Get(fsString, func(fsString string) (f interface{}, ok bool, err error) {
f, err = create(fsString)
ok = err == nil || err == fs.ErrorIsFile
created = ok
return f, ok, err
})
if err != nil && err != fs.ErrorIsFile {
return nil, err
}
f = value.(fs.Fs)
// Check we stored the Fs at the canonical name
if created {
canonicalName := fs.ConfigString(f)
if canonicalName != fsString {
// Note that if err == fs.ErrorIsFile at this moment
// then we can't rename the remote as it will have the
// wrong error status, we need to add a new one.
if err == nil {
fs.Debugf(nil, "fs cache: renaming cache item %q to be canonical %q", fsString, canonicalName)
value, found := c.Rename(fsString, canonicalName)
if found {
f = value.(fs.Fs)
}
addMapping(fsString, canonicalName)
} else {
fs.Debugf(nil, "fs cache: adding new entry for parent of %q, %q", fsString, canonicalName)
Put(canonicalName, f)
}
}
}
return f, err
}
// Pin f into the cache until Unpin is called
func Pin(f fs.Fs) {
c.Pin(fs.ConfigString(f))
}
// PinUntilFinalized pins f into the cache until x is garbage collected
//
// This calls runtime.SetFinalizer on x so it shouldn't have a
// finalizer already.
func PinUntilFinalized(f fs.Fs, x interface{}) {
Pin(f)
runtime.SetFinalizer(x, func(_ interface{}) {
Unpin(f)
})
}
// Unpin f from the cache
func Unpin(f fs.Fs) {
c.Pin(fs.ConfigString(f))
}
// Get gets an fs.Fs named fsString either from the cache or creates it afresh
func Get(fsString string) (f fs.Fs, err error) {
return GetFn(fsString, fs.NewFs)
}
// Put puts an fs.Fs named fsString into the cache
func Put(fsString string, f fs.Fs) {
canonicalName := fs.ConfigString(f)
c.Put(canonicalName, f)
addMapping(fsString, canonicalName)
}
// Clear removes everything from the cache
func Clear() {
c.Clear()
}